IL37560A0 - Prostaglandin a compounds - Google Patents
Prostaglandin a compoundsInfo
- Publication number
- IL37560A0 IL37560A0 IL37560A IL3756071A IL37560A0 IL 37560 A0 IL37560 A0 IL 37560A0 IL 37560 A IL37560 A IL 37560A IL 3756071 A IL3756071 A IL 3756071A IL 37560 A0 IL37560 A0 IL 37560A0
- Authority
- IL
- Israel
- Prior art keywords
- prostaglandin
- compounds
- Prior art date
Links
- BGKHCLZFGPIKKU-UHFFFAOYSA-N (13E,15S)-15-hydroxy-9-oxo-prosta-10,13-dienoic acid Natural products CCCCCC(O)C=CC1C=CC(=O)C1CCCCCCC(O)=O BGKHCLZFGPIKKU-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US7210570A | 1970-09-14 | 1970-09-14 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL37560A0 true IL37560A0 (en) | 1971-11-29 |
| IL37560A IL37560A (en) | 1976-04-30 |
Family
ID=22105603
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL37560A IL37560A (en) | 1970-09-14 | 1971-08-24 | 15-methyl prostaglandin a1 and a2 compounds |
Country Status (12)
| Country | Link |
|---|---|
| AU (1) | AU456371B2 (en) |
| BE (1) | BE772584A (en) |
| CA (1) | CA950901A (en) |
| DE (1) | DE2145600A1 (en) |
| ES (1) | ES395036A2 (en) |
| FR (1) | FR2106500B1 (en) |
| GB (1) | GB1314292A (en) |
| IL (1) | IL37560A (en) |
| NL (1) | NL7112466A (en) |
| PH (1) | PH12134A (en) |
| SU (1) | SU399108A3 (en) |
| ZA (1) | ZA715518B (en) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3892795A (en) * | 1971-04-12 | 1975-07-01 | Upjohn Co | 16-Methyl and 16,16 dimethyl PGA{HD 2 {B compounds |
| US3954832A (en) * | 1972-07-24 | 1976-05-04 | The Upjohn Company | 16-And 16,16-methyl and ethyl substituted PGA1 -type compounds |
-
1971
- 1971-08-16 CA CA120,632,A patent/CA950901A/en not_active Expired
- 1971-08-18 GB GB3878271A patent/GB1314292A/en not_active Expired
- 1971-08-18 ZA ZA715518A patent/ZA715518B/en unknown
- 1971-08-24 IL IL37560A patent/IL37560A/en unknown
- 1971-08-25 PH PH12784A patent/PH12134A/en unknown
- 1971-09-10 NL NL7112466A patent/NL7112466A/xx unknown
- 1971-09-13 DE DE19712145600 patent/DE2145600A1/en active Pending
- 1971-09-13 AU AU33396/71A patent/AU456371B2/en not_active Expired
- 1971-09-13 ES ES395036A patent/ES395036A2/en not_active Expired
- 1971-09-13 FR FR7132974A patent/FR2106500B1/fr not_active Expired
- 1971-09-13 SU SU1695975A patent/SU399108A3/ru active
- 1971-09-14 BE BE772584A patent/BE772584A/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SU399108A3 (en) | 1973-09-27 |
| NL7112466A (en) | 1972-03-16 |
| GB1314292A (en) | 1973-04-18 |
| IL37560A (en) | 1976-04-30 |
| ZA715518B (en) | 1972-05-31 |
| ES395036A2 (en) | 1973-12-16 |
| BE772584A (en) | 1972-03-14 |
| FR2106500A1 (en) | 1972-05-05 |
| FR2106500B1 (en) | 1974-11-15 |
| AU3339671A (en) | 1973-03-22 |
| DE2145600A1 (en) | 1972-03-16 |
| CA950901A (en) | 1974-07-09 |
| PH12134A (en) | 1978-11-07 |
| AU456371B2 (en) | 1974-12-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA707611B (en) | 3-hydroxy-3-methyl cepham-4-carboxylic compounds | |
| ZA715707B (en) | Monomethylamino compounds | |
| ZA717693B (en) | N-substituted-2-carboxy-1-azacyclic compounds | |
| CY787A (en) | Novel phtalimidine compounds | |
| ZA732244B (en) | Prostaglandin analogs | |
| ZA718157B (en) | Prostglandin analogs | |
| KE2770A (en) | Benzobicycloalkane compounds | |
| ZA704918B (en) | A play-pen for children | |
| BG25034A1 (en) | A tooth-gear | |
| PH10995A (en) | 6-acylamino-6-substituted penicillin compounds | |
| ZA732352B (en) | Prostaglandin analogs | |
| AU3273571A (en) | New 2-hydroxy-4@-phenoxybenzophenone compounds | |
| PH13699A (en) | 15-methyl prostaglandins | |
| IL37560A0 (en) | Prostaglandin a compounds | |
| AU3731471A (en) | Bis-triazole compounds | |
| ZA737328B (en) | Prostaglandin compounds | |
| ZA711840B (en) | Pge3-type compounds | |
| ZA728737B (en) | Prostaglandin derivatives | |
| IL36196A0 (en) | Prostaglandin analogs | |
| IE34998B1 (en) | A benzocycloheptathiophene derivative | |
| ZA72646B (en) | Prostaglandin analogs | |
| ZA722435B (en) | Prostaglandin analogs | |
| ZA72645B (en) | Prostaglandin analogs | |
| ZA728738B (en) | Prostaglandin derivatives | |
| IL36197A0 (en) | Prostaglandin analogs |