ZA711920B - Phenazine derivatives - Google Patents
Phenazine derivativesInfo
- Publication number
- ZA711920B ZA711920B ZA711920A ZA711920A ZA711920B ZA 711920 B ZA711920 B ZA 711920B ZA 711920 A ZA711920 A ZA 711920A ZA 711920 A ZA711920 A ZA 711920A ZA 711920 B ZA711920 B ZA 711920B
- Authority
- ZA
- South Africa
- Prior art keywords
- phenazine derivatives
- phenazine
- derivatives
- Prior art date
Links
- 125000001791 phenazinyl group Chemical class C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/50—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to ring nitrogen atoms
- C07D241/52—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2529870A | 1970-04-02 | 1970-04-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA711920B true ZA711920B (en) | 1971-12-29 |
Family
ID=21825201
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA711920A ZA711920B (en) | 1970-04-02 | 1971-03-24 | Phenazine derivatives |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3681331A (enExample) |
| AT (2) | AT318971B (enExample) |
| BE (1) | BE765156A (enExample) |
| CA (1) | CA1003832A (enExample) |
| CH (3) | CH558143A (enExample) |
| DE (1) | DE2115659A1 (enExample) |
| ES (1) | ES389789A1 (enExample) |
| FR (1) | FR2085792B1 (enExample) |
| GB (1) | GB1285010A (enExample) |
| HU (1) | HU162982B (enExample) |
| NL (1) | NL7104374A (enExample) |
| SE (2) | SE366987B (enExample) |
| ZA (1) | ZA711920B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5639949A (en) * | 1990-08-20 | 1997-06-17 | Ciba-Geigy Corporation | Genes for the synthesis of antipathogenic substances |
| US5637591A (en) * | 1995-06-02 | 1997-06-10 | Fuji Immunopharmaceuticals Corp. | Antimicrobial and anticollagenase activity of phenazine-5, 10-dioxide and derivatives |
| WO1998027969A2 (en) * | 1996-12-24 | 1998-07-02 | Queen's University At Kingston | Antimicrobial phenazine compounds |
| US20080269231A1 (en) * | 2007-01-16 | 2008-10-30 | Jj Pharma, Inc. | Phenazine Compounds and Use Thereof in Autoimmune and Inflammatory Disease |
| GB201319363D0 (en) | 2013-11-01 | 2013-12-18 | Uni I Oslo | Compounds |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3080283A (en) * | 1959-08-06 | 1963-03-05 | Philips Corp | Phenazine derivatives for combating nematodes |
| FR89671E (fr) * | 1965-03-25 | 1967-07-28 | Rhone Poulenc Sa | Nouveaux dérivés de la phénazine et leur préparation |
| US3520888A (en) * | 1965-10-22 | 1970-07-21 | Pfizer & Co C | 3,4-dihydrophenazine-5,10-dioxides |
| FR1525622A (fr) * | 1966-06-03 | 1968-05-17 | Canadian Patents Dev | Procédé de préparation de phénazines substituées |
| CH521358A (de) * | 1966-11-25 | 1972-04-15 | Hoffmann La Roche | Verfahren zur Herstellung von Phenazinderivaten |
| US3530130A (en) * | 1967-09-14 | 1970-09-22 | Hoffmann La Roche | 1-acylated-6-methoxyphenazine 5,10-dioxides |
| US3563991A (en) * | 1968-12-18 | 1971-02-16 | Pfizer & Co C | 1-oxo-1,2,3,4-tetrahydrophenazine-5,10-dioxides |
| CH546771A (de) * | 1969-04-22 | 1974-03-15 | Hoffmann La Roche | Verfahren zur herstellung von alkalimetallderivaten von 1,6-dihydroxyphenazin-5,10-dioxiden. |
-
1970
- 1970-04-02 US US25298A patent/US3681331A/en not_active Expired - Lifetime
-
1971
- 1971-03-24 ZA ZA711920A patent/ZA711920B/xx unknown
- 1971-03-25 CH CH133174A patent/CH558143A/xx not_active IP Right Cessation
- 1971-03-25 CH CH441871A patent/CH553192A/xx not_active IP Right Cessation
- 1971-03-25 CH CH133074A patent/CH557824A/xx not_active IP Right Cessation
- 1971-03-31 FR FR7111347A patent/FR2085792B1/fr not_active Expired
- 1971-03-31 DE DE19712115659 patent/DE2115659A1/de active Pending
- 1971-04-01 NL NL7104374A patent/NL7104374A/xx not_active Application Discontinuation
- 1971-04-01 ES ES389789A patent/ES389789A1/es not_active Expired
- 1971-04-01 AT AT227372A patent/AT318971B/de not_active IP Right Cessation
- 1971-04-01 AT AT276271A patent/AT304561B/de not_active IP Right Cessation
- 1971-04-01 CA CA109,335A patent/CA1003832A/en not_active Expired
- 1971-04-01 BE BE765156A patent/BE765156A/xx unknown
- 1971-04-02 SE SE04336/71A patent/SE366987B/xx unknown
- 1971-04-02 SE SE7309583A patent/SE396749B/xx unknown
- 1971-04-02 HU HUHO1366A patent/HU162982B/hu unknown
- 1971-04-19 GB GB26105/71A patent/GB1285010A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES389789A1 (es) | 1973-06-01 |
| NL7104374A (enExample) | 1971-10-05 |
| HU162982B (enExample) | 1973-05-28 |
| GB1285010A (en) | 1972-08-09 |
| FR2085792A1 (enExample) | 1971-12-31 |
| BE765156A (fr) | 1971-10-01 |
| CH558143A (de) | 1975-01-31 |
| SE396749B (sv) | 1977-10-03 |
| SE366987B (enExample) | 1974-05-13 |
| CH553192A (de) | 1974-08-30 |
| DE2115659A1 (de) | 1971-10-21 |
| CH557824A (de) | 1975-01-15 |
| AT318971B (de) | 1974-11-25 |
| US3681331A (en) | 1972-08-01 |
| CA1003832A (en) | 1977-01-18 |
| AT304561B (de) | 1973-01-10 |
| FR2085792B1 (enExample) | 1974-08-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA714729B (en) | Novel benzcyclobutene derivatives | |
| KE2611A (en) | Pyridoquinoline derivatives | |
| ZA718044B (en) | Triazolobenzodiazepine derivatives | |
| ZA717541B (en) | Ergolene derivatives | |
| CY761A (en) | Benzene derivatives | |
| ZA71532B (en) | Benzocycloheptaisoquinoline derivatives | |
| ZA711921B (en) | Phenazine derivatives | |
| PH11791A (en) | Triourea derivatives | |
| ZA711920B (en) | Phenazine derivatives | |
| HK27776A (en) | Diazabicycloundecapentene derivative | |
| ZA714137B (en) | Indenopyrrole derivatives | |
| ZA713033B (en) | Phenazine derivatives | |
| ZA715596B (en) | Triazolobenzodiazepine 5n-oxide derivatives | |
| IL36933A (en) | 1-phenoxy-3-amino-propan-2-ol derivatives | |
| ZA716654B (en) | Basic thienylalkane derivatives | |
| ZA713111B (en) | Substituted carbamoyloxyphenylurea derivatives | |
| ZA711487B (en) | 2-amino-imidazol-2-ine derivatives | |
| ZA706115B (en) | Phenazine derivatives | |
| ZA714759B (en) | Anthraquinone derivatives | |
| AU458856B2 (en) | Phenazine derivatives | |
| AU458857B2 (en) | Phenazine derivatives | |
| AU2723771A (en) | Phenazine derivatives | |
| AU2723871A (en) | Phenazine derivatives | |
| MY7600126A (en) | Pyridoquinoline derivatives | |
| GB1371091A (en) | Leucauramine derivatives |