ZA200610426B

ZA200610426B - 3-Aminocyclopentanecarboxamides as modulators of chemokine receptors

3-Aminocyclopentanecarboxamides as modulators of chemokine receptors Download PDF

Info

Publication number: ZA200610426B
Authority: ZA; South Africa
Prior art keywords: compound; alkyl; pyran; cyclopentyl; trifluoromethyl
Prior art date: 2004-06-28

Application number

ZA200610426A

Other languages

English (en)

Inventor

Xue Chu-Biao

Feng Hao

Glenn Joseph

Brian W Metcalf

Zheng Changsheng

Xia Michael

Cao Ganfeng

Original Assignee

Incyte Corp

Priority date

2004-06-28

Filing date

2006-12-12

Publication date

2008-07-30

2006-12-12 Application filed by Incyte Corp filed Critical Incyte Corp

2008-07-30 Publication of ZA200610426B publication Critical patent/ZA200610426B/en

Links

102000009410 Chemokine receptor Human genes 0.000 title claims description 19
108050000299 Chemokine receptor Proteins 0.000 title claims description 19
OLHSXPNNEJJDLQ-UHFFFAOYSA-N 3-aminocyclopentane-1-carboxamide Chemical class NC1CCC(C(N)=O)C1 OLHSXPNNEJJDLQ-UHFFFAOYSA-N 0.000 title 1
125000000217 alkyl group Chemical group 0.000 claims description 96
150000001875 compounds Chemical class 0.000 claims description 84
-1 carboeyclyloxy Chemical group 0.000 claims description 53
125000003545 alkoxy group Chemical group 0.000 claims description 42
125000000753 cycloalkyl group Chemical group 0.000 claims description 37
125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 24
125000004438 haloalkoxy group Chemical group 0.000 claims description 22
125000001188 haloalkyl group Chemical group 0.000 claims description 22
125000000623 heterocyclic group Chemical group 0.000 claims description 21
125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 20
125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 18
201000010099 disease Diseases 0.000 claims description 18
208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 18
238000000034 method Methods 0.000 claims description 18
125000004432 carbon atom Chemical group C* 0.000 claims description 16
208000031886 HIV Infections Diseases 0.000 claims description 15
150000003839 salts Chemical class 0.000 claims description 15
125000000000 cycloalkoxy group Chemical group 0.000 claims description 13
125000004452 carbocyclyl group Chemical group 0.000 claims description 12
229910052739 hydrogen Inorganic materials 0.000 claims description 12
102100031151 C-C chemokine receptor type 2 Human genes 0.000 claims description 11
101710149815 C-C chemokine receptor type 2 Proteins 0.000 claims description 11
229910052757 nitrogen Inorganic materials 0.000 claims description 11
229940002612 prodrug Drugs 0.000 claims description 11
239000000651 prodrug Substances 0.000 claims description 11
229910052799 carbon Inorganic materials 0.000 claims description 10
230000000694 effects Effects 0.000 claims description 10
239000000203 mixture Substances 0.000 claims description 10
125000001424 substituent group Chemical group 0.000 claims description 10
125000003342 alkenyl group Chemical group 0.000 claims description 8
239000003814 drug Substances 0.000 claims description 8
125000000304 alkynyl group Chemical group 0.000 claims description 7
201000001320 Atherosclerosis Diseases 0.000 claims description 5
102100035875 C-C chemokine receptor type 5 Human genes 0.000 claims description 5
101710149870 C-C chemokine receptor type 5 Proteins 0.000 claims description 5
KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 5
201000006417 multiple sclerosis Diseases 0.000 claims description 5
125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
206010039073 rheumatoid arthritis Diseases 0.000 claims description 5
208000037357 HIV infectious disease Diseases 0.000 claims description 4
208000033519 human immunodeficiency virus infectious disease Diseases 0.000 claims description 4
125000002768 hydroxyalkyl group Chemical group 0.000 claims description 4
238000002360 preparation method Methods 0.000 claims description 4
125000005309 thioalkoxy group Chemical group 0.000 claims description 4
206010028980 Neoplasm Diseases 0.000 claims description 3
208000036142 Viral infection Diseases 0.000 claims description 3
201000011510 cancer Diseases 0.000 claims description 3
125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
125000005844 heterocyclyloxy group Chemical group 0.000 claims description 3
230000002401 inhibitory effect Effects 0.000 claims description 3
125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
230000009385 viral infection Effects 0.000 claims description 3
101150088095 RTM2 gene Proteins 0.000 claims description 2
206010052779 Transplant rejections Diseases 0.000 claims description 2
206010012601 diabetes mellitus Diseases 0.000 claims description 2
239000003937 drug carrier Substances 0.000 claims description 2
125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 2
208000027866 inflammatory disease Diseases 0.000 claims description 2
206010025135 lupus erythematosus Diseases 0.000 claims description 2
125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 9
125000001475 halogen functional group Chemical group 0.000 claims 8
125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims 4
AHVQYHFYQWKUKB-UHFFFAOYSA-N oxan-4-amine Chemical compound NC1CCOCC1 AHVQYHFYQWKUKB-UHFFFAOYSA-N 0.000 claims 4
125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims 3
238000004519 manufacturing process Methods 0.000 claims 3
125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 claims 3
239000002260 anti-inflammatory agent Substances 0.000 claims 2
229940121363 anti-inflammatory agent Drugs 0.000 claims 2
RUQKNYTXAHKXDA-FKMNTQNHSA-N (4-hydroxy-4-phenylpiperidin-1-yl)-[(1s,3r)-3-[(3-methoxyoxan-4-yl)amino]-1-propan-2-ylcyclopentyl]methanone Chemical compound COC1COCCC1N[C@H]1C[C@](C(=O)N2CCC(O)(CC2)C=2C=CC=CC=2)(C(C)C)CC1 RUQKNYTXAHKXDA-FKMNTQNHSA-N 0.000 claims 1
125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims 1
206010006187 Breast cancer Diseases 0.000 claims 1
208000026310 Breast neoplasm Diseases 0.000 claims 1
102100038520 Calcitonin receptor Human genes 0.000 claims 1
101710178048 Calcitonin receptor Proteins 0.000 claims 1
208000034578 Multiple myelomas Diseases 0.000 claims 1
208000008589 Obesity Diseases 0.000 claims 1
206010033128 Ovarian cancer Diseases 0.000 claims 1
206010061535 Ovarian neoplasm Diseases 0.000 claims 1
206010035226 Plasma cell myeloma Diseases 0.000 claims 1
GXYWKFBKGZKVJL-XJJXGSDGSA-N [(1s,3r)-1-(2-methoxyethyl)-3-[[(4r)-3-methoxyoxan-4-yl]amino]cyclopentyl]-[4-[4-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl]methanone Chemical compound N([C@@H]1CC[C@](C1)(CCOC)C(=O)N1CCN(CC1)C=1N=CC=C(C=1)C(F)(F)F)[C@@H]1CCOCC1OC GXYWKFBKGZKVJL-XJJXGSDGSA-N 0.000 claims 1
OYZJOHSSFZXJSA-BJVXHXQFSA-N [(1s,3r)-1-ethyl-3-[[(4r)-3-methoxyoxan-4-yl]amino]cyclopentyl]-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]methanone Chemical compound N([C@@H]1CC[C@](C1)(CC)C(=O)N1CCN(CC1)C=1N=C(C=CN=1)C(F)(F)F)[C@@H]1CCOCC1OC OYZJOHSSFZXJSA-BJVXHXQFSA-N 0.000 claims 1
FDLNSUAMNMSJIX-GDDLFDBWSA-N [(1s,3r)-3-[(3-methoxyoxan-4-yl)amino]-1-propan-2-ylcyclopentyl]-(4-phenyl-3,6-dihydro-2h-pyridin-1-yl)methanone Chemical compound COC1COCCC1N[C@H]1C[C@](C(=O)N2CC=C(CC2)C=2C=CC=CC=2)(C(C)C)CC1 FDLNSUAMNMSJIX-GDDLFDBWSA-N 0.000 claims 1
DQWSENNLMPJNRJ-HKWVNQEYSA-N [(1s,3r)-3-[(3-methoxyoxan-4-yl)amino]-1-propan-2-ylcyclopentyl]-[4-[4-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl]methanone Chemical compound COC1COCCC1N[C@H]1C[C@](C(=O)N2CCN(CC2)C=2N=CC=C(C=2)C(F)(F)F)(C(C)C)CC1 DQWSENNLMPJNRJ-HKWVNQEYSA-N 0.000 claims 1
ZUSWDTWYONAOPH-UHFFFAOYSA-N [2-(trifluoromethyl)phenyl]hydrazine;hydrochloride Chemical group [Cl-].[NH3+]NC1=CC=CC=C1C(F)(F)F ZUSWDTWYONAOPH-UHFFFAOYSA-N 0.000 claims 1
RMSGLKOMJCNJDP-FKMNTQNHSA-N [4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-[(1s,3r)-3-[(3-methoxyoxan-4-yl)amino]-1-propan-2-ylcyclopentyl]methanone Chemical compound COC1COCCC1N[C@H]1C[C@](C(=O)N2CCC(O)(CC2)C=2C=C(C=CC=2)C(F)(F)F)(C(C)C)CC1 RMSGLKOMJCNJDP-FKMNTQNHSA-N 0.000 claims 1
239000003443 antiviral agent Substances 0.000 claims 1
208000026278 immune system disease Diseases 0.000 claims 1
208000004296 neuralgia Diseases 0.000 claims 1
208000021722 neuropathic pain Diseases 0.000 claims 1
235000020824 obesity Nutrition 0.000 claims 1
125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 claims 1
210000004981 tumor-associated macrophage Anatomy 0.000 claims 1
102000019034 Chemokines Human genes 0.000 description 17
108010012236 Chemokines Proteins 0.000 description 17
210000004027 cell Anatomy 0.000 description 16
125000005843 halogen group Chemical group 0.000 description 16
125000000592 heterocycloalkyl group Chemical group 0.000 description 13
125000003118 aryl group Chemical group 0.000 description 11
241000713772 Human immunodeficiency virus 1 Species 0.000 description 10
125000001072 heteroaryl group Chemical group 0.000 description 10
210000000265 leukocyte Anatomy 0.000 description 10
125000005842 heteroatom Chemical group 0.000 description 9
210000002540 macrophage Anatomy 0.000 description 9
210000001616 monocyte Anatomy 0.000 description 9
102100021943 C-C motif chemokine 2 Human genes 0.000 description 8
101710155857 C-C motif chemokine 2 Proteins 0.000 description 8
210000004698 lymphocyte Anatomy 0.000 description 8
ZGDKVKUWTCGYOA-URGPHPNLSA-N [4-[4-[(z)-c-(4-bromophenyl)-n-ethoxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidin-1-yl]-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)methanone Chemical compound C=1C=C(Br)C=CC=1C(=N/OCC)\C(CC1)CCN1C(CC1)(C)CCN1C(=O)C1=C(C)C=C[N+]([O-])=C1C ZGDKVKUWTCGYOA-URGPHPNLSA-N 0.000 description 7
125000004429 atom Chemical group 0.000 description 6
230000002757 inflammatory effect Effects 0.000 description 6
102000005962 receptors Human genes 0.000 description 6
108020003175 receptors Proteins 0.000 description 6
239000002253 acid Substances 0.000 description 5
239000003795 chemical substances by application Substances 0.000 description 5
239000003446 ligand Substances 0.000 description 5
230000008569 process Effects 0.000 description 5
210000001519 tissue Anatomy 0.000 description 5
102100031650 C-X-C chemokine receptor type 4 Human genes 0.000 description 4
208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 description 4
101000922348 Homo sapiens C-X-C chemokine receptor type 4 Proteins 0.000 description 4
102000004890 Interleukin-8 Human genes 0.000 description 4
108090001007 Interleukin-8 Proteins 0.000 description 4
210000001744 T-lymphocyte Anatomy 0.000 description 4
239000005557 antagonist Substances 0.000 description 4
238000013459 approach Methods 0.000 description 4
208000006673 asthma Diseases 0.000 description 4
230000003399 chemotactic effect Effects 0.000 description 4
AYXBAIULRDEVAS-UHFFFAOYSA-N dimethyl-[[4-[[3-(4-methylphenyl)-8,9-dihydro-7h-benzo[7]annulene-6-carbonyl]amino]phenyl]methyl]-(oxan-4-yl)azanium;iodide Chemical compound [I-].C1=CC(C)=CC=C1C1=CC=C(CCCC(=C2)C(=O)NC=3C=CC(C[N+](C)(C)C4CCOCC4)=CC=3)C2=C1 AYXBAIULRDEVAS-UHFFFAOYSA-N 0.000 description 4
XKTZWUACRZHVAN-VADRZIEHSA-N interleukin-8 Chemical compound C([C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@@H](NC(C)=O)CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CCSC)C(=O)N1[C@H](CCC1)C(=O)N1[C@H](CCC1)C(=O)N[C@@H](C)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC=1C=CC(O)=CC=1)C(=O)N[C@H](CO)C(=O)N1[C@H](CCC1)C(N)=O)C1=CC=CC=C1 XKTZWUACRZHVAN-VADRZIEHSA-N 0.000 description 4
229940096397 interleukin-8 Drugs 0.000 description 4
125000002950 monocyclic group Chemical group 0.000 description 4
210000000440 neutrophil Anatomy 0.000 description 4
125000000160 oxazolidinyl group Chemical group 0.000 description 4
125000003367 polycyclic group Chemical group 0.000 description 4
230000007502 viral entry Effects 0.000 description 4
WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
208000023275 Autoimmune disease Diseases 0.000 description 3
LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
241000282414 Homo sapiens Species 0.000 description 3
208000022559 Inflammatory bowel disease Diseases 0.000 description 3
102000015696 Interleukins Human genes 0.000 description 3
108010063738 Interleukins Proteins 0.000 description 3
201000004681 Psoriasis Diseases 0.000 description 3
125000002947 alkylene group Chemical group 0.000 description 3
239000002585 base Substances 0.000 description 3
210000003651 basophil Anatomy 0.000 description 3
125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 3
230000015572 biosynthetic process Effects 0.000 description 3
230000000903 blocking effect Effects 0.000 description 3
150000001721 carbon Chemical group 0.000 description 3
230000012292 cell migration Effects 0.000 description 3
239000002975 chemoattractant Substances 0.000 description 3
229940079593 drug Drugs 0.000 description 3
210000003979 eosinophil Anatomy 0.000 description 3
125000002541 furyl group Chemical group 0.000 description 3
125000004415 heterocyclylalkyl group Chemical group 0.000 description 3
125000002632 imidazolidinyl group Chemical group 0.000 description 3
230000000977 initiatory effect Effects 0.000 description 3
210000003734 kidney Anatomy 0.000 description 3
230000005012 migration Effects 0.000 description 3
238000013508 migration Methods 0.000 description 3
VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
201000008383 nephritis Diseases 0.000 description 3
125000004043 oxo group Chemical group O=* 0.000 description 3
229910052760 oxygen Inorganic materials 0.000 description 3
125000003386 piperidinyl group Chemical group 0.000 description 3
108090000623 proteins and genes Proteins 0.000 description 3
125000003072 pyrazolidinyl group Chemical group 0.000 description 3
125000004076 pyridyl group Chemical group 0.000 description 3
125000000714 pyrimidinyl group Chemical group 0.000 description 3
230000007115 recruitment Effects 0.000 description 3
125000003718 tetrahydrofuranyl group Chemical group 0.000 description 3
230000001225 therapeutic effect Effects 0.000 description 3
125000001544 thienyl group Chemical group 0.000 description 3
KWGRBVOPPLSCSI-WPRPVWTQSA-N (-)-ephedrine Chemical compound CN[C@@H](C)[C@H](O)C1=CC=CC=C1 KWGRBVOPPLSCSI-WPRPVWTQSA-N 0.000 description 2
125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 2
FTNJQNQLEGKTGD-UHFFFAOYSA-N 1,3-benzodioxole Chemical compound C1=CC=C2OCOC2=C1 FTNJQNQLEGKTGD-UHFFFAOYSA-N 0.000 description 2
IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
102100031172 C-C chemokine receptor type 1 Human genes 0.000 description 2
101710149814 C-C chemokine receptor type 1 Proteins 0.000 description 2
108010040471 CC Chemokines Proteins 0.000 description 2
102000001902 CC Chemokines Human genes 0.000 description 2
125000006414 CCl Chemical group ClC* 0.000 description 2
108050006947 CXC Chemokine Proteins 0.000 description 2
102000019388 CXC chemokine Human genes 0.000 description 2
206010007559 Cardiac failure congestive Diseases 0.000 description 2
108010055166 Chemokine CCL5 Proteins 0.000 description 2
RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
102000011652 Formyl peptide receptors Human genes 0.000 description 2
108010076288 Formyl peptide receptors Proteins 0.000 description 2
108091006027 G proteins Proteins 0.000 description 2
102000030782 GTP binding Human genes 0.000 description 2
108091000058 GTP-Binding Proteins 0.000 description 2
102100034221 Growth-regulated alpha protein Human genes 0.000 description 2
NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
101001069921 Homo sapiens Growth-regulated alpha protein Proteins 0.000 description 2
102000014150 Interferons Human genes 0.000 description 2
108010050904 Interferons Proteins 0.000 description 2
208000011200 Kawasaki disease Diseases 0.000 description 2
241000282553 Macaca Species 0.000 description 2
206010027260 Meningitis viral Diseases 0.000 description 2
241000699670 Mus sp. Species 0.000 description 2
208000009525 Myocarditis Diseases 0.000 description 2
206010040047 Sepsis Diseases 0.000 description 2
WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
108060008682 Tumor Necrosis Factor Proteins 0.000 description 2
230000002378 acidificating effect Effects 0.000 description 2
230000003213 activating effect Effects 0.000 description 2
230000004913 activation Effects 0.000 description 2
125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 2
235000001014 amino acid Nutrition 0.000 description 2
125000003710 aryl alkyl group Chemical group 0.000 description 2
125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 2
125000005605 benzo group Chemical group 0.000 description 2
BNBQRQQYDMDJAH-UHFFFAOYSA-N benzodioxan Chemical compound C1=CC=C2OCCOC2=C1 BNBQRQQYDMDJAH-UHFFFAOYSA-N 0.000 description 2
125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 2
210000004369 blood Anatomy 0.000 description 2
239000008280 blood Substances 0.000 description 2
239000011575 calcium Substances 0.000 description 2
125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 2
239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
239000000969 carrier Substances 0.000 description 2
230000001684 chronic effect Effects 0.000 description 2
125000004122 cyclic group Chemical group 0.000 description 2
125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 2
125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 2
125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
125000000151 cysteine group Chemical group N[C@@H](CS)C(=O)* 0.000 description 2
230000002950 deficient Effects 0.000 description 2
238000009510 drug design Methods 0.000 description 2
125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
210000002950 fibroblast Anatomy 0.000 description 2
108091008053 gene clusters Proteins 0.000 description 2
208000006454 hepatitis Diseases 0.000 description 2
231100000283 hepatitis Toxicity 0.000 description 2
210000003630 histaminocyte Anatomy 0.000 description 2
125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
125000002883 imidazolyl group Chemical group 0.000 description 2
125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 2
125000001041 indolyl group Chemical group 0.000 description 2
208000015181 infectious disease Diseases 0.000 description 2
239000003112 inhibitor Substances 0.000 description 2
230000003993 interaction Effects 0.000 description 2
229940079322 interferon Drugs 0.000 description 2
230000003834 intracellular effect Effects 0.000 description 2
125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 2
125000003965 isoxazolidinyl group Chemical group 0.000 description 2
125000000842 isoxazolyl group Chemical group 0.000 description 2
208000017169 kidney disease Diseases 0.000 description 2
JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
230000001404 mediated effect Effects 0.000 description 2
125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
150000007522 mineralic acids Chemical class 0.000 description 2
208000001725 mucocutaneous lymph node syndrome Diseases 0.000 description 2
125000004433 nitrogen atom Chemical group N* 0.000 description 2
231100000252 nontoxic Toxicity 0.000 description 2
230000003000 nontoxic effect Effects 0.000 description 2
125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 2
125000005482 norpinyl group Chemical group 0.000 description 2
150000007524 organic acids Chemical class 0.000 description 2
125000002971 oxazolyl group Chemical group 0.000 description 2
235000018102 proteins Nutrition 0.000 description 2
102000004169 proteins and genes Human genes 0.000 description 2
208000005069 pulmonary fibrosis Diseases 0.000 description 2
125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 2
125000003373 pyrazinyl group Chemical group 0.000 description 2
125000003226 pyrazolyl group Chemical group 0.000 description 2
125000002098 pyridazinyl group Chemical group 0.000 description 2
125000000719 pyrrolidinyl group Chemical group 0.000 description 2
230000010076 replication Effects 0.000 description 2
201000000306 sarcoidosis Diseases 0.000 description 2
229920006395 saturated elastomer Polymers 0.000 description 2
150000003384 small molecules Chemical class 0.000 description 2
210000000329 smooth muscle myocyte Anatomy 0.000 description 2
229910052717 sulfur Inorganic materials 0.000 description 2
125000005958 tetrahydrothienyl group Chemical group 0.000 description 2
125000003831 tetrazolyl group Chemical group 0.000 description 2
238000002560 therapeutic procedure Methods 0.000 description 2
125000001984 thiazolidinyl group Chemical group 0.000 description 2
125000000335 thiazolyl group Chemical group 0.000 description 2
125000004306 triazinyl group Chemical group 0.000 description 2
125000001425 triazolyl group Chemical group 0.000 description 2
102000003390 tumor necrosis factor Human genes 0.000 description 2
201000010044 viral meningitis Diseases 0.000 description 2
FMCGSUUBYTWNDP-ONGXEEELSA-N (1R,2S)-2-(dimethylamino)-1-phenyl-1-propanol Chemical compound CN(C)[C@@H](C)[C@H](O)C1=CC=CC=C1 FMCGSUUBYTWNDP-ONGXEEELSA-N 0.000 description 1
QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
DNISEZBAYYIQFB-PHDIDXHHSA-N (2r,3r)-2,3-diacetyloxybutanedioic acid Chemical compound CC(=O)O[C@@H](C(O)=O)[C@H](C(O)=O)OC(C)=O DNISEZBAYYIQFB-PHDIDXHHSA-N 0.000 description 1
BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
125000005943 1,2,3,6-tetrahydropyridyl group Chemical group 0.000 description 1
125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 1
125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 1
125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
125000005955 1H-indazolyl group Chemical group 0.000 description 1
YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
125000004562 2,3-dihydroindol-1-yl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
UZYQSNQJLWTICD-UHFFFAOYSA-N 2-(n-benzoylanilino)-2,2-dinitroacetic acid Chemical compound C=1C=CC=CC=1N(C(C(=O)O)([N+]([O-])=O)[N+]([O-])=O)C(=O)C1=CC=CC=C1 UZYQSNQJLWTICD-UHFFFAOYSA-N 0.000 description 1
IJXJGQCXFSSHNL-UHFFFAOYSA-N 2-amino-2-phenylethanol Chemical compound OCC(N)C1=CC=CC=C1 IJXJGQCXFSSHNL-UHFFFAOYSA-N 0.000 description 1
KMGUEILFFWDGFV-UHFFFAOYSA-N 2-benzoyl-2-benzoyloxy-3-hydroxybutanedioic acid Chemical compound C=1C=CC=CC=1C(=O)C(C(C(O)=O)O)(C(O)=O)OC(=O)C1=CC=CC=C1 KMGUEILFFWDGFV-UHFFFAOYSA-N 0.000 description 1
GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical compound C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 1
125000005986 4-piperidonyl group Chemical group 0.000 description 1
125000002471 4H-quinolizinyl group Chemical group C=1(C=CCN2C=CC=CC12)* 0.000 description 1
HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
208000036065 Airway Remodeling Diseases 0.000 description 1
206010003571 Astrocytoma Diseases 0.000 description 1
108050005711 C Chemokine Proteins 0.000 description 1
102000017483 C chemokine Human genes 0.000 description 1
102100023702 C-C motif chemokine 13 Human genes 0.000 description 1
101710112613 C-C motif chemokine 13 Proteins 0.000 description 1
102100032367 C-C motif chemokine 5 Human genes 0.000 description 1
102100032366 C-C motif chemokine 7 Human genes 0.000 description 1
101710155834 C-C motif chemokine 7 Proteins 0.000 description 1
102100034871 C-C motif chemokine 8 Human genes 0.000 description 1
101710155833 C-C motif chemokine 8 Proteins 0.000 description 1
102100036166 C-X-C chemokine receptor type 1 Human genes 0.000 description 1
102100028989 C-X-C chemokine receptor type 2 Human genes 0.000 description 1
108091008927 CC chemokine receptors Proteins 0.000 description 1
108700012434 CCL3 Proteins 0.000 description 1
102000005674 CCR Receptors Human genes 0.000 description 1
210000001266 CD8-positive T-lymphocyte Anatomy 0.000 description 1
108091008928 CXC chemokine receptors Proteins 0.000 description 1
102000054900 CXCR Receptors Human genes 0.000 description 1
OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
102000000844 Cell Surface Receptors Human genes 0.000 description 1
108010001857 Cell Surface Receptors Proteins 0.000 description 1
102000000013 Chemokine CCL3 Human genes 0.000 description 1
102000001326 Chemokine CCL4 Human genes 0.000 description 1
108010055165 Chemokine CCL4 Proteins 0.000 description 1
108010078239 Chemokine CX3CL1 Proteins 0.000 description 1
206010009900 Colitis ulcerative Diseases 0.000 description 1
208000011231 Crohn disease Diseases 0.000 description 1
102000004127 Cytokines Human genes 0.000 description 1
108090000695 Cytokines Proteins 0.000 description 1
206010012442 Dermatitis contact Diseases 0.000 description 1
YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
201000009273 Endometriosis Diseases 0.000 description 1
BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
102000013818 Fractalkine Human genes 0.000 description 1
102000003688 G-Protein-Coupled Receptors Human genes 0.000 description 1
108090000045 G-Protein-Coupled Receptors Proteins 0.000 description 1
206010018364 Glomerulonephritis Diseases 0.000 description 1
208000009329 Graft vs Host Disease Diseases 0.000 description 1
206010019280 Heart failures Diseases 0.000 description 1
101000947174 Homo sapiens C-X-C chemokine receptor type 1 Proteins 0.000 description 1
UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
201000009794 Idiopathic Pulmonary Fibrosis Diseases 0.000 description 1
102000004889 Interleukin-6 Human genes 0.000 description 1
108090001005 Interleukin-6 Proteins 0.000 description 1
108010018951 Interleukin-8B Receptors Proteins 0.000 description 1
241000282560 Macaca mulatta Species 0.000 description 1
108010090054 Membrane Glycoproteins Proteins 0.000 description 1
102000012750 Membrane Glycoproteins Human genes 0.000 description 1
241001465754 Metazoa Species 0.000 description 1
108010064136 Monocyte Chemoattractant Proteins Proteins 0.000 description 1
102000014962 Monocyte Chemoattractant Proteins Human genes 0.000 description 1
101000978374 Mus musculus C-C motif chemokine 12 Proteins 0.000 description 1
FMCGSUUBYTWNDP-UHFFFAOYSA-N N-Methylephedrine Natural products CN(C)C(C)C(O)C1=CC=CC=C1 FMCGSUUBYTWNDP-UHFFFAOYSA-N 0.000 description 1
206010033645 Pancreatitis Diseases 0.000 description 1
206010034277 Pemphigoid Diseases 0.000 description 1
201000011152 Pemphigus Diseases 0.000 description 1
206010035664 Pneumonia Diseases 0.000 description 1
IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
241000219061 Rheum Species 0.000 description 1
102100021669 Stromal cell-derived factor 1 Human genes 0.000 description 1
101710088580 Stromal cell-derived factor 1 Proteins 0.000 description 1
NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
230000024932 T cell mediated immunity Effects 0.000 description 1
FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
206010053613 Type IV hypersensitivity reaction Diseases 0.000 description 1
201000006704 Ulcerative Colitis Diseases 0.000 description 1
206010047112 Vasculitides Diseases 0.000 description 1
206010047115 Vasculitis Diseases 0.000 description 1
108010003533 Viral Envelope Proteins Proteins 0.000 description 1
BBAWTPDTGRXPDG-UHFFFAOYSA-N [1,3]thiazolo[4,5-b]pyridine Chemical compound C1=CC=C2SC=NC2=N1 BBAWTPDTGRXPDG-UHFFFAOYSA-N 0.000 description 1
238000009825 accumulation Methods 0.000 description 1
150000007513 acids Chemical class 0.000 description 1
125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
208000037883 airway inflammation Diseases 0.000 description 1
239000003513 alkali Substances 0.000 description 1
150000001336 alkenes Chemical class 0.000 description 1
229920000180 alkyd Polymers 0.000 description 1
208000026935 allergic disease Diseases 0.000 description 1
125000003275 alpha amino acid group Chemical group 0.000 description 1
HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
150000001412 amines Chemical class 0.000 description 1
150000001413 amino acids Chemical class 0.000 description 1
125000003277 amino group Chemical group 0.000 description 1
238000010171 animal model Methods 0.000 description 1
125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
230000036436 anti-hiv Effects 0.000 description 1
230000000798 anti-retroviral effect Effects 0.000 description 1
239000004599 antimicrobial Substances 0.000 description 1
150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
206010003246 arthritis Diseases 0.000 description 1
230000003143 atherosclerotic effect Effects 0.000 description 1
QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
125000004566 azetidin-1-yl group Chemical group N1(CCC1)* 0.000 description 1
125000004931 azocinyl group Chemical group N1=C(C=CC=CC=C1)* 0.000 description 1
235000015241 bacon Nutrition 0.000 description 1
230000008901 benefit Effects 0.000 description 1
125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 description 1
125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 1
125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
150000001558 benzoic acid derivatives Chemical class 0.000 description 1
125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
125000005512 benztetrazolyl group Chemical group 0.000 description 1
210000004204 blood vessel Anatomy 0.000 description 1
125000001246 bromo group Chemical group Br* 0.000 description 1
229940124630 bronchodilator Drugs 0.000 description 1
125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
229910052791 calcium Inorganic materials 0.000 description 1
MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical class C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
125000005884 carbocyclylalkyl group Chemical group 0.000 description 1
125000004623 carbolinyl group Chemical group 0.000 description 1
150000001735 carboxylic acids Chemical class 0.000 description 1
230000017455 cell-cell adhesion Effects 0.000 description 1
230000001413 cellular effect Effects 0.000 description 1
206010008118 cerebral infarction Diseases 0.000 description 1
208000026106 cerebrovascular disease Diseases 0.000 description 1
230000035605 chemotaxis Effects 0.000 description 1
238000002512 chemotherapy Methods 0.000 description 1
125000001309 chloro group Chemical group Cl* 0.000 description 1
125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 1
208000037976 chronic inflammation Diseases 0.000 description 1
230000006020 chronic inflammation Effects 0.000 description 1
230000012085 chronic inflammatory response Effects 0.000 description 1
125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
238000002648 combination therapy Methods 0.000 description 1
239000000470 constituent Substances 0.000 description 1
208000010247 contact dermatitis Diseases 0.000 description 1
125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
125000002188 cycloheptatrienyl group Chemical group C1(=CC=CC=CC1)* 0.000 description 1
125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 description 1
SSJXIUAHEKJCMH-UHFFFAOYSA-N cyclohexane-1,2-diamine Chemical compound NC1CCCCC1N SSJXIUAHEKJCMH-UHFFFAOYSA-N 0.000 description 1
KWGRBVOPPLSCSI-UHFFFAOYSA-N d-ephedrine Natural products CNC(C)C(O)C1=CC=CC=C1 KWGRBVOPPLSCSI-UHFFFAOYSA-N 0.000 description 1
230000006378 damage Effects 0.000 description 1
230000034994 death Effects 0.000 description 1
125000004856 decahydroquinolinyl group Chemical group N1(CCCC2CCCCC12)* 0.000 description 1
230000003247 decreasing effect Effects 0.000 description 1
230000007123 defense Effects 0.000 description 1
210000004443 dendritic cell Anatomy 0.000 description 1
201000001981 dermatomyositis Diseases 0.000 description 1
229910052805 deuterium Inorganic materials 0.000 description 1
238000011161 development Methods 0.000 description 1
230000007646 directional migration Effects 0.000 description 1
DLNKOYKMWOXYQA-UHFFFAOYSA-N dl-pseudophenylpropanolamine Natural products CC(N)C(O)C1=CC=CC=C1 DLNKOYKMWOXYQA-UHFFFAOYSA-N 0.000 description 1
239000002552 dosage form Substances 0.000 description 1
230000000797 effect on infection Effects 0.000 description 1
238000010828 elution Methods 0.000 description 1
239000012156 elution solvent Substances 0.000 description 1
229960002179 ephedrine Drugs 0.000 description 1
125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
230000001605 fetal effect Effects 0.000 description 1
125000001153 fluoro group Chemical group F* 0.000 description 1
238000001640 fractional crystallisation Methods 0.000 description 1
238000010575 fractional recrystallization Methods 0.000 description 1
230000006870 function Effects 0.000 description 1
125000000524 functional group Chemical group 0.000 description 1
125000003838 furazanyl group Chemical group 0.000 description 1
230000002068 genetic effect Effects 0.000 description 1
208000024908 graft versus host disease Diseases 0.000 description 1
229910052736 halogen Inorganic materials 0.000 description 1
150000002367 halogens Chemical class 0.000 description 1
125000004446 heteroarylalkyl group Chemical group 0.000 description 1
125000005885 heterocycloalkylalkyl group Chemical group 0.000 description 1
229960001340 histamine Drugs 0.000 description 1
150000002430 hydrocarbons Chemical group 0.000 description 1
239000001257 hydrogen Substances 0.000 description 1
125000002636 imidazolinyl group Chemical group 0.000 description 1
230000002519 immonomodulatory effect Effects 0.000 description 1
210000000987 immune system Anatomy 0.000 description 1
238000001727 in vivo Methods 0.000 description 1
125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
125000004926 indolenyl group Chemical group 0.000 description 1
125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
230000008595 infiltration Effects 0.000 description 1
238000001764 infiltration Methods 0.000 description 1
230000004054 inflammatory process Effects 0.000 description 1
230000028709 inflammatory response Effects 0.000 description 1
230000005764 inhibitory process Effects 0.000 description 1
229910052500 inorganic mineral Inorganic materials 0.000 description 1
239000000543 intermediate Substances 0.000 description 1
208000036971 interstitial lung disease 2 Diseases 0.000 description 1
125000002346 iodo group Chemical group I* 0.000 description 1
230000007794 irritation Effects 0.000 description 1
125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 description 1
125000005438 isoindazolyl group Chemical group 0.000 description 1
125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
125000005956 isoquinolyl group Chemical group 0.000 description 1
125000001786 isothiazolyl group Chemical group 0.000 description 1
239000004310 lactic acid Substances 0.000 description 1
235000014655 lactic acid Nutrition 0.000 description 1
230000003902 lesion Effects 0.000 description 1
230000004199 lung function Effects 0.000 description 1
239000002932 luster Substances 0.000 description 1
238000012423 maintenance Methods 0.000 description 1
239000001630 malic acid Substances 0.000 description 1
235000011090 malic acid Nutrition 0.000 description 1
208000030883 malignant astrocytoma Diseases 0.000 description 1
229960002510 mandelic acid Drugs 0.000 description 1
239000000463 material Substances 0.000 description 1
AEUKDPKXTPNBNY-XEYRWQBLSA-N mcp 2 Chemical compound C([C@@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCNC(N)=N)C(=O)NCC(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CS)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC(C)C)NC(=O)[C@H](CS)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CS)NC(=O)[C@H](C)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)[C@@H](N)C(C)C)C(C)C)C1=CC=CC=C1 AEUKDPKXTPNBNY-XEYRWQBLSA-N 0.000 description 1
230000034217 membrane fusion Effects 0.000 description 1
210000003071 memory t lymphocyte Anatomy 0.000 description 1
239000011707 mineral Substances 0.000 description 1
238000012986 modification Methods 0.000 description 1
230000004048 modification Effects 0.000 description 1
210000002464 muscle smooth vascular Anatomy 0.000 description 1
SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
AGVKXDPPPSLISR-UHFFFAOYSA-N n-ethylcyclohexanamine Chemical compound CCNC1CCCCC1 AGVKXDPPPSLISR-UHFFFAOYSA-N 0.000 description 1
229940073569 n-methylephedrine Drugs 0.000 description 1
OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
125000005893 naphthalimidyl group Chemical group 0.000 description 1
125000001624 naphthyl group Chemical group 0.000 description 1
125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
210000000822 natural killer cell Anatomy 0.000 description 1
125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
230000007823 neuropathy Effects 0.000 description 1
201000001119 neuropathy Diseases 0.000 description 1
239000002547 new drug Substances 0.000 description 1
239000012457 nonaqueous media Substances 0.000 description 1
125000004930 octahydroisoquinolinyl group Chemical group C1(NCCC2CCCC=C12)* 0.000 description 1
210000000056 organ Anatomy 0.000 description 1
235000005985 organic acids Nutrition 0.000 description 1
239000003960 organic solvent Substances 0.000 description 1
230000008520 organization Effects 0.000 description 1
125000001715 oxadiazolyl group Chemical group 0.000 description 1
QNNHQVPFZIFNFK-UHFFFAOYSA-N oxazolo[4,5-b]pyridine Chemical compound C1=CC=C2OC=NC2=N1 QNNHQVPFZIFNFK-UHFFFAOYSA-N 0.000 description 1
239000001301 oxygen Substances 0.000 description 1
125000004430 oxygen atom Chemical group O* 0.000 description 1
230000007170 pathology Effects 0.000 description 1
201000001976 pemphigus vulgaris Diseases 0.000 description 1
YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 1
125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
208000033808 peripheral neuropathy Diseases 0.000 description 1
239000002831 pharmacologic agent Substances 0.000 description 1
125000001792 phenanthrenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C=CC12)* 0.000 description 1
125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
125000004625 phenanthrolinyl group Chemical group N1=C(C=CC2=CC=C3C=CC=NC3=C12)* 0.000 description 1
125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
125000005954 phenoxathiinyl group Chemical group 0.000 description 1
125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
DLNKOYKMWOXYQA-APPZFPTMSA-N phenylpropanolamine Chemical compound C[C@@H](N)[C@H](O)C1=CC=CC=C1 DLNKOYKMWOXYQA-APPZFPTMSA-N 0.000 description 1
229960000395 phenylpropanolamine Drugs 0.000 description 1
125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
125000005545 phthalimidyl group Chemical group 0.000 description 1
125000004193 piperazinyl group Chemical group 0.000 description 1
125000004928 piperidonyl group Chemical group 0.000 description 1
229960005235 piperonyl butoxide Drugs 0.000 description 1
125000004591 piperonyl group Chemical group C(C1=CC=2OCOC2C=C1)* 0.000 description 1
229920000728 polyester Polymers 0.000 description 1
229920001184 polypeptide Polymers 0.000 description 1
230000003389 potentiating effect Effects 0.000 description 1
108090000765 processed proteins & peptides Proteins 0.000 description 1
102000004196 processed proteins & peptides Human genes 0.000 description 1
230000007425 progressive decline Effects 0.000 description 1
125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
230000020978 protein processing Effects 0.000 description 1
125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
208000002815 pulmonary hypertension Diseases 0.000 description 1
201000003651 pulmonary sarcoidosis Diseases 0.000 description 1
125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
125000002755 pyrazolinyl group Chemical group 0.000 description 1
125000001422 pyrrolinyl group Chemical group 0.000 description 1
125000000168 pyrrolyl group Chemical group 0.000 description 1
125000001453 quaternary ammonium group Chemical group 0.000 description 1
150000003242 quaternary ammonium salts Chemical class 0.000 description 1
125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
125000004548 quinolin-3-yl group Chemical group N1=CC(=CC2=CC=CC=C12)* 0.000 description 1
125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
125000005493 quinolyl group Chemical group 0.000 description 1
125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
238000001525 receptor binding assay Methods 0.000 description 1
230000004044 response Effects 0.000 description 1
208000037803 restenosis Diseases 0.000 description 1
238000010839 reverse transcription Methods 0.000 description 1
230000002441 reversible effect Effects 0.000 description 1
238000012552 review Methods 0.000 description 1
238000005096 rolling process Methods 0.000 description 1
229930195734 saturated hydrocarbon Natural products 0.000 description 1
238000003567 signal transduction assay Methods 0.000 description 1
210000003491 skin Anatomy 0.000 description 1
239000007858 starting material Substances 0.000 description 1
230000000707 stereoselective effect Effects 0.000 description 1
239000000126 substance Substances 0.000 description 1
238000006467 substitution reaction Methods 0.000 description 1
125000004089 sulfido group Chemical group [S-]* 0.000 description 1
239000011593 sulfur Substances 0.000 description 1
125000004434 sulfur atom Chemical group 0.000 description 1
238000003786 synthesis reaction Methods 0.000 description 1
201000000596 systemic lupus erythematosus Diseases 0.000 description 1
230000008685 targeting Effects 0.000 description 1
235000002906 tartaric acid Nutrition 0.000 description 1
239000011975 tartaric acid Substances 0.000 description 1
125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
229940124597 therapeutic agent Drugs 0.000 description 1
125000004627 thianthrenyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3SC12)* 0.000 description 1
230000000451 tissue damage Effects 0.000 description 1
231100000827 tissue damage Toxicity 0.000 description 1
231100000419 toxicity Toxicity 0.000 description 1
230000001988 toxicity Effects 0.000 description 1
229910052722 tritium Inorganic materials 0.000 description 1
230000005951 type IV hypersensitivity Effects 0.000 description 1
208000027930 type IV hypersensitivity disease Diseases 0.000 description 1
230000002792 vascular Effects 0.000 description 1
210000003556 vascular endothelial cell Anatomy 0.000 description 1
125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
230000029812 viral genome replication Effects 0.000 description 1
230000017613 viral reproduction Effects 0.000 description 1
230000003612 virological effect Effects 0.000 description 1
XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1