ZA72250B - Pharmaceutical preparation containing 1-benzoyl 3,5-dimethyl pyrazole - Google Patents
Pharmaceutical preparation containing 1-benzoyl 3,5-dimethyl pyrazoleInfo
- Publication number
- ZA72250B ZA72250B ZA720250A ZA72250A ZA72250B ZA 72250 B ZA72250 B ZA 72250B ZA 720250 A ZA720250 A ZA 720250A ZA 72250 A ZA72250 A ZA 72250A ZA 72250 B ZA72250 B ZA 72250B
- Authority
- ZA
- South Africa
- Prior art keywords
- benzoyl
- pharmaceutical preparation
- preparation containing
- dimethyl pyrazole
- pyrazole
- Prior art date
Links
- AHNLSPFBSUPXHJ-UHFFFAOYSA-N (3,5-dimethylpyrazol-1-yl)-phenylmethanone Chemical compound N1=C(C)C=C(C)N1C(=O)C1=CC=CC=C1 AHNLSPFBSUPXHJ-UHFFFAOYSA-N 0.000 title 1
- 239000000825 pharmaceutical preparation Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7101228A FR2121461B1 (enExample) | 1971-01-15 | 1971-01-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA72250B true ZA72250B (en) | 1972-10-25 |
Family
ID=9070319
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA720250A ZA72250B (en) | 1971-01-15 | 1972-01-14 | Pharmaceutical preparation containing 1-benzoyl 3,5-dimethyl pyrazole |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3743739A (enExample) |
| AU (1) | AU463887B2 (enExample) |
| BE (1) | BE778096A (enExample) |
| CA (1) | CA991080A (enExample) |
| DE (1) | DE2200976A1 (enExample) |
| FR (1) | FR2121461B1 (enExample) |
| GB (1) | GB1369704A (enExample) |
| IE (1) | IE35960B1 (enExample) |
| IL (1) | IL38381A (enExample) |
| OA (1) | OA04062A (enExample) |
| ZA (1) | ZA72250B (enExample) |
-
1971
- 1971-01-15 FR FR7101228A patent/FR2121461B1/fr not_active Expired
- 1971-12-16 IL IL38381A patent/IL38381A/xx unknown
- 1971-12-23 AU AU37264/71A patent/AU463887B2/en not_active Expired
-
1972
- 1972-01-06 CA CA131,844A patent/CA991080A/en not_active Expired
- 1972-01-06 IE IE19/72A patent/IE35960B1/xx unknown
- 1972-01-10 US US00216760A patent/US3743739A/en not_active Expired - Lifetime
- 1972-01-10 DE DE19722200976 patent/DE2200976A1/de active Granted
- 1972-01-10 OA OA54457A patent/OA04062A/xx unknown
- 1972-01-11 GB GB119272A patent/GB1369704A/en not_active Expired
- 1972-01-14 BE BE778096A patent/BE778096A/xx unknown
- 1972-01-14 ZA ZA720250A patent/ZA72250B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3743739A (en) | 1973-07-03 |
| BE778096A (fr) | 1972-07-14 |
| IE35960L (en) | 1972-07-15 |
| AU3726471A (en) | 1973-06-28 |
| AU463887B2 (en) | 1975-08-07 |
| CA991080A (en) | 1976-06-15 |
| IL38381A0 (en) | 1972-02-29 |
| OA04062A (fr) | 1979-10-30 |
| GB1369704A (en) | 1974-10-09 |
| DE2200976A1 (de) | 1972-07-20 |
| FR2121461B1 (enExample) | 1974-03-22 |
| IE35960B1 (en) | 1976-07-07 |
| FR2121461A1 (enExample) | 1972-08-25 |
| IL38381A (en) | 1974-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA723888B (en) | Substituted 1,2,4-triazole derivatives | |
| IL46201A (en) | 3-substituted 1,3-dihydrospiro(isobenzofuran-azacycloalkanes),their preparation and pharmaceutical compositions containing them | |
| IL37385A (en) | Benzyl-imidazoles and 1,2,4-triazoles,their production and pharmaceutical compositions containing them | |
| IL45114A (en) | 3-substituted 5,5-diphenylhydantoins | |
| IL39735A0 (en) | 3,20-dioxo-pregn-4-ene 21-carboxylic acid derivatives | |
| IL39851A (en) | 1,2,3,4,4a,10b-hexahydro-phenanthridine derivatives,processes for the preparation thereof and pharmaceutical compositions containing the same | |
| IL45771A0 (en) | Pharmaceutical compositions containing 1-propyl-1,2,4-triazole derivatives | |
| PH10227A (en) | 1-substituted benzodiazepine-2-ones and pharmaceutical compositions containing the same | |
| GB1407478A (en) | 11beta-alkoxy-estra-1,3,5-10-trienes and processes for their preparation | |
| IL36973A (en) | 3',4'-dideoxykanamycin b and its preparation | |
| ZA72250B (en) | Pharmaceutical preparation containing 1-benzoyl 3,5-dimethyl pyrazole | |
| ZA716684B (en) | Substituted 2,2'-biimidazoles and process for their preparation | |
| IL38593A (en) | Substituted 2-arylamino-imidazoline-(2)derivatives,their preparation and pharmaceutical compositions containing them | |
| ZA745608B (en) | 3,3-methylene-bis-(4-hydroxy-5-azacoumarin) its preparation and use | |
| ZA741277B (en) | 3-benzylpyrido (3,4-e)-as-triazine and 1,2-dihydro-3-benzylpyrido (3,4-e)-as -triazine hydrochloride | |
| ZA713617B (en) | 2,6-methano-3-benzazocines and preparation thereof | |
| CA1008077A (en) | 1,2,3-triazoles and process for their preparation | |
| IL44451A0 (en) | 1,2-diphenyl-ethane derivatives,processes for the preparation thereof and pharmaceutical composition containing the same | |
| IL36628A (en) | 4, 14-estradiene compounds and processes for their preparation | |
| IL38791A (en) | 1,3,4,5-tetrahydro-2,3-benzoxazepine derivatives | |
| IL38252A0 (en) | A benzodiazepine derivatives,its preparation and pharmaceutical compositions containing it | |
| CA882705A (en) | 5,8-dihydronaphthyloxy-amino-propanols and related compounds | |
| IL39366A0 (en) | Fungicidal preparations containing 1,3,4-thiadiazole derivatives | |
| IE35049B1 (en) | 1,2,4-triazole derivatives | |
| CA832005A (en) | 1,3-dimethyl-4-nitro pyrazoles |