ZA715518B - Prostanoic acid derivatives - Google Patents
Prostanoic acid derivativesInfo
- Publication number
- ZA715518B ZA715518B ZA715518A ZA715518A ZA715518B ZA 715518 B ZA715518 B ZA 715518B ZA 715518 A ZA715518 A ZA 715518A ZA 715518 A ZA715518 A ZA 715518A ZA 715518 B ZA715518 B ZA 715518B
- Authority
- ZA
- South Africa
- Prior art keywords
- acid derivatives
- prostanoic acid
- prostanoic
- derivatives
- acid
- Prior art date
Links
- WGJJROVFWIXTPA-OALUTQOASA-N prostanoic acid Chemical class CCCCCCCC[C@H]1CCC[C@@H]1CCCCCCC(O)=O WGJJROVFWIXTPA-OALUTQOASA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US7210570A | 1970-09-14 | 1970-09-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA715518B true ZA715518B (en) | 1972-05-31 |
Family
ID=22105603
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA715518A ZA715518B (en) | 1970-09-14 | 1971-08-18 | Prostanoic acid derivatives |
Country Status (12)
| Country | Link |
|---|---|
| AU (1) | AU456371B2 (en:Method) |
| BE (1) | BE772584A (en:Method) |
| CA (1) | CA950901A (en:Method) |
| DE (1) | DE2145600A1 (en:Method) |
| ES (1) | ES395036A2 (en:Method) |
| FR (1) | FR2106500B1 (en:Method) |
| GB (1) | GB1314292A (en:Method) |
| IL (1) | IL37560A (en:Method) |
| NL (1) | NL7112466A (en:Method) |
| PH (1) | PH12134A (en:Method) |
| SU (1) | SU399108A3 (en:Method) |
| ZA (1) | ZA715518B (en:Method) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3892795A (en) * | 1971-04-12 | 1975-07-01 | Upjohn Co | 16-Methyl and 16,16 dimethyl PGA{HD 2 {B compounds |
| US3954832A (en) * | 1972-07-24 | 1976-05-04 | The Upjohn Company | 16-And 16,16-methyl and ethyl substituted PGA1 -type compounds |
-
1971
- 1971-08-16 CA CA120,632,A patent/CA950901A/en not_active Expired
- 1971-08-18 ZA ZA715518A patent/ZA715518B/xx unknown
- 1971-08-18 GB GB3878271A patent/GB1314292A/en not_active Expired
- 1971-08-24 IL IL37560A patent/IL37560A/en unknown
- 1971-08-25 PH PH12784A patent/PH12134A/en unknown
- 1971-09-10 NL NL7112466A patent/NL7112466A/xx unknown
- 1971-09-13 ES ES395036A patent/ES395036A2/es not_active Expired
- 1971-09-13 AU AU33396/71A patent/AU456371B2/en not_active Expired
- 1971-09-13 DE DE19712145600 patent/DE2145600A1/de active Pending
- 1971-09-13 FR FR7132974A patent/FR2106500B1/fr not_active Expired
- 1971-09-13 SU SU1695975A patent/SU399108A3/ru active
- 1971-09-14 BE BE772584A patent/BE772584A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NL7112466A (en:Method) | 1972-03-16 |
| IL37560A0 (en) | 1971-11-29 |
| GB1314292A (en) | 1973-04-18 |
| SU399108A3 (en:Method) | 1973-09-27 |
| BE772584A (fr) | 1972-03-14 |
| ES395036A2 (es) | 1973-12-16 |
| CA950901A (en) | 1974-07-09 |
| AU3339671A (en) | 1973-03-22 |
| FR2106500B1 (en:Method) | 1974-11-15 |
| FR2106500A1 (en:Method) | 1972-05-05 |
| IL37560A (en) | 1976-04-30 |
| DE2145600A1 (de) | 1972-03-16 |
| AU456371B2 (en) | 1974-12-19 |
| PH12134A (en) | 1978-11-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL40521A (en) | 1-heterocyclyl-3-indolealkanoic acid derivatives | |
| ZA714729B (en) | Novel benzcyclobutene derivatives | |
| HK3277A (en) | Prostanoic acid derivatives | |
| KE2611A (en) | Pyridoquinoline derivatives | |
| IL39376A0 (en) | Prostanoic acid derivatives | |
| ZM15873A1 (en) | Prostanoic acid derivatives | |
| AU4847172A (en) | Cycloalkylaminoarylcarboxylic acid derivatives | |
| IL37019A0 (en) | Quinolinecarboxylic acid derivatives | |
| CA957693A (en) | 1-thiachromone-2-carboxylic acid derivatives | |
| IE37237L (en) | Pyrroleacetic acid derivatives | |
| IL38096A0 (en) | Ergolene derivatives | |
| ZA716894B (en) | Penicillanic acid derivatives | |
| PH11791A (en) | Triourea derivatives | |
| ZA712428B (en) | Substituted furancarboxylic acid cycloalkylamide | |
| MY7500276A (en) | 2-chloroethanephosphonic acid derivatives | |
| PH17276A (en) | N-substituted tetrachlorophthalamic acid derivatives | |
| ZA715518B (en) | Prostanoic acid derivatives | |
| ZA715163B (en) | Prostanoic acid derivatives | |
| GB1405794A (en) | Alpha-thioacetic acid derivatives | |
| ZA715919B (en) | Process for the preparation of prostanoic acid derivatives | |
| IL36933A0 (en) | 1-phenoxy-3-amino-propan-2-ol derivatives | |
| CA850674A (en) | Prostanoic acid derivatives | |
| ZA718556B (en) | Pnenylacetic acid derivatives | |
| IL37263A0 (en) | Process for the preparation of prostanoic acid derivatives | |
| IL32222A0 (en) | Prostanoic acid derivatives |