ZA712420B - Antiviral compositions containing rifamycin sv derivatives - Google Patents
Antiviral compositions containing rifamycin sv derivativesInfo
- Publication number
- ZA712420B ZA712420B ZA712420A ZA712420A ZA712420B ZA 712420 B ZA712420 B ZA 712420B ZA 712420 A ZA712420 A ZA 712420A ZA 712420 A ZA712420 A ZA 712420A ZA 712420 B ZA712420 B ZA 712420B
- Authority
- ZA
- South Africa
- Prior art keywords
- derivatives
- compositions containing
- antiviral compositions
- containing rifamycin
- rifamycin
- Prior art date
Links
- 230000000840 anti-viral effect Effects 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
- HJYYPODYNSCCOU-ODRIEIDWSA-N rifamycin SV Chemical class OC1=C(C(O)=C2C)C3=C(O)C=C1NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O HJYYPODYNSCCOU-ODRIEIDWSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/08—Bridged systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Fodder In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT25381/70A IT1046627B (it) | 1970-06-01 | 1970-06-01 | Composizioni antivirali contenenti derivati della rifaumicina sv |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA712420B true ZA712420B (en) | 1972-01-26 |
Family
ID=11216534
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA712420A ZA712420B (en) | 1970-06-01 | 1971-04-15 | Antiviral compositions containing rifamycin sv derivatives |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3796798A (enExample) |
| JP (1) | JPS4921764B1 (enExample) |
| BE (1) | BE767845A (enExample) |
| DE (1) | DE2127172A1 (enExample) |
| FR (1) | FR2100710B1 (enExample) |
| GB (1) | GB1319868A (enExample) |
| IL (1) | IL36617A (enExample) |
| IT (1) | IT1046627B (enExample) |
| NL (1) | NL7105341A (enExample) |
| ZA (1) | ZA712420B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2728869A1 (de) * | 1976-06-25 | 1977-12-29 | Antibiotice Iasi Intreprindere | Rifamycinen und verfahren zu deren herstellung |
| GB1594134A (en) * | 1977-11-25 | 1981-07-30 | Holco Investment Inc | Rifamycins |
| DE3574142D1 (en) * | 1985-10-18 | 1989-12-14 | Ciba Geigy Ag | Substituted 4-benzyl-piperazinyl compounds |
| EP0284552A1 (de) * | 1987-03-06 | 1988-09-28 | Ciba-Geigy Ag | 4-Benzyl-piperazinyl-Hydrazone |
| WO1989002894A1 (fr) * | 1987-09-25 | 1989-04-06 | Ciba-Geigy Ag | Derives diacyle de la 4-(trialkylbenzyle)-piperazinyle |
| US6143740A (en) * | 1996-11-19 | 2000-11-07 | Georgetown University | Heregulin antagonists and methods for their use |
| US20090275594A1 (en) * | 2008-05-05 | 2009-11-05 | Macielag Mark J | 3-hydrazone piperazinyl rifamycin derivatives useful as antimicrobial agents |
-
1970
- 1970-06-01 IT IT25381/70A patent/IT1046627B/it active
-
1971
- 1971-04-14 IL IL36617A patent/IL36617A/xx unknown
- 1971-04-15 ZA ZA712420A patent/ZA712420B/xx unknown
- 1971-04-20 NL NL7105341A patent/NL7105341A/xx unknown
- 1971-05-17 JP JP46033202A patent/JPS4921764B1/ja active Pending
- 1971-05-28 BE BE767845A patent/BE767845A/xx unknown
- 1971-05-28 FR FR7119539A patent/FR2100710B1/fr not_active Expired
- 1971-05-28 GB GB1798871A patent/GB1319868A/en not_active Expired
- 1971-06-01 DE DE19712127172 patent/DE2127172A1/de active Pending
- 1971-06-01 US US00149086A patent/US3796798A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IT1046627B (it) | 1980-07-31 |
| DE2127172A1 (de) | 1971-12-16 |
| FR2100710A1 (enExample) | 1972-03-24 |
| FR2100710B1 (enExample) | 1975-06-06 |
| IL36617A (en) | 1975-03-13 |
| IL36617A0 (en) | 1971-06-23 |
| NL7105341A (enExample) | 1971-12-03 |
| US3796798A (en) | 1974-03-12 |
| BE767845A (fr) | 1971-10-18 |
| JPS4921764B1 (enExample) | 1974-06-04 |
| GB1319868A (en) | 1973-06-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA714729B (en) | Novel benzcyclobutene derivatives | |
| IL37975A (en) | Pharmaceutical compositions containing adenosine derivatives | |
| KE2611A (en) | Pyridoquinoline derivatives | |
| ZA712345B (en) | Phenylalkane derivatives | |
| IE35376B1 (en) | Pyrimidine derivatives | |
| ZA712420B (en) | Antiviral compositions containing rifamycin sv derivatives | |
| IL38096A0 (en) | Ergolene derivatives | |
| ZA71532B (en) | Benzocycloheptaisoquinoline derivatives | |
| IL38024A0 (en) | Herbicidal compositions containing urea derivatives | |
| ZA711451B (en) | Pyridoindole derivatives | |
| IL36967A (en) | Compositions containing m-tyrisone | |
| PH11791A (en) | Triourea derivatives | |
| ZA711452B (en) | Pyridoindole derivatives | |
| ZA714137B (en) | Indenopyrrole derivatives | |
| AU450051B2 (en) | Antiviral compositions containing rifamycin sv derivatives | |
| AU2948171A (en) | Antiviral compositions containing rifamycin sv derivatives | |
| IL36616A (en) | Antiviral compositions containing 1-amino-piperazine derivatives | |
| ZA715597B (en) | Triazolobenzodiazepine derivatives | |
| ZA716654B (en) | Basic thienylalkane derivatives | |
| IL36933A0 (en) | 1-phenoxy-3-amino-propan-2-ol derivatives | |
| ZA713111B (en) | Substituted carbamoyloxyphenylurea derivatives | |
| ZA712421B (en) | Antiviral compositions containing piperazine derivatives | |
| AU462384B2 (en) | Antiviral compositions containing piperazine derivatives | |
| ZA712229B (en) | Phenyloxy derivatives | |
| CA986017A (en) | Compositions containing purine derivatives |