ZA718548B - 2-3-hydroxy-1-octynyl)3hydroxy-5-oxocyclopent-1-eneheptanoic acid,optical isomers thereof and the corresponding esters - Google Patents
2-3-hydroxy-1-octynyl)3hydroxy-5-oxocyclopent-1-eneheptanoic acid,optical isomers thereof and the corresponding estersInfo
- Publication number
- ZA718548B ZA718548B ZA718548A ZA718548A ZA718548B ZA 718548 B ZA718548 B ZA 718548B ZA 718548 A ZA718548 A ZA 718548A ZA 718548 A ZA718548 A ZA 718548A ZA 718548 B ZA718548 B ZA 718548B
- Authority
- ZA
- South Africa
- Prior art keywords
- oxocyclopent
- 3hydroxy
- octynyl
- hydroxy
- optical isomers
- Prior art date
Links
- IXOFUWJRSYPKSX-UHFFFAOYSA-N 7-(3-hydroxy-5-oxocyclopenten-1-yl)heptanoic acid Chemical compound OC1CC(=O)C(CCCCCCC(O)=O)=C1 IXOFUWJRSYPKSX-UHFFFAOYSA-N 0.000 title 1
- 150000002148 esters Chemical class 0.000 title 1
- 230000003287 optical effect Effects 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US10042070A | 1970-12-21 | 1970-12-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA718548B true ZA718548B (en) | 1973-02-28 |
Family
ID=22279681
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA718548A ZA718548B (en) | 1970-12-21 | 1971-12-21 | 2-3-hydroxy-1-octynyl)3hydroxy-5-oxocyclopent-1-eneheptanoic acid,optical isomers thereof and the corresponding esters |
Country Status (7)
| Country | Link |
|---|---|
| AT (1) | AT322748B (Direct) |
| AU (1) | AU3709571A (Direct) |
| BE (1) | BE777022A (Direct) |
| DE (1) | DE2163115A1 (Direct) |
| FR (1) | FR2118953B1 (Direct) |
| GB (1) | GB1341780A (Direct) |
| ZA (1) | ZA718548B (Direct) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA983486A (en) * | 1972-06-12 | 1976-02-10 | G.D. Searle And Co. Of Canada | 2-(3-hydroxy-3-optionally alkylated-1-alkynyl)-3-hydroxy-5-oxo-1-cyclopentene-1-alkanoic acids, derivatives thereof and process |
| US4172953A (en) * | 1973-03-30 | 1979-10-30 | G. D. Searle & Co. | 2,3,5-Trisubstituted cyclopentanealkenoic acids, derivatives thereof and intermediates thereto |
-
1971
- 1971-12-20 FR FR7145762A patent/FR2118953B1/fr not_active Expired
- 1971-12-20 AU AU37095/71A patent/AU3709571A/en not_active Expired
- 1971-12-20 GB GB5910971A patent/GB1341780A/en not_active Expired
- 1971-12-20 DE DE19712163115 patent/DE2163115A1/de active Pending
- 1971-12-20 AT AT1091871A patent/AT322748B/de not_active IP Right Cessation
- 1971-12-21 BE BE777022A patent/BE777022A/xx unknown
- 1971-12-21 ZA ZA718548A patent/ZA718548B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AT322748B (de) | 1975-06-10 |
| BE777022A (fr) | 1972-06-21 |
| GB1341780A (en) | 1973-12-25 |
| DE2163115A1 (de) | 1972-07-13 |
| FR2118953A1 (Direct) | 1972-08-04 |
| AU3709571A (en) | 1973-06-28 |
| FR2118953B1 (Direct) | 1975-06-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA947763A (en) | Basic substituted-alkylidenamino-oxylalkyl-carboxylic-acid esters | |
| CA930372A (en) | Fluorinated thioether-acrylic esters | |
| PH10003A (en) | Cyclopropanecarboxylic acid esters | |
| CA969551A (en) | Esters | |
| ZA718548B (en) | 2-3-hydroxy-1-octynyl)3hydroxy-5-oxocyclopent-1-eneheptanoic acid,optical isomers thereof and the corresponding esters | |
| CA988095A (en) | Perfluoroalkylalkylmonocarboxylic acid esters | |
| AU476015B2 (en) | Di-substituted-phenethylcarbamic acid esters | |
| CA854728A (en) | Stable esters | |
| CA956640A (en) | Esters | |
| CA987338A (en) | Aromatic perfluoroalkylalkylmonocarboxylic acid esters | |
| PH9248A (en) | O,o-dialkyl-s-phenyl-dithiophosphoric acid ester | |
| CA933531A (en) | Esters | |
| IL35262A0 (en) | Novel 2-chlorethylphosphonothioic acid,its trithioic acid and esters | |
| IE34638L (en) | Indoloquinolines-lysergic acid esters. | |
| CA934752A (en) | 18-METHYL-17.alpha.-ETHYNYL-TESTOSTERONE ESTERS | |
| CA853227A (en) | Cyclopropanecarboxylyic acid esters | |
| CA850134A (en) | Omega-fluoromethacrylic acid esters | |
| AU465752B2 (en) | Triazolylthiophosphonic acid esters | |
| AU465772B2 (en) | Triazolylphosphoric acid esters | |
| AU2419071A (en) | Aliphatic esters | |
| CA859182A (en) | Modified esters | |
| CA932743A (en) | Esters | |
| CA933939A (en) | Esters | |
| CA852245A (en) | Esters | |
| CA973552A (en) | Esters |