ZA721091B - Selective herbicidal compositions containing n-(4-isopropyl phenyl)-n'-methyl urea - Google Patents
Selective herbicidal compositions containing n-(4-isopropyl phenyl)-n'-methyl ureaInfo
- Publication number
- ZA721091B ZA721091B ZA721091A ZA721091A ZA721091B ZA 721091 B ZA721091 B ZA 721091B ZA 721091 A ZA721091 A ZA 721091A ZA 721091 A ZA721091 A ZA 721091A ZA 721091 B ZA721091 B ZA 721091B
- Authority
- ZA
- South Africa
- Prior art keywords
- compositions containing
- herbicidal compositions
- isopropyl phenyl
- methyl urea
- selective herbicidal
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title 1
- DOULWWSSZVEPIN-UHFFFAOYSA-N isoproturon-monodemethyl Chemical compound CNC(=O)NC1=CC=C(C(C)C)C=C1 DOULWWSSZVEPIN-UHFFFAOYSA-N 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C273/00—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C273/18—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas
- C07C273/1809—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas with formation of the N-C(O)-N moiety
- C07C273/1818—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas with formation of the N-C(O)-N moiety from -N=C=O and XNR'R"
- C07C273/1827—X being H
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7106581A FR2125240A1 (en) | 1971-02-19 | 1971-02-19 | N-(4-isopropylphenyl)-n'-methylurea - as selective herbicide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA721091B true ZA721091B (en) | 1972-11-29 |
Family
ID=9072513
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA721091A ZA721091B (en) | 1971-02-19 | 1972-02-18 | Selective herbicidal compositions containing n-(4-isopropyl phenyl)-n'-methyl urea |
Country Status (9)
| Country | Link |
|---|---|
| BE (1) | BE778726A (cg-RX-API-DMAC10.html) |
| BR (1) | BR7200917D0 (cg-RX-API-DMAC10.html) |
| DD (1) | DD95148A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2206680A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2125240A1 (cg-RX-API-DMAC10.html) |
| IT (1) | IT950655B (cg-RX-API-DMAC10.html) |
| NL (1) | NL7202170A (cg-RX-API-DMAC10.html) |
| OA (1) | OA03971A (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA721091B (cg-RX-API-DMAC10.html) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2180619B1 (cg-RX-API-DMAC10.html) * | 1972-04-21 | 1975-06-13 | Pepro |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2655447A (en) * | 1952-02-14 | 1953-10-13 | Du Pont | Composition and method |
| IL31574A0 (en) * | 1968-02-13 | 1969-04-30 | Ciba Ltd | Use of certain ureas for combating weeds |
-
1971
- 1971-02-19 FR FR7106581A patent/FR2125240A1/fr active Granted
-
1972
- 1972-01-31 BE BE778726A patent/BE778726A/xx unknown
- 1972-02-11 DE DE19722206680 patent/DE2206680A1/de active Pending
- 1972-02-16 DD DD160915A patent/DD95148A5/xx unknown
- 1972-02-17 IT IT48387/72A patent/IT950655B/it active
- 1972-02-18 NL NL7202170A patent/NL7202170A/xx not_active Application Discontinuation
- 1972-02-18 ZA ZA721091A patent/ZA721091B/xx unknown
- 1972-02-18 BR BR917/72A patent/BR7200917D0/pt unknown
- 1972-03-02 OA OA54503A patent/OA03971A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2206680A1 (de) | 1972-08-24 |
| FR2125240A1 (en) | 1972-09-29 |
| BE778726A (fr) | 1972-05-16 |
| NL7202170A (cg-RX-API-DMAC10.html) | 1972-08-22 |
| FR2125240B1 (cg-RX-API-DMAC10.html) | 1973-11-23 |
| OA03971A (fr) | 1979-08-31 |
| DD95148A5 (cg-RX-API-DMAC10.html) | 1973-01-12 |
| IT950655B (it) | 1973-06-20 |
| BR7200917D0 (pt) | 1974-01-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BE805108A (fr) | Compositions d'isocyanates | |
| PH12104A (en) | Novel n-(substituted phenyl)-n'-benzoyl-ureas and their use as insecticides | |
| IL47972A0 (en) | Novel n-phosphonomethylglycines and herbicidal compositions | |
| IL39346A (en) | 2,4-diamino-pyrimidine-5-carboxylic acid amide derivatives and herbicidal compositions containing them | |
| IL34723A0 (en) | 1,2,4-thiadiazolyl ureas and herbicidal compositions containing them | |
| IL38912A (en) | Diphenylamines and pesticidal compositions comprising them | |
| IL40936A (en) | N-substituted sulfonylglycolic acid anilides and herbicidal compositions containing them | |
| PH10221A (en) | Herbicidal compositions and use of n-(cycloalken-1-yl)-alpha-haloacetamides | |
| IL45269A (en) | N-(3-alkylphenyl)-n' n'-dimethyl-ureas their preparation and their use as selective herbicides | |
| ZA721091B (en) | Selective herbicidal compositions containing n-(4-isopropyl phenyl)-n'-methyl urea | |
| IL37307A (en) | Selective herbicidal compositions containing n-(4-isopropylphenyl)-n',n'-dimethylurea | |
| IL39506A (en) | N-(3-carbamoyloxyphenyl)-n'-methylurea derivatives and herbicidal compositions containing them | |
| IL48705A (en) | N-(4-halobenzyl)-n-sec.alkyl-n'-phenylthioureas, their preparation and fungicidal compositions containing them | |
| KE2706A (en) | New substituted 2,6-dinitroanilines and herbicidal compositions containing them | |
| IL48033A (en) | N-(3,4-methylenedioxyphenyl)-prop-2-yl)-n'-(substituted phenyl)-piperazines, their preparation and pharmaceutical compositions containing them | |
| IL23216A (en) | N-(2-chloro-5-trifluoromethyl-phenyl)-n'-methyl urea and the production thereof | |
| IL38161A0 (en) | Substituted phenyl ureas and thioureas and their use as herbicides | |
| PH11481A (en) | N-(trichloromethylthio,tetrachloroethythio or tetrachlorofluoromethylthio)-halo-benzoyl anilides and their use as fungicides | |
| IL36448A (en) | N-(substituted phenyl)-ureas,their preparation and use as selective herbicides | |
| IL39573A (en) | Substituted 2,5-dialkylcyanobenzyl cyanides and herbicidal compositions containing them | |
| IL46622A (en) | N-(1'-allylpyrrolidinyl 2'-methyl)-2-methoxy-4,5-azimido benzamide and its salts, their preparation and pharmaceutical compositions containing them | |
| FR2282883A1 (fr) | N-2-(6-hydroxybenzothiazolyl)-n'-phenyl (ou phenyl substitue) urees | |
| IL36718A0 (en) | Herbicidal compositions containing phenylureas,certain new phenylureas and their preparation | |
| IL39825A (en) | N-chlorodifluoromethylsulphinyl phenyl ureas,processes for their manufacture and herbicidal compositions containing them | |
| IL38499A (en) | Herbicidal n-(1-cycloalken-1-yl)-amino-s-triazine compounds |