WO2019233826A1 - Fungicidal mixtures comprising substituted 3-phenyl-5-(trifluoromethyl)-1,2,4-oxadiazoles - Google Patents
Fungicidal mixtures comprising substituted 3-phenyl-5-(trifluoromethyl)-1,2,4-oxadiazoles Download PDFInfo
- Publication number
- WO2019233826A1 WO2019233826A1 PCT/EP2019/063813 EP2019063813W WO2019233826A1 WO 2019233826 A1 WO2019233826 A1 WO 2019233826A1 EP 2019063813 W EP2019063813 W EP 2019063813W WO 2019233826 A1 WO2019233826 A1 WO 2019233826A1
- Authority
- WO
- WIPO (PCT)
- Prior art keywords
- methyl
- phenyl
- trifluoromethyl
- carboxamide
- chloro
- Prior art date
Links
- 0 CC(C)(C1)ON=C1S(C(c1c(*)[n](C)nc1C(F)(F)F)F)(=*)=O Chemical compound CC(C)(C1)ON=C1S(C(c1c(*)[n](C)nc1C(F)(F)F)F)(=*)=O 0.000 description 1
- ZEDGCQSZPRUCDF-YVNNLAQVSA-N CC(C/C(/C)=N\OC)NC(c(cc1)ccc1-c1n[o]c(C(F)(F)F)n1)=O Chemical compound CC(C/C(/C)=N\OC)NC(c(cc1)ccc1-c1n[o]c(C(F)(F)F)n1)=O ZEDGCQSZPRUCDF-YVNNLAQVSA-N 0.000 description 1
- VFZCQUCADXRQMT-UHFFFAOYSA-N O=C(C(Oc(cc1)ccc1-c1n[o]c(C(F)(F)F)n1)(F)F)NC1CC1 Chemical compound O=C(C(Oc(cc1)ccc1-c1n[o]c(C(F)(F)F)n1)(F)F)NC1CC1 VFZCQUCADXRQMT-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/82—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with three ring hetero atoms
Definitions
- Fungicidal mixtures comprising substituted 3-phenyl-5-(trifluoromethyl)-1 ,2,4-oxadiazoles
- the present invention relates to a fungicidal mixture comprising, as active components 1 ) at least one active compound selected from the group consisting of
- respiration inhibitors diflumetorim (A.4.1); nitrophenyl derivates: binapacryl (A.4.2), dinobuton (A.4.3), dinocap (A.4.4), fluazinam (A.4.5), meptyldinocap (A.4.6), ferimzone (A.4.7); organometal compounds: fentin salts, e. g. fentin-acetate (A.4.8), fentin chloride (A.4.9) or fentin hydroxide (A.4.10); ametoctradin (A.4.1 1); silthiofam (A.4.12);
- - C14 demethylase inhibitors triazoles: azaconazole (B.1.1), bitertanol (B.1.2), bromu- conazole (B.1.3), cyproconazole (B.1.4), difenoconazole (B.1.5), diniconazole (B.1.6), diniconazole-M (B.1.7), epoxiconazole (B.1.8), fenbuconazole (B.1.9), fluquinconazole (B.1.10), flusilazole (B.1.11 ), flutriafol (B.1.12), hexaconazole (B.1.13), imibenconazole (B.1.14), ipconazole (B.1.15), metconazole (B.1.17), myclobutanil (B.1.18), oxpoconazole (B.1.19), paclobutrazole (B.1.20), penconazole (B.1.21 ), propiconazole
- benalaxyl (C.1.1 ), benalaxyl-M (C.1.2), kiralaxyl (C.1.3), metalaxyl (C.1.4), metalaxyl-M (C.1.5), ofurace (C.1.6), oxadixyl (C.1.7);
- nucleic acid synthesis inhibitors hymexazole (C.2.1 ), octhilinone (C.2.2), oxolinic acid (C.2.3), bupirimate (C.2.4), 5-fluorocytosine (C.2.5), 5-fluoro-2-(p-tolylmethoxy)pyrimidin- 4-amine (C.2.6), 5-fluoro-2-(4-fluorophenylmethoxy)pyrimidin-4-amine (C.2.7), 5-fluoro- 2-(4-chlorophenylmethoxy)pyrimidin-4 amine (C.2.8);
- tubulin inhibitors benomyl (D.1.1), carbendazim (D.1.2), fuberidazole (D1.3), thiabendazole (D.1.4), thiophanate-methyl (D.1.5), pyridachlometyl (D.1.6), /V-ethyl-2-[(3-ethynyl-8-methyl- 6-quinolyl)oxy]butanamide (D.1.8), /V-ethyl-2-[(3-ethynyl-8-methyl-6-quinolyl)oxy]-2- methylsulfanyl-acetamide (D.1.9), 2-[(3-ethynyl-8-methyl-6-quinolyl)oxy]-/V-(2- fluoroethyl)butanamide (D.1.10), 2-[(3-ethynyl-8-methyl-6-quinolyl)oxy]-/V-(2-fluoroethyl)-2- methoxy-acetamide (D.1.1 1)
- diethofencarb (D.2.1 ), ethaboxam (D.2.2), pencycuron (D.2.3), fluopicolide (D.2.4), zoxamide (D.2.5), metrafenone (D.2.6), pyriofenone (D.2.7),
- cyprodinil E.1.1
- mepanipyrim E.1.2
- pyrimethanil E.1.3
- fluoroimid F.1.1
- iprodione F.1.2
- procymidone F.1.3
- vinclozolin F.1.4
- fludioxonil F.1.5
- quinoxyfen F.2.1 ;
- edifenphos G.1.1
- iprobenfos G.1.2
- pyrazophos G.1.3
- isoprothiolane G.1.4
- dicloran G.2.1
- quintozene G.2.2
- tecnazene G.2.3
- tolclofos-methyl G.2.4
- biphenyl G.2.5
- chloroneb G.2.6
- etridiazole G.2.7
- zinc thiazole G.2.8
- dimethomorph G.3.1
- flumorph G.3.2
- mandipropamid G.3.3
- pyrimorph G.3.4
- benthiavalicarb G.3.5
- iprovalicarb G.3.6
- valifenalate G.3.7
- propamocarb (G.4.1 );
- oxathiapiprolin G.5.1
- fluoxapiprolin G.5.3
- 4-[1-[2- [3-(difluoromethyl)-5-methyl-pyrazol-1-yl]acetyl]-4-piperidyl]-/V-tetralin-1-yl-pyridine-2- carboxamide G.5.4
- 4-[1-[2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetyl]-4-piperidyl]-/ ⁇ A tetralin-1-yl-pyridine-2-carboxamide G.5.5
- 4-[1-[2-[3-(difluoromethyl)-5-(tri- fluoromethyl)pyrazol-1-yl]acetyl]-4-piperidyl]-/V-tetralin-1-yl-pyridine-2-carboxamide G.5.6
- organochlorine compounds anilazine (H.3.1 ), chlorothalonil (H.3.2), captafol (H.3.3), captan (H.3.4), folpet (H.3.5), dichlofluanid (H.3.6), dichlorophen (H.3.7), hexachlorobenzene (H.3.8), pentachlorphenole (H.3.9) and its salts, phthalide (H.3.10), tolylfluanid (H.3.1 1 );
- guanidine H.4.1
- dodine H.4.2
- dodine free base H.4.3
- guazatine H.4.4
- guazatine-acetate H.4.5
- iminoctadine H.4.6
- iminoctadine-triacetate H.4.7
- iminoctadine-tris(albesilate) H.4.8
- dithianon H.4.9
- 2,6-dimethyl-1 A/,5A L [1 ,4]di- thiino[2,3-c:5,6-c']dipyrrole-1 ,3,5,7(2A/,6A)-tetraone (H.4.10);
- - melanin synthesis inhibitors pyroquilon (1.2.1 ), tricyclazole (I.2.2), carpropamid (1.2.3), dicyclomet (I.2.4), fenoxanil (1.2.5);
- abscisic acid (M.1.1 ), amidochlor, ancymidol, 6-benzylaminopurine, brassinolide, butralin, chlormequat, chlormequat chloride, choline chloride, cyclanilide, daminozide, dikegulac, dimethipin, 2,6-dimethylpuridine, ethephon, flumetralin, flurprimidol, fluthiacet, forchlorfenuron, gibberellic acid, inabenfide, indole-3-acetic acid , maleic hydrazide, mefluidide, mepiquat, mepiquat chloride, naphthaleneacetic acid, /V-6-benzyl adenine, paclobutrazol, prohexadione, prohexadione-calcium, prohydrojasmon, thidiazuron, triapenthenol, tributyl phosphorotrithio
- Lipid biosynthesis inhibitors alloxydim, alloxydim-sodium, butroxydim, clethodim,
- clodinafop clodinafop-propargyl, cycloxydim, cyhalofop, cyhalofop-butyl, diclofop, diclofop- methyl, fenoxaprop, fenoxaprop-ethyl, fenoxaprop-P, fenoxaprop-P-ethyl, fluazifop, fluazifop- butyl, fluazifop-P, fluazifop-P-butyl, haloxyfop, haloxyfop-methyl, haloxyfop-P, haloxyfop-P- methyl, metamifop, pinoxaden, profoxydim, propaquizafop, quizalofop, quizalofop-ethyl, quizalofop-tefuryl, quizalofop-P, quizalofop-P-ethyl,
- N.2 ALS inhibitors amidosulfuron, azimsulfuron, bensulfuron, bensulfuron-methyl, chlorimuron, chlorimuron-ethyl, chlorsulfuron, cinosulfuron, cyclosulfamuron, ethametsulfuron, ethamet- sulfuron-methyl, ethoxysulfuron, flazasulfuron, flucetosulfuron, flupyrsulfuron, flupyrsulfuron- methyl-sodium, foramsulfuron, halosulfuron, halosulfuron-methyl, imazosulfuron, iodosulfu- ron, iodosulfuron-methyl-sodium, iofensulfuron, iofensulfuron-sodium, mesosulfuron, meta- zosulfuron, metsulfuron, metsulfuron-methyl, nic
- Photosynthesis inhibitors amicarbazone; chlorotriazine; ametryn, atrazine, chlohdazone, cyanazine, desmetryn, dimethametryn,hexazinone, metribuzin, prometon, prometryn, pro- pazine, simazine, simetryn, terbumeton, terbuthylazin, terbutryn, trietazin; chlorobromuron, chlorotoluron, chloroxuron, dimefuron, diuron, fluometuron, isoproturon, isouron, linuron, metamitron, methabenzthiazuron, metobenzuron, metoxuron, monolinuron, neburon, sidu- ron, tebuthiuron, thiadiazuron, desmedipham, karbutilat, phenmedipham, phenmedipham- ethyl, bromofenoxim
- N.4 protoporphyrinogen-IX oxidase inhibitors acifluorfen, acifluorfen-sodium, azafenidin, ben- carbazone, benzfendizone, bifenox, butafenacil, carfentrazone, carfentrazone-ethyl, chlor- methoxyfen, cinidon-ethyl, fluazolate, flufenpyr, flufenpyr-ethyl, flumiclorac, flumiclorac-pen- tyl, flumioxazin, fluoroglycofen, fluoroglycofen-ethyl, fluthiacet, fluthiacet-methyl, fomesafen, halosafen, lactofen, oxadiargyl, oxadiazon, oxyfluorfen, pentoxazone, profluazol, pyraclonil, pyraflufen, pyraflufen
- N.6 EPSP synthase inhibitors glyphosate, glyphosate-isopropylammonium, glyposate- potassium, glyphosate-trimesium (sulfosate);
- Glutamine synthase inhibitors bilanaphos (bialaphos), bilanaphos-sodium, glufosinate, glufosinate-P, glufosinate-ammonium;
- Mitosis inhibitors benfluralin, butralin, dinitramine, ethalfluralin, fluchloralin, oryzalin, pen- dimethalin, prodiamine, trifluralin; amiprophos, amiprophos-methyl, butamiphos; chlorthal, chlorthal-dimethyl, dithiopyr, thiazopyr, propyzamide, tebutam; carbetamide, chlorpropham, flamprop, flamprop-isopropyl, flamprop-methyl, flamprop-M-isopropyl, flamprop-M-methyl, propham;
- N.10 VLCFA inhibitors acetochlor, alachlor, butachlor, dimethachlor, dimethenamid, dimethen- amid-P, metazachlor, metolachlor, metolachlor-S, pethoxamid, pretilachlor, propachlor, prop- isochlor, thenylchlor, flufenacet, mefenacet, diphenamid, naproanilide, napropamide, napro- pamide-M, fentrazamide, anilofos, cafenstrole, fenoxasulfone, ipfencarbazone, piperophos, pyroxasulfone, isoxazoline compounds of the formulae 11.1 , II.2, II.3, 11.4, II.5, II.6, II.7, II.8 and II.9
- N.1 1 Cellulose biosynthesis inhibitors: chlorthiamid, dichlobenil, flupoxam, indaziflam, isoxaben, triaziflam, 1 -cyclohexyl-5-pentafluorphenyloxy-14-[1 ,2,4,6]thiatriazin-3-ylamine (175899-01 - 1 );
- N.12 Decoupler herbicides dinoseb, dinoterb, DNOC and its salts
- N.13 Auxinic herbicides 2,4-D and its salts and esters, clacyfos, 2,4-DB and its salts and
- esters aminocyclopyrachlor and its salts and esters, aminopyralid and its salts such as aminopyralid-dimethylammonium, aminopyralid-tris(2-hydroxypropyl)ammonium and its esters, benazolin, benazolin-ethyl, chloramben and its salts and esters, clomeprop, clopy- ralid and its salts and esters, dicamba and its salts and esters, dichlorprop and its salts and esters, dichlorprop-P and its salts and esters, fluroxypyr, fluroxypyr-butometyl, fluroxypyr- meptyl, halauxifen and its salts and esters (943832-60-8); MCPA and its salts and esters, MCPA-thioethyl, MCPB and its salts and esters, mecoprop and its salts and esters, meco- prop-P and its salts and esters, picloram and
- TBA (2,3,6) and its salts and esters, triclopyr and its salts and esters, 4-amino-3-chloro- 6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylic acid, florpyrauxifen- benzyl, florpyrauxifen;
- N.14 Auxin transport inhibitors diflufenzopyr, diflufenzopyr-sodium, naptalam, naptalam- sodium;
- Acetylcholine esterase (AChE) inhibitors aldicarb (0.1.1 ), alanycarb (0.1 .2), bendiocarb
- GABA-gated chloride channel antagonists endosulfan (0.2.1 ), chlordane (0.2.2), ethiprole (0.2.3), fipronil (0.2.4), flufiprole (0.2.5), pyrafluprole (0.2.6), pyriprole (0.2.7);
- Nicotinic acetylcholine receptor agonists (nAChR): acetamiprid (0.4.1 ), clothianidin (0.4.2), cycloxaprid (0.4.3), dinotefuran (0.4.4), imidacloprid (0.4.5), nitenpyram (0.4.6), thiacloprid (0.4.7), thiamethoxam (0.4.8), 4,5-dihydro-/V-nitro-1 -(2-oxiranylmethyl)-1 TT-imidazol ⁇ -amine (0.4.9), (2£)-1 -[(6-chloropyridin-3-yl)methyl]-/V : -nitro-2-pentylidene- hydrazinecarboximidamide (0.4.10), 1 -[(6-chloropyridin-3-yl)methyl]-7-methyl-8-nitro-5- propoxy-1 ,2,3,5,6,7-hexahydroimidazo[1 ,2-a]pyridine (0.4.1
- Chloride channel activators abamectin (0.6.1), emamectin benzoate (0.6.2), ivermectin (0.6.3), lepimectin (0.6.4), milbemectin (0.6.5);
- 0.8 miscellaneous non-specific (multi-site) inhibitors methyl bromide (0.8.1) and other alkyl halides, chloropicrin (0.8.2), sulfuryl fluoride (0.8.3), borax (0.8.4), tartar emetic (0.8.5);
- 0.9 Chordotonal organ TRPV channel modulators pymetrozine (0.9.1 ), pyrifluquinazon (0.9.2), flonicamid (0.9.3);
- Mite growth inhibitors clofentezine (0.10.1 ), hexythiazox (0.10.2), diflovidazin (0.10.3), etoxazole (0.10.4);
- 0.1 1 Microbial disruptors of insect midgut membranes Bacillus thuringiensis, Bacillus
- frane/ensis (0.1 1.1), Bacillus sphaericus (0.1 1.2), Bacillus thuringiensis subsp. aizawai (0.1 1.3), Bacillus thuringiensis subsp. kurstaki (0L 1.4), Bacillus thuringiensis subsp.
- Inhibitors of mitochondrial ATP synthase diafenthiuron (0.12.1 ), azocyclotin (0.12.2), cyhexatin (0.12.3), fenbutatin oxide (0.12.4), propargite (0.12.5), tetradifon (0.12.6);
- Nicotinic acetylcholine receptor (nAChR) channel blockers bensultap (0.14.1), cartap hydrochloride (0.14.2), thiocyclam (0.14.3), thiosultap sodium (0.14.4);
- Inhibitors of the chitin biosynthesis type 0 bistrifluron (0.15.1 ), chlorfluazuron (0.15.2), diflubenzuron (0.15.3), flucycloxuron (0.15.4), flufenoxuron (0.15.5), hexaflumuron
- Inhibitors of the chitin biosynthesis type 1 buprofezin (0.16.1);
- Ecdyson receptor agonists methoxyfenozide (0.18.1), tebufenozide (0.18.2),
- halofenozide (0.18.3), fufenozide (0.18.4), chromafenozide (0.18.5);
- Octopamin receptor agonists amitraz (0.19.1 );
- Mitochondrial complex I electron transport inhibitors fenazaquin (0.21.1), fenpyroximate (0.21.2), pyrimidifen (0.21.3), pyridaben (0.21.4), tebufenpyrad (0.21.5), tolfenpyrad (0.21.6), rotenone (0.21.7);
- Inhibitors of the of acetyl CoA carboxylase spirodiclofen (0.23.1 ), spiromesifen (0.23.2), spirotetramat (0.23.3), spiropidion (0.23.4);
- Mitochondrial complex IV electron transport inhibitors aluminium phosphide (0.24.1 ), calcium phosphide (0.24.2), phosphine (0.24.3), zinc phosphide (0.24.4), cyanide (0.24.5);
- Mitochondrial complex II electron transport inhibitors cyenopyrafen (0.25.1), cyflumetofen (0.25.2);
- insecticidal active compounds of unknown or uncertain mode of action afidopyropen (0.28.1 ), afoxolaner (0.28.2), azadirachtin (0.28.3), amidoflumet (0.28.4), benzoximate (0.28.5), broflanilide (0.28.6), bromopropylate (0.28.7), chinomethionat (0.28.8), cryolite (0.28.9), dicloromezotiaz (0.28.10), dicofol (0.28.11 ), flufenerim (0.28.12), flometoquin (0.28.13), fluensulfone (0.28.14), fluhexafon (0.28.15), fluopyram (0.28.16), fluralaner (0.28.17), metoxadiazone (0.28.18), piperonyl butoxide (0.28.19), pyflubumide (0.28.20), pyridalyl (0.28.21), tioxazaf
- the group of compounds I .A , I.B, I.C, I.D, I.E, I.F, I.G, I.H, I.J, I.K, I.L, I.M, I.N, and I.O as defined above in component 1) is herein collectively referred to as“compounds of the formula I” or“compounds I”.
- the invention also relates to a method for controlling phytopathogenic harmful fungi, comprising treating the fungi, their habitat or the seed, the soil or the plants to be protected against fungal attack with an effective amount of mixtures comprising compounds I and compounds II; to the use of mixtures comprising compounds I and compounds II for controlling phytopathogenic harmful fungi; to agrochemical compositions comprising these mixtures; and to agrochemical compositions comprising these mixtures and further comprising seed.
- mixtures of different active compounds are conventionally employed for controlling harmful fungi.
- active compounds having different mechanisms of action it is possible to ensure successful control over a relatively long period of time.
- compositions which, at a reduced total amount of active compounds applied, have improved activity against the harmful fungi (synergistic mixtures) and a broadened activity spectrum, in particular for certain indications.
- compositions comprising at least one compound I and at least one compound II.
- the term“mixture” in the context of the present invention shall mean a physical mixture of the components prior to application or the result of a simultaneous, i.e. joint or separate, application of a compound I and of a compound II on the fungi, their habitat or the seed, the soil or the plants to be protected against fungal attack.
- Compounds I and/or the compounds II can be present in different crystal modifications, which may differ in biological activity.
- the scope of the present invention includes mixtures of the (R)- and (S)-isomers and the racemates of compounds I and/or II and /or III having one or more chiral centers.
- atrope isomers of active compounds I and/or II and/or III may be present. They also form part of the subject matter of the invention.
- Agriculturally acceptable salts of the active compounds I, II and III encompass especially the salts of those cations or the acid addition salts of those acids whose cations and anions, respectively, have no adverse effect on the fungicidal action of the active compounds.
- Suitable cations are thus in particular the ions of the alkali metals, preferably sodium and potassium, of the alkaline earth metals, preferably calcium, magnesium and barium, of the transition metals, preferably manganese, copper, zinc and iron, and also the ammonium ion which, if desired, may carry 1 to 4 Ci-C 4 -alkyl substituents and/or one phenyl or benzyl substituent, preferably diisopropylammonium, tetramethylammonium, tetrabutylammonium, trimethylbenzylammonium, furthermore phosphonium ions, sulfonium ions, preferably tri(Ci-C4-alkyl)sulfonium, and
- Anions of useful acid addition salts are primarily chloride, bromide, fluoride, hydrogensulfate, sulfate, dihydrogenphosphate, hydrogen- phosphate, phosphate, nitrate, bicarbonate, carbonate, hexafluorosilicate, hexafluorophosphate, benzoate, and the anions of Ci-C4-alkanoic acids, preferably formate, acetate, propionate and butyrate. They can be formed by reacting a compound I with an acid of the corresponding anion, preferably of hydrochloric acid, hydrobromic acid, sulfuric acid, phosphoric acid or nitric acid.
- the active substances referred to as compounds II or III, their preparation and their activity e. g. against harmful fungi is known (cf.: http://www.alanwood.net/pesticides/); these substances are commercially available.
- the compounds described by IUPAC nomenclature, their preparation and their pesticidal activity are also known (cf. Can. J. Plant Sci. 48(6), 587-94, 1968;
- Compounds I.F and I.G can be prepared from ester of formula IV via treatment with amines V in a trimethylaluminium or lanthanum trifluoromethanesulfonate mediated direct amide bond formation as described in Org. Synth. 59, 49, 1979; Org. Lett. 16(7), 2018-2021 , 2014 and Chem. Commun. (Cambridge) (9), 1 100-1 102, 2008 in a suitable solvent (e.g. toluene or dichloromethane) at a temperature between 20°C and 140°C.
- a suitable solvent e.g. toluene or dichloromethane
- Compounds IV can be prepared by reacting amidoximes of formula VI with trifluoroacetic anhydride (TFAA) in an organic solvent, e.g. dichloromethane or THF, at temperatures between 0 °C and 100 °C, preferably at about 25 °C, as previously described in WO 2013/008162.
- TFAA trifluoroacetic anhydride
- Compounds VII can be accessed from the respective hydroxy compounds VIII with methyl 2- bromo acetate IX in an organic solvent and in the presence of a base (for precedents see for example Org. Lett. 18(18), 4570-4573, 2016; Bioorg. & Med Chem. 23(1 ), 132-140, 2015; and WO 2016/01 1019).
- a base for precedents see for example Org. Lett. 18(18), 4570-4573, 2016; Bioorg. & Med Chem. 23(1 ), 132-140, 2015; and WO 2016/01 1019.
- an polar aprotic solvent e.g. A/,A7dimethylformamide, tetrahydrofuran or acetonitrile
- an inorganic base are used, more preferably NN- dimethylformamide and potassium or caesium carbonate.
- the reaction is best performed at elevated temperatures, most preferably in the range between 60°C and 120°C.
- mixtures comprising as component 2) at least one active compound selected from inhibitors of complex III at Q 0 site in group A), more preferably selected from compounds (A.1.1 ), (A.1.4), (A.1.8), (A.1.9), (A.1.10), (A.1 .1 1 ), (A.1.12), (A.1 .13), (A.1.14),
- mixtures comprising as component 2) at least one active compound selected from inhibitors of complex III at Q, site in group A), more preferably selected from compounds (A.2.1 ), (A.2.3), (A.2.4), (A.2.5) and (A.2.6); particularly selected from (A.2.4) and (A.2.6).
- mixtures comprising as component 2) at least one active compound selected from inhibitors of complex II in group A), more preferably selected from compounds (A.3.2), (A.3.3), (A.3.4), (A.3.7), (A.3.9), (A.3.1 1 ), (A.3.12), (A.3.15), (A.3.16), (A.3.17), (A.3.18), (A.3.19), (A.3.20), (A.3.21 ), (A.3.22), (A.3.23), (A.3.24), (A.3.25), (A.3.26), (A.3.27), (A.3.28), (A.3.29), (A.3.31 ), (A.3.32), (A.3.33), (A.3.34), (A.3.35), (A.3.36), (A.3.37), (A.3.38) and
- (A.3.39) particularly selected from (A.3.2), (A.3.3), (A.3.4), (A.3.7), (A.3.9), (A.3.17), (A.3.24), (A.3.28), (A.3.29), (A.3.31 ), (A.3.32), (A.3.33), (A.3.34), (A.3.35), (A.3.36), (A.3.37), (A.3.38) and (A.3.39).
- mixtures comprising as component 2) at least one active compound selected from other respiration inhibitors in group A), more preferably selected from compounds (A.4.5) and (A.4.1 1 ).
- mixtures comprising as component 2) at least one active compound selected from C14 demethylase inhibitors in group B), more preferably selected from
- mixtures comprising as component 2) at least one active compound selected from Deltal 4-reductase inhibitors in group B), more preferably selected from compounds (B.2.4), (B.2.5), (B.2.6) and (B.2.8); in particular (B.2.4) and (B.2.6).
- mixtures comprising as component 2) at least one active compound selected from phenylamides and acyl amino acid fungicides in group C), more preferably selected from compounds (C.1.1 ), (C.1 .2), (C.1.4) and (C.1 .5).
- mixtures comprising as component 2) at least one active compound selected from other nucleic acid synthesis inhibitors in group C), more preferably selected from compounds (C.2.6),(C.2.7) and (C.2.8).
- mixtures comprising as component 2) at least one active compound selected from group D), more preferably selected from compounds (D.1 .1 ), (D.1.2), (D.1 .5), (D.2.4), (D.2.6) and (D.2.7); particularly selected from (D.2.6) and (D.2.7).
- mixtures comprising as component 2) at least one active compound selected from group E), more preferably selected from compounds (E.1.1 ), (E.1.3), (E.2.2) and (E.2.3); in particular (E.1.1 ).
- mixtures comprising as component 2) at least one active compound selected from group H), more preferably selected from compounds (H.1 .5), (H.1.7), (H.2.2), (H.2.3), (H.2.5), (H.2.7), (H.2.8), (H.3.2), (H.3.4), (H.3.5), (H.4.9) and (H.4.10); particularly selected from (H.1.5), (H.1 .7), (H.2.2), (H.3.2) and (H.3.5).
- active compound selected from group H more preferably selected from compounds (H.1 .5), (H.1.7), (H.2.2), (H.2.3), (H.2.5), (H.2.7), (H.2.8), (H.3.2), (H.3.4), (H.3.5), (H.4.9) and (H.4.10); particularly selected from (H.1.5), (H.1 .7), (H.2.2), (H.3.2) and (H.3.5).
- mixtures comprising as component 2) at least one active compound selected from group I), more preferably selected from compounds (1.2.2) and (1.2.5).
- mixtures comprising as component 2) at least one active compound selected from group J), more preferably selected from compounds (J.1.2), (J.1 .5), (J.1 .8), (J.1.1 1 ) and (J.1.12).
- mixtures comprising as component 2) at least one active compound selected from group K), more preferably selected from compounds (K.1.3), (K.1 .29), (K.1.30), (K.1.31 ), (K.1.32), (K.1.41 ), (K.1 .42), (K.1.44), (K.1 .45), (K.1.47), (K.1.49) and (K.1.54);
- binary mixtures A-1 to A-739 listed in Table A, wherein compounds I (component 1 , a group represented by the expression“(I)” consisting of compounds I .A , I.B, I.C, I.D, I.E, I.F, I.G, I.H, I.J, I.K, I.L, I.M, I.N and I.O) and one pesticide II selected from the groups A) to O) as defined herein (component 2, for example, (A.1 .1 ) or azoxystrobin, in mixture A-1 ).
- compounds I component 1 , a group represented by the expression“(I)” consisting of compounds I .A , I.B, I.C, I.D, I.E, I.F, I.G, I.H, I.J, I.K, I.L, I.M, I.N and I.O
- component 2 for example, (A.1 .1 ) or azoxystrobin, in mixture A
- A-1 (I) + (A.1 .1 ), A-2: (I) + (A.1 .2), A-3: (I) + (A.1.3), A-4: (I) + (A.1 .4), A-5: (I) + (A.1.5), A-6: (I) + (A.1 .6), A-7: (I) + (A.1 .7), A-8: (I) + (A.1 .8), A-9: (I) + (A.1 .9), A-10: (I) + (A.1 .10), A-1 1 : (I) + (A.1 .1 1 ), A-12: (I) + (A.1 .12), A-13: (I) + (A.1 .13), A-14: (I) + (A.1 .14), A-15: (I) + (A.1 .15), A-16: (I) + (A.1 .16), A-17: (I) + (A.1 .17),
- A-501 (I) + (0.4.1 ), A-502: (I) + (0.4.2), A-503: (I) + (0.4.3), A-504: (I) + (0.4.4), A- 505: (I) + (0.4.5), A-506: (I) + (0.4.6), A-507: (I) + (0.4.7), A-508: (I) + (0.4.8), A-509: (I) + (0.4.9), A-510: (I) + (0.4.10), A-51 1 : (I) + (0.4.1 1 ), A-512: (I) + (0.4.12), A-513: (I) + (0.4.13), A-514: (I) + (0.4.14), A-515: (I) + (0.4.15), A-516: (I) + (0.4.16), A-517: (I) + (0.4.17), A-518: (I) + (0.4.18), A-519: (I) + (0.4.19), A-520: (I
- A-603 (I) + (0.23.2), A-604: (I) + (0.23.3), A-605: (I) + (0.24.1 ), A-606: (I) + (0.24.2), A-607 : (I) + (0.24.3), A-608: (I) + (0.24.4), A-609: (I) + (0.24.5), A-610: (I) + (0.25.1 ), A-61 1 : (I) + (0.25.2), A-612: (I) + (0.26.1 ), A-613: (I) + (0.26.2), A-614: (I) + (0.26.3), A-615: (I) +
- A-616 (I) + (0.26.5), A-617: (I) + (0.26.6), A-618: (I) + (0.26.7), A-619: (I) + (0.26.8), A-620: (I) + (0.26.9), A-621 : (I) + (0.26.10), A-622: (I) + (0.26.1 1 ), A-623: (I) + (0.26.12), A- 624: (I) + (0.26.13), A-625: (I) + (0.26.14), A-626: (I) + (0.26.15), A-627: (I) + (0.26.16), A-628: (I) + (0.26.17), A-629: (I) + (0.26.18), A-630: (I) + (0.27.1 ), A-631 : (I) + (0.27.2), A-632: (I) + (0.27.3), A-633: (I) + (0.27.4), A-634: (I) + (0.27.5), A-6
- A-730 (I) + (A.1 .21 a), A-731 : (I) + (K.1.46), A-732: (I) + (K.1.48), A-733: (I) +
- the weight ratio of component 1 ) to component 2) in mixtures A-1 to A-739 of Table A is between 100:1 and 1 :100, preferably between 50:1 and 1 :50, more preferably between 20:1 and 1 :20, particularly between 5:1 and 1 :5; for example 3:1 , 2:1 , 1 .5:1 , 1 :1 , 1 :1.5, 1 :2 or 1 :3.
- the weight ratio of component 1 ) to component 2) is between 100:1 and 1 :100 in mixtures A- 1 to A-739 of Table A.
- the weight ratio of component 1 ) to component 2) is between 50:1 and 1 :50 in mixtures A-1 to A-739 of Table A.
- the weight ratio of component 1 ) to component 2) is between 20:1 and 1 :20 in mixtures A-1 to A-739 of Table A.
- the weight ratio of component 1 ) to component 2) is between 5:1 and 1 :5 in mixtures A-1 to A-739 of Table A.
- the weight ratio of component 1 ) to component 2) is between 3:1 and 1 :3 in mixtures A-1 to A-739 of Table A.
- the weight ratio of component 1) to component 2) is between 2:1 and 1:2 in mixtures A-1 to A-739 of Table A.
- the weight ratio of component 1) to component 2) is between 1.5:1 and 1 :1.5 in mixtures A-1 to A-739 of Table A.
- the weight ratio of component 1) to component 2) is 1:1 in mixtures A-1 to A-739 of Table A.
- the mixtures A-1 to A-739 of Table A and in particular when the weight ratios of component 1) to component 2) are as disclosed for these mixtures as herein before mentioned, are used against Phakopsora pachyrhizi and P. meibomiae on soybeans and/or against Puccinia triticina, P. striiformis, P. hordei, P. graminis or P. recondita on wheat, barley or rye; P. coronata e.g. on oats, P. sorghi und P. poly so ra on corn; Puccinia spp. on other crops, e.g. P. heiiathion sunflower, P. arachidis on peanuts; Uromyces spp. on pulses and other crops crops, e.g. Uromyces viciae-fabae, Uromyces vigniae, Uromyces pisi, U.
- binary mixtures listed in Table B1 to Table B14 for example mixtures B1-1 to B1-161 in table B1, wherein component 1) is compound I. A, and wherein component 2) is selected from compounds II of groups A) to O), as defined herein.
- B1-1 I.A + (A.1.1), B1-2: I.A + (A.1.4), B1-3: I.A+ (A.1.8), B1-4: I.A + (A.1.9), B1-5: I.A + (A.1.10), B1-6: I.A + (A.1.11), B1-7: I.A + (A.1.12), B1-8: I.A + (A.1.13), B1-9: I.A + (A.1.14), B1- 10: I.A + (A.1.17), B1-11: I.A + (A.1.21), B1-12: I.A + (A.121a), B1-13: I.A + (A.1.24), B1-14: I.A + (A.1.25), B1-15: I.A + (A.1.26), B1-16: I.A + (A.1.27), B1-17: I.A + (A.1.30), B1-18: I.A + (A.1.31), B1-19: I.A + (A
- B1-45 I.A + (A.3.26)
- B1-46 I.A + (A.3.27)
- B1-47 I.A + (A.3.28)
- B1-48 I.A +
- B1-49 I.A + (A.3.31)
- B1-50 I.A + (A.3.32)
- B1-51 I.A + (A.3.33)
- B1-52 I.A +
- B1-53 I.A + (A.3.35)
- B1-54 I.A + (A.3.36)
- B1-55 I.A + (A.3.37)
- B1-56 I.A +
- B1-57 I.A + (A.3.39)
- B1-58 I.A+ (A.4.5)
- B1-59 I.A + (A.4.11)
- B1-60 I.A+ (B.1.4)
- B1-61 I.A+ (B.1.5)
- B1-62 I.A + (B.1.8.)
- B1-63 I.A + (B.1.10)
- B1-64 I.A + (B.1.11)
- B1-65 I.A + (B.1.12)
- B1-66 I.A + (B.1.13)
- B1-67 I.A + (B.1.17)
- B1-69 I.A + (B.1.21)
- B1-70 I.A + (B.1.22)
- B1-71 I.A + (B.1.23)
- B1-72 I.A + (B.1.25)
- B1-73 I.A +
- B.1.26 B1-74: I.A + (B.1.29)
- B1-75 I.A + (B.1.33)
- B1-76 I.A + (B.1.34)
- B1-77 I.A +
- B1-113 I.A + (G.5.6), B1-114: I.A + (G.5.7), B1-115: I.A + (G.5.8), B1-116: I.A +
- the weight ratio of compound I.A to component 2) in mixtures B1-1 to B1- 161 of Table B1 is between 100:1 and 1:100, preferably between 50:1 and 1:50, more preferably between 20:1 and 1 :20, particularly between 5:1 and 1 :5; for example 3:1 , 1:1 or 1 :3.
- Table B2 Mixtures B2-1 to B2-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.B.
- Table B3 Mixtures B3-1 to B3-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.C.
- Table B4 Mixtures B4-1 to B4-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.D.
- Table B5 Mixtures B5-1 to B5-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.E.
- Table B6 Mixtures B6-1 to B6-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.F.
- Table B7 Mixtures B7-1 to B7-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.G.
- Table B8 Mixtures B8-1 to B8-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.H.
- Table B9 Mixtures B9-1 to B9-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.J.
- Table B10 Mixtures B10-1 to B10-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.K.
- Table B11 Mixtures B11-1 to B11-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.L.
- Table B12 Mixtures B12-1 to B12-161 are defined as mixtures B1-1 to B1-161 of Table B1 , wherein compound I .A in each mixture is replaced with compound I.M.
- Mixtures B13-1 to B13-161 are defined as mixtures B1-1 to B1-161 of Table B1 , wherein compound I .A in each mixture is replaced with compound I.N.
- Table B14 Mixtures B14-1 to B14-161 are defined as mixtures B1-1 to B1-161 of Table B1 , wherein compound I. A in each mixture is replaced with compound I.O.
- the weight ratio of component 1 ) to component 2) is between 100:1 and 1 :100 in mixtures as defined in Tables B1 to B14.
- the weight ratio of component 1 ) to component 2) is between 50:1 and 1 :50 in mixtures as defined in Tables B1 to B14.
- the weight ratio of component 1 ) to component 2) is between 20:1 and 1 :20 in mixtures as defined in Tables B1 to B14.
- the weight ratio of component 1 ) to component 2) is between 5:1 and 1 :5 in mixtures as defined in Tables B1 to B14.
- the weight ratio of component 1 ) to component 2) is between 3:1 and 1 :3 in mixtures as defined in Tables B1 to B14.
- the weight ratio of component 1 ) to component 2) is between 2:1 and 1 :2 in mixtures as defined in Tables B1 to B14.
- the weight ratio of component 1 ) to component 2) is between 1.5:1 and 1 :1.5 in mixtures as defined in Tables B1 to B14.
- the weight ratio of component 1 ) to component 2) is 1 :1 in mixtures as defined in Tables B1 to B14.
- the mixtures as defined inTables B1 to B14 and in particular when the weight ratios of compound I to component 2) are as disclosed for these mixtures as herein before mentioned, are used against Phakopsora pachyrhizi and P. meibomiae on soybeans and/or against Puccinia triticina, P. striiformis, P. hordei, P. graminis or P. recondita on wheat, barley or rye; P. coronata e.g. on oats, P. sorghi und P. poly so ra on corn; Puccinia spp. on other crops, e.g. P. heiiathion sunflower, P.
- arachidis on peanuts Uromyces spp. on pulses and other crops crops, e.g. Uromyces viciae-fabae, Uromyces vigniae, Uromyces pisi, U. ciceris-arietini, U. betae syn U. beticoia.
- E.1 to E.560 listed in Table B15 relate to binary mixtures as defined in Tables B1 to B14 in particular weight ratios of component 1) to component 2).
- a preferred embodiment relates to the use of the mixtures according to embodiments E.1 to E.560 of Table B15 against Phakopsora pachyrhizi and P. meibomiae on soybeans and/or against Puccinia triticina, P. striiformis, P. hordei, P. gra minis ox P. recon dita on wheat, barley or rye; P. coronata e.g. on oats, P. sorghi und P. poiysora on corn; Puccinia spp. on other crops, e.g. P. he! iathi on sunflower, P. arachidis on peanuts; Uromyces spp.
- the binary mixtures above comprise besides at least one compound I and at least one compound II as component 3) at least one further active compound III, resulting in a ternary mixture.
- the components 1 ) and 2), or, all three components 1), 2) and 3), in these mixtures are present in a synergistically effective amount.
- one embodiment relates to ternary mixtures comprising, as active components
- component 2) at least one active compound II selected from groups A) to O) as defined for component 2) in binary mixtures above, or an N-oxide, or an agriculturally useful salt thereof;
- the at least one active compound III of component 3 is not identical with the at least one active compound II of component 2).
- the invention also relates to a method for controlling phytopathogenic harmful fungi, comprising treating the fungi, their habitat or the seed, the soil or the plants to be protected against fungal attack with an effective amount of the above mentioned ternary mixtures comprising compounds I, compounds II and compounds III; to the use of these ternary mixtures for controlling phytopathogenic harmful fungi; to agrochemical compositions comprising these ternary mixtures; and to agrochemical compositions comprising these ternary mixtures and further comprising seed.
- the ternary mixtures comprise as compounds III fungicidal compounds that are independently of each other selected from the groups A), B), C), D), E), F), G), H), I), J), K) and O) ; and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
- ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from inhibitors of complex III at Q o site in group A), more preferably selected from compounds (A.1.1), (A.1.4), (A.1.8),
- ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from inhibitors of complex III at Qi site in group A), more preferably selected from compounds (A.2.1), (A.2.3), (A.2.4), (A.2.5) and (A.2.6); particularly selected from (A.2.4) and (A.2.6); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
- ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from other respiration inhibitors in group A), more preferably selected from compounds (A.4.5) and (A.4.1 1); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
- ternary mixtures based on binary mixtures disclosed herein comprising as component 3) at least one active compound selected from C14 demethylase inhibitors in group B), more preferably selected from compounds (B.1.4), (B.1.5), (B.1.8), (B.1.10), (B.1.1 1 ), (B.1.12), (B.1.13), (B.1.17), (B.1.18), (B.1.21 ), (B.1.22), (B.1.23), (B.1.25), (B.1.26), (B.1.29), (B.1.33), (B.1.34), (B.1.37), (B.1.38), (B.1.43) and (B.1.46); particularly selected from (B.1.4), (B.1.5), (B.1.8), (B.1.17), (B.1.22), (B.1.23), (B.1.25), (B.1.29), and (B.1.38); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound selected from C14
- ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from Deltal 4-reductase inhibitors in group B), more preferably selected from compounds (B.2.4), (B.2.5), (B.2.6) and (B.2.8); in particular (B.2.4) and (B.2.6); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
- ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from phenylamides and acyl amino acid fungicides in group C), more preferably selected from compounds (C.1.1),
- ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from other nucleic acid synthesis inhibitors in group C), more preferably selected from compounds (C.2.6),(C.2.7) and (C.2.8); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
- ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from group D), more preferably selected from compounds (D.1.1 ), (D.1.2), (D.1.5), (D.2.4), (D.2.6) and (D.2.7); particularly selected from (D.2.6) and (D.2.7); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
- ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from group E), more preferably selected from compounds (E.1.1), (E.1.3), (E.2.2) and (E.2.3); in particular (E.1.1); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
- ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from group F), more preferably selected from compounds (F.1.2), (F.1.4) and (F.1.5); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
- ternary mixtures based on binary mixtures disclosed herein comprising as component 3) at least one active compound selected from group G), more preferably selected from compounds (G.3.1), (G.3.3), (G.3.6), (G.5.1), (G.5.2), (G.5.3), (G.5.4), (G.5.5), (G.5.6), G.5.7), (G.5.8), (G.5.9), (G.5.10) and (G.5.1 1); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
- ternary mixtures based on binary mixtures disclosed herein comprising as component 3) at least one active compound selected from group H), more preferably selected from compounds (H.1.5), (H.1.7), (H.2.2), (H.2.3), (H.2.5), (H.2.7), (H.2.8), (H.3.2), (H.3.4), (H.3.5), (H.4.9) and (H.4.10); particularly selected from (H.1.5), (H.1.7), (H.2.2), (H.3.2) and (H.3.5); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
- ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from group I), more preferably selected from compounds (1.2.2) and (1.2.5); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
- ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from group J), more preferably selected from compounds (J.1.2), (J.1.5), (J.1.8), (J.1.11 ) and (J.1.12); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
- ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from group K), more preferably selected from compounds (K.1.3), (K.1.29), (K.1.30), (K.1.31 ), (K.1.32), (K.1.41),
- the present invention relates furthermore to the mixtures as defined in Tables C1 to C14 comprising as component 1) one of the compounds I.A, I.B, I.C, I.D, I.E, I.F, I.G, I.H, I.J, I.K, I.L, I.M, I.N or 1.0 as defined above, and as component 2) one of the compounds II as defined and numbered above from groups A) to K), and as component 3) a compound III from groups A) to K) as defined herein.
- the compositions comprise the active substances in synergistically effective amounts.
- Table C1 Ternary mixtures C1-1 to C1-6865 comprising compound I. A as defined herein as component 1) and one compound II as defined above as component 2) and one compound III as defined above as component 3).
- the components 1), 2) and 3) are written down in this order (comp.1 )+comp.2)+comp.3)), so that one mixture, for example mixture C1 -1 , comprises as component 1) compound I .A, as component 2) compound (A.1.4) and as component 3) compound (A.1.1).
- C1-1 I.A+ (A.1.4) + (A.1.1), C1-2: I.A + (A.1.8) + (A.1.1), C1-3: I.A + (A.1.9) + (A.1.1), C1-4: LA + (A.1.10) + (A.1.1), C1-5: LA + (A.1.11) + (A.1.1), C1-6: LA + (A.1.12) + (A.1.1), C1-7: I.A + (A.1.13) + (A.1.1), C1-8: LA + (A.1.14) + (A.1.1), C1-9: LA + (A.1.17) + (A.1.1), C1-10: I.A + (A.1.21) + (A.1.1), C1-11: I.A + (A.121a) + (A.1.1), C1-12: LA + (A.1.24) + (A.1.1), C1-13: I.A + (A.1.25) + (A.1.1), C1-14: LA + (A.1.26) + (A.1.1), C1-15: LA
- C1-329 LA + (A.3.16) + (A.1.9)
- C1-330 LA + (A.3.17) + (A.1.9)
- C1-331 LA + (A.3.18) + (A.1.9)
- C 1-332 I.A+ (A.3.19) + (A.1.9)
- C1-333 I.A+ (A.3.20) + (A.1.9)
- C1-334 I.A+ (A.3.21) + (A.1.9) + (A.1.9) + (A.1.9)
- C1-335 I.A+ (A.3.22) + (A.1.9)
- C1-336 I.A+ (A.3.23) + (A.1.9)
- C1-340 I.A + (A.3.27) + (A.1.9)
- C1-341 I.A
- C 1-384 LA + (C.2.7) + (A.1.9)
- C1-385 I.A + (C.2.8) + (A.1.9)
- C1-386 LA + (D.1.1) + (A.1.9)
- C1-390 LA + (D.2.6) + (A.1.9)
- C1-391 I.A + (D.2.7) + (A.1.9)
- C1-392 LA + (E.1.1) + (A.1.9)
- C 1-402 LA + (G.5.1) + (A.1.9), C1-403: I.A+ (G.5.2) + (A.1.9), C1-404: I.A+ (G.5.3) + (A.1.9),
- C1-405 LA + (G.5.4) + (A.1.9)
- C1-406 LA + (G.5.5) + (A.1.9)
- C1-407 LA + (G.5.6) + (A.1.9)
- C1-408 LA + (G.5.7) + (A.1.9)
- C1-409 I.A+ (G.5.8) + (A.1.9)
- C1-410 I.A+ (G.5.9) + (A.1.9)
- C1-411 LA + (G.5.10) + (A.1.9)
- C1-412 LA + (G.5.11) + (A.1.9)
- C1-413 I.A + (H.1.5) + (A.1.9)
- C1-414 I.A + (H.1.7) + (A.1.9)
- C1-415 I.A + (H.2.2) + (A.1.9)
- C1-416 LA + (H.2.3) +
- C1-490 I.A+ (A.3.32) + (A.1.10)
- C1-491 I.A+ (A.3.33) + (A.1.10)
- C1-492 I.A+ (A.3.34) +
- C1-515 I.A+ (B.1.33) + (A.1.10)
- C1-516 I.A+ (B.1.34) + (A.1.10)
- C1-517 I.A+ (B.1.37) +
- C 1-529 I.A + (C.2.6) + (A.1.10), C1-530: I.A+ (C.2.7) + (A.1.10), C1-531: I.A+ (C.2.8) + (A.1.10), C1-532: I.A + (D.1.1) + (A.1.10), C1-533: I.A + (D.1.2) + (A.1.10), C1-534: I.A+ (D.1.5) + (A.1.10), C1-535: I.A+ (D.2.4) + (A.1.10), C1-536: I.A+ (D.2.6) + (A.1.10), C1-537: I.A + (D.2.7) + (A.1.10), C1-538: I.A+ (E.1.1) + (A.1.10), C1-539: I.A + (E.1.3) + (A.1.10), C1-540: I.A + (E.2.2) + (A.1.10), C1-5
- C 1-560 I.A + (H.1.7) + (A.1.10), C1-561: I.A+ (H.2.2) + (A.1.10), C1-562: I.A+ (H.2.3) + (A.1.10), C1-563: I.A + (H.2.5) + (A.1.10), C1-564: I.A + (H.2.7) + (A.1.10), C1-565: I.A+ (H.2.8) + (A.1.10), C 1-566: I.A+ (H.3.2) + (A.1.10), C1-567: I.A+ (H.3.4) + (A.1.10), C1-568: I.A + (H.3.5) + (A.1.10), C 1-569: I.A+ (H.4.9) + (A.1.10), C1-570: I.A + (H.4.10) + (A.1.10), C1-571: I.A + (1.2.2) + (A.1.10), C1-572
- C 1-802 I.A + (B.1.26) + (A.1.13)
- C1-803 I.A + (B.1.29) + (A.1.13)
- C1-804 I.A + (B.1.33) + (A.1.13)
- C1-805 LA + (B.1.34) + (A.1.13)
- C1-806 LA + (B.1.37) + (A.1.13)
- C1-807 I.A +
- C 1-892 LA + (A.1.34) + (A.1.14), C1-893: LA + (A.1.35) + (A.1.14), C1-894: LA + (A.2.1) + (A.1.14), C1-895: I.A + (A.2.3) + (A.1.14), C1-896: I.A+ (A.2.4) + (A.1.14), C1-897: I.A + (A.2.5) + (A.1.14), C1-898: I.A+ (A.2.6) + (A.1.14), C1-899: I.A + (A.3.2) + (A.1.14), C1-900: I.A + (A.3.3) + (A.1.14), C1-901 : I.A + (A.3.4) + (A.1.14), C1-902: I.A + (A.3.7) + (A.1.14), C1-903: I.A + (A.3.9) + (A.1.14), C1-904: LA + (
- C1-1656 I. A + (D.2.4) + (A.2.6)
- C1-1657 I.A + (D.2.7) + (A.2.6)
- C1-1658 I.A+ (E.1.1) + (A.2.6)
- C1-1659 I.A + (E.1.3) + (A.2.6)
- C1-1660 I.A + (E.2.2) + (A.2.6)
- C1-1661 I.A+ (E.2.3) + (A.2.6)
- C1-1662 I.A+ (F.1.2) + (A.2.6)
- C1-1663 I.A+ (F.1.4) + (A.2.6)
- C1- 1666 I.A + (G.3.3) + (A.2.6) + (A.2.6) + (A.2.6), C1-1667: I.A + (G.
- C 1-4227 LA + (G.5.10) + (B.1.5), C1-4228: I.A+ (G.5.11) + (B.1.5), C1-4229: LA + (H.1.5) + (B.1.5), C1-4230: I.A + (H.1.7) + (B.1.5), C1-4231: I.A+ (H.2.2) + (B.1.5), C1-4232: I.A+ (H.2.3) + (B.1.5), C1-4233: I.A+ (H.2.5) + (B.1.5), C1-4234: I.A+ (H.2.7) + (B.1.5), C1-4235: I.A + (H.2.8) + (B.1.5), C1-4236: I.A+ (H.3.2) + (B.1.5), C1-4237: I.A+ (H.3.4) + (B.1.5), C1-4238: I.A + (H.3.5) + (B.1.5), C1-4239: I.A+ (H.4.9) + (B.1.5), C1-4240
- Table C2 Mixtures C2-1 to C2-6865 are defined as mixtures C1-1 to C1-6865 of Table C1, wherein compound I.A in each mixture is replaced with compound I.B.
- Table C3 Mixtures C3-1 to C3-6865 are defined as mixtures C1-1 to C1-6865 of Table C1, wherein compound I.A in each mixture is replaced with compound I.C.
- Table C4 Mixtures C4-1 to C4-6865 are defined as mixtures C1-1 to C1-6865 of Table C1, wherein compound I.A in each mixture is replaced with compound I.D.
- Table C5 Mixtures C5-1 to C5-6865 are defined as mixtures C1-1 to C1-6865 of Table C1, wherein compound I.A in each mixture is replaced with compound I.E.
- Table C6 Mixtures C6-1 to C6-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I. A in each mixture is replaced with compound I.F.
- Table C7 Mixtures C7-1 to C7-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I. A in each mixture is replaced with compound I.G.
- Table C8 Mixtures C8-1 to C8-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I .A in each mixture is replaced with compound I.H.
- Mixtures C9-1 to C9-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I .A in each mixture is replaced with compound I.J.
- Mixtures C10-1 to C10-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I .A in each mixture is replaced with compound I.K.
- Table C11 Mixtures C11-1 to C11-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I .A in each mixture is replaced with compound I.L.
- Table C12 Mixtures C12-1 to C12-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I .A in each mixture is replaced with compound I.M.
- Table C13 Mixtures C13-1 to C13-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I .A in each mixture is replaced with compound I.N.
- Table C14 Mixtures C14-1 to C14-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I. A in each mixture is replaced with compound I.O.
- the weight ratio of compound I to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound III, is between 100:1 and 1 :100 in mixtures C1- 1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound III, is between 50:1 and 1 :50 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound III, is between 20:1 and 1 :20 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound III, is between 5:1 and 1 :5 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound III is, for example, 3:1 , 1 :1 or 1 :3 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound III, is between 100:1 and 1 :100 in mixtures C1- 1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound III, is between 50:1 and 1 :50 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound III, is between 20:1 and 1 :20 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound III, is between 5:1 and 1 :5 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound III is, for example, 3:1 , 1 :1 or 1 :3 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III, is between 100:1 and 1 :100 in mixtures C1- 1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III, is between 50:1 and 1 :50 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III, is between 20:1 and 1 :20 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III, is between 5:1 and 1 :5 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III is, for example, 3:1 , 1 :1 or 1 :3 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III, is between 50:1 and 1 :50 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III, is between 20:1 and 1 :20 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III, is between 5:1 and 1 :5 in mixtures C1-1 to C1- 6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III is, for example, 3:1 , 1 :1 or 1 :3 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5- 6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to CI O- 6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is 3:1 ; and the weight ratio of compound I to compound III is 3:1 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3- 6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8- 6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is 3:1 ; and the weight ratio of compound I to compound III is 1 :1 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3- 6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8- 6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is 3:1 ; and the weight ratio of compound I to compound III is 1 :3 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3- 6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8- 6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III is 3:1 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3- 6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8- 6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III is 1 :1 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C11-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III is 1 :3 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3- 6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8- 6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is 1 :3; and the weight ratio of compound I to compound III is 3:1 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3- 6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8- 6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is 1 :3; and the weight ratio of compound I to compound III is 1 :1 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3- 6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8- 6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- the weight ratio of compound I to compound II is 1 :3; and the weight ratio of compound I to compound III is 1 :3 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3- 6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8- 6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
- Puccinia triticina P. striiformis, P. hordei, P. graminis or P. recondita on wheat, barley or rye
- P. coronata e.g. on oats, P. sorghi und P. polysora on corn
- Puccinia spp. on other crops, e.g. P. heiiathion sunflower, P. arachidis on peanuts
- component 1 one of the compounds I .A, I.B, I.C, I.D, I.E, I.F, I.G, I.H, I.J, I.K, I.L, I.M, I.N, or I.O as defined above, and as component 2) one of the compounds II as defined and numbered above, and as component 3) a compound III from groups A) to K) as defined herein.
- component 1 one of the compounds I .A, I.B, I.C, I.D, I.E, I.F, I.G, I.H, I.J, I.K, I.L, I.M, I.N, or I.O as defined above
- component 2 one of the compounds II as defined and numbered above, and as component 3) a compound III from groups A) to K) as defined herein.
- component 2 one of the compounds I .A, I.B, I.C, I.D, I.E, I.F, I.G, I.H, I.J,
- compositions comprise the active substances in synergistically effective amounts.
- the components 1 ), 2) and 3) are written down in this order (comp.
- mixture D1 -1 comprises as
- component 1 compound I .A, as component 2) compound (A.1 .1 ) and as component 3) compound (B.2.4).
- D-1 I.A + (B.1.38) + (B.2.4), D-2: I.A + (B.1.38) + (A.1.25), D-3: I.A + (B.1.38) + (A.1.14), D-4: I.A + (B.1 .38) + (A.3.9), D-5: I.A + (B.1.38) + (B.1 .23), D-6: I.A + (B.1.38) + (A.1.1), D-7: I.A + (B.1 .38) + (A.1 .34), D-8: I.A + (B.1.38) + (D.2.6), D-9: I.A + (B.1.38) + (H.2.2), D-10: I.A + (B.1 .38) + (H.1 .5), D-1 1 : I.A + (A.3.9) + (A.1 .14), D-12: I.
- D-161 I.E + (A.1.25) + (H.2.2)
- D-162 I.E + (A.1.25) + (H.1.5)
- D-163 I.E +
- the weight ratio of compound to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound I , is between 100:1 and 1 :100 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound I , is between 50:1 and 1 :50 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound I , is between 20:1 and 1 :20 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound I , is between 5:1 and 1 :5 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound I is, for example, 3:1 , 1 :1 or 1 :3 in mixtures D- 1 to D-476 of Table D.
- the weight ratio of compound to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound I , is between 100:1 and 1 :100 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound I , is between 50:1 and 1 :50 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound I , is between 20:1 and 1 :20 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound I , is between 5:1 and 1 :5 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound I is 3:1 in mixtures D-1 to D-476 of Table D. In one embodiment the weight ratio of compound to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound I is 1 :1 in mixtures D-1 to D-476 of Table D. In one embodiment the weight ratio of compound to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound I is 1 :3 in mixtures D-1 to D-476 of Table D. In one embodiment the weight ratio of compound to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound I , is between 100:1 and 1 :100 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound I , is between 50:1 and 1 :50 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound I , is between 20:1 and 1 :20 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III, is between 5:1 and 1 :5 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III is 3:1 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound III is 1 :1 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound III is 1 :3 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III, is between 50:1 and 1 :50 in mixtures D-1 to D- 476 of Table D.
- the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III, is between 20:1 and 1 :20 in mixtures D-1 to D- 476 of Table D.
- the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III, is between 2:1 and 1 :10 in mixtures D-1 to D- 476 of Table D.
- the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III, is between 5:1 and 1 :5 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III, is between 2:1 and 1 :5 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 2:1 and 1 :2; and the weight ratio of compound I to compound III, is between 2:1 and 1 :20 in mixtures D-1 to D- 476 of Table D.
- the weight ratio of compound I to compound II is between 2:1 and 1 :2; and the weight ratio of compound I to compound III, is between 2:1 and 1 :10 in mixtures D-1 to D- 476 of Table D.
- the weight ratio of compound I to compound II is between 2:1 and 1 :2; and the weight ratio of compound I to compound III, is between 2:1 and 1 :5 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 2:1 and 1 :2; and the weight ratio of compound I to compound III, is between 1 :1 and 1 :5 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III, is between 2:1 and 1 :5 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III, is between 1 :1 and 1 :5 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III is 3:1 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III is 1 :1 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III is 1 :3 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III is 3:1 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III is 1 :1 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III is 1 :3 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 2:1 and 1 :2; and the weight ratio of compound I to compound III is 3:1 to 1 :3 in mixtures D-1 to D-476 of Table D. In one embodiment the weight ratio of compound I to compound II is between 2:1 and 1 :2; and the weight ratio of compound I to compound III is 2:1 to 1 :2 in mixtures D-1 to D-476 of Table D. In one embodiment the weight ratio of compound I to compound II is between 2:1 and 1 :2; and the weight ratio of compound I to compound III is 1.5:1 to 1 :1.5 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 2:1 and 1 :2; and the weight ratio of compound I to compound III is 1 :1 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 1.5:1 and 1 :1.5; and the weight ratio of compound I to compound III is 3:1 to 1 :3 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 1.5:1 and 1 :1.5; and the weight ratio of compound I to compound III is 2:1 to 1 :2 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 1.5:1 and 1 :1.5; and the weight ratio of compound I to compound III is 1.5:1 to 1 :1.5 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is between 1.5:1 and 1 :1.5; and the weight ratio of compound I to compound III is 1 :1 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is 3:1 ; and the weight ratio of compound I to compound III is 3:1 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is 3:1 ; and the weight ratio of compound I to compound III is 1 :1 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is 3:1 ; and the weight ratio of compound I to compound III is 1 :3 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III is 3:1 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III is 1 :1 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III is 1 :3 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III is 1 :11 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III is 1 :4 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is 4:3; and the weight ratio of compound I to compound III is 4:33 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is 4:3; and the weight ratio of compound I to compound III is 4:33 in mixtures D-1 to D-476 of Table D.
- the weight ratio of compound I to compound II is 4:2; and the weight ratio of compound I to compound III is 4:5 in mixtures D-1 to D-476 of Table D.
- mixtures D-1 to D-476 of Table D and in particular when the weight ratios of compound I to compound II and of compound I and compound III are as disclosed for these mixtures as herein before mentioned, are used against Phakopsora pachyrhizi and P. meibomiae on soybeans and/or against Puccinia triticina, P. striiformis, P. hordei, P. gra minis ox P. recon dita on wheat, barley or rye; P. coronata e.g. on oats, P. sorghi und P. poiysora on corn; Puccinia spp. on other crops, e.g. P.
- the binary and ternary mixtures and agrochemical compositions thereof according to the invention can, in the use form as fungicides, also be present together with further active substances, e. g. with herbicides, insecticides, growth regulators, fungicides or else with fertilizers, as pre-mix or, if appropriate, not until immeadiately prior to use (tank mix).
- further active substances e. g. with herbicides, insecticides, growth regulators, fungicides or else with fertilizers, as pre-mix or, if appropriate, not until immeadiately prior to use (tank mix).
- the binary and ternary mixtures and agrochemical compositions thereof according to the invention are suitable as fungicides. They are distinguished by an outstanding effectiveness against a broad spectrum of phytopathogenic fungi, including soil-borne fungi, which derive especially from the following classes or are closely related to any of them: Ascomycota
- Basdiomycota Basidiomycetes
- Basidiomycota Basidiomycetes
- Chytridiomycota Chytridiomycetes
- Chytridiomycetes Chytridiomycetes
- Deuteromycetes Syn. Fungi imperfecti
- Erysiphe Erysiphe
- Fusarium Fusarium
- Phomopsis and Pyrenophora
- Peronosporomycetes Syn. Oomycetes
- Plasmodiophora Zygomycetes, for example, but not limited to the genus Rhizopus.
- Some of the binary and ternary mixtures and agrochemical compositions thereof according to the invention are systemically effective and they can be used in crop protection as foliar fungicides, fungicides for seed dressing and soil fungicides. Moreover, they are suitable for controlling harmful fungi, which inter alia occur in wood or roots of plants.
- the binary and ternary mixtures and agrochemical compositions thereof according to the invention are particularly important in the control of a multitude of phytopathogenic fungi on various cultivated plants, such as cereals, e. g. wheat, rye, barley, triticale, oats or rice; beet, e. g. sugar beet or fodder beet; fruits, such as pomes, stone fruits or soft fruits, e. g.
- binary and ternary mixtures and agrochemical compositions thereof according to the invention are used for controlling a multitude of fungi on field crops, such as potatoes sugar beets, tobacco, wheat, rye, barley, oats, rice, corn, cotton, soybeans, oilseed rape, legumes, sunflowers, coffee or sugar cane; fruits; vines; ornamentals; or vegetables, such as cucumbers, tomatoes, beans or squashes.
- field crops such as potatoes sugar beets, tobacco, wheat, rye, barley, oats, rice, corn, cotton, soybeans, oilseed rape, legumes, sunflowers, coffee or sugar cane; fruits; vines; ornamentals; or vegetables, such as cucumbers, tomatoes, beans or squashes.
- plant propagation material is to be understood to denote all the generative parts of the plant such as seeds and vegetative plant material such as cuttings and tubers (e. g.
- potatoes which can be used for the multiplication of the plant. This includes seeds, roots, fruits, tubers, bulbs, rhizomes, shoots, sprouts and other parts of plants, including seedlings and young plants, which are to be transplanted after germination or after emergence from soil.
- These young plants may also be protected before transplantation by a total or partial treatment by immersion or pouring.
- treatment of plant propagation materials with binary and ternary mixtures and agrochemical compositions thereof according to the invention is used for controlling a multitude of fungi on cereals, such as wheat, rye, barley and oats; rice, corn, cotton and soybeans.
- cultiva plants is to be understood as including plants which have been modified by mutagenesis or genetic engineering in order to provide a new trait to a plant or to modify an already present trait.
- Mutagenesis includes techniques of random mutagenesis using X-rays or mutagenic chemicals, but also techniques of targeted mutagenesis, to create mutations at a specific locus of a plant genome.
- Targeted mutagenesis techniques frequently use oligonucleotides or proteins like CRISPR/Cas, zinc-finger nucleases, TALENs or meganucleases to achieve the targeting effect.
- Genetic engineering usually uses recombinant DNA techniques to create modifications in a plant genome which under natural circumstances cannot readily be obtained by cross breeding, mutagenesis or natural recombination.
- one or more genes are integrated into the genome of a plant to add a trait or improve a trait.
- transgenic plants These integrated genes are also referred to as transgenes in the art, while plant comprising such transgenes are referred to as transgenic plants.
- the process of plant transformation usually produces several transformation events, wich differ in the genomic locus in which a transgene has been integrated. Plants comprising a specific transgene on a specific genomic locus are usually described as comprising a specific “event”, which is referred to by a specific event name. Traits which have been introduced in plants or have been modified include herbicide tolerance, insect resistance, increased yield and tolerance to abiotic conditions, like drought.
- Herbicide tolerance has been created by using mutagenesis as well as using genetic engineering. Plants which have been rendered tolerant to acetolactate synthase (ALS) inhibitor herbicides by mutagenesis and breeding comprise plant varieties commercially available under the name Clearfield®.
- ALS acetolactate synthase
- Herbicide tolerance has been created via the use of transgenes to glyphosate, glufosinate, 2,4- D, dicamba, oxynil herbicides, like bromoxynil and ioxynil, sulfonylurea herbicides, ALS inhibitors and 4-hydroxyphenylpyruvate dioxygenase (HPPD) inhibitors, like isoxaflutole and mesotrione.
- transgenes to glyphosate, glufosinate, 2,4- D, dicamba, oxynil herbicides, like bromoxynil and ioxynil, sulfonylurea herbicides, ALS inhibitors and 4-hydroxyphenylpyruvate dioxygenase (HPPD) inhibitors, like isoxaflutole and mesotrione.
- HPPD 4-hydroxyphenylpyruvate dioxygenase
- Transgenes which have been used to provide herbicide tolerance traits comprise: for tolerance to glyphosate: cp4 epsps, epsps grg23ace5, mepsps, 2mepsps, gat4601 , gat4621 , goxv247; for tolerance to glufosinate: pat and bar, for tolerance to 2,4-D: aad-1 , aad-12; for tolerance to dicamba: dmo; for tolerance to oxynil herbicies: bxn; for tolerance to sulfonylurea herbicides: zm-hra, csr1-2, gm-hra, S4-HrA; for tolerance to ALS inhibitors: csr1-2; and for tolerance to HPPD inhibitors: hppdPF, W336, avhppd-03.
- Transgenes which have most frequently been used are toxin genes of Bacillus spp. and synthetic variants thereof, like cry1A, crylAb, cry1Ab-Ac, crylAc, cry1A.105, cry1 F, cry1 Fa2, cry2Ab2, cry2Ae, mcry3A, ecry3.1Ab, cry3Bb1 , cry34Ab1 , cry35Ab1 , cry9C, vip3A(a), vip3Aa20.
- genes of plant origin such as genes coding for protease inhibitors, like CpTI and pinll, have been transferred to other plants.
- a further approach uses transgenes such as dvsnf7 to produce double-stranded RNA in plants.
- transgene athb17 being present for example in corn event MON87403, or by using the transgene bbx32, being present for example in the soybean event MON87712.
- Cultivated plants comprising a modified oil content have been created by using the transgenes: gm-fad2-1 , Pj.D6D, Nc.Fad3, fad2-1A and fatb1-A. Soybean events comprising at least one of these genes are: 260-05, MON87705 and MON87769.
- transgene cspB comprised by the corn event MON87460 and by using the transgene Hahb-4, comprised by soybean event IND-00410-5.
- All traits and genes mentioned above can be used to generate an event that contains only one gene or as a stack of two or multiple genes. Those stacked genes can either provide the same trait or different traits. Therefore, every event can provide one or multiple traits.
- Transgenic corn events comprising herbicide tolerance genes, genes for insecticidal proteins, or double stranded RNA, or genes involved in increasing yield or abiotic stress tolerance include, but are not limited to,
- Transgenic soybean events comprising herbicide tolerance genes, genes for insecticidal proteins, or double stranded RNA, or genes involved in increasing yield or abiotic stress tolerance include, but are not limited to,
- Transgenic cotton events comprising herbicide tolerance genes, genes for insecticidal proteins, or double stranded RNA, or genes involved in increasing yield or abiotic stress tolerance include, but are not limited to,
- Transgenic canola events comprising herbicide tolerance genes, genes for insecticidal proteins, or double stranded RNA, or genes involved in increasing yield or abiotic stress tolerance include, but are not limited to, 23-18-17 (Event 18), 23-198 (Event 23), 61061 , 73496, DHA Canola, GT200 (RT200), GT73 (RT73), HCN10 (Topas 19/2), HCN28 (T45), HCN92 (Topas 19/2), HCR-1 MON88302, MPS961 , MPS962, MPS963, MPS964, MPS965, MS1 (B91-4),
- MS1 1 , MS8, OXY-235, PHY14, PHY23, PHY35, PHY36, RF1 (B93-101 ), RF2 (B94-2), RF3 Traits are frequently combined by combining genes in one transformation event or by combining different events during the breeding process resulting in a cultivated plant with stacked traits.
- Preferred combinations of traits are combinations of herbicide tolerance traits to different groups of herbicides, combinations of insect tolerance to different kind of insects, in particular tolerance to lepidopteran and coleopteran insects, combinations of herbicide tolerance with one or several types of insect resistance, combinations of herbicide tolerance with increased yield as well as combinations of herbicide tolerance and tolerance to abiotic conditions.
- CERA Cera-gmc.org/GMCropDatabase
- effects which are specific to a cultivated plant comprising a certain gene or event may result in effects which are specific to a cultivated plant comprising a certain gene or event. These effects might involve changes in growth behavior or changed resistance to biotic or abiotic stress factors. Such effects may in particular comprise enhanced yield, enhanced resistance or tolerance to insects, nematodes, fungal, bacterial, mycoplasma, viral or viroid pathogens as well as early vigour, early or delayed ripening, cold or heat tolerance as well as changed amino acid or fatty acid spectrum or content.
- the binary and ternary mixtures and agrochemical compositions thereof according to the invention are particularly suitable for controlling the following plant diseases:
- Albugo spp. white rust on ornamentals, vegetables (e. g. A. Candida) and sunflowers (e. g. A. tragopogonis), A Hern aria spp. (Alternaria leaf spot) on vegetables (e.g. A. dauciox A. porri), oilseed rape (A. brass icicoia or brassicae ), sugar beets (A. tenuis ), fruits (e.g. A. grandis ), rice, soybeans, potatoes and tomatoes (e. g. A. soiani, A. grandis or A. alternate), tomatoes (e. g. A. soiani ox A. aiternata) and wheat (e.g. A.
- B. oryzae ox ⁇ rice and turfs Biumeria (formerly Erysiphe) graminis (powdery mildew) on cereals (e. g. on wheat or barley); Botrytis cinerea (teleomorph: Botryotinia fuckeiianar. grey mold) on fruits and berries (e. g. strawberries), vegetables (e. g. lettuce, carrots, celery and cabbages); B. squamosa ox B. aiiii on onion family), oilseed rape, ornamentals (e.g.
- Ciadobotryum sin. Dactyiium
- Ciadobotryum syn. Dactyiium
- Ciadobotryum syn. Dactyiium
- C. mycophi!um formerly Dactylium dendroides, teleomorph: Nectria albertinii, Nectria rosella syn. Hypomyces rosellus
- Cladosporium spp. on tomatoes e. g. C. fulvum. leaf mold
- cereals e. g. C. herbarum (black ear) on wheat
- daviceps purpurea ergot
- Cochliobolus (anamorph: Helminthosporium of Bipoiaris ) spp. (leaf spots) on corn (C.
- cereals e. g. C. sativus, anamorph: B. sorokiniana
- rice e. g. C. miyabeanus, anamorph: H. oryzae
- Colletotrichum teleomorph: Glomerella
- spp. anthracnose on cotton (e. g. C. gossypil), corn (e. g. C. graminicola: Anthracnose stalk rot), soft fruits, potatoes (e. g.
- C. coccodes black dot
- beans e. g. C. Hndemuthianum
- soybeans e. g. C. truncatumox C. gloeosporioides
- vegetables e.g. C. lagenariumox C. capsid
- fruits e.g. C. acutatum
- coffee e.g. C. coffeanumox C. kahawae
- Corticium spp. e. g. C.
- sasakii sheath blight
- Corynespora cassiicoia leaf spots
- Cycioconium spp. e. g. C. oieaginumox ⁇ olive trees
- Helminthosporium, teleomorph Pyrenophora
- Phaeomonieiia chiamydospora (formerly Phaeoacremonium chiamydosporum)
- Microdochium (syn. Fusarium) nivaie (pink snow mold) on cereals (e. g. wheat or barley);
- Microsphaera diffusa (powdery mildew) on soybeans; Moniiinia spp., e. g. M. iaxa, M. fructicoia and M. fructigena (syn. Moniiia spp.: bloom and twig blight, brown rot) on stone fruits and other rosaceous plants; Mycosphaereiia spp. on cereals, bananas, soft fruits and ground nuts, such as e. g. M. graminicola (anamorph: Zymoseptoria M/c/formerly Septoria triticr. Septoria blotch) on wheat or M. fijiensis (syn. Pseudocercospora fijiensis. black Sigatoka disease) and M.
- meibomiae (soybean rust) on soybeans; Phiaiophora spp. e. g. on vines (e. g. P. tracheiphiia and P. tetraspora) and soybeans (e. g. P. gregata. stem rot); Phoma iingam ⁇ syn. Leptosphaeria bigiobosa and L macula ns. root and stem rot) on oilseed rape and cabbage, P. betae (root rot, leaf spot and damping-off) on sugar beets and P. zeae-maydis (syn. Phyiiostica zeae) on corn; Phomopsis spp.
- Piasmodiophora brassicae ⁇ club root on cabbage, oilseed rape, radish and other plants
- Piasmopara spp. e. g. P. viticoia (grapevine downy mildew) on vines and P.
- Podosphaera spp. (powdery mildew) on rosaceous plants, hop, pome and soft fruits (e. g. P. ieucotricha on apples) and curcurbits ( P '. xanthii) ⁇ , Poiymyxa spp., e. g. on cereals, such as barley and wheat ( P '. graminis) and sugar beets ( P '. betae) and thereby transmitted viral diseases; Pseudocercosporeiia herpotrichoides ⁇ syn. Ocuiimacuia yaiiundae,
- Pseudoperonospora downy mildew
- P. cubensis on cucurbits or P. hum Hi on hop
- Pseudopezicuia tracheiphiia fire disease or .rotbrenner’, anamorph
- Phiaiophora on vines; Pucci nia spp. (rusts) on various plants, e. g. P. triticina (brown or leaf rust), P. striiformis (stripe or yellow rust), P. hordei (dwarf rust), P. graminis (stem or black rust) or P. recondite (brown or leaf rust) on cereals, such as e. g. wheat, barley or rye, P. kuehnii (orange rust) on sugar cane and P. asparagi on asparagus; Pyrenopeziza spp., e.g. P.
- R. soiani(roo ⁇ and stem rot) on soybeans e.g. R. soiani (sheath blight) on rice or R. cereaiis (Rhizoctonia spring blight) on wheat or barley;
- Rhizopus stoionifer black mold, soft rot
- strawberries carrots, cabbage, vines and tomatoes
- Rhynchosporium secaiis and R. commune scald
- Sarociadium oryzae and S. attenuatum (sheath rot) on rice
- Scierotinia spp. stem rot or white mold
- vegetables S. minorand S. scierotiorum
- field crops such as oilseed rape, sunflowers (e. g. S. scierotiorum) and soybeans, S. roifsii ⁇ syn.
- Sphaerotheca fuHginea (syn. Podosphaera xanthir. powdery mildew) on cucurbits; Spongospora subterranea (powdery scab) on potatoes and thereby transmitted viral diseases; Stagonospora spp. on cereals, e. g. S. nodorum (Stagonospora blotch, teleomorph: Leptosphaeria [syn.
- phaseoii sugar beets (e. g. U. betae or U. beticoia) and on pulses (e.g. U. vignae, U. pisi, U. viciae-fabae and U. fabae , UstHago spp. (loose smut) on cereals (e. g. U. nuda and U.
- corn e. g. Li. maydis corn smut
- sugar cane e. g. V. inaequaiis
- Verticiiiium spp. wilt
- various plants such as fruits and ornamentals, vines, soft fruits, vegetables and field crops, e. g. V. iongisporum on oilseed rape, V. dahiiae on strawberries, oilseed rape, potatoes and tomatoes, and V. fungicoia on various plants, such as fruits and ornamentals, vines, soft fruits, vegetables and field crops, e. g. V. iongisporum on oilseed rape, V. dahiiae on strawberries, oilseed rape, potatoes and tomatoes, and V. fungicoia on
- the compounds I, their mixtures with other active compounds as defined herein and compositions thereof, respectively, are particularly suitable for controlling the following plant diseases: Puccinia spp. (rusts) on various plants, for example, but not limited to P. triticina (brown or leaf rust), P. striiformis (stripe or yellow rust), P. hordei (dwarf rust), P. graminis (stem or black rust) or P. recondite (brown or leaf rust) on cereals, such as e. g. wheat, barley or rye, P. sorghi (common rust) on maize, P. poiysora (southern rust) on maize; P.
- Puccinia spp. rusts
- rusts rusts
- P. triticina brown or leaf rust
- P. striiformis stripe or yellow rust
- P. hordei dwarf rust
- Fungicide-resistant strains of the above-mentioned phytopathgenic fungi have been reported, with strains resistant to one or more fungicides from various fungicidal mode of action classes being observed including but not limited to beta-tubulin assembly inhibitors, sterol
- DMI demethylation-inhibitors
- Qol quinone-outside-inhibitors
- SDHI succinate dehydrogenase inhibitors
- compounds I are useful to control phytopathogenic fungi comprising at least one of the following mutations: E198A/G/K or F200Y in the beta-tubulin gene conferring resistance to beta-tubulin assembly inhibitors (Phytopathol (2008) 98: 397-404), I365N/S, V368F, Q369H/P, N373S, T447S in the histidine kinase gene Os1 conferring resistance to MAP / histidin kinase inhibitors (dicarboximides; ibida); G143A, G137R or F129L in the mitochondrial cytochrome B Gene (Phytopathol (2003) 93: 891-900; Pest Manag Sci (2016) 72: 121 1-1215) resulting in resistance to Qol; V136A, Y137F (homologous to
- the binary and ternary mixtures and agrochemical compositions thereof according to the invention are also suitable for controlling harmful fungi in the protection of stored products or harvest and in the protection of materials.
- protection of materials is to be understood to denote the protection of technical and non-living materials, such as adhesives, glues, wood, paper and paperboard, textiles, leather, paint dispersions, plastics, cooling lubricants, fiber or fabrics, against the infestation and destruction by harmful microorganisms, such as fungi and bacteria.
- harmful microorganisms such as fungi and bacteria.
- Ascomycetes such as Ophiostoma spp., Ceratocystis s p p . , Aureobasidium pullulans, Sderophoma spp., Chaetomium s p p .
- yeast fungi such as Candida spp. and Saccharomyces cerevisae.
- Basidiomycetes such as Coniophora spp., Corioius spp., Gloeophyllum spp., Lentinus s ., P/eurotus spp., Poria spp., Serpuia spp. and Tyromyces spp., Deuteromycetes such as Aspergillus spp., Cladosporium spp., PeniciHium spp., Trichoderma spp., Alternaria spp., PaecHomyces spp. and Zygomycetes such as Mucor spp., and in addition in the protection of stored products and harvest the following yeast fungi are worthy of note: Candida spp. and Saccharomyces cerevisae.
- the method of treatment according to the invention can also be used in the field of protecting stored products or harvest against attack of fungi and microorganisms.
- the term "stored products” is understood to denote natural substances of plant or animal origin and their processed forms, which have been taken from the natural life cycle and for which long-term protection is desired.
- Stored products of crop plant origin such as plants or parts thereof, for example stalks, leafs, tubers, seeds, fruits or grains, can be protected in the freshly harvested state or in processed form, such as pre-dried, moistened, comminuted, ground, pressed or roasted, which process is also known as post-harvest treatment.
- stored products are timber, whether in the form of crude timber, such as construction timber, electricity pylons and barriers, or in the form of finished articles, such as furniture or objects made from wood.
- Stored products of animal origin are hides, leather, furs, hairs and the like.
- the combinations according the present invention can prevent disadvantageous effects such as decay, discoloration or mold.
- Preferably "stored products” is understood to denote natural substances of plant origin and their processed forms, more preferably fruits and their processed forms, such as pomes, stone fruits, soft fruits and citrus fruits and their processed forms.
- the binary and ternary mixtures and agrochemical compositions thereof according to the invention may be used for improving the health of a plant.
- the invention also relates to a method for improving plant health by treating a plant, its propagation material and/or the locus where the plant is growing or is to grow with an effective amount of compounds I and compositions thereof, respectively.
- plant health is to be understood to denote a condition of the plant and/or its products which is determined by several indicators alone or in combination with each other such as yield (e. g. increased biomass and/or increased content of valuable ingredients), plant vigor (e. g. improved plant growth and/or greener leaves (“greening effect”)), quality (e. g. improved content or composition of certain ingredients) and tolerance to abiotic and/or biotic stress.
- yield e. g. increased biomass and/or increased content of valuable ingredients
- plant vigor e. g. improved plant growth and/or greener leaves (“greening effect”)
- quality e. g. improved content or composition of certain ingredients
- tolerance to abiotic and/or biotic stress e. g. improved content or composition of certain ingredients
- the binary and ternary mixtures and agrochemical compositions thereof according to the invention are employed as such or in form of compositions by treating the fungi or the plants, plant propagation materials, such as seeds, soil, surfaces, materials or rooms to be protected from fungal attack with a fungicidally effective amount of the active substances.
- the application can be carried out both before and after the infection of the plants, plant propagation materials, such as seeds, soil, surfaces, materials or rooms by the fungi.
- Plant propagation materials may be treated with binary and ternary mixtures and agrochemical compositions thereof according to the invention as such or a composition comprising at least one compound I prophylactically either at or before planting or transplanting.
- An agrochemical composition comprises a fungicidally effective amount of a binary and ternary mixtures according to the invention.
- effective amount denotes an amount of the composition or of the compounds I, II and III, which is sufficient for controlling harmful fungi on cultivated plants or in the protection of materials and which does not result in a substantial damage to the treated plants. Such an amount can vary in a broad range and is dependent on various factors, such as the fungal species to be controlled, the treated cultivated plant or material, the climatic conditions and the specific binary or ternary mixtures used.
- the binary and ternary mixtures according to the invention can be converted into customary types of agrochemical compositions, e. g. solutions, emulsions, suspensions, dusts, powders, pastes, granules, pressings, capsules, and mixtures thereof.
- composition types are suspensions (e. g. SC, OD, FS), emulsifiable concentrates (e. g. EC), emulsions (e. g. EW, EO, ES, ME), capsules (e. g. CS, ZC), pastes, pastilles, wettable powders or dusts (e. g. WP, SP, WS, DP, DS), pressings (e. g.
- compositions types are defined in the “Catalogue of pesticide formulation types and international coding system”, Technical
- compositions are prepared in a known manner, such as described by Mollet and
- the binary or ternary mixtures of active compounds described herein can be prepared as compositions comprising besides the active ingredients at least one inert ingredient (auxiliary) by usual means, e. g. by the means given herein for the compositions of compounds I.
- Suitable auxiliaries are solvents, liquid carriers, solid carriers or fillers, surfactants, dispersants, emulsifiers, wetters, adjuvants, solubilizers, penetration enhancers, protective colloids, adhesion agents, thickeners, humectants, repellents, attractants, feeding stimulants, compatibilizers, bactericides, anti-freezing agents, anti-foaming agents, colorants, tackifiers and binders.
- Suitable solvents and liquid carriers are water and organic solvents, such as mineral oil fractions of medium to high boiling point, e. g. kerosene, diesel oil; oils of vegetable or animal origin; aliphatic, cyclic and aromatic hydrocarbons, e. g. toluene, paraffin,
- tetrahydronaphthalene alkylated naphthalenes
- alcohols e. g. ethanol, propanol, butanol, benzyl alcohol, cyclohexanol
- glycols DMSO; ketones, e. g. cyclohexanone; esters, e. g.
- lactates carbonates, fatty acid esters, gamma-butyrolactone; fatty acids; phosphonates;
- Suitable solid carriers or fillers are mineral earths, e. g. silicates, silica gels, talc, kaolins, limestone, lime, chalk, clays, dolomite, diatomaceous earth, bentonite, calcium sulfate, magnesium sulfate, magnesium oxide; polysaccharides, e. g. cellulose, starch; fertilizers, e. g. ammonium sulfate, ammonium phosphate, ammonium nitrate, ureas; products of vegetable origin, e. g. cereal meal, tree bark meal, wood meal, nutshell meal, and mixtures thereof.
- mineral earths e. g. silicates, silica gels, talc, kaolins, limestone, lime, chalk, clays, dolomite, diatomaceous earth, bentonite, calcium sulfate, magnesium sulfate, magnesium oxide
- polysaccharides e. g. cellulose, star
- Suitable surfactants are surface-active compounds, such as anionic, cationic, nonionic and amphoteric surfactants, block polymers, polyelectrolytes, and mixtures thereof. Such surfactants can be used as emulsifier, dispersant, solubilizer, wetter, penetration enhancer, protective colloid, or adjuvant. Examples of surfactants are listed in McCutcheon’s, Vol.1 : Emulsifiers & Detergents, McCutcheon’s Directories, Glen Rock, USA, 2008 (International Ed. or North American Ed.).
- Suitable anionic surfactants are alkali, alkaline earth or ammonium salts of sulfonates, sulfates, phosphates, carboxylates, and mixtures thereof.
- sulfonates are alkylaryl sulfonates, diphenyl sulfonates, alpha-olefin sulfonates, lignin sulfonates, sulfonates of fatty acids and oils, sulfonates of ethoxylated alkylphenols, sulfonates of alkoxylated arylphenols, sulfonates of condensed naphthalenes, sulfonates of dodecyl- and tridecylbenzenes, sulfonates of naphthalenes and alkyl naphthalenes, sulfosuccinates or sulfosuccinamates.
- Examples of sulfates are sulfates of fatty acids and oils, of ethoxylated alkylphenols, of alcohols, of ethoxylated alcohols, or of fatty acid esters.
- Examples of phosphates are phosphate esters.
- Examples of carboxylates are alkyl carboxylates, and carboxylated alcohol or alkylphenol ethoxylates.
- Suitable nonionic surfactants are alkoxylates, N-substituted fatty acid amides, amine oxides, esters, sugar-based surfactants, polymeric surfactants, and mixtures thereof.
- alkoxylates are compounds such as alcohols, alkylphenols, amines, amides, arylphenols, fatty acids or fatty acid esters which have been alkoxylated with 1 to 50 equivalents.
- Ethylene oxide and/or propylene oxide may be employed for the alkoxylation, preferably ethylene oxide.
- N-substituted fatty acid amides are fatty acid glucamides or fatty acid
- esters are fatty acid esters, glycerol esters or monoglycerides.
- sugar-based surfactants are sorbitans, ethoxylated sorbitans, sucrose and glucose esters or alkylpolyglucosides.
- polymeric surfactants are home- or copolymers of vinyl pyrrolidone, vinyl alcohols, or vinyl acetate.
- Suitable cationic surfactants are quaternary surfactants, for example quaternary ammonium compounds with one or two hydrophobic groups, or salts of long-chain primary amines.
- Suitable amphoteric surfactants are alkylbetains and imidazolines.
- Suitable block polymers are block polymers of the A-B or A-B-A type comprising blocks of polyethylene oxide and polypropylene oxide, or of the A-B-C type comprising alkanol, polyethylene oxide and polypropylene oxide.
- Suitable polyelectrolytes are polyacids or polybases. Examples of polyacids are alkali salts of polyacrylic acid or polyacid comb polymers. Examples of polybases are polyvinyl amines or polyethylene amines.
- Suitable adjuvants are compounds, which have a negligible or even no pesticidal activity themselves, and which improve the biological performance of the compound I on the target.
- examples are surfactants, mineral or vegetable oils, and other auxiliaries. Further examples are listed by Knowles, Adjuvants and additives, Agrow Reports DS256, T&F Informa UK, 2006, chapter 5.
- Suitable thickeners are polysaccharides (e. g. xanthan gum, carboxymethyl cellulose), inorganic clays (organically modified or unmodified), polycarboxylates, and silicates.
- Suitable bactericides are bronopol and isothiazolinone derivatives such as alkylisothiazolinones and benzisothiazolinones.
- Suitable anti-freezing agents are ethylene glycol, propylene glycol, urea and glycerin.
- Suitable anti-foaming agents are silicones, long chain alcohols, and salts of fatty acids.
- Suitable colorants are pigments of low water solubility and water- soluble dyes.
- examples are inorganic colorants (e. g. iron oxide, titan oxide, iron
- Suitable tackifiers or binders are polyvinyl pyrrolidones, polyvinyl acetates, polyvinyl alcohols, polyacrylates, biological or synthetic waxes, and cellulose ethers.
- composition types and their preparation are:
- a binary or ternary mixture according to the invention 10-60 wt% of a binary or ternary mixture according to the invention and 5-15 wt% wetting agent (e. g. alcohol alkoxylates) are dissolved in water and/or in a water-soluble solvent (e. g.
- the active compound dissolves upon dilution with water.
- a binary or ternary mixture according to the invention 5-25 wt% of a binary or ternary mixture according to the invention and 1-10 wt% dispersant (e. g. polyvinyl pyrrolidone) are dissolved in organic solvent (e. g. cyclohexanone) ad 100 wt%. Dilution with water gives a dispersion.
- dispersant e. g. polyvinyl pyrrolidone
- organic solvent e. g. cyclohexanone
- emulsifiers e. g. calcium dodecylbenzenesulfonate and castor oil ethoxylate
- water-insoluble organic solvent e. g. aromatic hydrocarbon
- lignosulfonate and alcohol ethoxylate 0.1-2 wt% thickener (e. g. xanthan gum) and water ad 100 wt% to give a fine active compound suspension. Dilution with water gives a stable suspension of the active substance.
- wt% binder e. g.
- polyvinyl alcohol is added.
- an OD type composition For the preparation of an OD type composition the following procedure can be used: in an agitated ball mill, 5-25 wt% of a binary or ternary mixture according to the invention, being not soluble in the continuous phase, are comminuted with addition of 2-10 wt% dispersants, wetting agents and emulsifiers (e. g. sodium lignosulfonate, alcohol ethnoxylate and alkoxylated triglycerides), 0.1-2 wt% rheology modifier (e. g. modified bentonites and xanthan gum) and a water immiscible solvent or oil as continuous phase ad 100 wt% to give a fine active compound suspension.
- dispersants e. g. sodium lignosulfonate, alcohol ethnoxylate and alkoxylated triglycerides
- 0.1-2 wt% rheology modifier e. g. modified bentonites and xanthan gum
- a binary or ternary mixture according to the invention are ground finely with addition of dispersants and wetting agents (e. g. sodium lignosulfonate and alcohol ethoxylate) ad 100 wt% and prepared as water-dispersible or water-soluble granules by means of technical appliances (e. g. extrusion, spray tower, fluidized bed). Dilution with water gives a stable dispersion or solution of the active substance.
- dispersants and wetting agents e. g. sodium lignosulfonate and alcohol ethoxylate
- 50-80 wt% of a binary or ternary mixture according to the invention are ground in a rotor-stator mill with addition of 1-5 wt% dispersants (e. g. sodium lignosulfonate), 1-3 wt% wetting agents (e. g. alcohol ethoxylate) and solid carrier (e. g. silica gel) ad 100 wt%. Dilution with water gives a stable dispersion or solution of the active substance.
- dispersants e. g. sodium lignosulfonate
- 1-3 wt% wetting agents e. g. alcohol ethoxylate
- solid carrier e. g. silica gel
- a binary or ternary mixture according to the invention are comminuted with addition of 3-10 wt% dispersants (e. g. sodium lignosulfonate), 1-5 wt% thickener (e. g. carboxymethyl cellulose) and water ad 100 wt% to give a fine suspension of the active substance. Dilution with water gives a stable suspension of the active substance.
- dispersants e. g. sodium lignosulfonate
- 1-5 wt% thickener e. g. carboxymethyl cellulose
- 5-20 wt% of a binary or ternary mixture according to the invention are added to 5-30 wt% organic solvent blend (e. g. fatty acid dimethyl amide and cyclohexanone), 10-25 wt% surfactant blend (e. g. alcohol ethoxylate and arylphenol ethoxylate), and water ad 100 %.
- organic solvent blend e. g. fatty acid dimethyl amide and cyclohexanone
- surfactant blend e. g. alcohol ethoxylate and arylphenol ethoxylate
- An oil phase comprising 5-50 wt% of a compound I, 0-40 wt% water insoluble organic solvent (e. g. aromatic hydrocarbon), 2-15 wt% acrylic monomers (e. g. methylmethacrylate, methacrylic acid and a di- or triacrylate) are dispersed into an aqueous solution of a protective colloid (e. g. polyvinyl alcohol). Radical polymerization results in the formation of poly(meth)acrylate microcapsules.
- an oil phase comprising 5-50 wt% of a binary or ternary mixture according to the invention according to the invention according to the invention, 0-40 wt% water insoluble organic solvent (e. g. aromatic hydrocarbon), and an isocyanate monomer (e.
- g. diphenylmethene-4,4’- diisocyanatae are dispersed into an aqueous solution of a protective colloid (e. g. polyvinyl alcohol).
- a protective colloid e. g. polyvinyl alcohol.
- the addition of a polyamine results in the formation of polyurea microcapsules.
- the monomers amount to 1-10 wt%.
- the wt% relate to the total CS composition.
- Dustable powders (DP, DS)
- 1-10 wt% of a binary or ternary mixture according to the invention are ground finely and mixed intimately with solid carrier (e. g. finely divided kaolin) ad 100 wt%.
- solid carrier e. g. finely divided kaolin
- a binary or ternary mixture according to the invention is ground finely and associated with solid carrier (e. g. silicate) ad 100 wt%.
- solid carrier e. g. silicate
- Granulation is achieved by extrusion, spray-drying or fluidized bed.
- organic solvent e. g. aromatic hydrocarbon
- compositions types i) to xiii) may optionally comprise further auxiliaries, such as 0.1-1 wt% bactericides, 5-15 wt% anti-freezing agents, 0.1-1 wt% anti-foaming agents, and 0.1-1 wt% colorants.
- auxiliaries such as 0.1-1 wt% bactericides, 5-15 wt% anti-freezing agents, 0.1-1 wt% anti-foaming agents, and 0.1-1 wt% colorants.
- the agrochemical compositions generally comprise between 0.01 and 95%, preferably between 0.1 and 90%, more preferably between 1 and 70%, and in particular between 10 and 60%, by weight of active substance.
- the active substances are employed in a purity of from 90% to 100%, preferably from 95% to 100% (according to NMR spectrum).
- compositions in question give, after two-to-tenfold dilution, active compound concentrations of from 0.01 to 60% by weight, preferably from 0.1 to 40%, in the ready-to-use preparations.
- Methods for applying compound I and compositions thereof, respectively, onto plant propagation material, especially seeds include dressing, coating, pelleting, dusting, and soaking as well as in-furrow application methods.
- binary or ternary mixture according to the invention or the compositions thereof, respectively are applied on to the plant propagation material by a method such that germination is not induced, e. g. by seed dressing, pelleting, coating and dusting.
- the amounts of active substances applied are, depending on the kind of effect desired, from 0.001 to 2 kg per ha, preferably from 0.005 to 2 kg per ha, more preferably from 0.05 to 0.9 kg per ha, and in particular from 0.1 to 0.75 kg per ha.
- amounts of active compound of from 0.1 to 1000 g, preferably from 1 to 1000 g, more preferably from 1 to 100 g and most preferably from 5 to 100 g, per 100 kilogram of plant propagation material (preferably seeds) are generally required.
- the amount of active compound applied depends on the kind of application area and on the desired effect. Amounts customarily applied in the protection of materials are 0.001 g to 2 kg, preferably 0.005 g to 1 kg, of active compound per cubic meter of treated material.
- oils, wetters, adjuvants, fertilizer, or micronutrients, and further pesticides may be added to the active substances or the compositions comprising them as premix or, if appropriate not until immediately prior to use (tank mix).
- pesticides e. g. herbicides, insecticides, fungicides, growth regulators, safeners, biopesticides
- These agents can be admixed with the compositions according to the invention in a weight ratio of 1 :100 to 100:1 , preferably 1 :10 to 10:1.
- a pesticide is generally a chemical or biological agent (such as pestidal active ingredient, compound, composition, virus, bacterium, antimicrobial or disinfectant) that through its effect deters, incapacitates, kills or otherwise discourages pests.
- Target pests can include insects, plant pathogens, weeds, mollusks, birds, mammals, fish, nematodes (roundworms), and microbes that destroy property, cause nuisance, spread disease or are vectors for disease.
- pesticide includes also plant growth regulators that alter the expected growth, flowering, or reproduction rate of plants; defoliants that cause leaves or other foliage to drop from a plant, usually to facilitate harvest; desiccants that promote drying of living tissues, such as unwanted plant tops; plant activators that activate plant physiology for defense of against certain pests; safeners that reduce unwanted herbicidal action of pesticides on crop plants; and plant growth promoters that affect plant physiology e.g. to increase plant growth, biomass, yield or any other quality parameter of the harvestable goods of a crop plant.
- composition according to the invention usually from a predosage device, a knapsack sprayer, a spray tank, a spray plane, or an irrigation system.
- a predosage device usually from a knapsack sprayer, a spray tank, a spray plane, or an irrigation system.
- agrochemical composition is made up with water, buffer, and/or further auxiliaries to the desired application concentration and the ready-to-use spray liquor or the agrochemical composition according to the invention is thus obtained.
- 20 to 2000 liters, preferably 50 to 400 liters, of the ready-to-use spray liquor are applied per hectare of agricultural useful area.
- composition according to the invention such as parts of a kit or parts of a binary or ternary mixture may be mixed by the user himself in a spray tank or any other kind of vessel used for applications (e. g. seed treater drums, seed pelleting machinery, knapsack sprayer) and further auxiliaries may be added, if appropriate.
- a spray tank or any other kind of vessel used for applications (e. g. seed treater drums, seed pelleting machinery, knapsack sprayer) and further auxiliaries may be added, if appropriate.
- one embodiment of the invention is a kit for preparing a usable pesticidal composition, the kit comprising a) a composition comprising component 1) as defined herein and at least one auxiliary; and b) a composition comprising component 2) as defined herein and at least one auxiliary; and optionally c) a composition comprising at least one auxiliary and optionally a further active component 3) as defined herein.
- the order of application is not essential for working of the present invention.
- the time between both applications may vary e. g. between 2 hours to 7 days.
- a broader range is possible ranging from 0.25 hour to 30 days, preferably from 0.5 hour to 14 days, particularly from 1 hour to 7 days or from 1.5 hours to 5 days, even more preferred from 2 hours to 1 day.
- b corresponds to the fungicidal infection of the untreated (control) plants in %
- An efficacy of 0 means that the infection level of the treated plants corresponds to that of the untreated control plants; an efficacy of 100 means that the treated plants were not infected.
- the expected efficacies of active compound combinations may be determined using Colby's formula (Colby, S.R. "Calculating synergistic and antagonistic responses of herbicide combinations", Weeds, 1J5, pp. 20-22, 1967) and compared with the observed efficacies.
- the active compounds were formulated separately as a stock solution having a concentration of 10000 ppm in dimethyl sulfoxide.
- the stock solutions were mixed according to the ratio, pipetted onto a micro titer plate (MTP) and diluted with water to the stated concentrations.
- MTP micro titer plate
- a spore suspension of Botrytis cinerea in an aqueous biomalt or yeast-bactopeptone- sodiumacetate solution was then added.
- the plates were placed in a water vapor-saturated chamber at a temperature of 18°C. Using an absorption photometer, the MTPs were measured at 405 nm 7 days after the inoculation.
- the measured parameters were compared to the growth of the active compound-free control variant (100%) and the fungus-free and active compound- free blank value to determine the relative growth in % of the pathogens in the respective active compounds. These percentages were converted into efficacies.
- An efficacy of 0 means that the growth level of the pathogens corresponds to that of the untreated control; an efficacy of 100 means that the pathogens were not growing.
- the active compounds were formulated separately as a stock solution having a concentration of 10000 ppm in dimethyl sulfoxide.
- the stock solutions were mixed according to the ratio, pipetted onto a micro titer plate (MTP) and diluted with water to the stated concentrations.
- MTP micro titer plate
- a spore suspension of Pyricularia oryzae in an aqueous biomalt or yeast-bactopeptone- sodiumacetate solution was then added.
- the plates were placed in a water vapor-saturated chamber at a temperature of 18°C. Using an absorption photometer, the MTPs were measured at 405 nm 7 days after the inoculation.
- the measured parameters were compared to the growth of the active compound-free control variant (100%) and the fungus-free and active compound- free blank value to determine the relative growth in % of the pathogens in the respective active compounds. These percentages were converted into efficacies.
- An efficacy of 0 means that the growth level of the pathogens corresponds to that of the untreated control; an efficacy of 100 means that the pathogens were not growing.
- the active compounds were formulated separately as a stock solution having a concentration of 10000 ppm in dimethyl sulfoxide.
- the stock solutions were mixed according to the ratio, pipetted onto a micro titer plate (MTP) and diluted with water to the stated concentrations.
- MTP micro titer plate
- a spore suspension of Septoria triticim an aqueous biomalt or yeast-bactopeptone-sodiumacetate solution was then added.
- the plates were placed in a water vapor-saturated chamber at a temperature of 18°C. Using an absorption photometer, the MTPs were measured at 405 nm 7 days after the inoculation.
- the measured parameters were compared to the growth of the active compound-free control variant (100%) and the fungus-free and active compound-free blank value to determine the relative growth in % of the pathogens in the respective active compounds. These percentages were converted into efficacies.
- An efficacy of 0 means that the growth level of the pathogens corresponds to that of the untreated control; an efficacy of 100 means that the pathogens were not growing.
- Table III Use examples of fungicidal activity against Septoria tritici
- the active compounds were formulated separately as a stock solution having a concentration of 10000 ppm in dimethyl sulfoxide.
- the product sulfur was used as a commercial finished formulation and diluted with water to the stated concentration of the active compound.
- the stock solutions were mixed according to the ratio, pipetted onto a micro titer plate (MTP) and diluted with water to the stated concentrations.
- MTP micro titer plate
- a spore suspension of Letosphaeria nodorum in an aqueous biomalt or yeast-bactopeptone-sodiumacetate solution was then added.
- the plates were placed in a water vapor-saturated chamber at a temperature of 18°C.
- the MTPs were measured at 405 nm 7 days after the inoculation.
- the measured parameters were compared to the growth of the active compound-free control variant (100%) and the fungus-free and active compound-free blank value to determine the relative growth in % of the pathogens in the respective active compounds. These percentages were converted into efficacies.
- An efficacy of 0 means that the growth level of the pathogens corresponds to that of the untreated control; an efficacy of 100 means that the pathogens were not growing.
- Table VI Use examples of fungicidal activity against Leptosphaeria nodorum
- the active compounds were formulated separately as a stock solution having a concentration of 10000 ppm in dimethyl sulfoxide.
- the stock solutions were mixed according to the ratio, pipetted onto a micro titer plate (MTP) and diluted with water to the stated concentrations.
- MTP micro titer plate
- a spore suspension of CoHetotrichum orbiculare in an aqueous biomalt or yeast-bactopeptone- sodiumacetate solution was then added.
- the plates were placed in a water vapor-saturated chamber at a temperature of 18°C. Using an absorption photometer, the MTPs were measured at 405 nm 7 days after the inoculation.
- the measured parameters were compared to the growth of the active compound-free control variant (100%) and the fungus-free and active compound- free blank value to determine the relative growth in % of the pathogens in the respective active compounds. These percentages were converted into efficacies.
- An efficacy of 0 means that the growth level of the pathogens corresponds to that of the untreated control; an efficacy of 100 means that the pathogens were not growing.
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Abstract
Fungicidal mixturecomprising substituted 3-phenyl-5-(trifluoromethyl)-1,2,4-oxadiazoles The present invention relates to fungicidal mixtures comprising at least one substituted 3- phenyl-5-(trifluoromethyl)-1,2,4-oxadiazoles (compounds I) and at least one active compound II; to a method for controlling phytopathogenic harmful fungi, comprising treating the fungi, their habitat or the seed, the soil or the plants to be protected against fungal attack with an effective amount of mixtures comprising compounds I and compounds II; to the use of mixtures comprising compounds I and compounds II for controlling phytopathogenic harmful fungi; to agrochemical compositions comprising these mixtures; and to agrochemical compositions further comprising seed.
Description
Fungicidal mixtures comprising substituted 3-phenyl-5-(trifluoromethyl)-1 ,2,4-oxadiazoles Description The present invention relates to a fungicidal mixture comprising, as active components 1 ) at least one active compound selected from the group consisting of
I.C: N-cyclobutyl-2,2-difluoro-2-[4-[5-(trifluoromethyl)-1 ,2,4-oxadiazol-3- yl]phenyl]acetamide
I.D: 2,2-difluoro-N-(1-methylcyclopropyl)-2-[4-[5-(trifluoromethyl)-1 ,2,4-oxadiazol-3- yl]phenyl]acetamide
I.E: N-[2-(difluoromethoxy)phenyl]-4-[5-(trifluoromethyl)-1 ,2,4-oxadiazol-3-yl]benzamide
I.J: N-[(3Z)-3-methoxyimino-1-methyl-butyl]-4-[5-(trifluoromethyl)-1 ,2,4-oxadiazol-3- yl]benzamide
I.M: N-cyclopropyl-2-[4-[5-(trifluoromethyl)-1 ,2,4-oxadiazol-3-yl]phenyl]propenamide
and as component
2) at least one active compound II selected from groups A) to O), or an N-oxide, or an agriculturally useful salt thereof:
A) Respiration inhibitors
Inhibitors of complex III at Q0 site: azoxystrobin (A.1.1), coumethoxystrobin (A.1.2), coumoxystrobin (A.1.3), dimoxystrobin (A.1.4), enestroburin (A.1.5), fenaminstrobin (A.1.6), fenoxystrobin/flufenoxystrobin (A.1.7), fluoxastrobin (A.1.8), kresoxim-methyl (A.1.9), mandestrobin (A.1.10), metominostrobin (A.1.1 1), orysastrobin (A.1.12), picoxystrobin (A.1.13), pyraclostrobin (A.1.14), pyrametostrobin (A.1.15), pyraoxystrobin (A.1.16), trifloxy- strobin (A.1.17), 2-(2-(3-(2,6-dichlorophenyl)-1-methyl-allylideneaminooxymethyl)-phenyl)- 2-methoxyimino-/V-methyl-acetamide (A.1.18), pyribencarb (A.1.19), triclopyricarb/chloro- dincarb (A.1.20), famoxadone (A.1.21 ), fenamidone (A.1.21 a), methyl-/V-[2-[(1 ,4-dimethyl- 5-phenyl-pyrazol-3-yl)oxylmethyl]phenyl]-/V-methoxy-carbamate (A.1.22), metyltetrapole (A.1.25), (Z;2£)-5-[1-(2,4-dichlorophenyl)pyrazol-3-yl]-oxy-2-methoxyimino- V,3-dimethyl- pent-3-enamide (A.1.34), (2^2£)-5-[1-(4-chlorophenyl)pyrazol-3-yl]oxy-2-methoxyimino-/V,3- dimethyl-pent-3-enamide (A.1.35), pyriminostrobin (A.1.36), bifujunzhi (A.1.37), 2-(ortho- ((2,5-dimethylphenyl-oxymethylen)phenyl)-3-methoxy-acrylic acid methylester (A.1.38);
- inhibitors of complex III at Q, site: cyazofamid (A.2.1), amisulbrom (A.2.2),
[(65,7/?,8/^-8-benzyl-3-[(3-hydroxy-4-methoxy-pyridine-2-carbonyl)amino]-6-methyl-4,9-di- oxo-1 ,5-dioxonan-7-yl] 2-methylpropanoate (A.2.3), fenpicoxamid (A.2.4), florylpicoxamid (A.2.5);
- inhibitors of complex II: benodanil (A.3.1), benzovindiflupyr (A.3.2), bixafen (A.3.3), boscalid (A.3.4), carboxin (A.3.5), fenfuram (A.3.6), fluopyram (A.3.7), flutolanil (A.3.8), fluxapyroxad (A.3.9), furametpyr (A.3.10), isofetamid (A.3.11 ), isopyrazam (A.3.12), mepronil (A.3.13), oxycarboxin (A.3.14), penflufen (A.3.15), penthiopyrad (A.3.16), pydiflumetofen (A.3.17), pyraziflumid (A.3.18), sedaxane (A.3.19), tecloftalam (A.3.20), thifluzamide (A.3.21 ), inpyrfluxam (A.3.22), pyrapropoyne (A.3.23), 1 ,3-dnmethyl-N-(1 ,1 ,3-trimethylindan-4- yl)pyrazole-4-carboxamide (A.3.24), fluindapyr (A.3.28), N-[2-[2-chloro-4- (trifluoro^methy phenoxylphenyll-S-idifluoromethy -S-fluoro-l-methyl-pyrazole^- carboxamide (A.3.29), methyl (£)-2-[2-[(5-cyano-2-methyl-phenoxy)methyl]phenyl]-3- methoxy-prop-2-enoate (A.3.30), isoflucypram (A.3.31), 2-(difluoromethyl)-/V-(1 ,1 ,3-trimethyl- indan-4-yl)pyridine-3-carboxamide (A.3.32), 2-(difluoromethyl)-/V-[(3/\ -1 ,1 ,3-trimethylindan- 4-yl]pyridine-3-carboxamide (A.3.33), 2-(difluoromethyl)-/V-(3-ethyl-1 ,1-dimethyl-indan-4-yl)- pyridine-3-carboxamide (A.3.34), 2-(difluoromethyl)-/V-[(3/\ -3-ethyl-1 ,1-dimethyl-indan-4-yl]- pyridine-3-carboxamide (A.3.35), 2-(difluoromethyl)-/V-(1 ,1-dimethyl-3-propyl-indan-4-yl)py- ridine-3-carboxamide (A.3.36), 2-(difluoromethyl)-/V-[(3/\ -1 ,1-dimethyl-3-propyl-indan-4-yl]- pyridine-3-carboxamide (A.3.37), 2-(difluoromethyl)-/V-(3-isobutyl-1 ,1-dimethyl-indan-4-yl)- pyridine-3-carboxamide (A.3.38), 2-(difluoromethyl)-/V-[(3/\ -3-isobutyl-1 ,1-dimethyl-indan- 4-yl]pyridine-3-carboxamide (A.3.39);
- other respiration inhibitors: diflumetorim (A.4.1); nitrophenyl derivates: binapacryl (A.4.2), dinobuton (A.4.3), dinocap (A.4.4), fluazinam (A.4.5), meptyldinocap (A.4.6), ferimzone (A.4.7); organometal compounds: fentin salts, e. g. fentin-acetate (A.4.8), fentin chloride (A.4.9) or fentin hydroxide (A.4.10); ametoctradin (A.4.1 1); silthiofam (A.4.12);
B) Sterol biosynthesis inhibitors (SBI fungicides)
- C14 demethylase inhibitors: triazoles: azaconazole (B.1.1), bitertanol (B.1.2), bromu- conazole (B.1.3), cyproconazole (B.1.4), difenoconazole (B.1.5), diniconazole (B.1.6), diniconazole-M (B.1.7), epoxiconazole (B.1.8), fenbuconazole (B.1.9), fluquinconazole (B.1.10), flusilazole (B.1.11 ), flutriafol (B.1.12), hexaconazole (B.1.13), imibenconazole
(B.1.14), ipconazole (B.1.15), metconazole (B.1.17), myclobutanil (B.1.18), oxpoconazole (B.1.19), paclobutrazole (B.1.20), penconazole (B.1.21 ), propiconazole (B.1.22), prothio- conazole (B.1.23), simeconazole (B.1.24), tebuconazole (B.1.25), tetraconazole (B.1.26), triadimefon (B.1.27), triadimenol (B.1.28), triticonazole (B.1.29), uniconazole (B.1.30), 2-(2,4-difluorophenyl)-1 ,1-difluoro-3-(tetrazol-1-yl)-1-[5-[4-(2,2,2-trifluoroethoxy)phenyl]- 2-pyridyl]propan-2-ol (B.1.31), 2-(2,4-difluorophenyl)-1 ,1-difluoro-3-(tetrazol-1-yl)-
1-[5-[4-(trifluoromethoxy)phenyl]-2-pyridyl]propan-2-ol (B.1.32), 4-[[6-[2-(2,4-difluorophenyl)- 1 ,1-difluoro-2-hydroxy-3-(5-sulfanyl-1 ,2,4-triazol-1-yl)propyl]-3-pyridyl]oxy]benzonitrile (B.1.33), ipfentrifluconazole (B.1.37), mefentrifluconazole (B.1.38), 2-(chloromethyl)-2- methyl-5-(p-tolylmethyl)-1-(1 ,2,4-triazol-1-ylmethyl)cyclopentanol (B.1.43); imidazoles:
imazalil (B.1.44), pefurazoate (B.1.45), prochloraz (B.1.46), triflumizol (B.1.47); pyrimidines, pyridines, piperazines: fenarimol (B.1.49), pyrifenox (B.1.50), triforine (B.1.51 ), [3-(4-chloro-
2-fluoro-phenyl)-5-(2,4-difluorophenyl)isoxazol-4-yl]-(3-pyridyl)methanol (B.1.52);
- Deltal 4-reductase inhibitors: aldimorph (B.2.1 ), dodemorph (B.2.2), dodemorph-acetate (B.2.3), fenpropimorph (B.2.4), tridemorph (B.2.5), fenpropidin (B.2.6), piperalin (B.2.7), spiroxamine (B.2.8);
- Inhibitors of 3-keto reductase: fenhexamid (B.3.1 );
- Other Sterol biosynthesis inhibitors: chlorphenomizole (B.4.1 );
C) Nucleic acid synthesis inhibitors
- phenylamides or acyl amino acid fungicides: benalaxyl (C.1.1 ), benalaxyl-M (C.1.2), kiralaxyl (C.1.3), metalaxyl (C.1.4), metalaxyl-M (C.1.5), ofurace (C.1.6), oxadixyl (C.1.7);
- other nucleic acid synthesis inhibitors: hymexazole (C.2.1 ), octhilinone (C.2.2), oxolinic acid (C.2.3), bupirimate (C.2.4), 5-fluorocytosine (C.2.5), 5-fluoro-2-(p-tolylmethoxy)pyrimidin- 4-amine (C.2.6), 5-fluoro-2-(4-fluorophenylmethoxy)pyrimidin-4-amine (C.2.7), 5-fluoro- 2-(4-chlorophenylmethoxy)pyrimidin-4 amine (C.2.8);
D) Inhibitors of cell division and cytoskeleton
- tubulin inhibitors: benomyl (D.1.1), carbendazim (D.1.2), fuberidazole (D1.3), thiabendazole (D.1.4), thiophanate-methyl (D.1.5), pyridachlometyl (D.1.6), /V-ethyl-2-[(3-ethynyl-8-methyl- 6-quinolyl)oxy]butanamide (D.1.8), /V-ethyl-2-[(3-ethynyl-8-methyl-6-quinolyl)oxy]-2- methylsulfanyl-acetamide (D.1.9), 2-[(3-ethynyl-8-methyl-6-quinolyl)oxy]-/V-(2- fluoroethyl)butanamide (D.1.10), 2-[(3-ethynyl-8-methyl-6-quinolyl)oxy]-/V-(2-fluoroethyl)-2- methoxy-acetamide (D.1.1 1), 2-[(3-ethynyl-8-methyl-6-quinolyl)oxy]-/V-propyl-butanamide (D.1.12), 2-[(3-ethynyl-8-methyl-6-quinolyl)oxy]-2-methoxy-/V-propyl-acetamide (D.1.13), 2- [(3-ethynyl-8-methyl-6-quinolyl)oxy]-2-methylsulfanyl-/V-propyl-acetamide (D.1.14),
2-[(3-ethynyl-8-methyl-6-quinolyl)oxy]-/V-(2-fluoroethyl)-2-methylsulfanyl-acetamide (D.1.15), 4-(2-bromo-4-fluoro-phenyl)-/V-(2-chloro-6-fluoro-phenyl)-2,5-dimethyl-pyrazol-3-amine (D.1.16);
- other cell division inhibitors: diethofencarb (D.2.1 ), ethaboxam (D.2.2), pencycuron (D.2.3), fluopicolide (D.2.4), zoxamide (D.2.5), metrafenone (D.2.6), pyriofenone (D.2.7),
phenamacril (D.2.8);
E) Inhibitors of amino acid and protein synthesis
- methionine synthesis inhibitors: cyprodinil (E.1.1 ), mepanipyrim (E.1.2), pyrimethanil (E.1.3);
- protein synthesis inhibitors: blasticidin-S (E.2.1), kasugamycin (E.2.2), kasugamycin hydro- chloride-hydrate (E.2.3), mildiomycin (E.2.4), streptomycin (E.2.5), oxytetracyclin (E.2.6);
F) Signal transduction inhibitors
- MAP / histidine kinase inhibitors: fluoroimid (F.1.1), iprodione (F.1.2), procymidone (F.1.3), vinclozolin (F.1.4), fludioxonil (F.1.5);
- G protein inhibitors: quinoxyfen (F.2.1 );
G) Lipid and membrane synthesis inhibitors
- Phospholipid biosynthesis inhibitors: edifenphos (G.1.1 ), iprobenfos (G.1.2), pyrazophos (G.1.3), isoprothiolane (G.1.4);
- lipid peroxidation: dicloran (G.2.1), quintozene (G.2.2), tecnazene (G.2.3), tolclofos-methyl (G.2.4), biphenyl (G.2.5), chloroneb (G.2.6), etridiazole (G.2.7), zinc thiazole (G.2.8);
- phospholipid biosynthesis and cell wall deposition: dimethomorph (G.3.1 ), flumorph (G.3.2), mandipropamid (G.3.3), pyrimorph (G.3.4), benthiavalicarb (G.3.5), iprovalicarb (G.3.6), valifenalate (G.3.7);
- compounds affecting cell membrane permeability and fatty acides: propamocarb (G.4.1 );
- inhibitors of oxysterol binding protein: oxathiapiprolin (G.5.1), fluoxapiprolin (G.5.3), 4-[1-[2- [3-(difluoromethyl)-5-methyl-pyrazol-1-yl]acetyl]-4-piperidyl]-/V-tetralin-1-yl-pyridine-2- carboxamide (G.5.4), 4-[1-[2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetyl]-4-piperidyl]-/\A tetralin-1-yl-pyridine-2-carboxamide (G.5.5), 4-[1-[2-[3-(difluoromethyl)-5-(tri- fluoromethyl)pyrazol-1-yl]acetyl]-4-piperidyl]-/V-tetralin-1-yl-pyridine-2-carboxamide (G.5.6), 4-[1-[2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]acetyl]-4-piperidyl]-/V-tetralin-1-yl-pyri- dine-2-carboxamide (G.5.7), 4-[1-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]-4-piperi- dyl]-/V-tetralin-1-yl-pyridine-2-carboxamide (G.5.8), 4-[1-[2-[5-(difluoromethyl)-3-(trifluoro- methyl)pyrazol-1-yl]acetyl]-4-piperidyl]-/V-tetralin-1-yl-pyridine-2-carboxamide (G.5.9),
4-[1 -[2-[3,5-bis(trifluoromethyl)pyrazol-1 -yl]acetyl]-4-piperidyl]-A tetralin-1 -yl-pyridine-2-car- boxamide (G.5.10), (4-[1-[2-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl]-4-piperidyl]- /V-tetralin-1-yl-pyridine-2-carboxamide (G.5.11 );
H) Inhibitors with Multi Site Action
- inorganic active substances: Bordeaux mixture (H.1.1), copper (H.1.2), copper acetate
(H.1.3), copper hydroxide (H.1.4), copper oxychloride (H.1.5), basic copper sulfate (H.1.6), sulfur (H.1.7);
- thio- and dithiocarbamates: ferbam (H.2.1 ), mancozeb (H.2.2), maneb (H.2.3), metam
(H.2.4), metiram (H.2.5), propineb (H.2.6), thiram (H.2.7), zineb (H.2.8), ziram (H.2.9);
- organochlorine compounds: anilazine (H.3.1 ), chlorothalonil (H.3.2), captafol (H.3.3), captan (H.3.4), folpet (H.3.5), dichlofluanid (H.3.6), dichlorophen (H.3.7), hexachlorobenzene (H.3.8), pentachlorphenole (H.3.9) and its salts, phthalide (H.3.10), tolylfluanid (H.3.1 1 );
- guanidines and others: guanidine (H.4.1 ), dodine (H.4.2), dodine free base (H.4.3),
guazatine (H.4.4), guazatine-acetate (H.4.5), iminoctadine (H.4.6), iminoctadine-triacetate (H.4.7), iminoctadine-tris(albesilate) (H.4.8), dithianon (H.4.9), 2,6-dimethyl-1 A/,5AL[1 ,4]di- thiino[2,3-c:5,6-c']dipyrrole-1 ,3,5,7(2A/,6A)-tetraone (H.4.10);
I) Cell wall synthesis inhibitors
- inhibitors of glucan synthesis: validamycin (1.1.1 ), polyoxin B (1.1.2);
- melanin synthesis inhibitors: pyroquilon (1.2.1 ), tricyclazole (I.2.2), carpropamid (1.2.3), dicyclomet (I.2.4), fenoxanil (1.2.5);
J) Plant defence inducers
- acibenzolar-S-methyl (J.1.1 ), probenazole (J.1.2), isotianil (J.1.3), tiadinil (J.1.4), prohexa- dione-calcium (J.1.5); phosphonates: fosetyl (J.1.6), fosetyl-aluminum (J.1.7), phosphorous acid and its salts (J.1.8), calcium phosphonate (J.1.1 1), potassium phosphonate (J.1.12), potassium or sodium bicarbonate (J.1.9), 4-cyclopropyl-/V-(2,4-dimethoxyphenyl)thiadiazole-
5-carboxamide (J.1.10);
K) Unknown mode of action
- bronopol (K.1.1 ), chinomethionat (K.1.2), cyflufenamid (K.1.3), cymoxanil (K.1.4), dazomet (K.1.5), debacarb (K.1.6), diclocymet (K.1.7), diclomezine (K.1.8), difenzoquat (K.1.9), di- fenzoquat-methylsulfate (K.1.10), diphenylamin (K.1.11 ), fenitropan (K.1.12), fenpyrazamine (K.1.13), flumetover (K.1.14), flusulfamide (K.1.15), flutianil (K.1.16), harpin (K.1.17), metha- sulfocarb (K.1.18), nitrapyrin (K.1.19), nitrothal-isopropyl (K.1.20), tolprocarb (K.1.21 ), oxin- copper (K.1.22), proquinazid (K.1.23), tebufloquin (K.1.24), tecloftalam (K.1.25), triazoxide (K.1.26), /Vi(4-(4-chloro-3-trifluoromethyl-phenoxy)-2,5-dimethyl-phenyl)-/V-ethyl-/V-methyl formamidine (K.1.27), /Vi(4-(4-fluoro-3-trifluoromethyl-phenoxy)-2,5-dimethyl-phenyl)-/V-eth- yl-/V-methyl formamidine (K.1.28), /Vi[4-[[3-[(4-chlorophenyl)methyl]-1 ,2,4-thiadiazol-5-yl]- oxy]-2,5-dimethyl-phenyl]-/V-ethyl-/V-methyl-formamidine (K.1.29), /V^S-bromo-e-indan^- yloxy-2-methyl-3-pyridyl)-/V-ethyl-/V-methyl-formamidine (K.1.30), /V^S-bromo-e-ld-^S-diflu- orophenyl)ethoxy]-2-methyl-3-pyridyl]-/V-ethyl-/V-methyl-formamidine (K.1.31), /V^S-bromo-
6-(4-isopropylcyclohexoxy)-2-methyl-3-pyridyl]-/V-ethyl-/V-methyl-formamidine (K.1.32), /Vi[5-bromo-2-methyl-6-(1-phenylethoxy)-3-pyridyl]-/V-ethyl-/V-methyl-formamidine (K.1.33), /Vi(2-methyl-5-trifluoromethyl-4-(3-trimethylsilanyl-propoxy)-phenyl)-/V-ethyl-/V-methyl forma- midine (K.1.34), /Vi(5-difluoromethyl-2-methyl-4-(3-trimethylsilanyl-propoxy)-phenyl)-/V-ethyl- /V-methyl formamidine (K.1.35), 2-(4-chloro-phenyl)-/V-[4-(3,4-dimethoxy-phenyl)-isoxazol- 5-yl]-2-prop-2-ynyloxy-acetamide (K.1.36), 3-[5-(4-chloro-phenyl)-2,3-dimethyl-isoxazolidin- 3-yl]-pyhdine (pyrisoxazole) (K.1.37), 3-[5-(4-methylphenyl)-2,3-dimethyl-isoxazolidin-3 yl]- pyridine (K.1.38), 5-chloro-1-(4,6-dimethoxy-pyrimidin-2-yl)-2-methyl-1 TT-benzoimidazole (K.1.39), ethyl (2)-3-amino-2-cyano-3-phenyl-prop-2-enoate (K.1.40), picarbutrazox (K.1.41), pentyl /V-[6-[[(2)-[(1-methyltetrazol-5-yl)-phenyl-methylene]amino]oxymethyl]-2-pyridyl]carba- mate (K.1.42), but-3-ynyl /V-[6-[[(2)-[(1-methyltetrazol-5-yl)-phenyl-methylene]amino]oxy- methyl]-2-pyridyl]carbamate (K.1.43), ipflufenoquin (K.1.44), quinofumelin (K.1.47), benziothiazolinone (K.1.48), bromothalonil (K.1.49), 2-(6-benzyl-2-pyridyl)quinazoline
(K.1.50), 2-[6-(3-fluoro-4-methoxy-phenyl)-5-methyl-2-pyridyl]quinazoline (K.1.51 ), dichlobentiazox (K.1.52), /Vi(2,5-dimethyl-4-phenoxy-phenyl)-/V-ethyl-/V-methyl-formamidine (K.1.53), pyrifenamine (K.1.54), fluopimomide (K.1.55), N'-[5-bromo-2-methyl-6-(1-methyl-2 propoxy-ethoxy)-3-pyridyl]-N-ethyl-N-methyl-formamidine (K.1.56) , N'-[4-(4,5- dichlorothiazol-2-yl)oxy-2,5-dimethyl-phenyl]-N-ethyl-N-methyl-formamidine (K.1.57);
M) Growth regulators
abscisic acid (M.1.1 ), amidochlor, ancymidol, 6-benzylaminopurine, brassinolide, butralin, chlormequat, chlormequat chloride, choline chloride, cyclanilide, daminozide, dikegulac, dimethipin, 2,6-dimethylpuridine, ethephon, flumetralin, flurprimidol, fluthiacet, forchlorfenuron, gibberellic acid, inabenfide, indole-3-acetic acid , maleic hydrazide, mefluidide, mepiquat, mepiquat chloride, naphthaleneacetic acid, /V-6-benzyl adenine, paclobutrazol, prohexadione, prohexadione-calcium, prohydrojasmon, thidiazuron, triapenthenol, tributyl phosphorotrithioate, 2,3,5-tri-iodobenzoic acid , trinexapac-ethyl, uniconazole;
N) Herbicides from classes N.1 to N.15
N.1 Lipid biosynthesis inhibitors: alloxydim, alloxydim-sodium, butroxydim, clethodim,
clodinafop, clodinafop-propargyl, cycloxydim, cyhalofop, cyhalofop-butyl, diclofop, diclofop- methyl, fenoxaprop, fenoxaprop-ethyl, fenoxaprop-P, fenoxaprop-P-ethyl, fluazifop, fluazifop- butyl, fluazifop-P, fluazifop-P-butyl, haloxyfop, haloxyfop-methyl, haloxyfop-P, haloxyfop-P- methyl, metamifop, pinoxaden, profoxydim, propaquizafop, quizalofop, quizalofop-ethyl, quizalofop-tefuryl, quizalofop-P, quizalofop-P-ethyl, quizalofop-P-tefuryl, sethoxydim, tepraloxydim, tralkoxydim, 4-(4'-chloro-4-cyclo~,propyl-2'-fluoro[1 ,1 '-biphenyl]-3-yl)-5-hy- droxy-2,2,6,6-tetramethyl-2 pyran-S^A^-one (1312337-72-6); 4-(2',4'-dichloro-4-cyclo- propyl[1 ,1 '-biphenyl]-3-yl)-5-hydroxy-2,2,6,6-tetramethyl-2A7Lpyran-3(6 7)-one (1312337-45- 3); 4-(4'-chloro-4-ethyl-2'-fluoro[1 ,1 '-biphenyl]-3-yl)-5-hydroxy-2,2,6,6-tetramethyl-2 7Lpyran- 3(6A)-one (1033757-93-5); 4-(2',4'-dichloro-4-ethyl[1 ,1'-biphenyl]-3-yl)-2,2,6,6-tetramethyl- 2^ί-pyran-3,5(4A/,6^)-dione (1312340-84-3); 5-(acetyloxy)-4-(4'-chloro-4-cyclopropyl-2'- fluoro[1 ,1 '-biphenyl]-3-yl)-3,6-dihydro-2,2,6,6-tetramethyl-2 7Lpyran-3-one (1312337-48-6); 5-(acetyloxy)-4-(2',4'-dichloro-4-cyclopropyl- [1 , 1 '-biphenyl]-3-yl)-3,6-dihydro-2,2,6,6-tetra- methyl^A pyran-S-one; 5-(acetyloxy)-4-(4'-chloro-4-ethyl-2'-fluoro[1 ,1 '-biphenyl]-3-yl)- S^-dihydro^^^^-tetramethyl^A pyran-S-one (1312340-82-1); 5-(acetyloxy)-4-(2',4'-di- chloro-4-ethyl[1 ,1 '-biphenyl]-3-yl)-3,6-dihydro-2,2,6,6-tetramethyl-2 7Lpyran-3-one (1033760- 55-2); 4-(4'-chloro-4-cyclopropyl-2'-fluoro[1 ,1 '-biphenyl]-3-yl)-5,6-dihydro-2,2,6,6-tetramethyl- S-oxo^A pyran-S-yl carbonic acid methyl ester (1312337-51-1); 4-(2',4'-dichloro -4-cyclo- propyl- [1 ,1'-biphenyl]-3-yl)-5,6-dihydro-2,2,6,6-tetramethyl-5-oxo-2A7Lpyran-3-yl carbonic acid methyl ester; 4-(4'-chloro-4-ethyl-2'-fluoro[1 ,1 '-biphenyl]-3-yl)-5,6-dihydro-2,2,6,6-tetra- methyl-S-oxo^A pyran-S-yl carbonic acid methyl ester (1312340-83-2); 4-(2',4'-dichloro- 4-ethyh[1 ,1 '-biphenyl]-3-yl)-5,6-dihydro-2,2,6,6-tetramethyl-5-oxo-2A7Lpyran-3-yl carbonic acid methyl ester (1033760-58-5); benfuresate, butylate, cycloate, dalapon, dimepiperate, EPTC, esprocarb, ethofumesate, flupropanate, molinate, orbencarb, pebulate, prosulfocarb, TCA, thiobencarb, tiocarbazil, triallate, vernolate;
N.2 ALS inhibitors: amidosulfuron, azimsulfuron, bensulfuron, bensulfuron-methyl, chlorimuron, chlorimuron-ethyl, chlorsulfuron, cinosulfuron, cyclosulfamuron, ethametsulfuron, ethamet- sulfuron-methyl, ethoxysulfuron, flazasulfuron, flucetosulfuron, flupyrsulfuron, flupyrsulfuron- methyl-sodium, foramsulfuron, halosulfuron, halosulfuron-methyl, imazosulfuron, iodosulfu- ron, iodosulfuron-methyl-sodium, iofensulfuron, iofensulfuron-sodium, mesosulfuron, meta- zosulfuron, metsulfuron, metsulfuron-methyl, nicosulfuron, orthosulfamuron, oxasulfuron, primisulfuron, primisulfuron-methyl, propyrisulfuron, prosulfuron, pyrazosulfuron, pyrazo- sulfuron-ethyl, rimsulfuron, sulfometuron, sulfometuron-methyl, sulfosulfuron, thifensulfuron, thifensulfuron-methyl, triasulfuron, tribenuron, tribenuron-methyl, trifloxysulfuron, triflusul- furon, triflusulfuron-methyl, tritosulfuron, imazamethabenz, imazamethabenz-methyl, imaza- mox, imazapic, imazapyr, imazaquin, imazethapyr; cloransulam, cloransulam-methyl, diclo- sulam, flumetsulam, florasulam, metosulam, penoxsulam, pyrimisulfan, pyroxsulam; bispyri- bac, bispyribac-sodium, pyribenzoxim, pyriftalid, pyriminobac, pyriminobac-methyl, pyrithio- bac, pyrithiobac-sodium, 4-[[[2-[(4,6-dimethoxy-2-pyrimidinyl)oxy]phenyl]methyl]amino]- benzoic acid-1 -methyhethyl ester (420138-41-6), 4-[[[2-[(4,6-dimethoxy-2-pyrimidinyl)oxy]- phenylj-'methyllaminol-benzoic acid propyl ester (420138-40-5), /V-(4-bromophenyl)- 2-[(4,6-dimethoxy-2-pyrimidinyl)oxy]benzenemethanamine (420138-01-8); flucarbazone,
flucarbazone-sodium, propoxycarbazone, propoxycarbazone-sodium, thiencarbazone, thiencarbazone-methyl; triafamone;
N.3 Photosynthesis inhibitors: amicarbazone; chlorotriazine; ametryn, atrazine, chlohdazone, cyanazine, desmetryn, dimethametryn,hexazinone, metribuzin, prometon, prometryn, pro- pazine, simazine, simetryn, terbumeton, terbuthylazin, terbutryn, trietazin; chlorobromuron, chlorotoluron, chloroxuron, dimefuron, diuron, fluometuron, isoproturon, isouron, linuron, metamitron, methabenzthiazuron, metobenzuron, metoxuron, monolinuron, neburon, sidu- ron, tebuthiuron, thiadiazuron, desmedipham, karbutilat, phenmedipham, phenmedipham- ethyl, bromofenoxim, bromoxynil and its salts and esters, ioxynil and its salts and esters, bromacil, lenacil, terbacil, bentazon, bentazon-sodium, pyridate, pyridafol, pentanochlor, propanil; diquat, diquat-dibromide, paraquat, paraquat-dichloride, paraquat-dimetilsulfate, 1- (e-tert-butylpyrimidin^-yl^-hydroxy^-methHOxy-S-methyl^H-pynOl-S-one (1654744-66-7), 1 -(5-tert-butylisoxazol-3-yl)-2-hydroxy-4 methoxy-3-methyl-2H-pyrrol-5-one (1637455-12-9),
1-(5-tert-butylisoxazol-3-yl)-4-chloro-2 hydroxy-3-methyl-2H-pyrrol-5-one (1637453-94-1), 1- (5-tert-butyl-1 -methyl-pyrazol-3-yl)-4 chloro-2-hydroxy-3-methyl-2H-pyrrol-5-one (1654057- 29-0), 1 -(5-tert-butyl-1 -methyl-pyrazol-3-yl)-3-chloro-2-hydroxy-4-methyl-2H-pyrrol-5-one
(1654747-80-4), 4-hydroxy-1 methoxy-5-methyl-3-[4-(trifluoromethyl)-2-pyridyl]imidazolidin-
2-one; (2023785-78-4), 4 hydroxy-1 ,5-dimethyl-3-[4-(trifluoromethyl)-2-pyridyl]imidazolidin-2- one (2023785-79-5), 5 ethoxy-4-hydroxy-1-methyl-3-[4-(trifluoromethyl)-2- pyridyl]imidazolidin-2-one (1701416-69-4), 4-hydroxy-1-methyl-3-[4-(trifluoromethyl)-2- pyridyl]imidazolidin-2-one (1708087-22-2), 4 hydroxy-1 ,5-dimethyl-3-[1 -methyl-5- (trifluoromethyl)pyrazol-3-yl]imidazolidin-2-one (2023785-80-8), 1-(5-tert-butylisoxazol-3-yl)-
4-ethoxy-5-hydroxy-3-methyl-imidazolidin-2-one (1844836-64-1 );
N.4 protoporphyrinogen-IX oxidase inhibitors: acifluorfen, acifluorfen-sodium, azafenidin, ben- carbazone, benzfendizone, bifenox, butafenacil, carfentrazone, carfentrazone-ethyl, chlor- methoxyfen, cinidon-ethyl, fluazolate, flufenpyr, flufenpyr-ethyl, flumiclorac, flumiclorac-pen- tyl, flumioxazin, fluoroglycofen, fluoroglycofen-ethyl, fluthiacet, fluthiacet-methyl, fomesafen, halosafen, lactofen, oxadiargyl, oxadiazon, oxyfluorfen, pentoxazone, profluazol, pyraclonil, pyraflufen, pyraflufen-ethyl, saflufenacil, sulfentrazone, thidiazimin, tiafenacil, trifludimoxazin, ethyl [3-[2-chloro-4-fluoro-5-(1-methyl-6-trifluoromethyl-2,4-dioxo-1 ,2,3,4-tetrahydropyrimi- din-3-yl)phenoxy]-2-pyridyloxy]acetate (353292-31-6), /V-ethyl-3-(2,6-dichloro-4-trifluoro- methylphenoxy)-5-methyl-1 //-pyrazole-1 -carboxamide (452098-92-9), /V-tetrahydrofurfuryl-
3-(2,6-dichloro-4-trifluoromethylphenoxy)-5-methyl-1 //-pyrazole-1 -carboxamide (915396-43- 9), /V-ethyl-3-(2-chloro-6-fluoro-4-trifluoromethyhphenoxy)-5-methyl-1 //-pyrazole-1 -carbox- amide (452099-05-7), /V-tetrahydro-,furfuryl-3-(2-chloro-6-fluoro-4-trifluoro-,methylphenoxy)-
5-methyl-1 //-pyrazole-1 -carboxamide (452100-03-7), 3-[7-fluoro-3-oxo-4-(prop-2-ynyl)-
3.4-dihydro-277-benzo[1 ,4]oxazin-6-yl]-1 ,5-dimethyl-6-thioxo-[1 ,3,5]triazinan-2,4-dione (451484-50-7), 2-(2,2,7-trifluoro-3-oxo-4-prop-2-ynyl-3,4-dihydro-2ATLbenzo[1 ,4]oxazin-6-yl)- 4,5,6,7-tetrahydro-isoindole-1 ,3-dione (1300118-96-0), l-methyl-e-trifluoro^methyl- 3-(2,2,7-tri-fluoro-3-oxo-4-prop-2-ynyl-3,4-dihydro-2ATLbenzo[1 ,4]oxazin-6-yl)-1 TT-pyrimidine-
2.4-dione (1304113-05-0), methyl (£)-4-[2-chloro-5-[4-chloro-5-(difluoromethoxy)-1 TT-methyl- pyrazol-3-yl]-4-fluoro-phenoxy]-3-methoxy-but-2-enoate (948893-00-3), 3-[7-chloro-5-fluoro- 2-(trifluoromethyl)-1 TT-benzimidazol^-yll-l -methyl-6-(trifluoromethyl)-1 /^-pyrimidine-2, 4-di- one (212754-02-4);
N.5 Bleacher herbicides: beflubutamid, diflufenican, fluridone, flurochloridone, flurtamone, norflurazon, picolinafen, 4-(3-trifluoromethyhphenoxy)-2-(4-trifluoromethylphenyl)pyrimidine (180608-33-7); benzobicyclon, benzofenap, bicyclopyrone, clomazone, fenquintrione, isoxaflutole, mesotrione, pyrasulfotole, pyrazolynate, pyrazoxyfen, sulcotrione, tefuryltrione, tembotrione, tolpyralate, topramezone; aclonifen, amitrole, flumeturon;
N.6 EPSP synthase inhibitors: glyphosate, glyphosate-isopropylammonium, glyposate- potassium, glyphosate-trimesium (sulfosate);
N.7 Glutamine synthase inhibitors: bilanaphos (bialaphos), bilanaphos-sodium, glufosinate, glufosinate-P, glufosinate-ammonium;
N.8 DHP synthase inhibitors: asulam;
N.9 Mitosis inhibitors: benfluralin, butralin, dinitramine, ethalfluralin, fluchloralin, oryzalin, pen- dimethalin, prodiamine, trifluralin; amiprophos, amiprophos-methyl, butamiphos; chlorthal, chlorthal-dimethyl, dithiopyr, thiazopyr, propyzamide, tebutam; carbetamide, chlorpropham, flamprop, flamprop-isopropyl, flamprop-methyl, flamprop-M-isopropyl, flamprop-M-methyl, propham;
N.10 VLCFA inhibitors: acetochlor, alachlor, butachlor, dimethachlor, dimethenamid, dimethen- amid-P, metazachlor, metolachlor, metolachlor-S, pethoxamid, pretilachlor, propachlor, prop- isochlor, thenylchlor, flufenacet, mefenacet, diphenamid, naproanilide, napropamide, napro- pamide-M, fentrazamide, anilofos, cafenstrole, fenoxasulfone, ipfencarbazone, piperophos, pyroxasulfone, isoxazoline compounds of the formulae 11.1 , II.2, II.3, 11.4, II.5, II.6, II.7, II.8 and II.9
N.1 1 Cellulose biosynthesis inhibitors: chlorthiamid, dichlobenil, flupoxam, indaziflam, isoxaben, triaziflam, 1 -cyclohexyl-5-pentafluorphenyloxy-14-[1 ,2,4,6]thiatriazin-3-ylamine (175899-01 - 1 );
N.12 Decoupler herbicides: dinoseb, dinoterb, DNOC and its salts;
N.13 Auxinic herbicides: 2,4-D and its salts and esters, clacyfos, 2,4-DB and its salts and
esters, aminocyclopyrachlor and its salts and esters, aminopyralid and its salts such as aminopyralid-dimethylammonium, aminopyralid-tris(2-hydroxypropyl)ammonium and its esters, benazolin, benazolin-ethyl, chloramben and its salts and esters, clomeprop, clopy- ralid and its salts and esters, dicamba and its salts and esters, dichlorprop and its salts and esters, dichlorprop-P and its salts and esters, fluroxypyr, fluroxypyr-butometyl, fluroxypyr- meptyl, halauxifen and its salts and esters (943832-60-8); MCPA and its salts and esters, MCPA-thioethyl, MCPB and its salts and esters, mecoprop and its salts and esters, meco- prop-P and its salts and esters, picloram and its salts and esters, quinclorac, quinmerac,
TBA (2,3,6) and its salts and esters, triclopyr and its salts and esters, 4-amino-3-chloro- 6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylic acid, florpyrauxifen- benzyl, florpyrauxifen;
N.14 Auxin transport inhibitors: diflufenzopyr, diflufenzopyr-sodium, naptalam, naptalam- sodium;
N.15 Other herbicides: bromobutide, chlorflurenol, chlorflurenol-methyl, cinmethylin, cumyluron, cyclopyrimorate (499223-49-3) and its salts and esters, dalapon, dazomet, difenzoquat, di- fenzoquat-metilsulfate, dimethipin, DSMA, dymron, endothal and its salts, etobenzanid, flu- renol, flurenol-butyl, flurprimidol, fosamine, fosamine-ammonium, indanofan, maleic hydra- zide, mefluidide, metam, methiozolin (403640-27-7), methyl azide, methyl bromide, methyl- dymron, methyl iodide, MSMA, oleic acid, oxaziclomefone, pelargonic acid, pyributicarb, quinoclamine, tridiphane;
O) Insecticides from classes 0.1 to 0.29
O.1 Acetylcholine esterase (AChE) inhibitors: aldicarb (0.1.1 ), alanycarb (0.1 .2), bendiocarb
(0.1.3), benfuracarb (0.1 .4), butocarboxim (0.1.5), butoxycarboxim (0.1.6), carbaryl (0.1.7), carbofuran (0.1.8), carbosulfan (0.1.9), ethiofencarb (0.1 .10), fenobucarb (0.1 .1 1 ), formetanate (0.1 .12), furathiocarb (0.1 .13), isoprocarb (0.1.14), methiocarb (0.1.15), methomyl (0.1 .16), metolcarb (0.1 .17), oxamyl (0.1.18), pirimicarb (0.1 .19), propoxur (0.1.20), thiodicarb (0.1.21 ), thiofanox (0.1 .22), trimethacarb (0.1 .23), XMC (0.1.24), xylylcarb (0.1.25), triazamate (0.1.26), acephate (0.1.27), azamethiphos (0.1.28), azinphos-ethyl (0.1 .29), azinphosmethyl (0.1 .30), cadusafos (0.1.31 ), chlorethoxyfos (0.1.32), chlorfenvinphos (0.1 .33), chlormephos (0.1 .34), chlorpyrifos (0.1.35), chlorpyrifos- methyl (0.1 .36), coumaphos (0.1.37), cyanophos (0.1 .38), demeton-S-methyl (0.1 .39), diazinon (0.1 .40), dichlorvos/ DDVP (0.1 .41 ), dicrotophos (0.1 .42), dimethoate (0.1 .43), dimethylvinphos (0.1 .44), disulfoton (0.1 .45), EPN (0.1.46), ethion (0.1 .47), ethoprophos
(0.1.48), famphur (0.1 .49), fenamiphos (0.1.50), fenitrothion (0.1.51 ), fenthion (0.1.52), fosthiazate (0.1 .53), heptenophos (0.1 .54), imicyafos (0.1 .55), isofenphos (0.1.56), isopropyl O-(methoxyaminothio-phosphoryl) salicylate (0.1 .57), isoxathion (0.1.58), malathion (0.1 .59), mecarbam (0.1.60), methamidophos (0.1 .61 ), methidathion (0.1.62), mevinphos (0.1 .63), monocrotophos (0.1.64), naled (0.1 .65), omethoate (0.1.66), oxydemeton-methyl (0.1 .67), parathion (0.1.68), parathion-methyl (0.1.69), phenthoate (0.1.70), phorate (0.1.71 ), phosalone (0.1.72), phosmet (0.1.73), phosphamidon (0.1.74), phoxim (0.1.75), pirimiphos- methyl (0.1 .76), profenofos (0.1.77), propetamphos (0.1.78), prothiofos (0.1 .79), pyraclofos (0.1 .80), pyridaphenthion (0.1.81 ), quinalphos (0.1.82), sulfotep (0.1.83), tebupirimfos (0.1.84), temephos (0.1.85), terbufos (0.1.86),
tetrachlorvinphos (0.1 .87), thiometon (0.1 .88), triazophos (0.1 .89), trichlorfon (0.1.90), vamidothion (0.1 .91 );
0.2 GABA-gated chloride channel antagonists: endosulfan (0.2.1 ), chlordane (0.2.2), ethiprole (0.2.3), fipronil (0.2.4), flufiprole (0.2.5), pyrafluprole (0.2.6), pyriprole (0.2.7);
0.3 Sodium channel modulators: acrinathrin (0.3.1 ), allethrin (0.3.2), d-cis-trans allethrin
(0.3.3), d-trans allethrin (0.3.4), bifenthrin (0.3.5), kappa-bifenthrin (0.3.6), bioallethrin (0.3.7), bioallethrin S-cylclopentenyl (0.3.8), bioresmethrin (0.3.9), cycloprothrin (0.3.10), cyfluthrin (0.3.1 1 ), beta-cyfluthrin (0.3.12), cyhalothrin (0.3.13), lambda-cyhalothrin
(0.3.14), gamma-cyhalothrin (0.3.15), cypermethrin (0.3.16), alpha-cypermethrin (0.3.17), beta-cypermethrin (0.3.18), theta-cypermethrin (0.3.19), zeta-cypermethrin (0.3.20), cyphenothrin (0.3.21 ), deltamethrin (0.3.22), empenthrin (0.3.23), esfenvalerate (0.3.24), etofenprox (0.3.25), fenpropathrin (0.3.26), fenvalerate (0.3.27), flucythrinate (0.3.28), flumethrin (0.3.29), tau-fluvalinate (0.3.30), halfenprox (0.3.31 ), heptafluthrin (0.3.32), imiprothrin (0.3.33), meperfluthrin (0.3.34), metofluthrin (0.3.35), momfluorothrin (0.3.36), epsilon-momfluorothrin (0.3.37), permethrin (0.3.38), phenothrin (0.3.39), prallethrin (0.3.40), profluthrin (0.3.41 ), pyrethrin (pyrethrum) (0.3.42), resmethrin (0.3.43), silafluofen (0.3.44), tefluthrin (0.3.45), kappa-tefluthrin (0.3.46), tetramethylfluthrin (0.3.47), tetramethrin (0.3.48), tralomethrin (0.3.49), transfluthrin (0.3.50), DDT (0.3.51 ), methoxychlor (0.3.52);
0.4 Nicotinic acetylcholine receptor agonists (nAChR): acetamiprid (0.4.1 ), clothianidin (0.4.2), cycloxaprid (0.4.3), dinotefuran (0.4.4), imidacloprid (0.4.5), nitenpyram (0.4.6), thiacloprid (0.4.7), thiamethoxam (0.4.8), 4,5-dihydro-/V-nitro-1 -(2-oxiranylmethyl)-1 TT-imidazol^-amine (0.4.9), (2£)-1 -[(6-chloropyridin-3-yl)methyl]-/V:-nitro-2-pentylidene- hydrazinecarboximidamide (0.4.10), 1 -[(6-chloropyridin-3-yl)methyl]-7-methyl-8-nitro-5- propoxy-1 ,2,3,5,6,7-hexahydroimidazo[1 ,2-a]pyridine (0.4.1 1 ), nicotine (0.4.12), sulfoxaflor (0.4.13), flupyradifurone (0.4.14), triflumezopyrim (0.4.15), (3/\ -3-(2-chlorothiazol-5-yl)-8- methyl-5-oxo-6-phenyl-2,3-dihydrothiazolo[3,2-a]pyrimidin-8-ium-7-olate (0.4.16), (3S)-3-(6- chloro-3-pyridyl)-8-methyl-5-oxo-6-phenyl-2,3-dihydrothiazolo[3,2-a]pyrimidin-8-ium-7-olate (0.4.17), (3S)-8-methyl-5-oxo-6-phenyl-3-pyrimidin-5-yl-2,3-dihydrothiazolo[3,2-a]pyrimidin- 8-ium-7-olate (0.4.18), (3/\ -3-(2-chlorothiazol-5-yl)-8-methyl-5-oxo-6-[3- (trifluoromethyl)phenyl]-2,3-dihydrothiazolo[3,2-a]pyrimidin-8-ium-7-olate (0.4.19), ( 3R)-3-{2 - chlorothiazol-5-yl)-6-(3,5-dichlorophenyl)-8-methyl-5-oxo-2,3-dihydrothiazolo[3,2-a]pyrimidin- 8-ium-7-olate (0.4.20), (3/\ -3-(2-chlorothiazol-5-yl)-8-ethyl-5-oxo-6-phenyl-2,3-di- hydrothiazolo[3,2-a]pyrimidin-8-ium-7-olate (0.4.21 );
0.5 Nicotinic acetylcholine receptor allosteric activators: spinosad (0.5.1 ), spinetoram (0.5.2);
0.6 Chloride channel activators: abamectin (0.6.1), emamectin benzoate (0.6.2), ivermectin (0.6.3), lepimectin (0.6.4), milbemectin (0.6.5);
0.7 Juvenile hormone mimics: hydroprene (0.7.1), kinoprene (0.7.2), methoprene (0.7.3), fenoxycarb (0.7.4), pyriproxyfen (0.7.5);
0.8 miscellaneous non-specific (multi-site) inhibitors: methyl bromide (0.8.1) and other alkyl halides, chloropicrin (0.8.2), sulfuryl fluoride (0.8.3), borax (0.8.4), tartar emetic (0.8.5);
0.9 Chordotonal organ TRPV channel modulators: pymetrozine (0.9.1 ), pyrifluquinazon (0.9.2), flonicamid (0.9.3);
0.10 Mite growth inhibitors: clofentezine (0.10.1 ), hexythiazox (0.10.2), diflovidazin (0.10.3), etoxazole (0.10.4);
0.1 1 Microbial disruptors of insect midgut membranes: Bacillus thuringiensis, Bacillus
sphaericus and the insecticdal proteins they produce: Bacillus thuringiensis subsp.
Israe/ensis (0.1 1.1), Bacillus sphaericus (0.1 1.2), Bacillus thuringiensis subsp. aizawai (0.1 1.3), Bacillus thuringiensis subsp. kurstaki (0L 1.4), Bacillus thuringiensis subsp.
tenebrionis (0.11.5), the Bt crop proteins: Cry1 Ab (0.1 1.6), Cry1 Ac (0.11.7), Cry1 Fa (0.11.8), Cry2Ab (0.11.9), mCry3A (0.11.10), Cry3Ab (0.11.1 1), Cry3Bb (0.1 1.12), Cry34/35Ab1 (0.11.13);
0.12 Inhibitors of mitochondrial ATP synthase: diafenthiuron (0.12.1 ), azocyclotin (0.12.2), cyhexatin (0.12.3), fenbutatin oxide (0.12.4), propargite (0.12.5), tetradifon (0.12.6);
0.13 Uncouplers of oxidative phosphorylation via disruption of the proton gradient: chlorfenapyr (0.13.1 ), DNOC (0.13.2), sulfluramid (0.13.3);
0.14 Nicotinic acetylcholine receptor (nAChR) channel blockers: bensultap (0.14.1), cartap hydrochloride (0.14.2), thiocyclam (0.14.3), thiosultap sodium (0.14.4);
0.15 Inhibitors of the chitin biosynthesis type 0: bistrifluron (0.15.1 ), chlorfluazuron (0.15.2), diflubenzuron (0.15.3), flucycloxuron (0.15.4), flufenoxuron (0.15.5), hexaflumuron
(0.15.6), lufenuron (0.15.7), novaluron (0.15.8), noviflumuron (0.15.9), teflubenzuron (0.15.10), triflumuron (0.15.11 );
0.16 Inhibitors of the chitin biosynthesis type 1 : buprofezin (0.16.1);
0.17 Moulting disruptors: cyromazine (0.17.1 );
0.18 Ecdyson receptor agonists: methoxyfenozide (0.18.1), tebufenozide (0.18.2),
halofenozide (0.18.3), fufenozide (0.18.4), chromafenozide (0.18.5);
0.19 Octopamin receptor agonists: amitraz (0.19.1 );
0.20 Mitochondrial complex III electron transport inhibitors: hydramethylnon (0.20.1),
acequinocyl (0.20.2), fluacrypyrim (0.20.3), bifenazate (0.20.4);
0.21 Mitochondrial complex I electron transport inhibitors: fenazaquin (0.21.1), fenpyroximate (0.21.2), pyrimidifen (0.21.3), pyridaben (0.21.4), tebufenpyrad (0.21.5), tolfenpyrad (0.21.6), rotenone (0.21.7);
0.22 Voltage-dependent sodium channel blockers: indoxacarb (0.22.1), metaflumizonev
(0.22.2), 2-[2-(4-cyanophenyl)-1-[3-(trifluoromethyl)phenyl]ethylidene]-/V-[4- (difluoromethoxy)phenyl]-hydrazinecarboxamide (0.22.3), /V-(3-chloro-2-methylphenyl)-2-[(4- chlorophenyl)-[4-[methyl(methylsulfonyl)amino]phenyl]methylene]-hydrazinecarboxamide (0.22.4);
0.23 Inhibitors of the of acetyl CoA carboxylase: spirodiclofen (0.23.1 ), spiromesifen (0.23.2),
spirotetramat (0.23.3), spiropidion (0.23.4);
4 Mitochondrial complex IV electron transport inhibitors: aluminium phosphide (0.24.1 ), calcium phosphide (0.24.2), phosphine (0.24.3), zinc phosphide (0.24.4), cyanide (0.24.5); 5 Mitochondrial complex II electron transport inhibitors: cyenopyrafen (0.25.1), cyflumetofen (0.25.2);
6 Ryanodine receptor-modulators: flubendiamide (0.26.1), chlorantraniliprole (0.26.2), cyantraniliprole (0.26.3), cyclaniliprole (0.26.4), tetraniliprole (0.26.5), (/ )-3-chloro-/V-{2- methyl-4-[1 ,2,2,2 -tetrafluoro-1 -(trifluoromethyl)ethyl]phenyl}-Ae-(1 -methyl-2 - methylsulfonylethyl)phthalamide (0.26.6), (S)-3-chloro-/V-{2-methyl-4-[1 ,2,2,2-tetrafluoro-1- (trifluoromethyl)ethyl]phenyl}-/Ve-(1-methyl-2-methylsulfonylethyl)phthalamide (0.26.7), methyl-2-[3,5-dibromo-2-({[3-bromo-1-(3-chloropyridin-2-yl)-1 /7-pyrazol-5-yl]carbonyl}- amino)benzoyl]-1 ,2-dimethylhydrazinecarboxylate (0.26.8), /V-[4,6-dichloro-2-[(diethyl- lambda-4-sulfanylidene)carbamoyl]-phenyl]-2-(3-chloro-2-pyridyl)-5-(trifluoromethyl)pyrazole-
3-carboxamide (0.26.9), /V-[4-chloro-2-[(diethyl-lambda-4-sulfanylidene)carbamoyl]-6- methyl-phenyl]-2-(3-chloro-2-pyridyl)-5-(trifluoromethyl)pyrazole-3-carboxamide (0.26.10), /V-[4-chloro-2-[(di-2-propyl-lambda-4-sulfanylidene)carbamoyl]-6-methyl-phenyl]-2-(3-chloro- 2-pyridyl)-5-(trifluoromethyl)pyrazole-3-carboxamide (0.26.1 1), /V-[4,6-dichloro-2-[(di-2- propyl-lambda-4-sulfanylidene)carbamoyl]-phenyl]-2-(3-chloro-2-pyridyl)-5- (trifluoromethyl)pyrazole-3-carboxamide (0.26.12), /V-[4,6-dibromo-2-[(diethyl-lambda-4- sulfanylidene)carbamoyl]-phenyl]-2-(3-chloro-2-pyridyl)-5-(trifluoromethyl)pyrazole-3- carboxamide (0.26.13), /V-[2-(5-amino-1 ,3,4-thiadiazol-2-yl)-4-chloro-6-methylphenyl]-3- bromo-1-(3-chloro-2-pyridinyl)-1 TT-pyrazole-S-carboxamide (0.26.14), 3-chloro-1-(3-chloro-2- pyridinyl)-/V-[2,4-dichloro-6-[[(1 -cyano-1 -methylethyl)amino]carbonyl]phenyl]-1 A pyrazole- 5-carboxamide (0.26.15), tetrachlorantraniliprole (0.26.16), /V-[4-chloro-2-[[(1 ,1- dimethylethyl)amino]carbonyl]-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-3-(fluoromethoxy)-
1 /7-pyrazole-5-carboxamide (0.26.17), cyhalodiamide (0.26.18);
7: Chordotonal organ Modulators - undefined target site: flonicamid (0.27.1 );
8. insecticidal active compounds of unknown or uncertain mode of action: afidopyropen (0.28.1 ), afoxolaner (0.28.2), azadirachtin (0.28.3), amidoflumet (0.28.4), benzoximate (0.28.5), broflanilide (0.28.6), bromopropylate (0.28.7), chinomethionat (0.28.8), cryolite (0.28.9), dicloromezotiaz (0.28.10), dicofol (0.28.11 ), flufenerim (0.28.12), flometoquin (0.28.13), fluensulfone (0.28.14), fluhexafon (0.28.15), fluopyram (0.28.16), fluralaner (0.28.17), metoxadiazone (0.28.18), piperonyl butoxide (0.28.19), pyflubumide (0.28.20), pyridalyl (0.28.21), tioxazafen (0.28.22), 1 1-(4-chloro-2,6-dimethylphenyl)-12-hydroxy-1 ,4- dioxa-9-azadispiro[4.2.4.2]-tetradec-11 -en-10-one, 3-(4’-fluoro-2,4-dimethylbiphenyl-3-yl)-4- hydroxy-8-oxa-1 -azaspiro[4.5]dec-3-en-2-one, 1 -[2-fluoro-4-methyl-5-[(2,2,2- trifluoroethyl)sulfinyl]phenyl]-3-(trifluoromethyl)-1 H- 1 ,2,4-triazole-5-amine (0.28.23), Bacillus firmus 1-1582 (0.28.24), flupyrimin (0.28.25), fluazaindolizine (0.28.26), 4-[5-(3,5-di- chlorophenyl)-5-(trifluoromethyl)-4A7Lisoxazol-3-yl]-2-methyl-/V-(1-oxothietan-3-yl)benzamide (0.28.27), fluxametamide (0.28.28), 5-[3-[2,6-dichloro-4-(3,3- dichloroallyloxy)phenoxy]propoxy]-1 TT-pyrazole (0.28.1), 4-cyano-/V-[2-cyano-5-[[2,6- dibromo-4-[1 ,2,2,3,3,3-hexafluoro-1-(trifluoromethyl)propyl]phenyl]carbamoyl]phenyl]-2- methyl-benzamide (0.28.29), 4-cyano-3-[(4-cyano-2-methyl-benzoyl)amino]-/V-[2,6-dichloro-
4-[1 ,2,2,3,3,3-hexafluoro-1 -(trifluoromethyl)propyl]phenyl]-2-fluoro-benzamide (0.28.30),
/V-[5-[[2-chloro-6-cyano-4-[1 ,2,2,3,3,3-hexafluoro-1-(trifluoromethyl)propyl]phenyl]carbamoyl]- 2-cyano-phenyl]-4-cyano-2-methyl-benzamide (0.28.31), /V-[5-[[2-bromo-6-chloro-4-[2,2,2-tri- fluoro-1 -hydroxy-1 -(trifluoromethyl)ethyl]phenyl]carbamoyl]-2-cyano-phenyl]-4-cyano- 2-methyl-benzamide (0.28.32), /V-[5-[[2-bromo-6-chloro-4-[1 ,2,2,3,3,3-hexafluoro-1 -(trifluoro- methyl)propyl]phenyl]carbamoyl]-2-cyano-phenyl]-4-cyano-2-methyl-benzamide (0.28.33), 4- cyano-/V-[2-cyano-5-[[2,6-dichloro-4-[1 ,2,2,3,3,3-hexafluoro-1-(trifluoromethyl)propyl]phenyl]- carbamoyl]phenyl]-2-methyl-benzamide (0.28.34), 4-cyano-/V-[2-cyano-5-[[2,6-dichloro-4- [1 ,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]phenyl]carbamoyl]phenyl]-2-methyl-benzamide (0.28.35), AA[5-[[2-bromo-6-chloro-4-[1 ,2,2,2-tetrafluoro-1 -(trifluoromethyl)ethyl]phenyl]- carbamoyl]-2-cyano-phenyl]-4-cyano-2-methyl-benzamide (0.28.36); 2-(1 ,3-dioxan-2-yl)-6- [2-(3-pyridinyl)-5-thiazolyl]-pyridine (0.28.37), 2-[6-[2-(5-fluoro-3-pyridinyl)-5-thiazolyl]-2- pyridinyl]-pyrimidine (0.28.38), 2-[6-[2-(3-pyridinyl)-5-thiazolyl]-2-pyridinyl]-pyrimidine (0.28.39), /V-methylsulfonyl-6-[2-(3-pyridyl)thiazol-5-yl]pyridine-2-carboxamide (0.28.40), N- methylsulfonyl-6-[2-(3-pyridyl)thiazol-5-yl]pyridine-2-carboxamide (0.28.41), 1-[(6-chloro-3- pyridinyl)methyl]-1 ,2,3,5,6,7-hexahydro-5-methoxy-7-methyl-8-nitro-imidazo[1 ,2-a]pyridine (0.28.42), 1 -[(6-chloropyridin-3-yl)methyl]-7-methyl-8-nitro-1 ,2,3,5,6,7-hexahydroimidazo[1 ,2- a]pyridin-5-ol (0.28.43), 1-isopropyl-/V,5-dimethyl-/V-pyridazin-4-yl-pyrazole-4-carboxamide (0.28.44), 1 -(1 ,2-dimethylpropyl)-/V-ethyl-5-methyl-/V-pyridazin-4-yl-pyrazole-4-carboxamide (0.28.45), /V,5-dimethyl-/V-pyridazin-4-yl-1 -(2,2,2-trifluoro-1 -methyl-ethyl)pyrazole-4-car- boxamide (0.28.46), 1-[1-(1-cyanocyclopropyl)ethyl]-/V-ethyl-5-methyl-/V-pyridazin-4-yl- pyrazole-4-carboxamide (0.28.47), /V-ethyl-1 -(2-fluoro-1 -methyl-propyl)-5-meth-yl-/V- pyridazin-4-yl-pyrazole-4-carboxamide (0.28.48), 1-(1 ,2-dimethylpropyl)-/V,5-dimethyl- /V-pyridazin-4-yl-pyrazole-4-carboxamide (0.28.49), 1-[1-(1-cyanocyclopropyl)ethyl]-/V,5-di- methyl-/V-pyridazin-4-yl-pyrazole-4-carboxamide (0.28.50), /V-methyl-1 -(2-fluoro-1 -methyl- propyl]-5-methyl-/V-pyridazin-4-yl-pyrazole-4-carboxamide (0.28.51), 1 -(4,4-di- fluorocyclohexyl)-/V-ethyl-5-methyl-/V-pyridazin-4-yl-pyrazole-4-carboxamide (0.28.52), 1- (4,4-difluorocyclohexyl)-/V,5-dimethyl-/V-pyridazin-4-yl-pyrazole-4-carboxamide (0.28.53), N- (1 -methylethyl)-2-(3-pyridinyl)-2 TT-indazole^-carboxamide (0.28.54), /V-cyclopropyl- 2-(3-pyridinyl)-2ATLindazole-4-carboxamide (0.28.55), /V-cyclohexyl-2-(3-pyndinyl)-277· indazole-4-carboxamide (0.28.56), 2-(3-pyridinyl)-/V-(2,2,2-trifluoroethyl)-2ATLindazole-4- carboxamide (0.28.57), 2-(3-pyridinyl)-/V-[(tetrahydro-2-furanyl)methyl]-2ATLindazole- 5-carboxamide (0.28.58), methyl 2-[[2-(3-pyridinyl)-2ATLindazol-5- yl]carbonyl]hydrazinecarboxylate (0.28.59), /V-[(2,2-difluorocyclopropyl)methyl]-2-(3- pyridinyl)-277-indazole-5-carboxamide (0.28.60), /V-(2,2-difluoropropyl)-2-(3-pyridinyl)-277- indazole-5-carboxamide (0.28.61), 2-(3-pyridinyl )-/V-(2-pyrimidinylmethyl )-277-indazole-5- carboxamide (0.28.62), /V-[(5-methyl-2-pyrazinyl)methyl]-2-(3-pyridinyl)-2ATLindazole-5-car- boxamide (0.28.63), tyclopyrazoflor (0.28.64), sarolaner (0.28.65), lotilaner (0.28.66), /V-[4-chloro-3-[[(phenylmethyl)amino]carbonyl]phenyl]-1-methyl-3-(1 ,1 ,2,2,2-penta- fluoroethyl)-4-(trifluoromethyl)-177-pyrazole-5-carboxamide (0.28.67), M.UN.22a 2-(3- ethylsulfonyl-2-pyridyl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine (0.28.68), 2-[3- ethylsulfonyl-5-(trifluoromethyl)-2-pyridyl]-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine (0.28.69), iscocycloseram(O.28.70), /V-[4-chloro-3-(cyclopropylcarbamoyl)phenyl]-2-methyl- 5-(1 ,1 ,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-3-carboxamide (0.28.72), LA[ 4- chloro-3-[(1 -cyanocyclopropyl)carbamoyl]phenyl]-2-methyl-5-(1 , 1 ,2,2,2-pentafluoroethyl)-4-
(trifluoromethyl)pyrazole-3-carboxamide (0.28.73), acynonapyr (0.28.74), benzpyrimoxan (0.28.75), chloro-/V-(1-cyanocyclopropyl)-5-[1-[2-methyl-5-(1 ,1 ,2,2,2-pentafluoroethyl)- 4-(trifluoromethyl)pyrazol-3-yl]pyrazol-4-yl]benzamide (0.28.76), oxazosulfyl (0.28.77),
[(25,3/?,4/?,55,65)-3,5-dimethoxy-6-methyl-4-propoxy-tetrahydropyran-2-yl]-/V-[4-[1-[4-(tri- fluoromethoxy)phenyl]-1 ,2,4-triazol-3-yl]phenyl]carbamate (0.28.78),
[(25,3/?,4/?,55,65)-3,4,5-trimethoxy-6-methyl-tetrahydropyran-2-yl] N-[4-[1-[4-(trifluoro- methoxy)phenyl]-1 ,2,4-triazol-3-yl]phenyl]carbamate (0.28.79), [(25,3/?,4/?,55,65)-3,5- dimethoxy-6-methyl-4-propoxy-tetrahydropyran-2-yl]-/V-[4-[1-[4-(1 ,1 ,2,2,2- pentafluoroethoxy)phenyl]-1 ,2,4-triazol-3-yl]phenyl]carbamate (0.28.80), [(25, 3/?, 4/?, 55, 65)- 3,4,5-trimethoxy-6-methyl-tetrahydropyran-2-yl]-/V-[4-[1-[4-(1 ,1 ,2,2,2-penta- fluoroethoxy)phenyl]-1 ,2,4-triazol-3-yl]phenyl]carbamate (0.28.81), (22)-3-(2- isopropylphenyl)-2-[(£)-[4-[1-[4-(1 ,1 ,2,2,2-pentafluoroethoxy)phenyl]-1 ,2,4-triazol-3- yl]phenyl]methylenehydrazono]thiazolidin-4-one (0.28.82), 2-(6-chloro-3-ethylsulfonyl- imidazo[1 ,2-a]pyridin-2-yl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine (0.28.83), 2-(6- bromo-3-ethylsulfonyl-imidazo[1 ,2-a]pyridin-2-yl)-3-methyl-6-(trifluoromethyl)imidazo[4,5- b]pyridine (0.28.84), 2-(3-ethylsulfonyl-6-iodo-imidazo[1 ,2-a]pyridin-2-yl)-3-methyl-6- (trifluoromethyl)imidazo[4,5-b]pyridine (0.28.85), 2-[3-ethylsulfonyl-6- (trifluoromethyl)imidazo[1 ,2-a]pyridin-2-yl]-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine (0.28.86), 2-(7-chloro-3-ethylsulfonyl-imidazo[1 ,2-a]pyridin-2-yl)-3-methyl-6- (trifluoromethyl)imidazo[4,5-b]pyridine (0.28.87), 2-(3-ethylsulfonyl-7-iodo-imidazo[1 ,2-a]py- ridin-2-yl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine (0.28.88), 3-ethylsulfonyl-6-iodo- 2-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]imidazo[1 ,2-a]pyridine-8-carbonitrile (0.28.89), 2-[3-ethylsulfonyl-8-fluoro-6-(trifluoromethyl)imidazo[1 ,2-a]pyridin-2-yl]-3-methyl-6- (trifluoromethyl)imidazo[4,5-b]pyridine (0.28.90), 2-[3-ethylsulfonyl-7- (trifluoromethyl)imidazo[1 ,2-a]pyridin-2-yl]-3-methyl-6-(trifluoromethylsulfinyl)imidazo- [4,5-b]pyridine (0.28.91), 2-[3-ethylsulfonyl-7-(trifluoromethyl)imidazo[1 ,2-a]pyridin-2-yl]-3- methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridine (0.28.92), 2-(6-bromo-3-ethylsulfonyl- imidazo[1 ,2-a]pyridin-2-yl)-6-(trifluoromethyl)pyrazolo[4,3-c]pyridine (0.28.93).
The group of compounds I .A , I.B, I.C, I.D, I.E, I.F, I.G, I.H, I.J, I.K, I.L, I.M, I.N, and I.O as defined above in component 1) is herein collectively referred to as“compounds of the formula I” or“compounds I”.
The invention also relates to a method for controlling phytopathogenic harmful fungi, comprising treating the fungi, their habitat or the seed, the soil or the plants to be protected against fungal attack with an effective amount of mixtures comprising compounds I and compounds II; to the use of mixtures comprising compounds I and compounds II for controlling phytopathogenic harmful fungi; to agrochemical compositions comprising these mixtures; and to agrochemical compositions comprising these mixtures and further comprising seed.
Practical agricultural experience has shown that the repeated and exclusive application of an individual active compound in the control of harmful fungi leads in many cases to a rapid selection of those fungus strains which have developed natural or adapted resistance against the active compound in question. Effective control of these fungi with the active compound in
question is then no longer possible.
To reduce the risk of the selection of resistant fungus strains, mixtures of different active compounds are conventionally employed for controlling harmful fungi. By combining active compounds having different mechanisms of action, it is possible to ensure successful control over a relatively long period of time.
It is an object of the present invention to provide, with a view to effective resistance
management and effective control of phytopathogenic harmful fungi, at application rates which are as low as possible, compositions which, at a reduced total amount of active compounds applied, have improved activity against the harmful fungi (synergistic mixtures) and a broadened activity spectrum, in particular for certain indications.
We have accordingly found that this object is achieved by the compositions, defined herein, comprising at least one compound I and at least one compound II.
Moreover, we have found that simultaneous, that is joint or separate, application of a compound I and a compound II or successive application of a compound I and of compound II allows better control of harmful fungi than is possible with the individual compounds alone (synergistic mixtures). Therefore, the term“mixture” in the context of the present invention shall mean a physical mixture of the components prior to application or the result of a simultaneous, i.e. joint or separate, application of a compound I and of a compound II on the fungi, their habitat or the seed, the soil or the plants to be protected against fungal attack.
Compounds I and/or the compounds II can be present in different crystal modifications, which may differ in biological activity.
The scope of the present invention includes mixtures of the (R)- and (S)-isomers and the racemates of compounds I and/or II and /or III having one or more chiral centers. As a result of hindered rotation of asymmetrically substituted groups, atrope isomers of active compounds I and/or II and/or III may be present. They also form part of the subject matter of the invention.
Agriculturally acceptable salts of the active compounds I, II and III encompass especially the salts of those cations or the acid addition salts of those acids whose cations and anions, respectively, have no adverse effect on the fungicidal action of the active compounds. Suitable cations are thus in particular the ions of the alkali metals, preferably sodium and potassium, of the alkaline earth metals, preferably calcium, magnesium and barium, of the transition metals, preferably manganese, copper, zinc and iron, and also the ammonium ion which, if desired, may carry 1 to 4 Ci-C4-alkyl substituents and/or one phenyl or benzyl substituent, preferably diisopropylammonium, tetramethylammonium, tetrabutylammonium, trimethylbenzylammonium, furthermore phosphonium ions, sulfonium ions, preferably tri(Ci-C4-alkyl)sulfonium, and sulfoxonium ions, preferably tri(Ci-C4-alkyl)sulfoxonium. Anions of useful acid addition salts are primarily chloride, bromide, fluoride, hydrogensulfate, sulfate, dihydrogenphosphate, hydrogen- phosphate, phosphate, nitrate, bicarbonate, carbonate, hexafluorosilicate, hexafluorophosphate, benzoate, and the anions of Ci-C4-alkanoic acids, preferably formate, acetate, propionate and butyrate. They can be formed by reacting a compound I with an acid of the corresponding anion, preferably of hydrochloric acid, hydrobromic acid, sulfuric acid, phosphoric acid or nitric acid.
The active substances referred to as compounds II or III, their preparation and their activity e. g.
against harmful fungi is known (cf.: http://www.alanwood.net/pesticides/); these substances are commercially available. The compounds described by IUPAC nomenclature, their preparation and their pesticidal activity are also known (cf. Can. J. Plant Sci. 48(6), 587-94, 1968;
EP-A 141 317; EP-A 152 031 ; EP-A 226 917; EP-A 243 970; EP-A 256 503; EP-A 428 941 ; EP-A 532 022; EP-A 1 028 125; EP-A 1 035 122; EP-A 1 201 648; EP-A 1 122 244,
JP 2002316902; DE 19650197; DE 10021412; DE 102005009458; US 3,296,272;
US 3,325,503; WO 98/46608; WO 99/14187; WO 99/24413; WO 99/27783; WO 00/29404;
WO 00/46148; WO 00/65913; WO 01/54501 ; WO 01/56358; WO 02/22583; WO 02/40431 ;
WO 03/10149; WO 03/1 1853; WO 03/14103; WO 03/16286; WO 03/53145; WO 03/61388;
WO 03/66609; WO 03/74491 ; WO 04/49804; WO 04/83193; WO 05/120234; WO 05/123689;
WO 05/123690; WO 05/63721 ; WO 05/87772; WO 05/87773; WO 06/15866; WO 06/87325;
WO 06/87343; WO 07/82098; WO 07/90624, WO 10/139271 , WO 1 1/028657, WO 12/168188, WO 07/006670, WO 1 1/77514; WO 13/047749, WO 10/069882, WO 13/047441 , WO 03/16303, WO 09/90181 , WO 13/007767, WO 13/010862, WO 13/127704, WO 13/024009, WO 13/24010, WO 13/047441 , WO 13/162072, WO 13/092224, WO 1 1/135833, CN 1907024, CN 1456054, CN 103387541 , CN 1309897, WO 12/84812, CN 1907024, WO 09094442, WO 14/60177,
WO 13/1 16251 , WO 08/013622, WO 15/65922, WO 94/01546, EP 2865265, WO 07/129454, WO 12/16551 1 , WO 1 1/081 174, WO 13/47441 ).
Compounds I can be prepared in analogy to procedures described for similar fungicidally active compounds in: WO 2015/185485 A1 (compounds I .A, I.B, I.E), WO 2017/093019 A1
(compounds I.H, I.J), WO 2017/076742 A1 (compounds I.C, I.D, I.K, I.L, I.M, I.N, I.O).
Compounds I.F and I.G can be prepared from ester of formula IV via treatment with amines V in a trimethylaluminium or lanthanum trifluoromethanesulfonate mediated direct amide bond formation as described in Org. Synth. 59, 49, 1979; Org. Lett. 16(7), 2018-2021 , 2014 and Chem. Commun. (Cambridge) (9), 1 100-1 102, 2008 in a suitable solvent (e.g. toluene or dichloromethane) at a temperature between 20°C and 140°C.
Compounds IV can be prepared by reacting amidoximes of formula VI with trifluoroacetic anhydride (TFAA) in an organic solvent, e.g. dichloromethane or THF, at temperatures between 0 °C and 100 °C, preferably at about 25 °C, as previously described in WO 2013/008162.
A skilled person will recognize that compounds VI can be accessed by treating nitriles VII with hydroxylamine (or its HCI salt) in an organic solvent and in the presence of a base (for precedents see for example WO 2009/074950, WO 2006/013104, EP 1932843).
Compounds VII can be accessed from the respective hydroxy compounds VIII with methyl 2- bromo acetate IX in an organic solvent and in the presence of a base (for precedents see for example Org. Lett. 18(18), 4570-4573, 2016; Bioorg. & Med Chem. 23(1 ), 132-140, 2015; and WO 2016/01 1019). Preferably, an polar aprotic solvent (e.g. A/,A7dimethylformamide, tetrahydrofuran or acetonitrile) and an inorganic base are used, more preferably NN- dimethylformamide and potassium or caesium carbonate. The reaction is best performed at elevated temperatures, most preferably in the range between 60°C and 120°C.
VIII IX
Preference is also given to mixtures comprising as component 2) at least one active compound selected from inhibitors of complex III at Q0 site in group A), more preferably selected from compounds (A.1.1 ), (A.1.4), (A.1.8), (A.1.9), (A.1.10), (A.1 .1 1 ), (A.1.12), (A.1 .13), (A.1.14),
(A.1.17), (A.1.21 ), (A.1.21 a), (A.1.24), (A.1 .25), (A.1.26), (A.1 .27), (A.1.30), (A.1.31 ), (A.1 .32), (A.1.34) and (A.1.35); particularly selected from (A.1 .1 ), (A.1 .8), (A.1 .9), (A.1.10), (A.1.1 1 ), (A.1.13), (A.1 .14), (A.1.17), (A.1.25) and (A.1.34).
Preference is also given to mixtures comprising as component 2) at least one active compound selected from inhibitors of complex III at Q, site in group A), more preferably selected from compounds (A.2.1 ), (A.2.3), (A.2.4), (A.2.5) and (A.2.6); particularly selected from (A.2.4) and (A.2.6).
Preference is also given to mixtures comprising as component 2) at least one active compound selected from inhibitors of complex II in group A), more preferably selected from compounds (A.3.2), (A.3.3), (A.3.4), (A.3.7), (A.3.9), (A.3.1 1 ), (A.3.12), (A.3.15), (A.3.16), (A.3.17), (A.3.18), (A.3.19), (A.3.20), (A.3.21 ), (A.3.22), (A.3.23), (A.3.24), (A.3.25), (A.3.26), (A.3.27), (A.3.28), (A.3.29), (A.3.31 ), (A.3.32), (A.3.33), (A.3.34), (A.3.35), (A.3.36), (A.3.37), (A.3.38) and
(A.3.39); particularly selected from (A.3.2), (A.3.3), (A.3.4), (A.3.7), (A.3.9), (A.3.17), (A.3.24), (A.3.28), (A.3.29), (A.3.31 ), (A.3.32), (A.3.33), (A.3.34), (A.3.35), (A.3.36), (A.3.37), (A.3.38) and (A.3.39).
Preference is also given to mixtures comprising as component 2) at least one active compound selected from other respiration inhibitors in group A), more preferably selected from compounds (A.4.5) and (A.4.1 1 ).
Preference is also given to mixtures comprising as component 2) at least one active compound selected from C14 demethylase inhibitors in group B), more preferably selected from
compounds (B.1 .4), (B.1 .5), (B.1.8), (B.1.10), (B.1 .1 1 ), (B.1.12), (B.1 .13), (B.1 .17), (B.1.18),
(B.1.21 ), (B.1 .22), (B.1.23), (B.1.25), (B.1 .26), (B.1.29), (B.1 .33), (B.1.34), (B.1 .37), (B.1.38), (B.1.43) and (B.1 .46); particularly selected from (B.1.4), (B.1.5), (B.1 .8), (B.1 .17), (B.1.22), (B.1.23), (B.1.25), (B.1 .29), and (B.1 .38).
Preference is also given to mixtures comprising as component 2) at least one active compound selected from Deltal 4-reductase inhibitors in group B), more preferably selected from
compounds (B.2.4), (B.2.5), (B.2.6) and (B.2.8); in particular (B.2.4) and (B.2.6).
Preference is also given to mixtures comprising as component 2) at least one active compound selected from phenylamides and acyl amino acid fungicides in group C), more preferably selected from compounds (C.1.1 ), (C.1 .2), (C.1.4) and (C.1 .5).
Preference is also given to mixtures comprising as component 2) at least one active compound selected from other nucleic acid synthesis inhibitors in group C), more preferably selected from compounds (C.2.6),(C.2.7) and (C.2.8).
Preference is also given to mixtures comprising as component 2) at least one active compound selected from group D), more preferably selected from compounds (D.1 .1 ), (D.1.2), (D.1 .5), (D.2.4), (D.2.6) and (D.2.7); particularly selected from (D.2.6) and (D.2.7).
Preference is also given to mixtures comprising as component 2) at least one active compound selected from group E), more preferably selected from compounds (E.1.1 ), (E.1.3), (E.2.2) and (E.2.3); in particular (E.1.1 ).
Preference is also given to mixtures comprising as component 2) at least one active compound selected from group F), more preferably selected from compounds (F.1.2), (F.1 .4) and (F.1.5). Preference is also given to mixtures comprising as component 2) at least one active compound selected from group G), more preferably selected from compounds (G.3.1 ), (G.3.3), (G.3.6), (G.5.1 ), (G.5.2), (G.5.3), (G.5.4), (G.5.5), G.5.6), G.5.7), (G.5.8), (G.5.9), (G.5.10) and (G.5.1 1 ). Preference is also given to mixtures comprising as component 2) at least one active compound selected from group H), more preferably selected from compounds (H.1 .5), (H.1.7), (H.2.2), (H.2.3), (H.2.5), (H.2.7), (H.2.8), (H.3.2), (H.3.4), (H.3.5), (H.4.9) and (H.4.10); particularly selected from (H.1.5), (H.1 .7), (H.2.2), (H.3.2) and (H.3.5).
Preference is also given to mixtures comprising as component 2) at least one active compound selected from group I), more preferably selected from compounds (1.2.2) and (1.2.5).
Preference is also given to mixtures comprising as component 2) at least one active compound selected from group J), more preferably selected from compounds (J.1.2), (J.1 .5), (J.1 .8), (J.1.1 1 ) and (J.1.12).
Preference is also given to mixtures comprising as component 2) at least one active compound selected from group K), more preferably selected from compounds (K.1.3), (K.1 .29), (K.1.30), (K.1.31 ), (K.1.32), (K.1.41 ), (K.1 .42), (K.1.44), (K.1 .45), (K.1.47), (K.1.49) and (K.1.54);
particularly selected from (K.1.3), (K.1 .29), (K.1.30), (K.1 .31 ), (K.1.32), (K.1.42), (K.1.53) and (K.1 .54).
Particularly preferred are the following binary mixtures A-1 to A-739 listed in Table A, wherein compounds I (component 1 , a group represented by the expression“(I)” consisting of compounds I .A , I.B, I.C, I.D, I.E, I.F, I.G, I.H, I.J, I.K, I.L, I.M, I.N and I.O) and one pesticide II selected from the groups A) to O) as defined herein (component 2, for example, (A.1 .1 ) or azoxystrobin, in mixture A-1 ).
Table A:
A-1 : (I) + (A.1 .1 ), A-2: (I) + (A.1 .2), A-3: (I) + (A.1.3), A-4: (I) + (A.1 .4), A-5: (I) + (A.1.5), A-6: (I) + (A.1 .6), A-7: (I) + (A.1 .7), A-8: (I) + (A.1 .8), A-9: (I) + (A.1 .9), A-10: (I) + (A.1 .10), A-1 1 : (I) + (A.1 .1 1 ), A-12: (I) + (A.1 .12), A-13: (I) + (A.1 .13), A-14: (I) + (A.1 .14), A-15: (I) + (A.1 .15), A-16: (I) + (A.1 .16), A-17: (I) + (A.1 .17), A-18: (I) + (A.1 .18), A-19: (I) + (A.1 .19), A-20: (I) + (A.1 .20), A-21 : (I) + (A.1 .21 ), A-22: (I) + (A.1 .22), A-23: (I) + (A.1 .23), A-24: (I) + (A.1 .24), A-25: (I) +
(A.1 .25), A-26: (I) + (A.1 .26), A-27: (I) + (A.1 .27), A-28: (I) + (A.1 .30), A-29: (I) + (A.1 .31 ), A-30: (I) + (A.1 .32), A-31 : (I) + (A.2.1 ), A-32: (I) + (A.2.2), A-33: (I) + (A.2.3), A-34: (I) + (A.2.4), A-35: (I) + (A.2.6), A-36: (I) + (A.2.7), A-37: (I) + (A.2.8), A-38: (I) + (A.3.1 ), A-39: (I) + (A.3.2), A-40: (I) + (A.3.3), A-41 : (I) + (A.3.4), A-42: (I) + (A.3.5), A-43: (I) + (A.3.6), A-44: (I) + (A.3.7), A-45: (I) + (A.3.8), A-46: (I) + (A.3.9), A-47: (I) + (A.3.10), A-48: (I) + (A.3.1 1 ), A-49: (I) + (A.3.12), A-50: (I) + (A.3.13), A-51 : (I) + (A.3.14), A-52: (I) + (A.3.15), A-53: (I) + (A.3.16), A-54: (I) + (A.3.17), A- 55: (I) + (A.3.18), A-56: (I) + (A.3.19), A-57: (I) + (A.3.20), A-58: (I) + (A.3.21 ), A-59: (I) + (A.3.22), A-60: (I) + (A.3.23), A-61 : (I) + (A.3.24), A-62: (I) + (A.3.25), A-63: (I) + (A.3.26), A-64: (I) + (A.3.27), A-65: (I) + (A.3.28), A-66: (I) + (A.3.29), A-67: (I) + (A.3.30), A-68: (I) + (A.3.31 ), A-69: (I) + (A.3.32), A-70: (I) + (A.3.33), A-71 : (I) + (A.3.34), A-72: (I) + (A.3.35), A-73: (I) + (A.3.36), A-74: (I) + (A.3.37), A-75: (I) + (A.3.38), A-76: (I) + (A.3.39), A-77: (I) + (A.4.1 ), A-78:
(I) + (A.4.2), A-79: (I) + (A.4.3), A-80: (I) + (A.4.4), A-81 : (I) + (A.4.5), A-82: (I) + (A.4.6), A-83: (I) + (A.4.7), A-84: (I) + (A.4.8), A-85: (I) + (A.4.9), A-86: (I) + (A.4.10), A-87: (I) + (A.4.1 1 ), A-88: (I) + (A.4.12), A-89: (I) + (B.1 .1 ), A-90: (I) + (B.1 .2), A-91 : (I) + (B.1 .3), A-92: (I) + (B.1 .4), A-93: (I)
+ (B.1 .5), A-94: (I) + (B.1 .6), A-95: (I) + (B.1 .7), A-96: (I) + (B.1 .8), A-97: (I) + (B.1.9), A-98: (I) + (B.1 .10), A-99: (I) + (B.1 .1 1 ), A-100: (I) + (B.1 .12), A-101 : (I) + (B.1 .13), A-102: (I) + (B.1 .14), A- 103: (I) + (B.1 .15), A-104: (I) + (B.1 .16), A-105: (I) + (B.1.17), A-106: (I) + (B.1 .18), A-107: (I) + (B.1 .19), A-108: (I) + (B.1 .20), A-109: (I) + (B.1.21), A-1 10: (I) + (B.1 .22), A-1 1 1 : (I) + (B.1 .23), A-1 12: (I) + (B.1 .24), A-1 13: (I) + (B.1 .25), A-1 14: (I) + (B.1 .26), A-1 15: (I) + (B.1 .27), A-1 16: (I)
+ (B.1.28), A-1 17: (I) + (B.1 .29), A-1 18: (I) + (B.1 .30), A-1 19: (I) + (B.1 .34), A-120: (I) + (B.1 .37), A-121 : (I) + (B.1 .38), A-122: (I) + (B.1 .43), A-123: (I) + (B.1 .44), A-124: (I) + (B.1 .45), A-125: (I)
+ (B.1 .46), A-126: (I) + (B.1 .47), A-127: (I) + (B.1 .48), A-128: (I) + (B.1 .49), A-129: (I) + (B.1 .50), A-130: (I) + (B.1 .51 ), A-131 : (I) + (B.2.1 ), A-132: (I) + (B.2.2), A-133: (I) + (B.2.3), A-141 : (I) + (B.2.4), A-135: (I) + (B.2.5), A-136: (I) + (B.2.6), A-137: (I) + (B.2.7), A-138: (I) + (B.2.8), A-139: (I) + (B.3.1 ), A-140: (I) + (C.1.1 ), A-141 : (I) + (C.1 .2), A-142: (I) + (C.1 .3), A-143: (I) + (C.1 .4), A- 144: (I) + (C.1 .5), A-145: (I) + (C.1 .6), A-146: (I) + (C.1 .7), A-147: (I) + (C.2.1 ), A-148: (I) + (C.2.2), A-149: (I) + (C.2.3), A-150: (I) + (C.2.4), A-151 : (I) + (C.2.5), A-152: (I) + (C.2.6), A-153: (I) + (C.2.7), A-154: (I) + (D.1 .1 ), A-155: (I) + (D.1.2), A-156: (I) + (D.1 .3), A-157: (I) + (D.1 .4), A- 158: (I) + (D.1 .5), A-159: (I) + (D.1 .6), A-160: (I) + (D.2.1 ), A-161 : (I) + (D.2.2), A-162: (I) + (D.2.3), A-163: (I) + (D.2.4), A-164: (I) + (D.2.5), A-165: (I) + (D.2.6), A-166: (I) + (D.2.7), A-167: (I) + (E.1 .1 ), A-168: (I) + (E.1 .2), A-169: (I) + (E.1 .3), A-170: (I) + (E.2.1 ), A-171 : (I) + (E.2.2), A- 172: (I) + (E.2.3), A-173: (I) + (E.2.4), A-174: (I) + (E.2.5), A-175: (I) + (E.2.6), A-176: (I) + (E.2.7), A-177: (I) + (E.2.8), A-178: (I) + (F.1.1 ), A-179: (I) + (F.1.2), A-180: (I) + (F.1.3), A-181 : (I) + (F.1.4), A-182: (I) + (F.1.5), A-183: (I) + (F.1 .6), A-184: (I) + (F.2.1 ), A-185: (I) + (G.1.1 ), A- 186: (I) + (G.1 .2), A-187: (I) + (G.1 .3), A-188: (I) + (G.1.4), A-189: (I) + (G.2.1 ), A-190: (I) + (G.2.2), A-191 : (I) + (G.2.3), A-192: (I) + (G.2.4), A-193: (I) + (G.2.5), A-194: (I) + (G.2.6), A-195: (I) + (G.2.7), A-196: (I) + (G.3.1 ), A-197: (I) + (G.3.2), A-198: (I) + (G.3.3), A-199: (I) + (G.3.4), A-200: (I) + (G.3.5), A-201 : (I) + (G.3.6), A-202: (I) + (G.3.7), A-203: (I) + (G.3.8), A-204: (I) + (G.4.1 ), A-205: (I) + (G.5.1 ), A-206: (I) + (G.5.2), A-207: (I) + (G.5.3), A-208: (I) + (H.1.1 ), A-209: (I) + (H.1 .2), A-210: (I) + (H.1 .3), A-21 1 : (I) + (H.1.4), A-212: (I) + (H.1 .5), A-213: (I) + (H.1 .6), A- 214: (I) + (H.2.1 ), A-215: (I) + (H.2.2), A-216: (I) + (H.2.3), A-217: (I) + (H.2.4), A-218: (I) + (H.2.5), A-219: (I) + (H.2.6), A-220: (I) + (H.2.7), A-221 : (I) + (H.2.8), A-222: (I) + (H.2.9), A-223: (I) + (H.3.1 ), A-224: (I) + (H.3.2), A-225: (I) + (H.3.3), A-226: (I) + (H.3.4), A-227: (I) + (H.3.5), A- 228: (I) + (H.3.6), A-229: (I) + (H.3.7), A-230: (I) + (H.3.8), A-231 : (I) + (H.3.9), A-232: (I) +
(H.3.10), A-233: (I) + (H.3.1 1 ), A-234: (I) + (H.4.1 ), A-235: (I) + (H.4.2), A-236: (I) + (H.4.3), A- 237: (I) + (H.4.4), A-238: (I) + (H.4.5), A-239: (I) + (H.4.6), A-240: (I) + (H.4.7), A-241 : (I) + (H.4.8), A-242: (I) + (H.4.9), A-243: (I) + (H.4.10), A-244: (I) + (1.1 .1 ), A-245: (I) + (1.1 .2), A-246: (I) + (1.2.1 ), A-247: (I) + (I.2.2), A-248: (I) + (I.2.3), A-249: (I) + (I.2.4), A-250: (I) + (I.2.5), A-251 : (I) + (J.1.1 ), A-252: (I) + (J.1.2), A-253: (I) + (J.1 .3), A-254: (I) + (J.1.4), A-255: (I) + (J.1.5), A- 256: (I) + (J.1.6), A-257: (I) + (J.1.7), A-258: (I) + (J.1.8), A-259: (I) + (J.1.9), A-260: (I) +
(J.1 .10), A-261 : (I) + (J.1.1 1 ), A-262: (I) + (J.1 .12), A-263: (I) + (K.1 .1 ), A-264: (I) + (K.1 .2), A- 265: (I) + (K.1 .3), A-266: (I) + (K.1.4), A-267: (I) + (K.1.5), A-268: (I) + (K.1 .6), A-269: (I) +
(K.1.7), A-270: (I) + (K.1 .8), A-271 : (I) + (K.1 .9), A-272: (I) + (K.1 .10), A-273: (I) + (K.1 .1 1 ), A- 274: (I) + (K.1 .12), A-275: (I) + (K.1 .13), A-276: (I) + (K.1 .14), A-277: (I) + (K.1 .15), A-278: (I) + (K.1 .16), A-279: (I) + (K.1 .17), A-280: (I) + (K.1 .18), A-281 : (I) + (K.1 .19), A-282: (I) + (K.1 .20), A-283: (I) + (K.1 .21 ), A-284: (I) + (K.1 .22), A-285: (I) + (K.1 .23), A-286: (I) + (K.1 .24), A-287: (I)
+ (K.1 .25), A-288: (I) + (K.1 .26), A-289: (I) + (K.1 .27), A-290: (I) + (K.1 .28), A-291 : (I) + (K.1 .29), A-292: (I) + (K.1 .30), A-293: (I) + (K.1 .31 ), A-294: (I) + (K.1 .32), A-295: (I) + (K.1 .33), A-296: (I)
+ (K.1 .34), A-297: (I) + (K.1 .35), A-298: (I) + (K.1 .36), A-299: (I) + (K.1 .37), A-300: (I) + (K.1 .38), A-301 : (I) + (K.1 .39), A-302: (I) + (K.1 .40), A-303: (I) + (K.1 .41 ), A-304: (I) + (K.1 .42), A-305: (I)
+ (K.1 .43), A-306: (I) + (K.1 .44), A-307: (I) + (K.1 .45), A-308: (I) + (K.1 .47), A-309: (I) + (M.1.1 ), A-310: (I) + (M.1 .2), A-31 1 : (I) + (M.1 .3), A-312: (I) + (M.1 .4), A-313: (I) + (M.1 .5), A-314: (I) + (M.1 .6), A-315: (I) + (M.1.7), A-316: (I) + (M.1.8), A-317: (I) + (M.1 .9), A-318: (I) + (M.1.10), A- 319: (I) + (M.1.1 1 ), A-320: (I) + (M.1.12), A-321 : (I) + (M.1 .13), A-322: (I) + (M.1.14), A-323: (I) + (M.1 .15), A-324: (I) + (M.1.16), A-325: (I) + (M.1.17), A-326: (I) + (M.1 .18), A-327: (I) + (M.1.19), A-328: (I) + (M.1.20), A-329: (I) + (M.1.21 ), A-330: (I) + (M.1.22), A-331 : (I) + (M.1.23), A-332: (I)
+ (M.1 .24), A-333: (I) + (M.1.25), A-334: (I) + (M.1.26), A-335: (I) + (M.1.27), A-336: (I) +
(M.1 .28), A-337: (I) + (M.1.29), A-338: (I) + (M.1.30), A-339: (I) + (M.1 .31 ), A-340: (I) + (M.1.32), A-341 : (I) + (M.1.33), A-342: (I) + (M.1.34), A-343: (I) + (M.1.35), A-344: (I) + (M.1.36), A-345: (I)
+ (M.1 .37), A-346: (I) + (M.1.38), A-347: (I) + (M.1.39), A-348: (I) + (M.1.40), A-349: (I) +
(M.1 .41 ), A-350: (I) + (M.1.42), A-351 : (I) + (M.1.43), A-352: (I) + (M.1 .44), A-353: (I) + (M.1.45), A-354: (I) + (M.1.46), A-355: (I) + (M.1.47), A-356: (I) + (M.1.48), A-357: (I) + (M.1.49), A-358: (I) + (M.1 .50), A-359: (I) + (N.1.1 ), A-360: (I) + (N.1 .2), A-361 : (I) + (N.1.3), A-362: (I) + (N.1.4), A- 363: (I) + (N.1 .5), A-364: (I) + (N.2.1 ), A-365: (I) + (N.2.2), A-366: (I) + (N.2.3), A-367: (I) + (N.3.1 ), A-368: (I) + (N.3.2), A-369: (I) + (N.3.3), A-370: (I) + (N.3.4), A-371 : (I) + (N.4.1 ), A-372: (I) + (N.5.1 ), A-373: (I) + (N.6.1 ), A-374: (I) + (N.6.2), A-375: (I) + (N.6.3), A-376: (I) + (N.6.4), A- 377: (I) + (N.6.5), A-378: (I) + (N.7.1 ), A-379: (I) + (N.7.2), A-380: (I) + (N.7.3), A-381 : (I) + (N.8.1 ), A-382: (I) + (N.9.1 ), A-383: (I) + (N.10.1 ), A-384: (I) + (N.10.2), A-385: (I) + (N.10.3), A- 386: (I) + (N.10.4), A-387: (I) + (N.10.5), A-388: (I) + (N.1 1 .1 ), A-389: (I) + (N.12.1 ), A-390: (I) + (N.12.2), A-391 : (I) + (N.12.3), A-392: (I) + (N.12.4), A-393: (I) + (N.13.1 ), A-394: (I) + (N.13.2), A-395: (I) + (N.13.3), A-396: (I) + (N.13.4), A-397: (I) + (N.13.5), A-398: (I) + (N.13.6), A-399: (I) + (N.13.7), A-400: (I) + (N.13.8), A-401 : (I) + (N.13.9), A-402: (I) + (N.14.1 ), A-403: (I) +
(N.14.2), A-404: (I) + (N.14.3), A-405: (I) + (N.15.1 ), A-406: (I) + (N.16.1 ), A-407: (I) + (N.16.2), A-408: (I) + (N .17.1 ), A-409: (I) + (N.17.2), A-410: (I) + (N.17.3), A-41 1 : (I) + (N.17.4), A-412: (I) + (N.17.5), A-413: (I) + (N.17.6), A-414: (I) + (N.17.7), A-415: (I) + (N.17.8), A-416: (I) +
(N.17.9), A-417: (I) + (N.17.10), A-418: (I) + (N.17.1 1 ), A-419: (I) + (N.17.12), A-420: (I) + (0.1.1 ), A-421 : (I) + (0.1 .2), A-422: (I) + (0.1.3), A-423: (I) + (0.1 .4), A-424: (I) + (0.1 .5), A-425: (I) + (0.1.6), A-426: (I) + (0.1 .7), A-427: (I) + (0.1 .8), A-428: (I) + (0.1.9), A-429: (I) + (0.1 .10),
A-430: (I) + (0.1.1 1 ), A-431 : (I) + (0.1.12), A-432: (I) + (0.1.13), A-433: (I) + (0.1.14), A-434: (I) + (0.1.15), A-435: (I) + (0.1.16), A-436: (I) + (0.1.17), A-437: (I) + (0.1 .18), A-438: (I) +
(0.1.19), A-439: (I) + (0.1 .20), A-440: (I) + (0.1.21 ), A-441 : (I) + (0.1.22), A-442: (I) + (0.1.23), A-443: (I) + (0.1.24), A-444: (I) + (0.1.25), A-445: (I) + (0.1.26), A-446: (I) + (0.1.27), A-447: (I) + (0.1.28), A-448: (I) + (0.1.29), A-449: (I) + (0.1.30), A-450: (I) + (0.1 .31 ), A-451 : (I) +
(0.1.32), A-452: (I) + (0.1 .33), A-453: (I) + (0.1.34), A-454: (I) + (0.1.35), A-455: (I) + (0.1.36), A-456: (I) + (0.1.37), A-457: (I) + (0.1.38), A-458: (I) + (0.2.1 ), A-459: (I) + (0.2.2), A-460: (I) + (0.2.3), A-461 : (I) + (0.2.4), A-462: (I) + (0.2.5), A-463: (I) + (0.2.6), A-464: (I) + (0.2.7), A-465: (I) + (0.2.8), A-466: (I) + (0.2.9), A-467: (I) + (0.2.10), A-468: (I) + (0.2.1 1 ), A-469: (I) +
(0.2.12), A-470: (I) + (0.2.13), A-471 : (I) + (0.2.14), A-472: (I) + (0.2.15), A-473: (I) + (0.2.16), A-474: (I) + (0.3.1 ), A-475: (I) + (0.3.2), A-476: (I) + (0.3.3), A-477: (I) + (0.3.4), A-478: (I) + (0.3.5), A-479: (I) + (0.3.6), A-480: (I) + (0.3.7), A-481 : (I) + (0.3.8), A-482: (I) + (0.3.9), A-483: (I) + (0.3.10), A-484: (I) + (0.3.1 1 ), A-485: (I) + (0.3.12), A-486: (I) + (0.3.13), A-487: (I) + (0.3.14), A-488: (I) + (0.3.15), A-489: (I) + (0.3.16), A-490: (I) + (0.3.17), A-491 : (I) + (0.3.18), A-492: (I) + (0.3.19), A-493: (I) + (0.3.20), A-494: (I) + (0.3.21 ), A-495: (I) + (0.3.22), A-496: (I) + (0.3.23), A-497: (I) + (0.3.24), A-498: (I) + (0.3.25), A-499: (I) + (0.3.26), A-500: (I) +
(0.3.27), A-501 : (I) + (0.4.1 ), A-502: (I) + (0.4.2), A-503: (I) + (0.4.3), A-504: (I) + (0.4.4), A- 505: (I) + (0.4.5), A-506: (I) + (0.4.6), A-507: (I) + (0.4.7), A-508: (I) + (0.4.8), A-509: (I) + (0.4.9), A-510: (I) + (0.4.10), A-51 1 : (I) + (0.4.1 1 ), A-512: (I) + (0.4.12), A-513: (I) + (0.4.13), A-514: (I) + (0.4.14), A-515: (I) + (0.4.15), A-516: (I) + (0.4.16), A-517: (I) + (0.4.17), A-518: (I) + (0.4.18), A-519: (I) + (0.4.19), A-520: (I) + (0.4.20), A-521 : (I) + (0.4.21 ), A-522: (I) +
(0.4.22), A-523: (I) + (0.4.23), A-524: (I) + (0.4.24), A-525: (I) + (0.5.1 ), A-526: (I) + (0.5.2), A- 527: (I) + (0.5.3), A-528: (I) + (0.5.4), A-529: (I) + (0.5.5), A-530: (I) + (0.5.6), A-531 : (I) + (0.5.7), A-532: (I) + (0.5.8), A-533: (I) + (0.5.9), A-534: (I) + (0.6.1 ), A-535: (I) + (0.6.2), A-536: (I) + (0.6.3), A-537: (I) + (0.6.4), A-538: (I) + (0.6.5), A-539: (I) + (0.6.6), A-540: (I) + (0.6.7), A-541 : (I) + (0.7.1 ), A-542: (I) + (0.7.2), A-543: (I) + (0.7.3), A-544: (I) + (0.7.4), A-545: (I) + (0.7.5), A-546: (I) + (0.7.6), A-547: (I) + (0.8.1 ), A-548: (I) + (0.8.2), A-549: (I) + (0.8.3), A-550: (I) + (0.8.4), A-551 : (I) + (0.8.5), A-552: (I) + (0.9.1 ), A-553: (I) + (0.9.2), A-554: (I) + (0.9.3), A-555: (I) + (0.10.1 ), A-556: (I) + (0.1 1 .1 ), A-557: (I) + (0.1 1 .2), A-558: (I) + (0.1 1 .3), A-559: (I) + (0.1 1 .4), A-560: (I) + (0.12.1 ), A-561 : (I) + (0.13.1 ), A-562: (I) + (0.14.1 ), A-563: (I) +
(0.14.2), A-564: (I) + (0.15.1 ), A-565: (I) + (0.15.2), A-566: (I) + (0.15.3), A-567: (I) + (0.15.4), A-568: (I) + (0.15.5), A-569: (I) + (0.15.6), A-570: (I) + (0.15.7), A-571 : (I) + (0.15.8), A-572: (I) + (0.15.9), A-573: (I) + (0.15.10), A-574: (I) + (0.15.1 1 ), A-575: (I) + (0.16.1 ), A-576: (I) + (0.16.2), A-577: (I) + (0.16.3), A-578: (I) + (0.16.4), A-579: (I) + (0.16.5), A-580: (I) + (0.16.6), A-581 : (I) + (0.17.1 ), A-582: (I) + (0.18.1 ), A-583: (I) + (0.18.2), A-584: (I) + (0.18.3), A-585: (I) + (0.18.4), A-586: (I) + (0.18.5), A-587: (I) + (0.19.1 ), A-588: (I) + (0.20.1 ), A-589: (I) +
(0.20.2), A-590: (I) + (0.20.3), A-591 : (I) + (0.21 .1 ), A-592: (I) + (0.21 .2), A-593: (I) + (0.21 .3), A-594: (I) + (0.21 .4), A-595: (I) + (0.21 .5), A-596: (I) + (0.21 .6), A-597: (I) + (0.21 .7), A-598: (I) + (0.22.1 ), A-599: (I) + (0.22.2), A-600: (I) + (0.22.3), A-601 : (I) + (0.22.4), A-602: (I) +
(0.23.1 ), A-603: (I) + (0.23.2), A-604: (I) + (0.23.3), A-605: (I) + (0.24.1 ), A-606: (I) + (0.24.2), A-607 : (I) + (0.24.3), A-608: (I) + (0.24.4), A-609: (I) + (0.24.5), A-610: (I) + (0.25.1 ), A-61 1 : (I) + (0.25.2), A-612: (I) + (0.26.1 ), A-613: (I) + (0.26.2), A-614: (I) + (0.26.3), A-615: (I) +
(0.26.4), A-616: (I) + (0.26.5), A-617: (I) + (0.26.6), A-618: (I) + (0.26.7), A-619: (I) + (0.26.8), A-620: (I) + (0.26.9), A-621 : (I) + (0.26.10), A-622: (I) + (0.26.1 1 ), A-623: (I) + (0.26.12), A-
624: (I) + (0.26.13), A-625: (I) + (0.26.14), A-626: (I) + (0.26.15), A-627: (I) + (0.26.16), A-628: (I) + (0.26.17), A-629: (I) + (0.26.18), A-630: (I) + (0.27.1 ), A-631 : (I) + (0.27.2), A-632: (I) + (0.27.3), A-633: (I) + (0.27.4), A-634: (I) + (0.27.5), A-635: (I) + (0.27.6), A-636: (I) + (0.27.7), A-637 : (I) + (0.27.8), A-638: (I) + (0.27.9), A-639: (I) + (0.27.10), A-640: (I) + (0.27.1 1 ), A-641 : (I) + (0.27.12), A-642: (I) + (0.27.13), A-643: (I) + (0.27.14), A-644: (I) + (0.27.15), A-645: (I) +
(0.27.16), A-646 (I) + (0.27.17), A-647 (I) + (0.27.18), A-648: (I) + (0.27.19), A-649 (l) + (0.27.20), A-650 (I) + (0.27.21 ), A-651 (I) + (0.27.22), A-652: (I) + (0.27.23), A-653 (l) + (0.27.24), A-654 (I) + (0.27.25), A-655 (I) + (0.27.26), A-656: (I) + (0.27.27), A-657 (l) + (0.27.28), A-658 (I) + (0.27.29), A-659 (I) + (0.27.30), A-660: (I) + (0.27.31 ), A-661 (l) + (0.27.32), A-662 (I) + (0.27.33), A-663 (I) + (0.27.34), A-664: (I) + (0.27.35), A-665 (l) + (0.27.36), A-666 (I) + (0.27.37), A-667 (I) + (0.27.38), A-668: (I) + (0.27.39), A-669 (l) + (0.27.40), A-670 (I) + (0.27.41 ), A-671 (I) + (0.27.42), A-672: (I) + (0.27.43), A-673 (l) + (0.27.44), A-674 (I) + (0.27.45), A-675 (I) + (0.27.46), A-676: (I) + (0.27.47), A-677 (l) + (0.27.48), A-678 (I) + (0.27.49), A-679 (I) + (0.27.50), A-680: (I) + (0.27.51 ), A-681 (i) + (0.27.52), A-682 (I) + (0.27.53), A-683 (I) + (0.27.54), A-684: (I) + (0.27.55), A-685 (i) + (0.27.56), A-686 (I) + (0.27.57), A-687 (I) + (0.27.58), A-688: (I) + (0.27.59), A-689 (i) + (0.27.60), A-690 (I) + (0.27.61 ), A-691 (I) + (0.27.62), A-692: (I) + (0.27.63), A-693 (i) + (0.27.64), A-694 (I) + (0.27.65), A-695 (I) + (0.27.66), A-696: (I) + (0.27.67), A-697 (i) + (0.27.68), A-698 (I) + (0.27.69), A-699 (I) + (0.27.70), A-700: (I) + (0.27.71 ), A-701 (i) + (0.27.72), A-702 (I) + (0.27.73), A-703 (I) + (0.27.74), A-704: (I) + (0.27.75), A-705 (i) + (0.27.76), A-706 (I) + (0.27.77), A-707 (I) + (0.27.78), A-708: (I) + (0.27.79), A-709 (i) + (0.27.80), A-710 (I) + (0.27.81 ), A-71 1 (I) + (0.27.82), A-712: (I) + (0.27.83), A-713 (i) + (0.27.84), A-714 (I) + (0.27.85), A-715 (I) + (0.27.86), A-716: (I) + (0.27.87), A-717 (i) + (0.27.88), A-718 (I) + (0.27.89), A-719 (I) + (0.27.90), A-720: (I) + (0.27.91 ), A-721 (i) + (0.27.92), A-722 (I) + (0.27.93), A-723 (I) + (0.27.94), A-724: (I) + (0.27.95), A-725 (i) + (0.27.96), A-726 (I) + (0.27.97), A-727 (I) + (0.27.98), A-728: (I) + (0.27.99), A-729 (i) +
(0.27.100), A-730: (I) + (A.1 .21 a), A-731 : (I) + (K.1.46), A-732: (I) + (K.1.48), A-733: (I) +
(K.1 .49), A-734: (I) + (K.1 .50), A-735: (I) + (K.1 .51 ), A-736: (I) + (K.1 .52), A-737: (I) + (K.1 .53), A-738: (I) + (K.1 .54), A-739: (I) + (A.2.6).
In one embodiment the weight ratio of component 1 ) to component 2) in mixtures A-1 to A-739 of Table A is between 100:1 and 1 :100, preferably between 50:1 and 1 :50, more preferably between 20:1 and 1 :20, particularly between 5:1 and 1 :5; for example 3:1 , 2:1 , 1 .5:1 , 1 :1 , 1 :1.5, 1 :2 or 1 :3.
In one embodiment the weight ratio of component 1 ) to component 2) is between 100:1 and 1 :100 in mixtures A- 1 to A-739 of Table A.
In one embodiment the weight ratio of component 1 ) to component 2) is between 50:1 and 1 :50 in mixtures A-1 to A-739 of Table A.
In one embodiment the weight ratio of component 1 ) to component 2) is between 20:1 and 1 :20 in mixtures A-1 to A-739 of Table A.
In one embodiment the weight ratio of component 1 ) to component 2) is between 5:1 and 1 :5 in mixtures A-1 to A-739 of Table A.
In one embodiment the weight ratio of component 1 ) to component 2) is between 3:1 and 1 :3 in
mixtures A-1 to A-739 of Table A.
In one embodiment the weight ratio of component 1) to component 2) is between 2:1 and 1:2 in mixtures A-1 to A-739 of Table A.
In one embodiment the weight ratio of component 1) to component 2) is between 1.5:1 and 1 :1.5 in mixtures A-1 to A-739 of Table A.
In one embodiment the weight ratio of component 1) to component 2) is 1:1 in mixtures A-1 to A-739 of Table A.
In a preferred embodiment the mixtures A-1 to A-739 of Table A and in particular when the weight ratios of component 1) to component 2) are as disclosed for these mixtures as herein before mentioned, are used against Phakopsora pachyrhizi and P. meibomiae on soybeans and/or against Puccinia triticina, P. striiformis, P. hordei, P. graminis or P. recondita on wheat, barley or rye; P. coronata e.g. on oats, P. sorghi und P. poly so ra on corn; Puccinia spp. on other crops, e.g. P. heiiathion sunflower, P. arachidis on peanuts; Uromyces spp. on pulses and other crops crops, e.g. Uromyces viciae-fabae, Uromyces vigniae, Uromyces pisi, U.
ciceris-arietini, U. betae syn U. beticoia.
Particularly preferred are the binary mixtures listed in Table B1 to Table B14, for example mixtures B1-1 to B1-161 in table B1, wherein component 1) is compound I. A, and wherein component 2) is selected from compounds II of groups A) to O), as defined herein.
Table B1:
B1-1 : I.A + (A.1.1), B1-2: I.A + (A.1.4), B1-3: I.A+ (A.1.8), B1-4: I.A + (A.1.9), B1-5: I.A + (A.1.10), B1-6: I.A + (A.1.11), B1-7: I.A + (A.1.12), B1-8: I.A + (A.1.13), B1-9: I.A + (A.1.14), B1- 10: I.A + (A.1.17), B1-11: I.A + (A.1.21), B1-12: I.A + (A.121a), B1-13: I.A + (A.1.24), B1-14: I.A + (A.1.25), B1-15: I.A + (A.1.26), B1-16: I.A + (A.1.27), B1-17: I.A + (A.1.30), B1-18: I.A + (A.1.31), B1-19: I.A + (A.1.32), B1-20: I.A + (A.1.34), B1-21: I.A + (A.1.35), B1-22: I.A + (A.2.1), B1-23: I.A + (A.2.3), B1-24: I.A + (A.2.4), B1-25: I.A + (A.2.5), B1-26: I.A + (A.2.6), B1-27: I.A + (A.3.2), B1-28: I.A+ (A.3.3), B1-29: I.A+ (A.3.4), B1-30: I.A+ (A.3.7), B1-31: I.A+ (A.3.9), B1- 32: I.A + (A.3.11), B1-33: I.A + (A.3.12), B1-34: I.A + (A.3.15), B1-35: I.A + (A.3.16), B1-36: I.A + (A.3.17), B1-37: I.A + (A.3.18), B1-38: I.A + (A.3.19), B1-39: I.A + (A.3.20), B1-40: I.A + (A.3.21), B1-41 : I.A + (A.3.22), B1-42: I.A + (A.3.23), B1-43: I.A + (A.3.24), B1-44: I.A +
(A.3.25), B1-45: I.A + (A.3.26), B1-46: I.A + (A.3.27), B1-47: I.A + (A.3.28), B1-48: I.A +
(A.3.29), B1-49: I.A + (A.3.31), B1-50: I.A + (A.3.32), B1-51: I.A + (A.3.33), B1-52: I.A +
(A.3.34), B1-53: I.A + (A.3.35), B1-54: I.A + (A.3.36), B1-55: I.A + (A.3.37), B1-56: I.A +
(A.3.38), B1-57: I.A + (A.3.39), B1-58: I.A+ (A.4.5), B1-59: I.A + (A.4.11), B1-60: I.A+ (B.1.4), B1-61 : I.A+ (B.1.5), B1-62: I.A + (B.1.8.), B1-63: I.A + (B.1.10), B1-64: I.A + (B.1.11), B1-65: I.A + (B.1.12), B1-66: I.A + (B.1.13), B1-67: I.A + (B.1.17), B1-68: I.A + (B.1.18), B1-69: I.A + (B.1.21), B1-70: I.A + (B.1.22), B1-71: I.A + (B.1.23), B1-72: I.A + (B.1.25), B1-73: I.A +
(B.1.26), B1-74: I.A + (B.1.29), B1-75: I.A + (B.1.33), B1-76: I.A + (B.1.34), B1-77: I.A +
(B.1.37), B1-78: I.A + (B.1.38), B1-79: I.A + (B.1.43), B1-80: I.A + (B.1.46), B1-81: I.A + (B.2.4), B1-82: I.A + (B.2.5), B1-83: I.A+ (B.2.6), B1-84: I.A+ (B.2.8), B1-85: I.A + (C.1.1), B1-86: I.A + (C.1.2), B1-87: I.A+ (C.1.4), B1-88: I.A+ (C.1.5), B1-89: I.A+ (C.2.6), B1-90: I.A+ (C.2.7), B1-
91: I.A+ (C.2.8), B1-92: I.A+ (D.1.1), B1-93: I.A + (D.1.2), B1-94: I.A + (D.1.5), B1-95: I.A + (D.2.4), B1-96: I.A+ (D.2.6), B1-97: I.A+ (D.2.7), B1-98: I.A+ (E.1.1), B1-99: I.A+ (E.1.3), B1- 100: I.A + (E.2.2), B1-101: I.A + (E.2.3), B1-102: I.A + (F.1.2), B1-103: I.A + (F.1.4), B1-104: I.A + (F.1.5), B1-105: I.A+ (G.3.1), B1-106: I.A + (G.3.3), B1-107: I.A + (G.3.6), B1-108: I.A + (G.5.1), B1-109: I.A + (G.5.2), B1-110: I.A + (G.5.3), B1-111: I.A + (G.5.4), B1-112: I.A +
(G.5.5), B1-113: I.A + (G.5.6), B1-114: I.A + (G.5.7), B1-115: I.A + (G.5.8), B1-116: I.A +
(G.5.9), B1-117: I.A + (G.5.10), B1-118: I.A + (G.5.11), B1-119: I.A + (H.1.5), B1-120: I.A + (H.1.7), B1-121 : I.A+ (H.2.2), B1-122: I.A+ (H.2.3), B1-123: I.A + (H.2.5), B1-124: I.A + (H.2.7), B1-125: I.A + (H.2.8), B1-126: I.A + (H.3.2), B1-127: I.A + (H.3.4), B1-128: I.A + (H.3.5), B1- 129: I.A + (H.4.9), B1-130: I.A + (H.4.10), B1-131: I.A+ (I.2.2), B1-132: I.A + (I.2.5), B1-133: I.A + (J.1.2), B1-134: I.A + (J.1.5), B1-135: I.A + (J.1.8), B1-136: I.A + (J.1.11), B1-137: I.A + (J.1.12), B1-138: I.A + (K.1.3), B1-139: I.A + (K.1.29), B1-140: I.A + (K.1.30), B1-141: I.A + (K.1.31), B1-142: I.A + (K.1.32), B1-143: I.A + (K.1.41), B1-144: I.A + (K.1.42), B1-145: I.A + (K.1.44), B1-146: I.A + (K.1.45), B1-147: I.A + (K.1.47), B1-148: I.A + (K.1.49), B1-149: I.A +
(K.1.53), B1-150: I.A + (K.1.54), B1-151: I.A + (0.4.2), B1-152: I.A + (0.4.5), B1-153: I.A + (0.4.8), B1-154: I.A + (0.26.2), B1-155: I.A + (0.26.3), B1-156: I.A + (0.26.4), B1-157: I.A + (0.26.5), B1-158: I.A + (0.27.7), B1-159: I.A + (0.27.76), B1-160: I.A + (0.27.78), B1-161: I.A + (0.27.79).
In one embodiment the weight ratio of compound I.A to component 2) in mixtures B1-1 to B1- 161 of Table B1 is between 100:1 and 1:100, preferably between 50:1 and 1:50, more preferably between 20:1 and 1 :20, particularly between 5:1 and 1 :5; for example 3:1 , 1:1 or 1 :3.
Table B2: Mixtures B2-1 to B2-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.B.
Table B3: Mixtures B3-1 to B3-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.C.
Table B4: Mixtures B4-1 to B4-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.D.
Table B5: Mixtures B5-1 to B5-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.E.
Table B6: Mixtures B6-1 to B6-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.F.
Table B7: Mixtures B7-1 to B7-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.G.
Table B8: Mixtures B8-1 to B8-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.H.
Table B9: Mixtures B9-1 to B9-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.J.
Table B10: Mixtures B10-1 to B10-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.K.
Table B11: Mixtures B11-1 to B11-161 are defined as mixtures B1-1 to B1-161 of Table B1, wherein compound I.A in each mixture is replaced with compound I.L.
Table B12: Mixtures B12-1 to B12-161 are defined as mixtures B1-1 to B1-161 of Table B1 , wherein compound I .A in each mixture is replaced with compound I.M.
Table B13: Mixtures B13-1 to B13-161 are defined as mixtures B1-1 to B1-161 of Table B1 , wherein compound I .A in each mixture is replaced with compound I.N.
Table B14: Mixtures B14-1 to B14-161 are defined as mixtures B1-1 to B1-161 of Table B1 , wherein compound I. A in each mixture is replaced with compound I.O.
In one embodiment the weight ratio of component 1 ) to component 2) is between 100:1 and 1 :100 in mixtures as defined in Tables B1 to B14.
In one embodiment the weight ratio of component 1 ) to component 2) is between 50:1 and 1 :50 in mixtures as defined in Tables B1 to B14.
In one embodiment the weight ratio of component 1 ) to component 2) is between 20:1 and 1 :20 in mixtures as defined in Tables B1 to B14.
In one embodiment the weight ratio of component 1 ) to component 2) is between 5:1 and 1 :5 in mixtures as defined in Tables B1 to B14.
In one embodiment the weight ratio of component 1 ) to component 2) is between 3:1 and 1 :3 in mixtures as defined in Tables B1 to B14.
In one embodiment the weight ratio of component 1 ) to component 2) is between 2:1 and 1 :2 in mixtures as defined in Tables B1 to B14.
In one embodiment the weight ratio of component 1 ) to component 2) is between 1.5:1 and 1 :1.5 in mixtures as defined in Tables B1 to B14.
In one embodiment the weight ratio of component 1 ) to component 2) is 1 :1 in mixtures as defined in Tables B1 to B14.
In a preferred embodiment the mixtures as defined inTables B1 to B14 and in particular when the weight ratios of compound I to component 2) are as disclosed for these mixtures as herein before mentioned, are used against Phakopsora pachyrhizi and P. meibomiae on soybeans and/or against Puccinia triticina, P. striiformis, P. hordei, P. graminis or P. recondita on wheat, barley or rye; P. coronata e.g. on oats, P. sorghi und P. poly so ra on corn; Puccinia spp. on other crops, e.g. P. heiiathion sunflower, P. arachidis on peanuts; Uromyces spp. on pulses and other crops crops, e.g. Uromyces viciae-fabae, Uromyces vigniae, Uromyces pisi, U. ciceris-arietini, U. betae syn U. beticoia.
Further preferred embodiments E.1 to E.560 listed in Table B15 relate to binary mixtures as defined in Tables B1 to B14 in particular weight ratios of component 1) to component 2).
Table B15:
A preferred embodiment relates to the use of the mixtures according to embodiments E.1 to E.560 of Table B15 against Phakopsora pachyrhizi and P. meibomiae on soybeans and/or against Puccinia triticina, P. striiformis, P. hordei, P. gra minis ox P. recon dita on wheat, barley or rye; P. coronata e.g. on oats, P. sorghi und P. poiysora on corn; Puccinia spp. on other crops,
e.g. P. he! iathi on sunflower, P. arachidis on peanuts; Uromyces spp. on pulses and other crops crops, e.g. Uromyces viciae-fabae, Uromyces vigniae, Uromyces pisi, U. ciceris-arietini, U. betae syn U. beticda.
It may be preferred that the binary mixtures above comprise besides at least one compound I and at least one compound II as component 3) at least one further active compound III, resulting in a ternary mixture. Preferably, the components 1 ) and 2), or, all three components 1), 2) and 3), in these mixtures are present in a synergistically effective amount.
Accordingly one embodiment relates to ternary mixtures comprising, as active components
1 ) at least one active compound I as defined or preferably defined herein, or an N-oxide, or an agriculturally useful salt thereof;
and as component
2) at least one active compound II selected from groups A) to O) as defined for component 2) in binary mixtures above, or an N-oxide, or an agriculturally useful salt thereof;
and as component
3) at least one active compound III selected from groups A) to O) as defined for component 2) in binary mixtures above, or an N-oxide, or an agriculturally useful salt thereof;
wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
The invention also relates to a method for controlling phytopathogenic harmful fungi, comprising treating the fungi, their habitat or the seed, the soil or the plants to be protected against fungal attack with an effective amount of the above mentioned ternary mixtures comprising compounds I, compounds II and compounds III; to the use of these ternary mixtures for controlling phytopathogenic harmful fungi; to agrochemical compositions comprising these ternary mixtures; and to agrochemical compositions comprising these ternary mixtures and further comprising seed.
It is preferred that the ternary mixtures comprise as compounds III fungicidal compounds that are independently of each other selected from the groups A), B), C), D), E), F), G), H), I), J), K) and O) ; and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
Preference is also given to ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from inhibitors of complex III at Qo site in group A), more preferably selected from compounds (A.1.1), (A.1.4), (A.1.8),
(A.1.9), (A.1.10), (A.1.11 ), (A.1.12), (A.1.13), (A.1.14), (A.1.17), (A.1.21), (A.1.21 a), (A.1.24),
(A.1.25), (A.1.26), (A.1.27), (A.1.30), (A.1.31), (A.1.32), (A.1.34) and (A.1.35); particularly selected from (A.1.1), (A.1.8), (A.1.9), (A.1.10), (A.1.11 ), (A.1.13), (A.1.14), (A.1.17), (A.1.25), and (A.1.34); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
Preference is also given to ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from inhibitors of complex III at Qi site in group A), more preferably selected from compounds (A.2.1), (A.2.3), (A.2.4),
(A.2.5) and (A.2.6); particularly selected from (A.2.4) and (A.2.6); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
Preference is also given to ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from inhibitors of complex II in group A), more preferably selected from compounds (A.3.2), (A.3.3), (A.3.4), (A.3.7), (A.3.9), (A.3.11 ), (A.3.12), (A.3.15), (A.3.16), (A.3.17), (A.3.18), (A.3.19), (A.3.20), (A.3.21 ), (A.3.22), (A.3.23), (A.3.24), (A.3.25), (A.3.26), (A.3.27), (A.3.28), (A.3.29), (A.3.31), (A.3.32), (A.3.33), (A.3.34), (A.3.35), (A.3.36), (A.3.37), (A.3.38) and (A.3.39); particularly selected from (A.3.2), (A.3.3), (A.3.4), (A.3.7), (A.3.9), (A.3.17), (A.3.24), (A.3.28), (A.3.29), (A.3.31 ), (A.3.32),
(A.3.33), (A.3.34), (A.3.35), (A.3.36), (A.3.37), (A.3.38) and (A.3.39); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
Preference is also given to ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from other respiration inhibitors in group A), more preferably selected from compounds (A.4.5) and (A.4.1 1); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
Preference is also given to ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from C14 demethylase inhibitors in group B), more preferably selected from compounds (B.1.4), (B.1.5), (B.1.8), (B.1.10), (B.1.1 1 ), (B.1.12), (B.1.13), (B.1.17), (B.1.18), (B.1.21 ), (B.1.22), (B.1.23), (B.1.25), (B.1.26), (B.1.29), (B.1.33), (B.1.34), (B.1.37), (B.1.38), (B.1.43) and (B.1.46); particularly selected from (B.1.4), (B.1.5), (B.1.8), (B.1.17), (B.1.22), (B.1.23), (B.1.25), (B.1.29), and (B.1.38); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
Preference is also given to ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from Deltal 4-reductase inhibitors in group B), more preferably selected from compounds (B.2.4), (B.2.5), (B.2.6) and (B.2.8); in particular (B.2.4) and (B.2.6); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
Preference is also given to ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from phenylamides and acyl amino acid fungicides in group C), more preferably selected from compounds (C.1.1),
(C.1.2), (C.1.4) and (C.1.5); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
Preference is also given to ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from other nucleic acid synthesis inhibitors in group C), more preferably selected from compounds (C.2.6),(C.2.7) and (C.2.8); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
Preference is also given to ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from group D), more preferably selected from compounds (D.1.1 ), (D.1.2), (D.1.5), (D.2.4), (D.2.6) and (D.2.7);
particularly selected from (D.2.6) and (D.2.7); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
Preference is also given to ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from group E), more preferably selected from compounds (E.1.1), (E.1.3), (E.2.2) and (E.2.3); in particular (E.1.1); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
Preference is also given to ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from group F), more preferably selected from compounds (F.1.2), (F.1.4) and (F.1.5); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
Preference is also given to ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from group G), more preferably selected from compounds (G.3.1), (G.3.3), (G.3.6), (G.5.1), (G.5.2), (G.5.3), (G.5.4), (G.5.5), (G.5.6), G.5.7), (G.5.8), (G.5.9), (G.5.10) and (G.5.1 1); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
Preference is also given to ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from group H), more preferably selected from compounds (H.1.5), (H.1.7), (H.2.2), (H.2.3), (H.2.5), (H.2.7), (H.2.8), (H.3.2), (H.3.4), (H.3.5), (H.4.9) and (H.4.10); particularly selected from (H.1.5), (H.1.7), (H.2.2), (H.3.2) and (H.3.5); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
Preference is also given to ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from group I), more preferably selected from compounds (1.2.2) and (1.2.5); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
Preference is also given to ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from group J), more preferably selected from compounds (J.1.2), (J.1.5), (J.1.8), (J.1.11 ) and (J.1.12); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
Preference is also given to ternary mixtures based on binary mixtures disclosed herein, comprising as component 3) at least one active compound selected from group K), more preferably selected from compounds (K.1.3), (K.1.29), (K.1.30), (K.1.31 ), (K.1.32), (K.1.41),
(K.1.42), (K.1.44), (K.1.45), (K.1.47), (K.1.49), (K.1.53) and (K.1.54); particularly selected from (K.1.3), (K.1.29), (K.1.30), (K.1.31), (K.1.32), (K.1.42), (K.1.53) and (K.1.54); and wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
The present invention relates furthermore to the mixtures as defined in Tables C1 to C14 comprising as component 1) one of the compounds I.A, I.B, I.C, I.D, I.E, I.F, I.G, I.H, I.J, I.K, I.L,
I.M, I.N or 1.0 as defined above, and as component 2) one of the compounds II as defined and numbered above from groups A) to K), and as component 3) a compound III from groups A) to K) as defined herein. Preferably, the compositions comprise the active substances in synergistically effective amounts.
Table C1: Ternary mixtures C1-1 to C1-6865 comprising compound I. A as defined herein as component 1) and one compound II as defined above as component 2) and one compound III as defined above as component 3). The components 1), 2) and 3) are written down in this order (comp.1 )+comp.2)+comp.3)), so that one mixture, for example mixture C1 -1 , comprises as component 1) compound I .A, as component 2) compound (A.1.4) and as component 3) compound (A.1.1).
C1-1 : I.A+ (A.1.4) + (A.1.1), C1-2: I.A + (A.1.8) + (A.1.1), C1-3: I.A + (A.1.9) + (A.1.1), C1-4: LA + (A.1.10) + (A.1.1), C1-5: LA + (A.1.11) + (A.1.1), C1-6: LA + (A.1.12) + (A.1.1), C1-7: I.A + (A.1.13) + (A.1.1), C1-8: LA + (A.1.14) + (A.1.1), C1-9: LA + (A.1.17) + (A.1.1), C1-10: I.A + (A.1.21) + (A.1.1), C1-11: I.A + (A.121a) + (A.1.1), C1-12: LA + (A.1.24) + (A.1.1), C1-13: I.A + (A.1.25) + (A.1.1), C1-14: LA + (A.1.26) + (A.1.1), C1-15: LA + (A.1.27) + (A.1.1), C1-16: I.A + (A.1.30) + (A.1.1), C1-17: LA + (A.1.31) + (A.1.1), C1-18: LA + (A.1.32) + (A.1.1), C1-19: I.A + (A.1.34) + (A.1.1), C1-20: LA + (A.1.35) + (A.1.1), C1-21: LA + (A.2.1) + (A.1.1), C1-22: I.A +
(A.2.3) + (A.1.1), C1-23: I.A + (A.2.4) + (A.1.1), C1-24: I.A+ (A.2.5) + (A.1.1), C1-25: I.A +
(A.2.6) + (A.1.1), C1-26: I.A+ (A.3.2) + (A.1.1), C1-27: I.A+ (A.3.3) + (A.1.1), C1-28: I.A +
(A.3.4) + (A.1.1), C1-29: I.A+ (A.3.7) + (A.1.1), C1-30: I.A+ (A.3.9) + (A.1.1), C1-31: I.A +
(A.3.11) + (A.1.1), C1-32 I.A+ (A.3.12) + (A.1.1), C1-33: I.A+ (A.3.15) + (A.1.1), C1-34: I.A + (A.3.16) + (A.1.1), C1-35 I.A+ (A.3.17) + (A.1.1), C1-36: I.A+ (A.3.18) + (A.1.1), C1-37: I.A + (A.3.19) + (A.1.1), C1-38 I.A + (A.3.20) + (A.1.1), C1-39: I.A+ (A.3.21) + (A.1.1), C1-40: I.A + (A.3.22) + (A.1.1), C1-41 I.A+ (A.3.23) + (A.1.1), C1-42: I.A+ (A.3.24) + (A.1.1), C1-43: I.A + (A.3.25) + (A.1.1), C1-44 I.A+ (A.3.26) + (A.1.1), C1-45: I.A+ (A.3.27) + (A.1.1), C1-46: I.A + (A.3.28) + (A.1.1), C1-47 I.A+ (A.3.29) + (A.1.1), C1-48: I.A+ (A.3.31) + (A.1.1), C1-49: I.A + (A.3.32) + (A.1.1), C1-50 I.A+ (A.3.33) + (A.1.1), C1-51: I.A+ (A.3.34) + (A.1.1), C1-52: I.A + (A.3.35) + (A.1.1), C1-53 I.A+ (A.3.36) + (A.1.1), C1-54: I.A+ (A.3.37) + (A.1.1), C1-55: I.A + (A.3.38) + (A.1.1), C1-56 I.A+ (A.3.39) + (A.1.1), C1-57: I.A+ (A.4.5) + (A.1.1), C1-58: I.A + (A.4.11) + (A.1.1), C1-59 I.A+ (B.1.4) + (A.1.1), C1-60: LA + (B.1.5) + (A.1.1), C1-61: I.A +
(B.1.8.) + (A.1.1), C1-62: I.A+ (B.1.10) + (A.1.1), C1-63: I.A+ (B.1.11) + (A.1.1), C1-64: I.A +
(B.1.12) + (A.1.1), C1-65 I.A+ (B.1.13) + (A.1.1), C1-66: I.A+ (B.1.17) + (A.1.1), C1-67: I.A + (B.1.18) + (A.1.1), C1-68 I.A+ (B.1.21) + (A.1.1), C1-69: I.A+ (B.1.22) + (A.1.1), C1-70: I.A + (B.1.23) + (A.1.1), C1-71 I.A+ (B.1.25) + (A.1.1), C1-72: I.A+ (B.1.26) + (A.1.1), C1-73: I.A + (B.1.29) + (A.1.1), C1-74 I.A+ (B.1.33) + (A.1.1), C1-75: I.A+ (B.1.34) + (A.1.1), C1-76: I.A + (B.1.37) + (A.1.1), C1-77 I.A+ (B.1.38) + (A.1.1), C1-78: I.A+ (B.1.43) + (A.1.1), C1-79: I.A + (B.1.46) + (A.1.1), C1-80 I.A+ (B.2.4) + (A.1.1), C1-81: I.A+ (B.2.5) + (A.1.1), C1-82: I.A + (B.2.6) + (A.1.1), C1-83: I.A+ (B.2.8) + (A.1.1), C1-84: I.A+ (C.1.1) + (A.1.1), C1-85: I.A +
(C.1.2) + (A.1.1), C1-86: I.A+ (C.1.4) + (A.1.1), C1-87: I.A+ (C.1.5) + (A.1.1), C1-88: I.A +
(C.2.6) + (A.1.1), C1-89: I.A+ (C.2.7) + (A.1.1), C1-90: I.A+ (C.2.8) + (A.1.1), C1-91: I.A +
(D.1.1) + (A.1.1), C1-92: I.A+ (D.1.2) + (A.1.1), C1-93: I.A+ (D.1.5) + (A.1.1), C1-94: I.A +
(D.2.4) + (A.1.1), C1-95: I.A+ (D.2.6) + (A.1.1), C1-96: I.A+ (D.2.7) + (A.1.1), C1-97: I.A +
(E.1.1) + (A.1.1), C1-98: I.A+ (E.1.3) + (A.1.1), C1-99: I.A+ (E.2.2) + (A.1.1), C1-100: I.A + (E.2.3) + (A.1.1), C1-101 : I.A+ (F.1.2) + (A.1.1), C1-102: I.A+ (F.1.4) + (A.1.1), C1-103: I.A + (F.1.5) + (A.1.1), C1-104: I.A+ (G.3.1) + (A.1.1), C1-105: I.A+ (G.3.3) + (A.1.1), C1-106: I.A + (G.3.6) + (A.1.1), C1-107: I.A+ (G.5.1) + (A.1.1), C1-108: I.A+ (G.5.2) + (A.1.1), C1-109: I.A + (G.5.3) + (A.1.1), C1-110: I.A+ (G.5.4) + (A.1.1), C1-111: I.A+ (G.5.5) + (A.1.1), C1-112: I.A + (G.5.6) + (A.1.1), C1-113: I.A+ (G.5.7) + (A.1.1), C1-114: I.A+ (G.5.8) + (A.1.1), C1-115: I.A + (G.5.9) + (A.1.1), C1-116: I.A+ (G.5.10) + (A.1.1), C1-117: I.A + (G.5.11) + (A.1.1), C1-118: I. A + (H.1.5) + (A.1.1), C1-119: I.A+ (H.1.7) + (A.1.1), C1-120: I.A+ (H.2.2) + (A.1.1), C1-121: I.A + (H.2.3) + (A.1.1), C1-122: I.A + (H.2.5) + (A.1.1), C1-123: I.A+ (H.2.7) + (A.1.1), C1-124: I.A + (H.2.8) + (A.1.1), C1-125: I.A + (H.3.2) + (A.1.1), C1-126: I.A+ (H.3.4) + (A.1.1), C1-127: I.A + (H.3.5) + (A.1.1), C1-128: I.A + (H.4.9) + (A.1.1), C1-129: I.A+ (H.4.10) + (A.1.1), C1-130: I.A + (I.2.2) + (A.1.1), C1-131 : I.A+ (I.2.5) + (A.1.1), C1-132: I.A + (J.1.2) + (A.1.1), C1-133: I.A + (J.1.5) + (A.1.1), C1-134: I.A + (J.1.8) + (A.1.1), C1-135: I.A + (J.1.11) + (A.1.1), C1-136: I.A + (J.1.12) + (A.1.1), C1-137: I.A+ (K.1.3) + (A.1.1), C1-138: I.A+ (K.1.29) + (A.1.1), C1-139: I.A + (K.1.30) + (A.1.1), C1-140: I.A + (K.1.31) + (A.1.1), C1-141: I.A + (K.1.32) + (A.1.1), C1-142: I.A + (K.1.41) + (A.1.1), C1-143: I.A + (K.1.42) + (A.1.1), C1-144: I.A + (K.1.44) + (A.1.1), C1-145: I.A+ (K.1.45) + (A.1.1), C1-146: I.A + (K.1.47) + (A.1.1), C1-147: I.A + (K.1.49) + (A.1.1), C1- 148: LA + (K.1.53) + (A.1.1), C1-149: LA + (K.1.54) + (A.1.1), C1-150: LA + (A.1.4) + (A.1.8), C1-151 : LA + (A.1.9) + (A.1.8), C1-152: I.A+ (A.1.10) + (A.1.8), C1-153: LA + (A.1.11) +
(A.1.8), C1-154: I.A+ (A.1.12) + (A.1.8), C1-155: LA + (A.1.13) + (A.1.8), C1-156: LA + (A.1.14) + (A.1.8), C1-157: I.A+ (A.1.17) + (A.1.8), C1-158: LA + (A.1.21) + (A.1.8), C1-159: I.A +
(A.121a) + (A.1.8), C1-160: LA + (A.1.24) + (A.1.8), C1-161: LA + (A.1.25) + (A.1.8), C1-162:
LA + (A.1.26) + (A.1.8), C1-163: LA + (A.1.27) + (A.1.8), C1-164: LA + (A.1.30) + (A.1.8), C1- 165: LA + (A.1.31) + (A.1.8), C1-166: LA + (A.1.32) + (A.1.8), C1-167: I.A + (A.1.34) + (A.1.8), C1-168: LA + (A.1.35) + (A.1.8), C1-169: LA + (A.2.1) + (A.1.8), C1-170: I.A+ (A.2.3) + (A.1.8), C1-171: LA + (A.2.4) + (A.1.8), C1-172: I.A+ (A.2.5) + (A.1.8), C1-173: I.A+ (A.2.6) + (A.1.8), C1-174: LA + (A.3.2) + (A.1.8), C1-175: I.A+ (A.3.3) + (A.1.8), C1-176: I.A+ (A.3.4) + (A.1.8), C1-177: LA + (A.3.7) + (A.1.8), C1-178: I.A+ (A.3.9) + (A.1.8), C1-179: LA + (A.3.11) + (A.1.8), C1-180: LA + (A.3.12) + (A.1.8), C1-181: LA + (A.3.15) + (A.1.8), C1-182: I.A+ (A.3.16) + (A.1.8), C1-183: LA + (A.3.17) + (A.1.8), C1-184: I.A+ (A.3.18) + (A.1.8), C1-185: LA + (A.3.19) + (A.1.8), C1-186: I.A+ (A.3.20) + (A.1.8), C1-187: I.A+ (A.3.21) + (A.1.8), C1-188: I.A + (A.3.22) + (A.1.8), C1-189: I.A + (A.3.23) + (A.1.8), C1-190: I.A + (A.3.24) + (A.1.8), C1-191: I.A + (A.3.25) + (A.1.8), C1-192: I.A+ (A.3.26) + (A.1.8), C1-193: I.A + (A.3.27) + (A.1.8), C1-194: LA + (A.3.28) + (A.1.8), C1-195: I.A + (A.3.29) + (A.1.8), C1-196: LA + (A.3.31) + (A.1.8), C1- 197: LA + (A.3.32) + (A.1.8), C1-198: I.A + (A.3.33) + (A.1.8), C1-199: I.A + (A.3.34) + (A.1.8), C1-200: LA + (A.3.35) + (A.1.8), C1-201: I.A + (A.3.36) + (A.1.8), C1-202: I.A+ (A.3.37) + (A.1.8), C 1-203: I.A+ (A.3.38) + (A.1.8), C1-204: I.A+ (A.3.39) + (A.1.8), C1-205: I.A+ (A.4.5)
+ (A.1.8), C1-206: LA + (A.4.11) + (A.1.8), C1-207: I.A+ (B.1.4) + (A.1.8), C1-208: LA + (B.1.5) + (A.1.8), C1-209: LA + (B.1.8.) + (A.1.8), C1-210: LA + (B.1.10) + (A.1.8), C1-211: I.A +
(B.1.11) + (A.1.8), C1-212: I.A + (B.1.12) + (A.1.8), C1-213: LA + (B.1.13) + (A.1.8), C1-214: I.A + (B.1.17) + (A.1.8), C1-215: LA + (B.1.18) + (A.1.8), C1-216: LA + (B.1.21) + (A.1.8), C1-217:
I.A+ (B.1.22) + (A.1.8), C1-218: I.A + (B.1.23) + (A.1.8), C1-219: I.A + (B.1.25) + (A.1.8), C1- 220: I.A+ (B.1.26) + (A.1.8), C1-221: I.A + (B.1.29) + (A.1.8), C1-222: I.A + (B.1.33) + (A.1.8),
C 1-223: I.A+ (B.1.34) + (A.1.8), C1-224: I.A + (B.1.37) + (A.1.8), C1-225: I.A+ (B.1.38) + (A.1.8), C 1-226: I.A+ (B.1.43) + (A.1.8), C1-227: I.A+ (B.1.46) + (A.1.8), C1-228: I.A+ (B.2.4)
+ (A.1.8), C 1-229: I.A+ (B.2.5) + (A.1.8), C1-230: I.A + (B.2.6) + (A.1.8), C1-231: I.A+ (B.2.8) +
(A.1.8), C 1-232 I.A + (C.1.1) + (A.1.8), C1-233: I.A + (C.1.2) + (A.1.8), C1-234: I.A+ (C.1.4) + (A.1.8), C 1-235 I.A+ (C.1.5) + (A.1.8), C1-236: I.A + (C.2.6) + (A.1.8), C1-237: I.A+ (C.2.7) + (A.1.8), C 1-238 I.A + (C.2.8) + (A.1.8), C1-239: I.A + (D.1.1) + (A.1.8), C1-240: I.A+ (D.1.2) + (A.1.8), C1-241 I.A+ (D.1.5) + (A.1.8), C 1-242: I.A + (D.2.4) + (A.1.8), C1-243: I.A+ (D.2.6) + (A.1.8), C 1-244 I.A + (D.2.7) + (A.1.8), C1-245: I.A + (E.1.1) + (A.1.8), C1-246: I.A + (E.1.3) + (A.1.8), C 1-247 I.A + (E.2.2) + (A.1.8), C1-248: I.A+ (E.2.3) + (A.1.8), C1-249: I.A+ (F.1.2) + (A.1.8), C 1-250 I.A+ (F.1.4) + (A.1.8), C1-251 : I.A+ (F.1.5) + (A.1.8), C1-252: I.A+ (G.3.1) + (A.1.8), C 1-253 I.A + (G.3.3) + (A.1.8), C1-254: I.A+ (G.3.6) + (A.1.8), C1-255: I.A+ (G.5.1) + (A.1.8), C 1-256 I.A + (G.5.2) + (A.1.8), C1-257: I.A+ (G.5.3) + (A.1.8), C1-258: I.A+ (G.5.4) + (A.1.8), C 1-259 I.A + (G.5.5) + (A.1.8), C1-260: I.A+ (G.5.6) + (A.1.8), C1-261: I.A+ (G.5.7) + (A.1.8), C 1-262 I.A + (G.5.8) + (A.1.8), C1-263: I.A+ (G.5.9) + (A.1.8), C1-264: I.A+ (G.5.10) + (A.1.8), C 1-265 I.A + (G.5.11) + (A.1.8), C1-266: I.A + (H.1.5) + (A.1.8), C1-267: I.A + (H.1.7) + (A.1.8), C 1-268 I.A + (H.2.2) + (A.1.8), C1-269: I.A+ (H.2.3) + (A.1.8), C1-270: I.A+ (H.2.5) + (A.1.8), C1-271 I.A + (H.2.7) + (A.1.8), C1-272: I.A + (H.2.8) + (A.1.8), C1-273: I.A+ (H.3.2) + (A.1.8), C1-274 I.A + (H.3.4) + (A.1.8), C1-275: I.A + (H.3.5) + (A.1.8), C1-276: I.A+ (H.4.9) + (A.1.8), C 1-277 I.A + (H.4.10) + (A.1.8), C1-278: I.A+ (I.2.2) + (A.1.8), C1-279: I.A + (I.2.5) + (A.1.8), C 1-280 I.A + (J.1.2) + (A.1.8), C1-281 : I.A + (J.1.5) + (A.1.8), C1-282: I.A + (J.1.8) + (A.1.8), C 1-283 I.A + (J.1.11) + (A.1.8), C 1-284: I.A + (J.1.12) + (A.1.8), C1-285: I.A + (K.1.3) + (A.1.8), C 1-286 I.A+ (K.1.29) + (A.1.8), C1-287: I.A+ (K.1.30) + (A.1.8), C1-288: I.A+ (K.1.31) + (A.1.8), C 1-289: I.A+ (K.1.32) + (A.1.8), C1-290: I.A+ (K.1.41) + (A.1.8), C1-291: I.A + (K.1.42) + (A.1.8), C1-292: I.A+ (K.1.44) + (A.1.8), C1-293: I.A + (K.1.45) + (A.1.8), C1-294: I.A + (K.1.47) + (A.1.8), C1-295: I.A + (K.1.49) + (A.1.8), C1-296: LA + (K.1.53) + (A.1.8), C1-297: I.A+ (K.1.54) + (A.1.8), C1-298: LA + (A.1.4) + (A.1.9), C1-299: LA + (A.1.10) + (A.1.9), C1- 300: I.A+ (A.1.11) + (A.1.9), C1-301: LA + (A.1.12) + (A.1.9), C1-302: I.A + (A.1.13) + (A.1.9), C1-303: I.A+ (A.1.14) + (A.1.9), C1-304: I.A + (A.1.17) + (A.1.9), C1-305: LA + (A.1.21) + (A.1.9), C1-306: I.A + (A.121a) + (A.1.9), C1-307: LA + (A.1.24) + (A.1.9), C1-308: I.A +
(A.1.25) + (A.1.9), C1-309: LA + (A.1.26) + (A.1.9), C1-310: LA + (A.1.27) + (A.1.9), C1-311: I.A + (A.1.30) + (A.1.9), C1-312: I.A+ (A.1.31) + (A.1.9), C1-313: LA + (A.1.32) + (A.1.9), C1-314: LA + (A.1.34) + (A.1.9), C1-315: LA + (A.1.35) + (A.1.9), C1-316: LA + (A.2.1) + (A.1.9), C1- 317: LA + (A.2.3) + (A.1.9), C1-318: I.A+ (A.2.4) + (A.1.9), C1-319: I.A+ (A.2.5) + (A.1.9), C1-
320: LA + (A.2.6) + (A.1.9), C1-321: I.A+ (A.3.2) + (A.1.9), C1-322: I.A+ (A.3.3) + (A.1.9), C1-
323: LA + (A.3.4) + (A.1.9), C1-324: I.A+ (A.3.7) + (A.1.9), C1-325: I.A+ (A.3.9) + (A.1.9), C1-
326: I.A+ (A.3.11) + (A.1.9), C1-327: I.A + (A.3.12) + (A.1.9), C1-328: LA + (A.3.15) + (A.1.9),
C1-329: LA + (A.3.16) + (A.1.9), C1-330: LA + (A.3.17) + (A.1.9), C1-331: LA + (A.3.18) + (A.1.9), C 1-332: I.A+ (A.3.19) + (A.1.9), C1-333: I.A+ (A.3.20) + (A.1.9), C1-334: I.A+ (A.3.21) + (A.1.9), C1-335: I.A+ (A.3.22) + (A.1.9), C1-336: I.A+ (A.3.23) + (A.1.9), C1-337: I.A + (A.3.24) + (A.1.9), C1-338: I.A + (A.3.25) + (A.1.9), C1-339: I.A + (A.3.26) + (A.1.9), C1-340: I.A
+ (A.3.27) + (A.1.9), C1-341 : I.A+ (A.3.28) + (A.1.9), C1-342: I.A + (A.3.29) + (A.1.9), C1-343: I.A+ (A.3.31) + (A.1.9), C1-344: I.A + (A.3.32) + (A.1.9), C1-345: I.A+ (A.3.33) + (A.1.9), C1- 346: I.A+ (A.3.34) + (A.1.9), C1-347: I.A + (A.3.35) + (A.1.9), C1-348: I.A + (A.3.36) + (A.1.9), C1-349: I.A+ (A.3.37) + (A.1.9), C1-350: I.A + (A.3.38) + (A.1.9), C1-351: I.A+ (A.3.39) + (A.1.9), C 1-352: I.A+ (A.4.5) + (A.1.9), C1-353: I.A+ (A.4.11) + (A.1.9), C1-354: I.A+ (B.1.4) + (A.1.9), C1-355: I.A+ (B.1.5) + (A.1.9), C1-356: I.A+ (B.1.8.) + (A.1.9), C1-357: I.A + (B.1.10) + (A.1.9), C1-358: I.A+ (B.1.11) + (A.1.9), C1-359: I.A+ (B.1.12) + (A.1.9), C1-360: I.A+ (B.1.13) + (A.1.9), C1-361 : I.A+ (B.1.17) + (A.1.9), C1-362: I.A+ (B.1.18) + (A.1.9), C1-363: I.A +
(B.1.21) + (A.1.9), C1-364: I.A + (B.1.22) + (A.1.9), C1-365: I.A + (B.1.23) + (A.1.9), C1-366: I.A + (B.1.25) + (A.1.9), C1-367: I.A + (B.1.26) + (A.1.9), C1-368: LA + (B.1.29) + (A.1.9), C1-369: LA + (B.1.33) + (A.1.9), C1-370: LA + (B.1.34) + (A.1.9), C1-371: LA + (B.1.37) + (A.1.9), C1- 372: LA + (B.1.38) + (A.1.9), C1-373: LA + (B.1.43) + (A.1.9), C1-374: LA + (B.1.46) + (A.1.9), C1-375: LA + (B.2.4) + (A.1.9), C1-376: I.A+ (B.2.5) + (A.1.9), C1-377: I.A+ (B.2.6) + (A.1.9), C1-378: LA + (B.2.8) + (A.1.9), C1-379: LA + (C.1.1) + (A.1.9), C1-380: LA + (C.1.2) + (A.1.9),
C1-381 : I.A+ (C.1.4) + (A.1.9), C1-382: LA + (C.1.5) + (A.1.9), C1-383: I.A+ (C.2.6) + (A.1.9),
C 1-384: LA + (C.2.7) + (A.1.9), C1-385: I.A + (C.2.8) + (A.1.9), C1-386: LA + (D.1.1) + (A.1.9),
C1-387: I.A+ (D.1.2) + (A.1.9), C1-388: LA + (D.1.5) + (A.1.9), C1-389: I.A+ (D.2.4) + (A.1.9),
C1-390: LA + (D.2.6) + (A.1.9), C1-391: I.A + (D.2.7) + (A.1.9), C1-392: LA + (E.1.1) + (A.1.9),
C1-393: I.A+ (E.1.3) + (A.1.9), C1-394: I.A+ (E.2.2) + (A.1.9), C1-395: I.A+ (E.2.3) + (A.1.9),
C1-396: I.A+ (F.1.2) + (A.1.9), C1-397: LA + (F.1.4) + (A.1.9), C1-398: LA + (F.1.5) + (A.1.9),
C1-399: LA + (G.3.1) + (A.1.9), C1-400: LA + (G.3.3) + (A.1.9), C1-401: LA + (G.3.6) + (A.1.9),
C 1-402: LA + (G.5.1) + (A.1.9), C1-403: I.A+ (G.5.2) + (A.1.9), C1-404: I.A+ (G.5.3) + (A.1.9),
C1-405: LA + (G.5.4) + (A.1.9), C1-406: LA + (G.5.5) + (A.1.9), C1-407: LA + (G.5.6) + (A.1.9),
C1-408: LA + (G.5.7) + (A.1.9), C1-409: I.A+ (G.5.8) + (A.1.9), C1-410: I.A+ (G.5.9) + (A.1.9),
C1-411: LA + (G.5.10) + (A.1.9), C1-412: LA + (G.5.11) + (A.1.9), C1-413: I.A + (H.1.5) + (A.1.9), C1-414: I.A + (H.1.7) + (A.1.9), C1-415: I.A + (H.2.2) + (A.1.9), C1-416: LA + (H.2.3) +
(A.1.9), C1-417: I.A+ (H.2.5) + (A.1.9), C1-418: I.A + (H.2.7) + (A.1.9), C1-419: LA + (H.2.8) +
(A.1.9), C 1-420: LA + (H.3.2) + (A.1.9), C1-421: I.A + (H.3.4) + (A.1.9), C1-422: LA + (H.3.5) +
(A.1.9), C 1-423: LA + (H.4.9) + (A.1.9), C1-424: I.A + (H.4.10) + (A.1.9), C1-425: I.A+ (I.2.2) +
(A.1.9), C 1-426: I.A+ (I.2.5) + (A.1.9), C1-427: I.A + (J.1.2) + (A.1.9), C1-428: I.A + (J.1.5) + (A.1.9), C 1-429: I.A + (J.1.8) + (A.1.9), C1-430: I.A + (J.1.11) + (A.1.9), C1-431: I.A + (J.1.12) + (A.1.9), C 1-432: I.A+ (K.1.3) + (A.1.9), C1-433: LA + (K.1.29) + (A.1.9), C1-434: I.A+ (K.1.30)
+ (A.1.9), C1-435: LA + (K.1.31) + (A.1.9), C1-436: LA + (K.1.32) + (A.1.9), C1-437: I.A + (K.1.41) + (A.1.9), C1-438: LA + (K.1.42) + (A.1.9), C1-439: LA + (K.1.44) + (A.1.9), C1-440: I.A + (K.1.45) + (A.1.9), C1-441 : LA + (K.1.47) + (A.1.9), C1-442: I.A + (K.1.49) + (A.1.9), C1-443: LA + (K.1.53) + (A.1.9), C1-444: I.A + (K.1.54) + (A.1.9), C1-445: LA + (A.1.4) + (A.1.10), C1- 446: I.A+ (A.1.11) + (A.1.10), C1-447: I.A+ (A.1.12) + (A.1.10), C1-448: LA + (A.1.13) + (A.1.10), C1-449: LA + (A.1.14) + (A.1.10), C1-450: LA + (A.1.17) + (A.1.10), C1-451: I.A + (A.1.21) + (A.1.10), C 1-452: I.A + (A.121a) + (A.1.10), C1-453: I.A + (A.1.24) + (A.1.10), C1- 454: I.A + (A.1.25) + (A.1.10), C1-455: I.A+ (A.1.26) + (A.1.10), C1-456: I.A + (A.1.27) + (A.1.10), C 1-457: I.A + (A.1.30) + (A.1.10), C1-458: LA + (A.1.31) + (A.1.10), C1-459: I.A + (A.1.32) + (A.1.10), C 1-460: I.A+ (A.1.34) + (A.1.10), C1-461: I.A+ (A.1.35) + (A.1.10), C1-462:
I.A+ (A.2.1) + (A.1.10), C1-463: I.A + (A.2.3) + (A.1.10), C1-464: I.A+ (A.2.4) + (A.1.10), C1- 465: I.A+ (A.2.5) + (A.1.10), C1-466: I.A + (A.2.6) + (A.1.10), C1-467: I.A+ (A.3.2) + (A.1.10), C1-468: I.A+ (A.3.3) + (A.1.10), C1-469: I.A + (A.3.4) + (A.1.10), C1-470: I.A+ (A.3.7) + (A.1.10), C1-471 : I.A + (A.3.9) + (A.1.10), C1-472: I.A+ (A.3.11) + (A.1.10), C1-473: I.A + (A.3.12) + (A.1.10), C1-474: I.A+ (A.3.15) + (A.1.10), C1-475: I.A+ (A.3.16) + (A.1.10), C1-476: I.A+ (A.3.17) + (A.1.10), C1-477: I.A+ (A.3.18) + (A.1.10), C1-478: I.A + (A.3.19) + (A.1.10),
C1-479: I.A+ (A.3.20) + (A.1.10), C1-480: I.A+ (A.3.21) + (A.1.10), C1-481: I.A+ (A.3.22) +
(A.1.10), C 1-482: I.A + (A.3.23) + (A.1.10), C1-483: I.A + (A.3.24) + (A.1.10), C1-484: I.A + (A.3.25) + (A.1.10), C1-485: I.A+ (A.3.26) + (A.1.10), C1-486: I.A+ (A.3.27) + (A.1.10), C1-487: I.A+ (A.3.28) + (A.1.10), C1-488: I.A+ (A.3.29) + (A.1.10), C1-489: I.A + (A.3.31) + (A.1.10),
C1-490: I.A+ (A.3.32) + (A.1.10), C1-491: I.A+ (A.3.33) + (A.1.10), C1-492: I.A+ (A.3.34) +
(A.1.10), C1-493: I.A + (A.3.35) + (A.1.10), C1-494: I.A + (A.3.36) + (A.1.10), C1-495: I.A + (A.3.37) + (A.1.10), C1-496: I.A+ (A.3.38) + (A.1.10), C1-497: I.A+ (A.3.39) + (A.1.10), C1-498: I.A+ (A.4.5) + (A.1.10), C1-499: I.A + (A.4.11) + (A.1.10), C1-500: I.A + (B.1.4) + (A.1.10), C1- 501: I.A+ (B.1.5) + (A.1.10), C1-502: I.A + (B.1.8.) + (A.1.10), C1-503: I.A+ (B.1.10) + (A.1.10), C 1-504: I.A+ (B.1.11) + (A.1.10), C1-505: I.A+ (B.1.12) + (A.1.10), C1-506: I.A+ (B.1.13) + (A.1.10), C1-507: I.A + (B.1.17) + (A.1.10), C1-508: I.A + (B.1.18) + (A.1.10), C1-509: I.A +
(B.1.21) + (A.1.10), C1-510: I.A + (B.1.22) + (A.1.10), C1-511: I.A+ (B.1.23) + (A.1.10), C1-512: I.A+ (B.1.25) + (A.1.10), C1-513: I.A+ (B.1.26) + (A.1.10), C1-514: I.A + (B.1.29) + (A.1.10),
C1-515: I.A+ (B.1.33) + (A.1.10), C1-516: I.A+ (B.1.34) + (A.1.10), C1-517: I.A+ (B.1.37) +
(A.1.10), C1-518: I.A + (B.1.38) + (A.1.10), C1-519: I.A + (B.1.43) + (A.1.10), C1-520: I.A + (B.1.46) + (A.1.10), C1-521 : I.A+ (B.2.4) + (A.1.10), C1-522: I.A + (B.2.5) + (A.1.10), C1-523: I.A + (B.2.6) + (A.1.10), C1-524: I.A + (B.2.8) + (A.1.10), C1-525: I.A+ (C.1.1) + (A.1.10), C1- 526: I.A+ (C.1.2) + (A.1.10), C1-527: I.A+ (C.1.4) + (A.1.10), C1-528: I.A+ (C.1.5) + (A.1.10),
C 1-529: I.A + (C.2.6) + (A.1.10), C1-530: I.A+ (C.2.7) + (A.1.10), C1-531: I.A+ (C.2.8) + (A.1.10), C1-532: I.A + (D.1.1) + (A.1.10), C1-533: I.A + (D.1.2) + (A.1.10), C1-534: I.A+ (D.1.5) + (A.1.10), C1-535: I.A+ (D.2.4) + (A.1.10), C1-536: I.A+ (D.2.6) + (A.1.10), C1-537: I.A + (D.2.7) + (A.1.10), C1-538: I.A+ (E.1.1) + (A.1.10), C1-539: I.A + (E.1.3) + (A.1.10), C1-540: I.A + (E.2.2) + (A.1.10), C1-541 : I.A+ (E.2.3) + (A.1.10), C1-542: I.A + (F.1.2) + (A.1.10), C1-543: I.A+ (F.1.4) + (A.1.10), C 1-544: I.A+ (F.1.5) + (A.1.10), C1-545: I.A+ (G.3.1) + (A.1.10), C1- 546: I.A + (G.3.3) + (A.1.10), C1-547: I.A + (G.3.6) + (A.1.10), C1-548: I.A+ (G.5.1) + (A.1.10), C 1-549: I.A + (G.5.2) + (A.1.10), C1-550: I.A + (G.5.3) + (A.1.10), C1-551: I.A+ (G.5.4) + (A.1.10), C 1-552: I.A + (G.5.5) + (A.1.10), C1-553: I.A+ (G.5.6) + (A.1.10), C1-554: I.A +
(G.5.7) + (A.1.10), C1-555: I.A + (G.5.8) + (A.1.10), C1-556: I.A+ (G.5.9) + (A.1.10), C1-557:
I.A + (G.5.10) + (A.1.10), C1-558: I.A + (G.5.11) + (A.1.10), C1-559: I.A + (H.1.5) + (A.1.10),
C 1-560: I.A + (H.1.7) + (A.1.10), C1-561: I.A+ (H.2.2) + (A.1.10), C1-562: I.A+ (H.2.3) + (A.1.10), C1-563: I.A + (H.2.5) + (A.1.10), C1-564: I.A + (H.2.7) + (A.1.10), C1-565: I.A+ (H.2.8) + (A.1.10), C 1-566: I.A+ (H.3.2) + (A.1.10), C1-567: I.A+ (H.3.4) + (A.1.10), C1-568: I.A + (H.3.5) + (A.1.10), C 1-569: I.A+ (H.4.9) + (A.1.10), C1-570: I.A + (H.4.10) + (A.1.10), C1-571: I.A + (1.2.2) + (A.1.10), C1-572: I.A+ (I.2.5) + (A.1.10), C1-573: I.A + (J.1.2) + (A.1.10), C1-574: I.A + (J.1.5) + (A.1.10), C1-575: I.A + (J.1.8) + (A.1.10), C1-576: I.A + (J.1.11) + (A.1.10), C1- 577: I.A + (J.1.12) + (A.1.10), C1-578: I.A + (K.1.3) + (A.1.10), C1-579: I.A+ (K.1.29) + (A.1.10),
C 1-580: I.A+ (K.1.30) + (A.1.10), C1-581: I.A+ (K.1.31) + (A.1.10), C1-582: I.A+ (K.1.32) +
(A.1.10), C1-583: I.A + (K.1.41) + (A.1.10), C1-584: I.A + (K.1.42) + (A.1.10), C1-585: I.A + (K.1.44) + (A.1.10), C1-586: I.A + (K.1.45) + (A.1.10), C1-587: I.A + (K.1.47) + (A.1.10), C1-588: LA + (K.1.49) + (A.1.10), C1-589: LA + (K.1.53) + (A.1.10), C1-590: LA + (K.1.54) + (A.1.10), C1-591 : LA + (A.1.4) + (A.1.11), C1-592: LA + (A.1.12) + (A.1.11), C1-593: LA + (A.1.13) + (A.1.11), C1-594: LA + (A.1.14) + (A.1.11), C1-595: LA + (A.1.17) + (A.1.11), C1-596: I.A + (A.1.21) + (A.1.11), C1-597: I.A + (A.121a) + (A.1.11), C1-598: I.A + (A.1.24) + (A.1.11), C1- 599: I.A + (A.1.25) + (A.1.11), C1-600: I.A+ (A.1.26) + (A.1.11), C1-601: I.A + (A.1.27) + (A.1.11), C1-602: I.A + (A.1.30) + (A.1.11), C1-603: LA + (A.1.31) + (A.1.11), C1-604: I.A +
(A.1.32) + (A.1.11), C1-605: I.A + (A.1.34) + (A.1.11), C1-606: I.A + (A.1.35) + (A.1.11), C1-607: LA + (A.2.1) + (A.1.11), C1-608: I.A + (A.2.3) + (A.1.11), C1-609: I.A+ (A.2.4) + (A.1.11), C1- 610: I.A + (A.2.5) + (A.1.11), C1-611: I.A + (A.2.6) + (A.1.11), C1-612: I.A+ (A.3.2) + (A.1.11), C1-613: I.A + (A.3.3) + (A.1.11), C1-614: I.A + (A.3.4) + (A.1.11), C1-615: I.A+ (A.3.7) + (A.1.11), C1-616: I.A + (A.3.9) + (A.1.11), C1-617: I.A+ (A.3.11) + (A.1.11), C1-618: I.A + (A.3.12) + (A.1.11), C1-619: I.A+ (A.3.15) + (A.1.11), C1-620: I.A+ (A.3.16) + (A.1.11), C1-621: I.A + (A.3.17) + (A.1.11), C1-622: I.A+ (A.3.18) + (A.1.11), C1-623: I.A + (A.3.19) + (A.1.11),
C 1-624: I.A + (A.3.20) + (A.1.11), C1-625: I.A+ (A.3.21) + (A.1.11), C1-626: I.A+ (A.3.22) + (A.1.11), C 1-627: I.A + (A.3.23) + (A.1.11), C1-628: I.A + (A.3.24) + (A.1.11), C1-629: I.A + (A.3.25) + (A.1.11), C1-630: I.A+ (A.3.26) + (A.1.11), C1-631: I.A+ (A.3.27) + (A.1.11), C1-632: I.A + (A.3.28) + (A.1.11), C1-633: I.A+ (A.3.29) + (A.1.11), C1-634: I.A + (A.3.31) + (A.1.11), C1-635: I.A + (A.3.32) + (A.1.11), C1-636: I.A+ (A.3.33) + (A.1.11), C1-637: I.A+ (A.3.34) + (A.1.11), C1-638: I.A + (A.3.35) + (A.1.11), C1-639: I.A + (A.3.36) + (A.1.11), C1-640: I.A + (A.3.37) + (A.1.11), C1-641 : I.A+ (A.3.38) + (A.1.11), C1-642: I.A+ (A.3.39) + (A.1.11), C1-643: I.A + (A.4.5) + (A.1.11), C1-644: I.A + (A.4.11) + (A.1.11), C1-645: LA + (B.1.4) + (A.1.11), C1- 646: I.A+ (B.1.5) + (A.1.11), C1-647: I.A + (B.1.8.) + (A.1.11), C1-648: LA + (B.1.10) + (A.1.11), C 1-649: I.A+ (B.1.11) + (A.1.11), C1-650: LA + (B.1.12) + (A.1.11), C1-651: LA + (B.1.13) + (A.1.11), C 1-652: I.A + (B.1.17) + (A.1.11), C1-653: LA + (B.1.18) + (A.1.11), C1-654: I.A +
(B.1.21) + (A.1.11), C1-655: LA + (B.1.22) + (A.1.11), C1-656: LA + (B.1.23) + (A.1.11), C1-657: I.A+ (B.1.25) + (A.1.11), C1-658: LA + (B.1.26) + (A.1.11), C1-659: LA + (B.1.29) + (A.1.11),
C 1-660: LA + (B.1.33) + (A.1.11), C1-661: LA + (B.1.34) + (A.1.11), C1-662: I.A+ (B.1.37) + (A.1.11), C1-663: LA + (B.1.38) + (A.1.11), C1-664: I.A + (B.1.43) + (A.1.11), C1-665: I.A + (B.1.46) + (A.1.11), C1-666: I.A+ (B.2.4) + (A.1.11), C1-667: I.A + (B.2.5) + (A.1.11), C1-668: I.A + (B.2.6) + (A.1.11), C1-669: I.A + (B.2.8) + (A.1.11), C1-670: LA + (C.1.1) + (A.1.11), C1- 671: I.A+ (C.1.2) + (A.1.11), C1-672: I.A+ (C.1.4) + (A.1.11), C1-673: LA + (C.1.5) + (A.1.11), C1-674: I.A + (C.2.6) + (A.1.11), C1-675: I.A+ (C.2.7) + (A.1.11), C1-676: I.A+ (C.2.8) + (A.1.11), C 1-677: I.A + (D.1.1) + (A.1.11), C1-678: LA + (D.1.2) + (A.1.11), C1-679: LA + (D.1.5) + (A.1.11), C 1-680: I.A+ (D.2.4) + (A.1.11), C1-681: I.A+ (D.2.6) + (A.1.11), C1-682: I.A + (D.2.7) + (A.1.11), C 1-683: LA + (E.1.1) + (A.1.11), C1-684: I.A + (E.1.3) + (A.1.11), C1-685: I.A + (E.2.2) + (A.1.11), C1-686: I.A+ (E.2.3) + (A.1.11), C1-687: I.A + (F.1.2) + (A.1.11), C1-688: I.A+ (F.1.4) + (A.1.11), C 1-689: LA + (F.1.5) + (A.1.11), C1-690: LA + (G.3.1) + (A.1.11), C1- 691: I.A + (G.3.3) + (A.1.11), C1-692: I.A + (G.3.6) + (A.1.11), C1-693: LA + (G.5.1) + (A.1.11), C 1-694: I.A + (G.5.2) + (A.1.11), C1-695: I.A + (G.5.3) + (A.1.11), C1-696: I.A+ (G.5.4) +
(A.1.11), C1-697: I.A + (G.5.5) + (A.1.11), C1-698: I.A+ (G.5.6) + (A.1.11), C1-699: I.A +
(G.5.7) + (A.1.11), C1-700: I.A + (G.5.8) + (A.1.11), C1-701: I.A+ (G.5.9) + (A.1.11), C1-702: I.A+ (G.5.10) + (A.1.11), C1-703: I.A+ (G.5.11) + (A.1.11), C1-704: I.A + (H.1.5) + (A.1.11), C1-705: I.A+ (H.1.7) + (A.1.11), C1-706: I.A+ (H.2.2) + (A.1.11), C1-707: I.A+ (H.2.3) + (A.1.11), C1-708: I.A + (H.2.5) + (A.1.11), C1-709: I.A + (H.2.7) + (A.1.11), C1-710: I.A+ (H.2.8) + (A.1.11), C1-711: I.A+ (H.3.2) + (A.1.11), C1-712: I.A+ (H.3.4) + (A.1.11), C1-713: I.A + (H.3.5) + (A.1.11), C1-714: I.A+ (H.4.9) + (A.1.11), C1-715: I.A + (H.4.10) + (A.1.11), C1-716: I.A+ (I.2.2) + (A.1.11), C1-717: I.A+ (I.2.5) + (A.1.11), C1-718: I.A+ (J.1.2) + (A.1.11), C1-719: I.A+ (J.1.5) + (A.1.11), C1-720: I.A+ (J.1.8) + (A.1.11), C1-721: I.A + (J.1.11) + (A.1.11), C1- 722: I.A+ (J.1.12) + (A.1.11), C1-723: I.A + (K.1.3) + (A.1.11), C1-724: I.A+ (K.1.29) + (A.1.11), C1-725: I.A+ (K.1.30) + (A.1.11), C1-726: I.A+ (K.1.31) + (A.1.11), C1-727: I.A+ (K.1.32) + (A.1.11), C1-728: I.A + (K.1.41) + (A.1.11), C1-729: I.A + (K.1.42) + (A.1.11), C1-730: I.A + (K.1.44) + (A.1.11), C1-731 : I.A + (K.1.45) + (A.1.11), C1-732: I.A + (K.1.47) + (A.1.11), C1-733: I.A+ (K.1.49) + (A.1.11), C1-734: LA + (K.1.53) + (A.1.11), C1-735: LA + (K.1.54) + (A.1.11), C1-736: LA + (A.1.4) + (A.1.13), C1-737: LA + (A.1.12) + (A.1.13), C1-738: LA + (A.1.14) + (A.1.13), C1-739: LA + (A.1.17) + (A.1.13), C1-740: LA + (A.1.21) + (A.1.13), C1-741: I.A +
(A.121a) + (A.1.13), C1-742: LA + (A.1.24) + (A.1.13), C1-743: LA + (A.1.25) + (A.1.13), C1- 744: LA + (A.1.26) + (A.1.13), C1-745: LA + (A.1.27) + (A.1.13), C1-746: LA + (A.1.30) + (A.1.13), C1-747: LA + (A.1.31) + (A.1.13), C1-748: LA + (A.1.32) + (A.1.13), C1-749: I.A + (A.1.34) + (A.1.13), C1-750: LA + (A.1.35) + (A.1.13), C1-751: LA + (A.2.1) + (A.1.13), C1-752: LA + (A.2.3) + (A.1.13), C1-753: I.A + (A.2.4) + (A.1.13), C1-754: I.A+ (A.2.5) + (A.1.13), C1- 755: LA + (A.2.6) + (A.1.13), C1-756: I.A + (A.3.2) + (A.1.13), C1-757: I.A+ (A.3.3) + (A.1.13), C1-758: LA + (A.3.4) + (A.1.13), C1-759: I.A + (A.3.7) + (A.1.13), C1-760: I.A+ (A.3.9) + (A.1.13), C1-761 : LA + (A.3.11) + (A.1.13), C1-762: LA + (A.3.12) + (A.1.13), C1-763: I.A + (A.3.15) + (A.1.13), C1-764: LA + (A.3.16) + (A.1.13), C1-765: LA + (A.3.17) + (A.1.13), C1-766: LA + (A.3.18) + (A.1.13), C1-767: LA + (A.3.19) + (A.1.13), C1-768: I.A + (A.3.20) + (A.1.13), C1-769: LA + (A.3.21) + (A.1.13), C1-770: I.A+ (A.3.22) + (A.1.13), C1-771: I.A+ (A.3.23) + (A.1.13), C1-772: I.A + (A.3.24) + (A.1.13), C1-773: I.A + (A.3.25) + (A.1.13), C1-774: I.A + (A.3.26) + (A.1.13), C1-775: I.A+ (A.3.27) + (A.1.13), C1-776: I.A+ (A.3.28) + (A.1.13), C1-777: LA + (A.3.29) + (A.1.13), C1-778: LA + (A.3.31) + (A.1.13), C1-779: I.A + (A.3.32) + (A.1.13), C1-780: LA + (A.3.33) + (A.1.13), C1-781: I.A+ (A.3.34) + (A.1.13), C1-782: I.A+ (A.3.35) + (A.1.13), C1-783: I.A + (A.3.36) + (A.1.13), C1-784: I.A + (A.3.37) + (A.1.13), C1-785: I.A + (A.3.38) + (A.1.13), C1-786: I.A+ (A.3.39) + (A.1.13), C1-787: I.A+ (A.4.5) + (A.1.13), C1-788: I.A+ (A.4.11) + (A.1.13), C1-789: LA + (B.1.4) + (A.1.13), C1-790: LA + (B.1.5) + (A.1.13), C1- 791: LA + (B.1.8.) + (A.1.13), C1-792: LA + (B.1.10) + (A.1.13), C1-793: LA + (B.1.11) +
(A.1.13), C1-794: LA + (B.1.12) + (A.1.13), C1-795: LA + (B.1.13) + (A.1.13), C1-796: I.A + (B.1.17) + (A.1.13), C1-797: I.A + (B.1.18) + (A.1.13), C1-798: LA + (B.1.21) + (A.1.13), C1-799: LA + (B.1.22) + (A.1.13), C1-800: LA + (B.1.23) + (A.1.13), C1-801: LA + (B.1.25) + (A.1.13),
C 1-802: I.A + (B.1.26) + (A.1.13), C1-803: I.A + (B.1.29) + (A.1.13), C1-804: I.A + (B.1.33) + (A.1.13), C1-805: LA + (B.1.34) + (A.1.13), C1-806: LA + (B.1.37) + (A.1.13), C1-807: I.A +
(B.1.38) + (A.1.13), C1-808: LA + (B.1.43) + (A.1.13), C1-809: LA + (B.1.46) + (A.1.13), C1-810: LA + (B.2.4) + (A.1.13), C1-811: I.A + (B.2.5) + (A.1.13), C1-812: I.A+ (B.2.6) + (A.1.13), C1-
813: I.A+ (B.2.8) + (A.1.13), C1-814: I.A+ (C.1.1) + (A.1.13), C1-815: I.A+ (C.1.2) + (A.1.13), C1-816: I.A+ (C.1.4) + (A.1.13), C1-817: I.A+ (C.1.5) + (A.1.13), C1-818: I.A+ (C.2.6) + (A.1.13), C1-819: I.A + (C.2.7) + (A.1.13), C1-820: I.A + (C.2.8) + (A.1.13), C1-821: I.A+ (D.1.1) + (A.1.13), C 1-822: I.A+ (D.1.2) + (A.1.13), C1-823: I.A+ (D.1.5) + (A.1.13), C1-824: I.A + (D.2.4) + (A.1.13), C1-825: I.A+ (D.2.6) + (A.1.13), C1-826: I.A + (D.2.7) + (A.1.13), C1-827: I.A + (E.1.1) + (A.1.13), C1-828: I.A+ (E.1.3) + (A.1.13), C1-829: I.A+ (E.2.2) + (A.1.13), C1-830: I.A + (E.2.3) + (A.1.13), C1-831: I.A + (F.1.2) + (A.1.13), C1-832: I.A+ (F.1.4) + (A.1.13), C1- 833: I.A+ (F.1.5) + (A.1.13), C1-834: I.A+ (G.3.1) + (A.1.13), C1-835: I.A+ (G.3.3) + (A.1.13), C1-836: I.A + (G.3.6) + (A.1.13), C1-837: I.A + (G.5.1) + (A.1.13), C1-838: I.A+ (G.5.2) + (A.1.13), C1-839: I.A + (G.5.3) + (A.1.13), C1-840: I.A+ (G.5.4) + (A.1.13), C1-841: I.A +
(G.5.5) + (A.1.13), C 1-842: I.A + (G.5.6) + (A.1.13), C1-843: I.A+ (G.5.7) + (A.1.13), C1-844:
I.A + (G.5.8) + (A.1.13), C1-845: I.A+ (G.5.9) + (A.1.13), C1-846: I.A+ (G.5.10) + (A.1.13), C1- 847: I.A + (G.5.11) + (A.1.13), C1-848: I.A + (H.1.5) + (A.1.13), C1-849: I.A + (H.1.7) + (A.1.13), C 1-850: I.A + (H.2.2) + (A.1.13), C1-851: I.A+ (H.2.3) + (A.1.13), C1-852: I.A+ (H.2.5) + (A.1.13), C1-853: I.A + (H.2.7) + (A.1.13), C1-854: I.A + (H.2.8) + (A.1.13), C1-855: I.A+ (H.3.2) + (A.1.13), C 1-856: I.A+ (H.3.4) + (A.1.13), C1-857: I.A+ (H.3.5) + (A.1.13), C1-858: I.A + (H.4.9) + (A.1.13), C 1-859: I.A+ (H.4.10) + (A.1.13), C1-860: I.A + (I.2.2) + (A.1.13), C1-861: I.A + (I.2.5) + (A.1.13), C 1-862: I.A + (J.1.2) + (A.1.13), C1-863: I.A + (J.1.5) + (A.1.13), C1-864: I.A + (J.1.8) + (A.1.13), C 1-865: I.A + (J.1.11) + (A.1.13), C1-866: I.A + (J.1.12) + (A.1.13), C1-867: I.A+ (K.1.3) + (A.1.13), C1-868: I.A + (K.1.29) + (A.1.13), C1-869: I.A + (K.1.30) + (A.1.13), C1- 870: I.A+ (K.1.31) + (A.1.13), C1-871: I.A + (K.1.32) + (A.1.13), C1-872: LA + (K.1.41) + (A.1.13), C1-873: I.A + (K.1.42) + (A.1.13), C1-874: LA + (K.1.44) + (A.1.13), C1-875: I.A + (K.1.45) + (A.1.13), C1-876: LA + (K.1.47) + (A.1.13), C1-877: LA + (K.1.49) + (A.1.13), C1-878: LA + (K.1.53) + (A.1.13), C1-879: I.A+ (K.1.54) + (A.1.13), C1-880: LA + (A.1.4) + (A.1.14), C1- 881: I.A+ (A.1.12) + (A.1.14), C1-882: LA + (A.1.17) + (A.1.14), C1-883: I.A + (A.1.21) + (A.1.14), C 1-884: I.A + (A.121a) + (A.1.14), C1-885: LA + (A.1.24) + (A.1.14), C1-886: I.A +
(A.1.25) + (A.1.14), C 1-887: LA + (A.1.26) + (A.1.14), C1-888: LA + (A.1.27) + (A.1.14), C1-889: LA + (A.1.30) + (A.1.14), C1-890: LA + (A.1.31) + (A.1.14), C1-891: I.A + (A.1.32) + (A.1.14),
C 1-892: LA + (A.1.34) + (A.1.14), C1-893: LA + (A.1.35) + (A.1.14), C1-894: LA + (A.2.1) + (A.1.14), C1-895: I.A + (A.2.3) + (A.1.14), C1-896: I.A+ (A.2.4) + (A.1.14), C1-897: I.A + (A.2.5) + (A.1.14), C1-898: I.A+ (A.2.6) + (A.1.14), C1-899: I.A + (A.3.2) + (A.1.14), C1-900: I.A + (A.3.3) + (A.1.14), C1-901 : I.A + (A.3.4) + (A.1.14), C1-902: I.A + (A.3.7) + (A.1.14), C1-903: I.A + (A.3.9) + (A.1.14), C1-904: LA + (A.3.11) + (A.1.14), C1-905: I.A+ (A.3.12) + (A.1.14), C1- 906: LA + (A.3.15) + (A.1.14), C1-907: LA + (A.3.16) + (A.1.14), C1-908: I.A + (A.3.17) + (A.1.14), C1-909: I.A + (A.3.18) + (A.1.14), C1-910: I.A + (A.3.19) + (A.1.14), C1-911: I.A + (A.3.20) + (A.1.14), C1-912: LA + (A.3.21) + (A.1.14), C1-913: I.A+ (A.3.22) + (A.1.14), C1-914: LA + (A.3.23) + (A.1.14), C1-915: I.A+ (A.3.24) + (A.1.14), C1-916: I.A + (A.3.25) + (A.1.14), C1-917: LA + (A.3.26) + (A.1.14), C1-918: I.A+ (A.3.27) + (A.1.14), C1-919: I.A+ (A.3.28) + (A.1.14), C1-920: I.A + (A.3.29) + (A.1.14), C1-921: LA + (A.3.31) + (A.1.14), C1-922: I.A + (A.3.32) + (A.1.14), C1-923: I.A+ (A.3.33) + (A.1.14), C1-924: I.A+ (A.3.34) + (A.1.14), C1-925: LA + (A.3.35) + (A.1.14), C1-926: I.A+ (A.3.36) + (A.1.14), C1-927: I.A + (A.3.37) + (A.1.14), C1-928: LA + (A.3.38) + (A.1.14), C1-929: I.A+ (A.3.39) + (A.1.14), C1-930: I.A+ (A.4.5) +
(A.1.14), C1-931 : I.A + (A.4.11) + (A.1.14), C1-932: I.A + (B.1.4) + (A.1.14), C1-933: I.A +
(B.1.5) + (A.1.14), C1-934: I.A + (B.1.8.) + (A.1.14), C1-935: I.A+ (B.1.10) + (A.1.14), C1-936: I.A+ (B.1.11) + (A.1.14), C1-937: I.A+ (B.1.12) + (A.1.14), C1-938: I.A + (B.1.13) + (A.1.14), C1-939: I.A+ (B.1.17) + (A.1.14), C1-940: I.A+ (B.1.18) + (A.1.14), C1-941: I.A+ (B.1.21) + (A.1.14), C1-942: I.A + (B.1.22) + (A.1.14), C1-943: I.A + (B.1.23) + (A.1.14), C1-944: I.A + (B.1.25) + (A.1.14), C1-945: I.A + (B.1.26) + (A.1.14), C1-946: I.A+ (B.1.29) + (A.1.14), C1-947: I.A + (B.1.33) + (A.1.14), C1-948: I.A+ (B.1.34) + (A.1.14), C1-949: I.A + (B.1.37) + (A.1.14), C1-950: I.A+ (B.1.38) + (A.1.14), C1-951: I.A+ (B.1.43) + (A.1.14), C1-952: I.A+ (B.1.46) + (A.1.14), C1-953: I.A + (B.2.4) + (A.1.14), C1-954: I.A+ (B.2.5) + (A.1.14), C1-955: I.A + (B.2.6) + (A.1.14), C1-956: I.A+ (B.2.8) + (A.1.14), C1-957: I.A + (C.1.1) + (A.1.14), C1-958: I.A + (C.1.2) + (A.1.14), C1-959: I.A+ (C.1.4) + (A.1.14), C1-960: I.A + (C.1.5) + (A.1.14), C1-961: I.A + (C.2.6) + (A.1.14), C 1-962: I.A+ (C.2.7) + (A.1.14), C1-963: I.A + (C.2.8) + (A.1.14), C1-964: I.A + (D.1.1) + (A.1.14), C1-965: I.A+ (D.1.2) + (A.1.14), C1-966: I.A+ (D.1.5) + (A.1.14), C1- 967: I.A + (D.2.4) + (A.1.14), C1-968: I.A+ (D.2.6) + (A.1.14), C1-969: I.A+ (D.2.7) + (A.1.14), C1-970: I.A + (E.1.1) + (A.1.14), C1-971: I.A + (E.1.3) + (A.1.14), C1-972: I.A+ (E.2.2) + (A.1.14), C1-973: I.A + (E.2.3) + (A.1.14), C1-974: I.A+ (F.1.2) + (A.1.14), C1-975: I.A+ (F.1.4) + (A.1.14), C1-976: I.A+ (F.1.5) + (A.1.14), C1-977: I.A+ (G.3.1) + (A.1.14), C1-978: I.A + (G.3.3) + (A.1.14), C1-979: I.A + (G.3.6) + (A.1.14), C1-980: I.A+ (G.5.1) + (A.1.14), C1-981:
I.A + (G.5.2) + (A.1.14), C1-982: I.A+ (G.5.3) + (A.1.14), C1-983: I.A+ (G.5.4) + (A.1.14), C1- 984: I.A + (G.5.5) + (A.1.14), C1-985: I.A + (G.5.6) + (A.1.14), C1-986: I.A+ (G.5.7) + (A.1.14), C1-987: I.A + (G.5.8) + (A.1.14), C1-988: I.A + (G.5.9) + (A.1.14), C1-989: I.A+ (G.5.10) + (A.1.14), C1-990: I.A + (G.5.11) + (A.1.14), C1-991: I.A + (H.1.5) + (A.1.14), C1-992: I.A + (H.1.7) + (A.1.14), C1-993: I.A+ (H.2.2) + (A.1.14), C1-994: I.A + (H.2.3) + (A.1.14), C1-995: I.A + (H.2.5) + (A.1.14), C1-996: I.A + (H.2.7) + (A.1.14), C1-997: I.A + (H.2.8) + (A.1.14), C1-998: I.A + (H.3.2) + (A.1.14), C1-999: I.A+ (H.3.4) + (A.1.14), C1-1000: I.A+ (H.3.5) + (A.1.14), C1- 1001: I.A + (H.4.9) + (A.1.14), C1-1002: I.A+ (H.4.10) + (A.1.14), C1-1003: I.A+ (I.2.2) + (A.1.14), C1-1004: I.A+ (I.2.5) + (A.1.14), C1-1005: I.A + (J.1.2) + (A.1.14), C1-1006: I.A + (J.1.5) + (A.1.14), C1-1007: I.A + (J.1.8) + (A.1.14), C1-1008: I.A + (J.1.11) + (A.1.14), C1-1009: I.A+ (J.1.12) + (A.1.14), C1-1010: I.A+ (K.1.3) + (A.1.14), C1-1011: I.A+ (K.1.29) + (A.1.14), C1-1012: I.A+ (K.1.30) + (A.1.14), C1-1013: I.A + (K.1.31) + (A.1.14), C1-1014: I.A+ (K.1.32) + (A.1.14), C1-1015: I.A+ (K.1.41) + (A.1.14), C1-1016: I.A+ (K.1.42) + (A.1.14), C1-1017: I.A + (K.1.44) + (A.1.14), C1-1018: I.A+ (K.1.45) + (A.1.14), C1-1019: I.A+ (K.1.47) + (A.1.14), C1- 1020: I.A+ (K.1.49) + (A.1.14), C1-1021: I.A + (K.1.53) + (A.1.14), C1-1022: I.A+ (K.1.54) + (A.1.14), C1-1023: LA + (A.1.4) + (A.1.17), C1-1024: I.A+ (A.1.12) + (A.1.17), C1-1025: I.A + (A.1.21) + (A.1.17), C1-1026: I.A + (A.121a) + (A.1.17), C1-1027: LA + (A.1.24) + (A.1.17), C1- 1028: LA + (A.1.25) + (A.1.17), C1-1029: LA + (A.1.26) + (A.1.17), C1-1030: LA + (A.1.27) + (A.1.17), C1-1031: LA + (A.1.30) + (A.1.17), C1-1032: I.A+ (A.1.31) + (A.1.17), C1-1033: I.A + (A.1.32) + (A.1.17), C1-1034: I.A+ (A.1.34) + (A.1.17), C1-1035: LA + (A.1.35) + (A.1.17), C1- 1036: LA + (A.2.1) + (A.1.17), C1-1037: I.A+ (A.2.3) + (A.1.17), C1-1038: I.A+ (A.2.4) + (A.1.17), C1-1039: I.A+ (A.2.5) + (A.1.17), C1-1040: I.A+ (A.2.6) + (A.1.17), C1-1041: I.A + (A.3.2) + (A.1.17), C1-1042: I.A+ (A.3.3) + (A.1.17), C1-1043: I.A+ (A.3.4) + (A.1.17), C1-1044: LA + (A.3.7) + (A.1.17), C1-1045: I.A+ (A.3.9) + (A.1.17), C1-1046: LA + (A.3.11) + (A.1.17),
C1-1047: I.A+ (A.3.12) + (A.1.17), C1-1048: I.A + (A.3.15) + (A.1.17), C1-1049: I.A+ (A.3.16) + (A.1.17), C1-1050: I.A+ (A.3.17) + (A.1.17), C1-1051: I.A+ (A.3.18) + (A.1.17), C1-1052: I.A + (A.3.19) + (A.1.17), C1-1053: I.A+ (A.3.20) + (A.1.17), C1-1054: I.A+ (A.3.21) + (A.1.17), C1- 1055: I.A+ (A.3.22) + (A.1.17), C1-1056: I.A+ (A.3.23) + (A.1.17), C1-1057: I.A+ (A.3.24) + (A.1.17), C1-1058: I.A+ (A.3.25) + (A.1.17), C1-1059: I.A+ (A.3.26) + (A.1.17), C1-1060: I.A + (A.3.27) + (A.1.17), C1-1061: I.A+ (A.3.28) + (A.1.17), C1-1062: I.A+ (A.3.29) + (A.1.17), C1- 1063: I.A+ (A.3.31) + (A.1.17), C1-1064: I.A + (A.3.32) + (A.1.17), C1-1065: I.A+ (A.3.33) + (A.1.17), C1-1066: I.A+ (A.3.34) + (A.1.17), C1-1067: I.A+ (A.3.35) + (A.1.17), C1-1068: I.A + (A.3.36) + (A.1.17), C1-1069: I.A+ (A.3.37) + (A.1.17), C1-1070: I.A+ (A.3.38) + (A.1.17), C1- 1071: I.A+ (A.3.39) + (A.1.17), C1-1072: I.A+ (A.4.5) + (A.1.17), C1-1073: I.A+ (A.4.11) + (A.1.17), C1-1074: I.A+ (B.1.4) + (A.1.17), C1-1075: I.A+ (B.1.5) + (A.1.17), C1-1076: I.A + (B.1.8.) + (A.1.17), C1-1077: I.A+ (B.1.10) + (A.1.17), C1-1078: I.A+ (B.1.11) + (A.1.17), C1- 1079: I.A+ (B.1.12) + (A.1.17), C1-1080: I.A+ (B.1.13) + (A.1.17), C1-1081: I.A+ (B.1.17) + (A.1.17), C1-1082: I.A+ (B.1.18) + (A.1.17), C1-1083: I.A+ (B.1.21) + (A.1.17), C1-1084: I.A + (B.1.22) + (A.1.17), C1-1085: I.A+ (B.1.23) + (A.1.17), C1-1086: I.A+ (B.1.25) + (A.1.17), C1- 1087: I.A+ (B.1.26) + (A.1.17), C1-1088: I.A+ (B.1.29) + (A.1.17), C1-1089: I.A+ (B.1.33) + (A.1.17), C1-1090: I.A+ (B.1.34) + (A.1.17), C1-1091: I.A+ (B.1.37) + (A.1.17), C1-1092: I.A + (B.1.38) + (A.1.17), C1-1093: I.A+ (B.1.43) + (A.1.17), C1-1094: I.A+ (B.1.46) + (A.1.17), C1- 1095: I.A+ (B.2.4) + (A.1.17), C1-1096: I.A+ (B.2.5) + (A.1.17), C1-1097: I.A+ (B.2.6) + (A.1.17), C1-1098: I.A+ (B.2.8) + (A.1.17), C1-1099: I.A+ (C.1.1) + (A.1.17), C1-1100: I.A + (C.1.2) + (A.1.17), C1-1101: I.A+ (C.1.4) + (A.1.17), C1-1102: I.A+ (C.1.5) + (A.1.17), C1- 1103: I.A+ (C.2.6) + (A.1.17), C1-1104: I.A+ (C.2.7) + (A.1.17), C1-1105: I.A+ (C.2.8) + (A.1.17), C1-1106: I.A + (D.1.1) + (A.1.17), C1-1107: I.A+ (D.1.2) + (A.1.17), C1-1108: I.A + (D.1.5) + (A.1.17), C1-1109: I.A+ (D.2.4) + (A.1.17), C1-1110: I.A+ (D.2.6) + (A.1.17), C1- 1111: I.A+ (D.2.7) + (A.1.17), C1-1112: I.A + (E.1.1) + (A.1.17), C1-1113: I.A+ (E.1.3) + (A.1.17), C1-1114: I.A+ (E.2.2) + (A.1.17), C1-1115: I.A+ (E.2.3) + (A.1.17), C1-1116: I.A + (F.1.2) + (A.1.17), C1-1117: I.A+ (F.1.4) + (A.1.17), C1-1118: I.A+ (F.1.5) + (A.1.17), C1-1119: I.A+ (G.3.1) + (A.1.17), C1-1120: I.A+ (G.3.3) + (A.1.17), C1-1121: I.A+ (G.3.6) + (A.1.17), C1-1122: I.A+ (G.5.1) + (A.1.17), C1-1123: I.A+ (G.5.2) + (A.1.17), C1-1124: I.A+ (G.5.3) + (A.1.17), C1-1125: I.A+ (G.5.4) + (A.1.17), C1-1126: I.A+ (G.5.5) + (A.1.17), C1-1127: I.A + (G.5.6) + (A.1.17), C1-1128: I.A+ (G.5.7) + (A.1.17), C1-1129: I.A+ (G.5.8) + (A.1.17), C1- 1130: I.A+ (G.5.9) + (A.1.17), C1-1131: I.A+ (G.5.10) + (A.1.17), C1-1132: I.A+ (G.5.11) + (A.1.17), C1-1133: I.A+ (H.1.5) + (A.1.17), C1-1134: I.A+ (H.1.7) + (A.1.17), C1-1135: I.A + (H.2.2) + (A.1.17), C1-1136: I.A+ (H.2.3) + (A.1.17), C1-1137: I.A+ (H.2.5) + (A.1.17), C1- 1138: I.A+ (H.2.7) + (A.1.17), C1-1139: I.A+ (H.2.8) + (A.1.17), C1-1140: I.A+ (H.3.2) + (A.1.17), C1-1141: I.A+ (H.3.4) + (A.1.17), C1-1142: I.A+ (H.3.5) + (A.1.17), C1-1143: I.A + (H.4.9) + (A.1.17), C1-1144: I.A+ (H.4.10) + (A.1.17), C1-1145: I.A+ (I.2.2) + (A.1.17), C1- 1146: I.A+ (I.2.5) + (A.1.17), C1-1147: I.A+ (J.1.2) + (A.1.17), C1-1148: I.A+ (J.1.5) + (A.1.17), C1-1149: I.A+ (J.1.8) + (A.1.17), C1-1150: I.A+ (J.1.11) + (A.1.17), C1-1151: I.A + (J.1.12) + (A.1.17), C1-1152: I.A+ (K.1.3) + (A.1.17), C1-1153: I.A+ (K.1.29) + (A.1.17), C1-1154: I.A + (K.1.30) + (A.1.17), C1-1155: I.A + (K.1.31) + (A.1.17), C1-1156: I.A+ (K.1.32) + (A.1.17), C1- 1157: I.A+ (K.1.41) + (A.1.17), C1-1158: I.A + (K.1.42) + (A.1.17), C1-1159: I.A+ (K.1.44) +
(A.1.17), C1-1160: I.A+ (K.1.45) + (A.1.17), C1-1161: I.A+ (K.1.47) + (A.1.17), C1-1162: I.A + (K.1.49) + (A.1.17), C1-1163: I.A+ (K.1.53) + (A.1.17), C1-1164: I.A+ (K.1.54) + (A.1.17), C1- 1165: I.A + (A.1.4) + (A.1.25), C1-1166: I.A+ (A.1.12) + (A.1.25), C1-1167: I.A+ (A.1.21) + (A.1.25), C1-1168: I.A + (A.121a) + (A.1.25), C1-1169: I.A + (A.1.24) + (A.1.25), C1-1170: I.A + (A.1.26) + (A.1.25), C1-1171: LA + (A.1.27) + (A.1.25), C1-1172: LA + (A.1.30) + (A.1.25), C1- 1173: LA + (A.1.31) + (A.1.25), C1-1174: LA + (A.1.32) + (A.1.25), C1-1175: LA + (A.1.34) + (A.1.25), C1-1176: LA + (A.1.35) + (A.1.25), C1-1177: LA + (A.2.1) + (A.1.25), C1-1178: I.A + (A.2.3) + (A.1.25), C1-1179: I.A+ (A.2.4) + (A.1.25), C1-1180: I.A+ (A.2.5) + (A.1.25), C1-1181: LA + (A.2.6) + (A.1.25), C1-1182: I.A+ (A.3.2) + (A.1.25), C1-1183: I.A+ (A.3.3) + (A.1.25), C1- 1184: LA + (A.3.4) + (A.1.25), C1-1185: I.A+ (A.3.7) + (A.1.25), C1-1186: I.A+ (A.3.9) + (A.1.25), C1-1187: LA + (A.3.11) + (A.1.25), C1-1188: I.A+ (A.3.12) + (A.1.25), C1-1189: I.A + (A.3.15) + (A.1.25), C1-1190: I.A+ (A.3.16) + (A.1.25), C1-1191: I.A+ (A.3.17) + (A.1.25), C1- 1192: I.A + (A.3.18) + (A.1.25), C1-1193: I.A+ (A.3.19) + (A.1.25), C1-1194: I.A+ (A.3.20) + (A.1.25), C1-1195: I.A+ (A.3.21) + (A.1.25), C1-1196: I.A+ (A.3.22) + (A.1.25), C1-1197: I.A + (A.3.23) + (A.1.25), C1-1198: I.A+ (A.3.24) + (A.1.25), C1-1199: I.A+ (A.3.25) + (A.1.25), C1- 1200: I.A + (A.3.26) + (A.1.25), C1-1201: I.A+ (A.3.27) + (A.1.25), C1-1202: I.A+ (A.3.28) + (A.1.25), C1-1203: I.A+ (A.3.29) + (A.1.25), C1-1204: I.A+ (A.3.31) + (A.1.25), C1-1205: I.A + (A.3.32) + (A.1.25), C1-1206: I.A+ (A.3.33) + (A.1.25), C1-1207: I.A+ (A.3.34) + (A.1.25), C1- 1208: I.A + (A.3.35) + (A.1.25), C1-1209: I.A+ (A.3.36) + (A.1.25), C1-1210: I.A+ (A.3.37) + (A.1.25), C1-1211: I.A+ (A.3.38) + (A.1.25), C1-1212: I.A+ (A.3.39) + (A.1.25), C1-1213: I.A + (A.4.5) + (A.1.25), C1-1214: I.A+ (A.4.11) + (A.1.25), C1-1215: I.A+ (B.1.4) + (A.1.25), C1- 1216: I.A+ (B.1.5) + (A.1.25), C1-1217: I.A+ (B.1.8.) + (A.1.25), C1-1218: I.A+ (B.1.10) + (A.1.25), C1-1219: I.A+ (B.1.11) + (A.1.25), C1-1220: I.A+ (B.1.12) + (A.1.25), C1-1221: I.A + (B.1.13) + (A.1.25), C1-1222: I.A+ (B.1.17) + (A.1.25), C1-1223: I.A+ (B.1.18) + (A.1.25), C1- 1224: LA + (B.1.21) + (A.1.25), C1-1225: I.A+ (B.1.22) + (A.1.25), C1-1226: LA + (B.1.23) + (A.1.25), C1-1227: I.A+ (B.1.25) + (A.1.25), C1-1228: I.A+ (B.1.26) + (A.1.25), C1-1229: I.A + (B.1.29) + (A.1.25), C1-1230: I.A+ (B.1.33) + (A.1.25), C1-1231: I.A+ (B.1.34) + (A.1.25), C1- 1232: LA + (B.1.37) + (A.1.25), C1-1233: I.A+ (B.1.38) + (A.1.25), C1-1234: I.A+ (B.1.43) + (A.1.25), C1-1235: I.A + (B.1.46) + (A.1.25), C1-1236: I.A+ (B.2.4) + (A.1.25), C1-1237: I.A + (B.2.5) + (A.1.25), C1-1238: I.A+ (B.2.6) + (A.1.25), C1-1239: I.A+ (B.2.8) + (A.1.25), C1-1240: I.A+ (C.1.1) + (A.1.25), C1-1241 : I.A+ (C.1.2) + (A.1.25), C1-1242: I.A+ (C.1.4) + (A.1.25), C1- 1243: LA + (C.1.5) + (A.1.25), C1-1244: I.A+ (C.2.6) + (A.1.25), C1-1245: I.A+ (C.2.7) + (A.1.25), C1-1246: I.A+ (C.2.8) + (A.1.25), C1-1247: I.A+ (D.1.1) + (A.1.25), C1-1248: I.A + (D.1.2) + (A.1.25), C1-1249: I.A+ (D.1.5) + (A.1.25), C1-1250: I.A+ (D.2.4) + (A.1.25), C1- 1251: I.A + (D.2.6) + (A.1.25), C1-1252: I.A+ (D.2.7) + (A.1.25), C1-1253: I.A+ (E.1.1) + (A.1.25), C1-1254: I.A+ (E.1.3) + (A.1.25), C1-1255: I.A+ (E.2.2) + (A.1.25), C1-1256: I.A + (E.2.3) + (A.1.25), C1-1257: I.A+ (F.1.2) + (A.1.25), C1-1258: I.A+ (F.1.4) + (A.1.25), C1-1259: I.A+ (F.1.5) + (A.1.25), C1-1260: I.A+ (G.3.1) + (A.1.25), C1-1261: I.A+ (G.3.3) + (A.1.25), C1- 1262: I.A + (G.3.6) + (A.1.25), C1-1263: I.A+ (G.5.1) + (A.1.25), C1-1264: I.A+ (G.5.2) + (A.1.25), C1-1265: I.A+ (G.5.3) + (A.1.25), C1-1266: I.A+ (G.5.4) + (A.1.25), C1-1267: I.A + (G.5.5) + (A.1.25), C1-1268: I.A+ (G.5.6) + (A.1.25), C1-1269: I.A+ (G.5.7) + (A.1.25), C1- 1270: I.A + (G.5.8) + (A.1.25), C1-1271: I.A+ (G.5.9) + (A.1.25), C1-1272: I.A+ (G.5.10) +
(A.1.25), C1-1273: I.A+ (G.5.11) + (A.1.25), C1-1274: I.A+ (H.1.5) + (A.1.25), C1-1275: I.A + (H.1.7) + (A.1.25), C1-1276: I.A+ (H.2.2) + (A.1.25), C1-1277: I.A+ (H.2.3) + (A.1.25), C1- 1278: I.A+ (H.2.5) + (A.1.25), C1-1279: I.A+ (H.2.7) + (A.1.25), C1-1280: I.A+ (H.2.8) + (A.1.25), C1-1281 : I.A+ (H.3.2) + (A.1.25), C1-1282: I.A+ (H.3.4) + (A.1.25), C1-1283: I.A + (H.3.5) + (A.1.25), C1-1284: I.A+ (H.4.9) + (A.1.25), C1-1285: I.A+ (H.4.10) + (A.1.25), C1- 1286: I.A+ (I.2.2) + (A.1.25), C1-1287: I.A+ (I.2.5) + (A.1.25), C1-1288: I.A+ (J.1.2) + (A.1.25), C1-1289: I.A+ (J.1.5) + (A.1.25), C1-1290: I.A+ (J.1.8) + (A.1.25), C1-1291: I.A+ (J.1.11) + (A.1.25), C1-1292: I.A+ (J.1.12) + (A.1.25), C1-1293: I.A+ (K.1.3) + (A.1.25), C1-1294: I.A + (K.1.29) + (A.1.25), C1-1295: I.A + (K.1.30) + (A.1.25), C1-1296: I.A+ (K.1.31) + (A.1.25), C1- 1297: I.A+ (K.1.32) + (A.1.25), C1-1298: I.A+ (K.1.41) + (A.1.25), C1-1299: I.A+ (K.1.42) + (A.1.25), C1-1300: I.A+ (K.1.44) + (A.1.25), C1-1301: I.A+ (K.1.45) + (A.1.25), C1-1302: I. A + (K.1.47) + (A.1.25), C1-1303: I.A+ (K.1.49) + (A.1.25), C1-1304: I.A+ (K.1.53) + (A.1.25), C1- 1305: I.A+ (K.1.54) + (A.1.25), C1-1306: I.A+ (A.1.4) + (A.1.34), C1-1307: I.A+ (A.1.12) + (A.1.34), C1-1308: I.A+ (A.1.21) + (A.1.34), C1-1309: I. A + (A.121a) + (A.1.34), C1-1310: I.A + (A.1.24) + (A.1.34), C1-1311: I.A+ (A.1.26) + (A.1.34), C1-1312: I.A+ (A.1.27) + (A.1.34), C1- 1313: I .A + (A.1.30) + (A.1.34), C1-1314: I.A+ (A.1.31) + (A.1.34), C1-1315: I.A+ (A.1.32) + (A.1.34), C1-1316: I.A+ (A.1.35) + (A.1.34), C1-1317: I.A+ (A.2.1) + (A.1.34), C1-1318: I.A + (A.2.3) + (A.1.34), C1-1319: I.A+ (A.2.4) + (A.1.34), C1-1320: I.A+ (A.2.5) + (A.1.34), C1-1321: I.A+ (A.2.6) + (A.1.34), C1-1322: I.A+ (A.3.2) + (A.1.34), C1-1323: I.A+ (A.3.3) + (A.1.34), C1- 1324: I.A+ (A.3.4) + (A.1.34), C1-1325: I.A+ (A.3.7) + (A.1.34), C1-1326: I.A+ (A.3.9) + (A.1.34), C1-1327: I.A+ (A.3.11) + (A.1.34), C1-1328: I.A+ (A.3.12) + (A.1.34), C1-1329: I.A + (A.3.15) + (A.1.34), C1-1330: I.A+ (A.3.16) + (A.1.34), C1-1331: I.A+ (A.3.17) + (A.1.34), C1- 1332: I.A+ (A.3.18) + (A.1.34), C1-1333: I.A+ (A.3.19) + (A.1.34), C1-1334: I.A+ (A.3.20) + (A.1.34), C1-1335: I.A+ (A.3.21) + (A.1.34), C1-1336: I.A+ (A.3.22) + (A.1.34), C1-1337: I.A + (A.3.23) + (A.1.34), C1-1338: I.A + (A.3.24) + (A.1.34), C1-1339: I.A+ (A.3.25) + (A.1.34), C1- 1340: I.A+ (A.3.26) + (A.1.34), C1-1341: I.A+ (A.3.27) + (A.1.34), C1-1342: I.A+ (A.3.28) + (A.1.34), C1-1343: I.A+ (A.3.29) + (A.1.34), C1-1344: I.A+ (A.3.31) + (A.1.34), C1-1345: I.A + (A.3.32) + (A.1.34), C1-1346: I.A+ (A.3.33) + (A.1.34), C1-1347: I.A+ (A.3.34) + (A.1.34), C1- 1348: I.A+ (A.3.35) + (A.1.34), C1-1349: I.A+ (A.3.36) + (A.1.34), C1-1350: I.A+ (A.3.37) + (A.1.34), C1-1351: I.A+ (A.3.38) + (A.1.34), C1-1352: I.A+ (A.3.39) + (A.1.34), C1-1353: I.A + (A.4.5) + (A.1.34), C1-1354: I.A+ (A.4.11) + (A.1.34), C1-1355: I.A+ (B.1.4) + (A.1.34), C1- 1356: I.A+ (B.1.5) + (A.1.34), C1-1357: I.A+ (B.1.8.) + (A.1.34), C1-1358: I.A+ (B.1.10) + (A.1.34), C1-1359: I.A+ (B.1.11) + (A.1.34), C1-1360: I.A+ (B.1.12) + (A.1.34), C1-1361: I.A + (B.1.13) + (A.1.34), C1-1362: I.A+ (B.1.17) + (A.1.34), C1-1363: I.A+ (B.1.18) + (A.1.34), C1- 1364: I.A+ (B.1.21) + (A.1.34), C1-1365: I.A+ (B.1.22) + (A.1.34), C1-1366: I.A+ (B.1.23) + (A.1.34), C1-1367: I.A+ (B.1.25) + (A.1.34), C1-1368: I.A+ (B.1.26) + (A.1.34), C1-1369: I.A + (B.1.29) + (A.1.34), C1-1370: I.A+ (B.1.33) + (A.1.34), C1-1371: I.A+ (B.1.34) + (A.1.34), C1- 1372: I.A+ (B.1.37) + (A.1.34), C1-1373: I.A+ (B.1.38) + (A.1.34), C1-1374: I.A+ (B.1.43) + (A.1.34), C1-1375: I.A+ (B.1.46) + (A.1.34), C1-1376: I.A+ (B.2.4) + (A.1.34), C1-1377: I.A + (B.2.5) + (A.1.34), C1-1378: I.A+ (B.2.6) + (A.1.34), C1-1379: I.A+ (B.2.8) + (A.1.34), C1-1380: I.A+ (C.1.1) + (A.1.34), C1-1381: I.A+ (C.1.2) + (A.1.34), C1-1382: I.A+ (C.1.4) + (A.1.34), C1- 1383: I.A+ (C.1.5) + (A.1.34), C1-1384: I.A+ (C.2.6) + (A.1.34), C1-1385: I.A+ (C.2.7) +
(A.1.34), C1-1386: I.A+ (C.2.8) + (A.1.34), C1-1387: I.A+ (D.1.1) + (A.1.34), C1-1388: I.A + (D.1.2) + (A.1.34), C1-1389: I.A+ (D.1.5) + (A.1.34), C1-1390: I.A+ (D.2.4) + (A.1.34), C1- 1391: I.A+ (D.2.6) + (A.1.34), C1-1392: I.A+ (D.2.7) + (A.1.34), C1-1393: I.A+ (E.1.1) + (A.1.34), C1-1394: I.A+ (E.1.3) + (A.1.34), C1-1395: I.A+ (E.2.2) + (A.1.34), C1-1396: I.A + (E.2.3) + (A.1.34), C1-1397: I.A+ (F.1.2) + (A.1.34), C1-1398: I.A+ (F.1.4) + (A.1.34), C1-1399: I.A+ (F.1.5) + (A.1.34), C1-1400: I.A+ (G.3.1) + (A.1.34), C1-1401: I.A+ (G.3.3) + (A.1.34), C1- 1402: I.A+ (G.3.6) + (A.1.34), C1-1403: I.A+ (G.5.1) + (A.1.34), C1-1404: I.A+ (G.5.2) + (A.1.34), C1-1405: I.A+ (G.5.3) + (A.1.34), C1-1406: I.A+ (G.5.4) + (A.1.34), C1-1407: I.A + (G.5.5) + (A.1.34), C1-1408: I.A+ (G.5.6) + (A.1.34), C1-1409: I.A+ (G.5.7) + (A.1.34), C1- 1410: I.A+ (G.5.8) + (A.1.34), C1-1411: I.A+ (G.5.9) + (A.1.34), C1-1412: I.A+ (G.5.10) + (A.1.34), C1-1413: I.A+ (G.5.11) + (A.1.34), C1-1414: I.A+ (H.1.5) + (A.1.34), C1-1415: I.A + (H.1.7) + (A.1.34), C1-1416: I.A+ (H.2.2) + (A.1.34), C1-1417: I.A+ (H.2.3) + (A.1.34), C1- 1418: I.A+ (H.2.5) + (A.1.34), C1-1419: I.A+ (H.2.7) + (A.1.34), C1-1420: I.A+ (H.2.8) + (A.1.34), C1-1421 : I.A+ (H.3.2) + (A.1.34), C1-1422: I.A+ (H.3.4) + (A.1.34), C1-1423: I.A + (H.3.5) + (A.1.34), C1-1424: I.A+ (H.4.9) + (A.1.34), C1-1425: I.A+ (H.4.10) + (A.1.34), C1- 1426: I.A+ (I.2.2) + (A.1.34), C1-1427: I.A+ (I.2.5) + (A.1.34), C1-1428: I.A+ (J.1.2) + (A.1.34), C1-1429: I.A+ (J.1.5) + (A.1.34), C1-1430: I.A+ (J.1.8) + (A.1.34), C1-1431: I.A+ (J.1.11) + (A.1.34), C1-1432: I.A+ (J.1.12) + (A.1.34), C1-1433: I.A+ (K.1.3) + (A.1.34), C1-1434: I.A + (K.1.29) + (A.1.34), C1-1435: I.A+ (K.1.30) + (A.1.34), C1-1436: I.A+ (K.1.31) + (A.1.34), C1- 1437: I.A+ (K.1.32) + (A.1.34), C1-1438: I.A+ (K.1.41) + (A.1.34), C1-1439: I.A+ (K.1.42) + (A.1.34), C1-1440: I.A+ (K.1.44) + (A.1.34), C1-1441: I.A+ (K.1.45) + (A.1.34), C1-1442: I.A + (K.1.47) + (A.1.34), C1-1443: I.A+ (K.1.49) + (A.1.34), C1-1444: I.A+ (K.1.53) + (A.1.34), C1- 1445: I.A+ (K.1.54) + (A.1.34), C1-1446: I.A + (A.1.4) + (A.2.4), C1-1447: I.A+ (A.1.12) + (A.2.4), C1-1448: I.A+ (A.1.21) + (A.2.4), C1-1449: I.A + (A.121a) + (A.2.4), C1-1450: I.A +
(A.1.24) + (A.2.4), C1-1451 : I.A + (A.1.26) + (A.2.4), C1-1452: LA + (A.1.27) + (A.2.4), C1-1453: LA + (A.1.30) + (A.2.4), C1-1454: LA + (A.1.31) + (A.2.4), C1-1455: LA + (A.1.32) + (A.2.4), C1- 1456: I.A + (A.1.35) + (A.2.4), C1-1457: I.A+ (A.2.1) + (A.2.4), C1-1458: I.A+ (A.2.3) + (A.2.4), C1-1459: I.A+ (A.2.5) + (A.2.4), C1-1460: I.A+ (A.2.6) + (A.2.4), C1-1461: I.A+ (A.3.2) + (A.2.4), C1-1462: I.A + (A.3.3) + (A.2.4), C1-1463: I.A + (A.3.4) + (A.2.4), C1-1464: I.A + (A.3.7) + (A.2.4), C1-1465: I.A+ (A.3.9) + (A.2.4), C1-1466: I.A+ (A.3.11) + (A.2.4), C1-1467: I.A + (A.3.12) + (A.2.4), C1-1468: I.A + (A.3.15) + (A.2.4), C1-1469: I.A + (A.3.16) + (A.2.4), C1-1470: LA + (A.3.17) + (A.2.4), C1-1471: I.A+ (A.3.18) + (A.2.4), C1-1472: I.A+ (A.3.19) + (A.2.4), C1- 1473: I.A + (A.3.20) + (A.2.4), C1-1474: I.A + (A.3.21) + (A.2.4), C1-1475: I.A + (A.3.22) + (A.2.4), C1-1476: I.A + (A.3.23) + (A.2.4), C1-1477: I.A + (A.3.24) + (A.2.4), C1-1478: I.A + (A.3.25) + (A.2.4), C1-1479: I.A+ (A.3.26) + (A.2.4), C1-1480: I.A+ (A.3.27) + (A.2.4), C1-1481: I.A + (A.3.28) + (A.2.4), C1-1482: I.A + (A.3.29) + (A.2.4), C1-1483: I.A + (A.3.31) + (A.2.4), C1- 1484: I.A + (A.3.32) + (A.2.4), C1-1485: I.A + (A.3.33) + (A.2.4), C1-1486: I.A + (A.3.34) + (A.2.4), C1-1487: I.A + (A.3.35) + (A.2.4), C1-1488: I.A + (A.3.36) + (A.2.4), C1-1489: I.A + (A.3.37) + (A.2.4), C1-1490: I.A + (A.3.38) + (A.2.4), C1-1491: I.A+ (A.3.39) + (A.2.4), C1-1492: LA + (A.4.5) + (A.2.4), C1-1493: I.A+ (A.4.11) + (A.2.4), C1-1494: I.A+ (B.1.4) + (A.2.4), C1- 1495: I.A+ (B.1.5) + (A.2.4), C1-1496: I.A+ (B.1.8.) + (A.2.4), C1-1497: I.A+ (B.1.10) + (A.2.4), C1-1498: LA + (B.1.11) + (A.2.4), C1-1499: I.A+ (B.1.12) + (A.2.4), C1-1500: I.A+ (B.1.13) +
(A.2.4), C1-1501: I.A+ (B.1.17) + (A.2.4), C1-1502: I.A+ (B.1.18) + (A.2.4), C1-1503: I.A +
(B.1.21) + (A.2.4), C1-1504: I.A+ (B.1.22) + (A.2.4), C1-1505: I.A+ (B.1.23) + (A.2.4), C1-1506: I.A+ (B.1.25) + (A.2.4), C1-1507: I.A+ (B.1.26) + (A.2.4), C1-1508: I.A+ (B.1.29) + (A.2.4), C1- 1509: I.A+ (B.1.33) + (A.2.4), C1-1510: I.A+ (B.1.34) + (A.2.4), C1-1511: I.A+ (B.1.37) + (A.2.4), C1-1512: I.A + (B.1.38) + (A.2.4), C1-1513: I.A+ (B.1.43) + (A.2.4), C1-1514: I.A + (B.1.46) + (A.2.4), C1-1515: I.A+ (B.2.4) + (A.2.4), C1-1516: I.A+ (B.2.5) + (A.2.4), C1-1517: I.A+ (B.2.6) + (A.2.4), C1-1518: I.A+ (B.2.8) + (A.2.4), C1-1519: I.A+ (C.1.1) + (A.2.4), C1- 1520: I.A+ (C.1.2) + (A.2.4), C1-1521: I.A+ (C.1.4) + (A.2.4), C1-1522: I.A+ (C.1.5) + (A.2.4), C1-1523: I.A + (C.2.6) + (A.2.4), C1-1524: I.A + (C.2.7) + (A.2.4), C1-1525: I.A + (C.2.8) + (A.2.4), C1-1526: LA + (D.1.1) + (A.2.4), C1-1527: LA + (D.1.2) + (A.2.4), C1-1528: LA + (D.1.5) + (A.2.4), C1-1529: I.A+ (D.2.4) + (A.2.4), C1-1530: I.A+ (D.2.6) + (A.2.4), C1-1531: I.A + (D.2.7) + (A.2.4), C1-1532: LA + (E.1.1) + (A.2.4), C1-1533: I.A + (E.1.3) + (A.2.4), C1-1534: I.A + (E.2.2) + (A.2.4), C1-1535: I.A+ (E.2.3) + (A.2.4), C1-1536: I.A+ (F.1.2) + (A.2.4), C1-1537: I.A+ (F.1.4) + (A.2.4), C1-1538: I.A+ (F.1.5) + (A.2.4), C1-1539: I.A+ (G.3.1) + (A.2.4), C1- 1540: LA + (G.3.3) + (A.2.4), C1-1541: I.A+ (G.3.6) + (A.2.4), C1-1542: LA + (G.5.1) + (A.2.4), C1-1543: I.A + (G.5.2) + (A.2.4), C1-1544: I.A + (G.5.3) + (A.2.4), C1-1545: I.A + (G.5.4) + (A.2.4), C1-1546: I.A + (G.5.5) + (A.2.4), C1-1547: I.A + (G.5.6) + (A.2.4), C1-1548: I.A +
(G.5.7) + (A.2.4), C1-1549: I.A+ (G.5.8) + (A.2.4), C1-1550: I.A+ (G.5.9) + (A.2.4), C1-1551:
LA + (G.5.10) + (A.2.4), C1-1552: I.A+ (G.5.11) + (A.2.4), C1-1553: I.A + (H.1.5) + (A.2.4), C1- 1554: I.A + (H.1.7) + (A.2.4), C1-1555: I.A+ (H.2.2) + (A.2.4), C1-1556: I.A+ (H.2.3) + (A.2.4), C1-1557: I.A + (H.2.5) + (A.2.4), C1-1558: I.A + (H.2.7) + (A.2.4), C1-1559: I.A + (H.2.8) + (A.2.4), C1-1560: I.A+ (H.3.2) + (A.2.4), C1-1561: I.A+ (H.3.4) + (A.2.4), C1-1562: I.A+ (H.3.5) + (A.2.4), C1-1563: I.A + (H.4.9) + (A.2.4), C1-1564: I.A + (H.4.10) + (A.2.4), C1-1565: I.A + (I.2.2) + (A.2.4), C1-1566: I.A+ (I.2.5) + (A.2.4), C1-1567: I.A + (J.1.2) + (A.2.4), C1-1568: I.A + (J.1.5) + (A.2.4), C1-1569: I.A + (J.1.8) + (A.2.4), C1-1570: I.A + (J.1.11) + (A.2.4), C1-1571: I.A + (J.1.12) + (A.2.4), C1-1572: I.A + (K.1.3) + (A.2.4), C1-1573: I.A+ (K.1.29) + (A.2.4), C1- 1574: LA + (K.1.30) + (A.2.4), C1-1575: I.A+ (K.1.31) + (A.2.4), C1-1576: I.A+ (K.1.32) + (A.2.4), C1-1577: I.A+ (K.1.41) + (A.2.4), C1-1578: I.A+ (K.1.42) + (A.2.4), C1-1579: I.A + (K.1.44) + (A.2.4), C1-1580: I.A+ (K.1.45) + (A.2.4), C1-1581: I.A+ (K.1.47) + (A.2.4), C1-1582: LA + (K.1.49) + (A.2.4), C1-1583: I.A+ (K.1.53) + (A.2.4), C1-1584: I.A+ (K.1.54) + (A.2.4), C1- 1585: I.A+ (A.1.12) + (A.2.6), C1-1586: I.A+ (A.1.27) + (A.2.6), C1-1587: I.A+ (A.1.35) + (A.2.6), C1-1588: I.A + (A.2.1) + (A.2.6), C1-1589: I.A + (A.2.3) + (A.2.6), C1-1590: I.A + (A.3.2) + (A.2.6), C1-1591: I.A+ (A.3.3) + (A.2.6), C1-1592: I.A+ (A.3.4) + (A.2.6), C1-1593: I.A + (A.3.7) + (A.2.6), C1-1594: I.A + (A.3.9) + (A.2.6), C1-1595: I.A + (A.3.12) + (A.2.6), C1-1596: I.A + (A.3.15) + (A.2.6), C1-1597: I.A + (A.3.16) + (A.2.6), C1-1598: I.A + (A.3.18) + (A.2.6), C1- 1599: I.A + (A.3.20) + (A.2.6), C1-1600: I.A+ (A.3.21) + (A.2.6), C1-1601: I.A+ (A.3.22) + (A.2.6), C1-1602: I.A + (A.3.23) + (A.2.6), C1-1603: I.A + (A.3.24) + (A.2.6), C1-1604: I.A + (A.3.25) + (A.2.6), C1-1605: I.A + (A.3.26) + (A.2.6), C1-1606: I.A + (A.3.27) + (A.2.6), C1-1607: I.A + (A.3.28) + (A.2.6), C1-1608: I.A + (A.3.29) + (A.2.6), C1-1609: I.A + (A.3.31) + (A.2.6), C1- 1610: I.A + (A.3.32) + (A.2.6), C1-1611: I.A+ (A.3.33) + (A.2.6), C1-1612: I.A+ (A.3.34) + (A.2.6), C1-1613: I.A + (A.3.35) + (A.2.6), C1-1614: I.A + (A.3.36) + (A.2.6), C1-1615: I.A + (A.3.37) + (A.2.6), C1-1616: I.A + (A.3.38) + (A.2.6), C1-1617: I.A + (A.3.39) + (A.2.6), C1-1618:
I.A+ (A.4.5) + (A.2.6), C1-1619: I.A+ (A.4.11) + (A.2.6), C1-1620: I.A+ (B.1.4) + (A.2.6), C1- 1621: I.A+ (B.1.5) + (A.2.6), C1-1622: I.A+ (B.1.8.) + (A.2.6), C1-1623: I.A+ (B.1.10) + (A.2.6), C1-1624: I.A+ (B.1.11) + (A.2.6), C1-1625: I.A+ (B.1.12) + (A.2.6), C1-1626: I.A+ (B.1.13) + (A.2.6), C1-1627: I.A+ (B.1.17) + (A.2.6), C1-1628: I.A+ (B.1.18) + (A.2.6), C1-1629: I.A +
(B.1.21) + (A.2.6), C1-1630: I.A+ (B.1.22) + (A.2.6), C1-1631: I.A+ (B.1.23) + (A.2.6), C1-1632: I.A+ (B.1.25) + (A.2.6), C1-1633: I.A+ (B.1.26) + (A.2.6), C1-1634: I.A+ (B.1.29) + (A.2.6), C1- 1635: I.A+ (B.1.33) + (A.2.6), C1-1636: I.A+ (B.1.34) + (A.2.6), C1-1637: I.A+ (B.1.37) + (A.2.6), C1-1638: I.A + (B.1.38) + (A.2.6), C1-1639: I.A+ (B.1.43) + (A.2.6), C1-1640: I.A + (B.1.46) + (A.2.6), C1-1641: I.A+ (B.2.4) + (A.2.6), C1-1642: I.A+ (B.2.5) + (A.2.6), C1-1643: I.A+ (B.2.6) + (A.2.6), C1-1644: I.A+ (B.2.8) + (A.2.6), C1-1645: I.A+ (C.1.1) + (A.2.6), C1- 1646: I.A+ (C.1.2) + (A.2.6), C1-1647: I.A+ (C.1.4) + (A.2.6), C1-1648: I.A+ (C.1.5) + (A.2.6), C1-1649: I.A+ (C.2.6) + (A.2.6), C1-1650: I.A+ (C.2.7) + (A.2.6), C1-1651: I.A+ (C.2.8) + (A.2.6), C1-1652: I.A+ (D.1.1) + (A.2.6), C1-1653: I.A+ (D.1.2) + (A.2.6), C1-1654: I.A+ (D.1.5) + (A.2.6), C1-1655: I. A + (D.2.4) + (A.2.6), C1-1656: I. A + (D.2.6) + (A.2.6), C1-1657: I.A + (D.2.7) + (A.2.6), C1-1658: I.A+ (E.1.1) + (A.2.6), C1-1659: I.A + (E.1.3) + (A.2.6), C1-1660: I.A + (E.2.2) + (A.2.6), C1-1661: I.A+ (E.2.3) + (A.2.6), C1-1662: I.A+ (F.1.2) + (A.2.6), C1-1663: I.A+ (F.1.4) + (A.2.6), C1-1664: I.A+ (F.1.5) + (A.2.6), C1-1665: I.A+ (G.3.1) + (A.2.6), C1- 1666: I.A + (G.3.3) + (A.2.6), C1-1667: I.A + (G.3.6) + (A.2.6), C1-1668: I.A + (G.5.1) + (A.2.6), C1-1669: I.A+ (G.5.2) + (A.2.6), C1-1670: I.A+ (G.5.3) + (A.2.6), C1-1671: I.A+ (G.5.4) + (A.2.6), C1-1672: I.A + (G.5.5) + (A.2.6), C1-1673: I.A + (G.5.6) + (A.2.6), C1-1674: I.A +
(G.5.7) + (A.2.6), C1-1675: I.A + (G.5.8) + (A.2.6), C1-1676: I.A + (G.5.9) + (A.2.6), C1-1677:
I.A + (G.5.10) + (A.2.6), C1-1678: I.A+ (G.5.11) + (A.2.6), C1-1679: I.A + (H.1.5) + (A.2.6), C1- 1680: I.A + (H.1.7) + (A.2.6), C1-1681: I.A+ (H.2.2) + (A.2.6), C1-1682: I.A+ (H.2.3) + (A.2.6), C1-1683: I.A + (H.2.5) + (A.2.6), C1-1684: I.A + (H.2.7) + (A.2.6), C1-1685: I.A + (H.2.8) + (A.2.6), C1-1686: I.A + (H.3.2) + (A.2.6), C1-1687: I.A + (H.3.4) + (A.2.6), C1-1688: I.A + (H.3.5) + (A.2.6), C1-1689: I.A+ (H.4.9) + (A.2.6), C1-1690: I.A+ (H.4.10) + (A.2.6), C1-1691: I.A + (I.2.2) + (A.2.6), C1-1692: I.A+ (I.2.5) + (A.2.6), C1-1693: I.A + (J.1.2) + (A.2.6), C1-1694: I.A + (J.1.5) + (A.2.6), C1-1695: I.A + (J.1.8) + (A.2.6), C1-1696: I.A + (J.1.11) + (A.2.6), C1-1697: I.A + (J.1.12) + (A.2.6), C1-1698: I.A+ (K.1.3) + (A.2.6), C1-1699: I.A+ (K.1.29) + (A.2.6), C1- 1700: I.A+ (K.1.30) + (A.2.6), C1-1701: I.A+ (K.1.31) + (A.2.6), C1-1702: I.A+ (K.1.32) + (A.2.6), C1-1703: I.A+ (K.1.41) + (A.2.6), C1-1704: I.A+ (K.1.42) + (A.2.6), C1-1705: I.A + (K.1.44) + (A.2.6), C1-1706: I.A+ (K.1.45) + (A.2.6), C1-1707: I.A+ (K.1.47) + (A.2.6), C1-1708: I.A+ (K.1.49) + (A.2.6), C1-1709: I.A+ (K.1.53) + (A.2.6), C1-1710: I.A+ (K.1.54) + (A.2.6), C1- 1711: I.A + (A.1.4) + (A.3.2), C1-1712: I.A+ (A.1.12) + (A.3.2), C1-1713: I.A+ (A.1.21) +
(A.3.2), C1-1714: I.A + (A.121a) + (A.3.2), C1-1715: LA + (A.1.24) + (A.3.2), C1-1716: I.A +
(A.1.26) + (A.3.2), C1-1717: LA + (A.1.27) + (A.3.2), C1-1718: LA + (A.1.30) + (A.3.2), C1-1719: LA + (A.1.31) + (A.3.2), C1-1720: I.A+ (A.1.32) + (A.3.2), C1-1721: I.A+ (A.1.35) + (A.3.2), C1- 1722: I.A + (A.2.1) + (A.3.2), C1-1723: I.A + (A.2.3) + (A.3.2), C1-1724: I.A + (A.2.5) + (A.3.2), C1-1725: I.A + (A.3.3) + (A.3.2), C1-1726: I.A + (A.3.4) + (A.3.2), C1-1727: I.A + (A.3.7) + (A.3.2), C1-1728: I.A+ (A.3.9) + (A.3.2), C1-1729: I.A+ (A.3.11) + (A.3.2), C1-1730: I.A + (A.3.12) + (A.3.2), C1-1731: I.A+ (A.3.15) + (A.3.2), C1-1732: I.A+ (A.3.16) + (A.3.2), C1-1733: I.A + (A.3.17) + (A.3.2), C1-1734: I.A + (A.3.18) + (A.3.2), C1-1735: I.A + (A.3.19) + (A.3.2), C1-
1736: I.A + (A.3.20) + (A.3.2), C1-1737: I.A + (A.3.21) + (A.3.2), C1-1738: I.A + (A.3.22) + (A.3.2), C1-1739: LA + (A.3.23) + (A.3.2), C1-1740: I.A+ (A.3.24) + (A.3.2), C1-1741: I.A + (A.3.25) + (A.3.2), C1-1742: I.A + (A.3.26) + (A.3.2), C1-1743: I.A + (A.3.27) + (A.3.2), C1-1744: I.A + (A.3.28) + (A.3.2), C1-1745: I.A + (A.3.29) + (A.3.2), C1-1746: I.A + (A.3.31) + (A.3.2), C1- 1747: I.A + (A.3.32) + (A.3.2), C1-1748: I.A + (A.3.33) + (A.3.2), C1-1749: I.A + (A.3.34) + (A.3.2), C1-1750: I.A+ (A.3.35) + (A.3.2), C1-1751: I.A+ (A.3.36) + (A.3.2), C1-1752: I.A + (A.3.37) + (A.3.2), C1-1753: I.A + (A.3.38) + (A.3.2), C1-1754: I.A + (A.3.39) + (A.3.2), C1-1755: I.A + (A.4.5) + (A.3.2), C1-1756: I.A+ (A.4.11) + (A.3.2), C1-1757: I.A+ (B.1.4) + (A.3.2), C1- 1758: I.A+ (B.1.5) + (A.3.2), C1-1759: I.A+ (B.1.8.) + (A.3.2), C1-1760: I.A+ (B.1.10) + (A.3.2), C1-1761: I.A+ (B.1.11) + (A.3.2), C1-1762: I.A+ (B.1.12) + (A.3.2), C1-1763: I.A+ (B.1.13) + (A.3.2), C1-1764: LA + (B.1.17) + (A.3.2), C1-1765: I.A+ (B.1.18) + (A.3.2), C1-1766: I.A +
(B.1.21) + (A.3.2), C1-1767: I.A+ (B.1.22) + (A.3.2), C1-1768: I.A+ (B.1.23) + (A.3.2), C1-1769: I.A+ (B.1.25) + (A.3.2), C1-1770: I.A+ (B.1.26) + (A.3.2), C1-1771: I.A+ (B.1.29) + (A.3.2), C1- 1772: LA + (B.1.33) + (A.3.2), C1-1773: I.A+ (B.1.34) + (A.3.2), C1-1774: I.A+ (B.1.37) + (A.3.2), C1-1775: I.A+ (B.1.38) + (A.3.2), C1-1776: I.A+ (B.1.43) + (A.3.2), C1-1777: I.A +
(B.1.46) + (A.3.2), C1-1778: I.A+ (B.2.4) + (A.3.2), C1-1779: I.A+ (B.2.5) + (A.3.2), C1-1780: LA + (B.2.6) + (A.3.2), C1-1781: I.A+ (B.2.8) + (A.3.2), C1-1782: I.A+ (C.1.1) + (A.3.2), C1- 1783: LA + (C.1.2) + (A.3.2), C1-1784: I.A+ (C.1.4) + (A.3.2), C1-1785: I.A+ (C.1.5) + (A.3.2), C1-1786: I.A + (C.2.6) + (A.3.2), C1-1787: I.A + (C.2.7) + (A.3.2), C1-1788: I.A + (C.2.8) + (A.3.2), C1-1789: I.A+ (D.1.1) + (A.3.2), C1-1790: I.A+ (D.1.2) + (A.3.2), C1-1791: I.A+ (D.1.5) + (A.3.2), C1-1792: I.A + (D.2.4) + (A.3.2), C1-1793: I.A + (D.2.6) + (A.3.2), C1-1794: I.A + (D.2.7) + (A.3.2), C1-1795: I.A+ (E.1.1) + (A.3.2), C1-1796: I.A + (E.1.3) + (A.3.2), C1-1797: I.A + (E.2.2) + (A.3.2), C1-1798: I.A+ (E.2.3) + (A.3.2), C1-1799: I.A+ (F.1.2) + (A.3.2), C1-1800: I.A+ (F.1.4) + (A.3.2), C1-1801: I.A+ (F.1.5) + (A.3.2), C1-1802: I.A+ (G.3.1) + (A.3.2), C1- 1803: I.A + (G.3.3) + (A.3.2), C1-1804: I.A + (G.3.6) + (A.3.2), C1-1805: I.A + (G.5.1) + (A.3.2), C1-1806: I.A + (G.5.2) + (A.3.2), C1-1807: I.A + (G.5.3) + (A.3.2), C1-1808: I.A + (G.5.4) + (A.3.2), C1-1809: I.A + (G.5.5) + (A.3.2), C1-1810: I.A+ (G.5.6) + (A.3.2), C1-1811: I.A +
(G.5.7) + (A.3.2), C1-1812: I.A + (G.5.8) + (A.3.2), C1-1813: I.A + (G.5.9) + (A.3.2), C1-1814:
LA + (G.5.10) + (A.3.2), C1-1815: I.A + (G.5.11) + (A.3.2), C1-1816: I.A + (H.1.5) + (A.3.2), C1- 1817: I.A + (H.1.7) + (A.3.2), C1-1818: I.A+ (H.2.2) + (A.3.2), C1-1819: I.A+ (H.2.3) + (A.3.2), C1-1820: I.A + (H.2.5) + (A.3.2), C1-1821: I.A+ (H.2.7) + (A.3.2), C1-1822: I.A+ (H.2.8) + (A.3.2), C1-1823: I.A + (H.3.2) + (A.3.2), C1-1824: I.A + (H.3.4) + (A.3.2), C1-1825: I.A + (H.3.5) + (A.3.2), C1-1826: I.A + (H.4.9) + (A.3.2), C1-1827: I.A + (H.4.10) + (A.3.2), C1-1828: I.A + (I.2.2) + (A.3.2), C1-1829: I.A+ (I.2.5) + (A.3.2), C1-1830: I.A + (J.1.2) + (A.3.2), C1-1831: I.A + (J.1.5) + (A.3.2), C1-1832: I.A + (J.1.8) + (A.3.2), C1-1833: I.A + (J.1.11) + (A.3.2), C1-1834: I.A + (J.1.12) + (A.3.2), C1-1835: LA + (K.1.3) + (A.3.2), C1-1836: I.A+ (K.1.29) + (A.3.2), C1- 1837: LA + (K.1.30) + (A.3.2), C1-1838: I.A+ (K.1.31) + (A.3.2), C1-1839: I.A+ (K.1.32) + (A.3.2), C1-1840: I.A+ (K.1.41) + (A.3.2), C1-1841: I.A+ (K.1.42) + (A.3.2), C1-1842: I.A +
(K.1.44) + (A.3.2), C1-1843: I.A+ (K.1.45) + (A.3.2), C1-1844: I.A+ (K.1.47) + (A.3.2), C1-1845: LA + (K.1.49) + (A.3.2), C1-1846: I.A + (K.1.53) + (A.3.2), C1-1847: I.A + (K.1.54) + (A.3.2), C1- 1848: LA + (A.1.4) + (A.3.3), C1-1849: I.A+ (A.1.12) + (A.3.3), C1-1850: I.A+ (A.1.21) +
(A.3.3), C1-1851: I.A + (A.121a) + (A.3.3), C1-1852: I.A+ (A.1.24) + (A.3.3), C1-1853: I.A +
(A.1.26) + (A.3.3), C1-1854: I.A+ (A.1.27) + (A.3.3), C1-1855: I.A+ (A.1.30) + (A.3.3), C1-1856: I.A+ (A.1.31) + (A.3.3), C1-1857: I.A+ (A.1.32) + (A.3.3), C1-1858: I.A+ (A.1.35) + (A.3.3), C1- 1859: I.A+ (A.2.1) + (A.3.3), C1-1860: I.A+ (A.2.3) + (A.3.3), C1-1861: I.A+ (A.2.5) + (A.3.3), C1-1862: I.A + (A.3.4) + (A.3.3), C1-1863: I.A + (A.3.7) + (A.3.3), C1-1864: I.A + (A.3.9) + (A.3.3), C1-1865: LA + (A.3.11) + (A.3.3), C1-1866: LA + (A.3.12) + (A.3.3), C1-1867: I.A + (A.3.15) + (A.3.3), C1-1868: I.A + (A.3.16) + (A.3.3), C1-1869: I.A + (A.3.17) + (A.3.3), C1-1870: LA + (A.3.18) + (A.3.3), C1-1871: I.A+ (A.3.19) + (A.3.3), C1-1872: I.A+ (A.3.20) + (A.3.3), C1- 1873: I.A + (A.3.21) + (A.3.3), C1-1874: I.A + (A.3.22) + (A.3.3), C1-1875: I.A + (A.3.23) + (A.3.3), C1-1876: I.A + (A.3.24) + (A.3.3), C1-1877: I.A + (A.3.25) + (A.3.3), C1-1878: I.A + (A.3.26) + (A.3.3), C1-1879: I.A+ (A.3.27) + (A.3.3), C1-1880: I.A+ (A.3.28) + (A.3.3), C1-1881: I.A + (A.3.29) + (A.3.3), C1-1882: I.A + (A.3.31) + (A.3.3), C1-1883: I.A + (A.3.32) + (A.3.3), C1- 1884: I.A + (A.3.33) + (A.3.3), C1-1885: I.A + (A.3.34) + (A.3.3), C1-1886: I.A + (A.3.35) + (A.3.3), C1-1887: I.A + (A.3.36) + (A.3.3), C1-1888: I.A + (A.3.37) + (A.3.3), C1-1889: I.A + (A.3.38) + (A.3.3), C1-1890: I.A+ (A.3.39) + (A.3.3), C1-1891: I.A+ (A.4.5) + (A.3.3), C1-1892: I.A+ (A.4.11) + (A.3.3), C1-1893: I.A+ (B.1.4) + (A.3.3), C1-1894: LA + (B.1.5) + (A.3.3), C1- 1895: I.A+ (B.1.8.) + (A.3.3), C1-1896: I.A + (B.1.10) + (A.3.3), C1-1897: LA + (B.1.11) +
(A.3.3), C1-1898: I.A+ (B.1.12) + (A.3.3), C1-1899: I.A+ (B.1.13) + (A.3.3), C1-1900: I.A + (B.1.17) + (A.3.3), C1-1901: I.A+ (B.1.18) + (A.3.3), C1-1902: LA + (B.1.21) + (A.3.3), C1-1903: LA + (B.1.22) + (A.3.3), C1-1904: LA + (B.1.23) + (A.3.3), C1-1905: I.A+ (B.1.25) + (A.3.3), C1- 1906: LA + (B.1.26) + (A.3.3), C1-1907: LA + (B.1.29) + (A.3.3), C1-1908: I.A+ (B.1.33) + (A.3.3), C1-1909: LA + (B.1.34) + (A.3.3), C1-1910: LA + (B.1.37) + (A.3.3), C1-1911: I.A +
(B.1.38) + (A.3.3), C1-1912: LA + (B.1.43) + (A.3.3), C1-1913: LA + (B.1.46) + (A.3.3), C1-1914: I.A + (B.2.4) + (A.3.3), C1-1915: I.A + (B.2.5) + (A.3.3), C1-1916: I.A + (B.2.6) + (A.3.3), C1- 1917: I.A + (B.2.8) + (A.3.3), C1-1918: I.A+ (C.1.1) + (A.3.3), C1-1919: I.A+ (C.1.2) + (A.3.3), C1-1920: LA + (C.1.4) + (A.3.3), C1-1921: LA + (C.1.5) + (A.3.3), C1-1922: I.A+ (C.2.6) + (A.3.3), C1-1923: I.A+ (C.2.7) + (A.3.3), C1-1924: I.A+ (C.2.8) + (A.3.3), C1-1925: I.A+ (D.1.1) + (A.3.3), C1-1926: I.A+ (D.1.2) + (A.3.3), C1-1927: LA + (D.1.5) + (A.3.3), C1-1928: I.A + (D.2.4) + (A.3.3), C1-1929: I.A+ (D.2.6) + (A.3.3), C1-1930: I.A+ (D.2.7) + (A.3.3), C1-1931: I.A + (E.1.1) + (A.3.3), C1-1932: LA + (E.1.3) + (A.3.3), C1-1933: I.A+ (E.2.2) + (A.3.3), C1-1934: LA + (E.2.3) + (A.3.3), C1-1935: I.A+ (F.1.2) + (A.3.3), C1-1936: I.A+ (F.1.4) + (A.3.3), C1- 1937: LA + (F.1.5) + (A.3.3), C1-1938: I.A+ (G.3.1) + (A.3.3), C1-1939: I.A+ (G.3.3) + (A.3.3), C1-1940: I.A + (G.3.6) + (A.3.3), C1-1941: I.A+ (G.5.1) + (A.3.3), C1-1942: I.A+ (G.5.2) + (A.3.3), C1-1943: I.A + (G.5.3) + (A.3.3), C1-1944: I.A + (G.5.4) + (A.3.3), C1-1945: I.A +
(G.5.5) + (A.3.3), C1-1946: I.A + (G.5.6) + (A.3.3), C1-1947: I.A + (G.5.7) + (A.3.3), C1-1948:
I.A + (G.5.8) + (A.3.3), C1-1949: I.A + (G.5.9) + (A.3.3), C1-1950: I.A + (G.5.10) + (A.3.3), C1- 1951: LA + (G.5.11) + (A.3.3), C1-1952: I.A + (H.1.5) + (A.3.3), C1-1953: I.A + (H.1.7) + (A.3.3), C1-1954: I.A + (H.2.2) + (A.3.3), C1-1955: I.A + (H.2.3) + (A.3.3), C1-1956: I.A + (H.2.5) + (A.3.3), C1-1957: I.A + (H.2.7) + (A.3.3), C1-1958: I.A + (H.2.8) + (A.3.3), C1-1959: I.A + (H.3.2) + (A.3.3), C1-1960: I.A+ (H.3.4) + (A.3.3), C1-1961: I.A+ (H.3.5) + (A.3.3), C1-1962: I.A + (H.4.9) + (A.3.3), C1-1963: I.A + (H.4.10) + (A.3.3), C1-1964: I.A + (I.2.2) + (A.3.3), C1-1965: I.A + (I.2.5) + (A.3.3), C1-1966: I.A + (J.1.2) + (A.3.3), C1-1967: I.A + (J.1.5) + (A.3.3), C1-1968: I.A + (J.1.8) + (A.3.3), C1-1969: I.A + (J.1.11) + (A.3.3), C1-1970: I.A + (J.1.12) + (A.3.3), C1-1971:
I.A+ (K.1.3) + (A.3.3), C1-1972: I.A + (K.1.29) + (A.3.3), C1-1973: I.A+ (K.1.30) + (A.3.3), C1- 1974: I.A+ (K.1.31) + (A.3.3), C1-1975: I.A+ (K.1.32) + (A.3.3), C1-1976: I.A+ (K.1.41) + (A.3.3), C1-1977: I.A+ (K.1.42) + (A.3.3), C1-1978: I.A+ (K.1.44) + (A.3.3), C1-1979: I.A + (K.1.45) + (A.3.3), C1-1980: I.A+ (K.1.47) + (A.3.3), C1-1981: I.A+ (K.1.49) + (A.3.3), C1-1982: I.A+ (K.1.53) + (A.3.3), C1-1983: I.A+ (K.1.54) + (A.3.3), C1-1984: I.A+ (A.1.4) + (A.3.4), C1- 1985: I.A+ (A.1.12) + (A.3.4), C1-1986: I.A+ (A.1.21) + (A.3.4), C1-1987: I. A + (A.121a) + (A.3.4), C1-1988: I.A+ (A.1.24) + (A.3.4), C1-1989: I.A+ (A.1.26) + (A.3.4), C1-1990: I.A +
(A.1.27) + (A.3.4), C1-1991: I.A+ (A.1.30) + (A.3.4), C1-1992: I.A+ (A.1.31) + (A.3.4), C1-1993: I .A + (A.1.32) + (A.3.4), C1-1994: I.A+ (A.1.35) + (A.3.4), C1-1995: I.A+ (A.2.1) + (A.3.4), C1- 1996: I.A + (A.2.3) + (A.3.4), C1-1997: I.A + (A.2.5) + (A.3.4), C1-1998: I.A + (A.3.7) + (A.3.4), C1-1999: I.A+ (A.3.9) + (A.3.4), C1-2000: LA + (A.3.11) + (A.3.4), C1-2001: LA + (A.3.12) + (A.3.4), C1-2002: I.A + (A.3.15) + (A.3.4), C1-2003: I.A + (A.3.16) + (A.3.4), C1-2004: I.A + (A.3.17) + (A.3.4), C1-2005: I.A + (A.3.18) + (A.3.4), C1-2006: I.A + (A.3.19) + (A.3.4), C1-2007: I.A + (A.3.20) + (A.3.4), C1-2008: I.A + (A.3.21) + (A.3.4), C1-2009: I.A + (A.3.22) + (A.3.4), C1- 2010: LA + (A.3.23) + (A.3.4), C1-2011: I.A+ (A.3.24) + (A.3.4), C1-2012: I.A+ (A.3.25) + (A.3.4), C1-2013: I.A + (A.3.26) + (A.3.4), C1-2014: I.A + (A.3.27) + (A.3.4), C1-2015: I.A + (A.3.28) + (A.3.4), C1-2016: I.A + (A.3.29) + (A.3.4), C1-2017: I.A + (A.3.31) + (A.3.4), C1-2018: I.A + (A.3.32) + (A.3.4), C1-2019: I.A + (A.3.33) + (A.3.4), C1-2020: I.A + (A.3.34) + (A.3.4), C1- 2021: I.A + (A.3.35) + (A.3.4), C1-2022: I.A+ (A.3.36) + (A.3.4), C1-2023: I.A+ (A.3.37) + (A.3.4), C1-2024: I.A + (A.3.38) + (A.3.4), C1-2025: I.A + (A.3.39) + (A.3.4), C1-2026: I.A + (A.4.5) + (A.3.4), C1-2027: I.A+ (A.4.11) + (A.3.4), C1-2028: I.A+ (B.1.4) + (A.3.4), C1-2029: I.A+ (B.1.5) + (A.3.4), C1-2030: I.A+ (B.1.8.) + (A.3.4), C1-2031: LA + (B.1.10) + (A.3.4), C1- 2032: I.A+ (B.1.11) + (A.3.4), C1-2033: I.A+ (B.1.12) + (A.3.4), C1-2034: I.A+ (B.1.13) + (A.3.4), C1-2035: I.A+ (B.1.17) + (A.3.4), C1-2036: I.A+ (B.1.18) + (A.3.4), C1-2037: I.A +
(B.1.21) + (A.3.4), C1-2038: LA + (B.1.22) + (A.3.4), C1-2039: I.A+ (B.1.23) + (A.3.4), C1-2040: I.A+ (B.1.25) + (A.3.4), C1-2041: I.A+ (B.1.26) + (A.3.4), C1-2042: I.A+ (B.1.29) + (A.3.4), C1- 2043: I.A + (B.1.33) + (A.3.4), C1-2044: I.A + (B.1.34) + (A.3.4), C1-2045: I.A + (B.1.37) + (A.3.4), C1-2046: I.A + (B.1.38) + (A.3.4), C1-2047: I.A + (B.1.43) + (A.3.4), C1-2048: I.A + (B.1.46) + (A.3.4), C1-2049: I.A+ (B.2.4) + (A.3.4), C1-2050: I.A+ (B.2.5) + (A.3.4), C1-2051: LA + (B.2.6) + (A.3.4), C1-2052: I.A+ (B.2.8) + (A.3.4), C1-2053: I.A+ (C.1.1) + (A.3.4), C1- 2054: LA + (C.1.2) + (A.3.4), C1-2055: I.A+ (C.1.4) + (A.3.4), C1-2056: I.A+ (C.1.5) + (A.3.4), C1-2057: I.A + (C.2.6) + (A.3.4), C1-2058: I.A + (C.2.7) + (A.3.4), C1-2059: I.A + (C.2.8) + (A.3.4), C1-2060: LA + (D.1.1) + (A.3.4), C1-2061: I.A+ (D.1.2) + (A.3.4), C1-2062: I.A+ (D.1.5) + (A.3.4), C1-2063: I.A + (D.2.4) + (A.3.4), C1-2064: I.A + (D.2.6) + (A.3.4), C1-2065: I.A + (D.2.7) + (A.3.4), C1-2066: I.A+ (E.1.1) + (A.3.4), C1-2067: I.A + (E.1.3) + (A.3.4), C1-2068: I.A + (E.2.2) + (A.3.4), C1-2069: I.A+ (E.2.3) + (A.3.4), C1-2070: I.A+ (F.1.2) + (A.3.4), C1-2071: I.A+ (F.1.4) + (A.3.4), C1-2072: I.A+ (F.1.5) + (A.3.4), C1-2073: I.A+ (G.3.1) + (A.3.4), C1- 2074: I.A + (G.3.3) + (A.3.4), C1-2075: I.A + (G.3.6) + (A.3.4), C1-2076: I.A + (G.5.1) + (A.3.4), C1-2077: I.A + (G.5.2) + (A.3.4), C1-2078: I.A + (G.5.3) + (A.3.4), C1-2079: I.A + (G.5.4) + (A.3.4), C1-2080: I.A+ (G.5.5) + (A.3.4), C1-2081: I.A+ (G.5.6) + (A.3.4), C1-2082: I.A +
(G.5.7) + (A.3.4), C1-2083: I.A + (G.5.8) + (A.3.4), C1-2084: I.A + (G.5.9) + (A.3.4), C1-2085:
LA + (G.5.10) + (A.3.4), C1-2086: I.A+ (G.5.11) + (A.3.4), C1-2087: I.A + (H.1.5) + (A.3.4), C1-
2088: I.A+ (H.1.7) + (A.3.4), C1-2089: I.A+ (H.2.2) + (A.3.4), C1-2090: I.A+ (H.2.3) + (A.3.4), C1-2091 : I.A+ (H.2.5) + (A.3.4), C1-2092: I.A+ (H.2.7) + (A.3.4), C1-2093: I.A+ (H.2.8) + (A.3.4), C1-2094: I. A + (H.3.2) + (A.3.4), C1-2095: I. A + (H.3.4) + (A.3.4), C1-2096: I. A + (H.3.5) + (A.3.4), C1-2097: I. A + (H.4.9) + (A.3.4), C1-2098: I. A + (H.4.10) + (A.3.4), C1-2099: I.A + (I.2.2) + (A.3.4), C1-2100: I.A+ (I.2.5) + (A.3.4), C1-2101: I.A + (J.1.2) + (A.3.4), C1-2102: I.A + (J.1.5) + (A.3.4), C1-2103: I.A + (J.1.8) + (A.3.4), C1-2104: I.A + (J.1.11) + (A.3.4), C1-2105: I.A + (J.1.12) + (A.3.4), C1-2106: I.A+ (K.1.3) + (A.3.4), C1-2107: I.A+ (K.1.29) + (A.3.4), C1- 2108: I.A+ (K.1.30) + (A.3.4), C1-2109: I.A+ (K.1.31) + (A.3.4), C1-2110: I.A+ (K.1.32) + (A.3.4), C1-2111: I.A + (K.1.41) + (A.3.4), C1-2112: I.A+ (K.1.42) + (A.3.4), C1-2113: I.A + (K.1.44) + (A.3.4), C1-2114: I.A+ (K.1.45) + (A.3.4), C1-2115: I.A+ (K.1.47) + (A.3.4), C1-2116: I.A+ (K.1.49) + (A.3.4), C1-2117: I.A+ (K.1.53) + (A.3.4), C1-2118: I.A+ (K.1.54) + (A.3.4), C1- 2119: I.A + (A.1.4) + (A.3.7), C1-2120: I.A+ (A.1.12) + (A.3.7), C1-2121: I.A+ (A.1.21) +
(A.3.7), C1-2122: I.A + (A.121a) + (A.3.7), C1-2123: LA + (A.1.24) + (A.3.7), C1-2124: I.A +
(A.1.26) + (A.3.7), C1-2125: LA + (A.1.27) + (A.3.7), C1-2126: LA + (A.1.30) + (A.3.7), C1-2127: LA + (A.1.31) + (A.3.7), C1-2128: I.A+ (A.1.32) + (A.3.7), C1-2129: I.A+ (A.1.35) + (A.3.7), C1- 2130: LA + (A.2.1) + (A.3.7), C1-2131: I.A+ (A.2.3) + (A.3.7), C1-2132: I.A+ (A.2.5) + (A.3.7), C1-2133: I.A+ (A.3.9) + (A.3.7), C1-2134: I.A+ (A.3.11) + (A.3.7), C1-2135: I.A+ (A.3.12) + (A.3.7), C1-2136: I.A + (A.3.15) + (A.3.7), C1-2137: I.A + (A.3.16) + (A.3.7), C1-2138: I.A + (A.3.17) + (A.3.7), C1-2139: I.A+ (A.3.18) + (A.3.7), C1-2140: I.A+ (A.3.19) + (A.3.7), C1-2141: I.A + (A.3.20) + (A.3.7), C1-2142: I.A + (A.3.21) + (A.3.7), C1-2143: I.A + (A.3.22) + (A.3.7), C1- 2144: I.A + (A.3.23) + (A.3.7), C1-2145: I.A + (A.3.24) + (A.3.7), C1-2146: I.A + (A.3.25) + (A.3.7), C1-2147: I.A + (A.3.26) + (A.3.7), C1-2148: I.A + (A.3.27) + (A.3.7), C1-2149: I.A + (A.3.28) + (A.3.7), C1-2150: I.A+ (A.3.29) + (A.3.7), C1-2151: I.A+ (A.3.31) + (A.3.7), C1-2152: I.A + (A.3.32) + (A.3.7), C1-2153: I.A + (A.3.33) + (A.3.7), C1-2154: I.A + (A.3.34) + (A.3.7), C1- 2155: I.A + (A.3.35) + (A.3.7), C1-2156: I.A + (A.3.36) + (A.3.7), C1-2157: I.A + (A.3.37) + (A.3.7), C1-2158: I.A + (A.3.38) + (A.3.7), C1-2159: I.A + (A.3.39) + (A.3.7), C1-2160: I.A + (A.4.5) + (A.3.7), C1-2161 : I.A+ (A.4.11) + (A.3.7), C1-2162: I.A+ (B.1.4) + (A.3.7), C1-2163: I.A+ (B.1.5) + (A.3.7), C1-2164: I.A+ (B.1.8.) + (A.3.7), C1-2165: LA + (B.1.10) + (A.3.7), C1- 2166: I.A+ (B.1.11) + (A.3.7), C1-2167: I.A+ (B.1.12) + (A.3.7), C1-2168: I.A+ (B.1.13) + (A.3.7), C1-2169: I.A+ (B.1.17) + (A.3.7), C1-2170: I.A+ (B.1.18) + (A.3.7), C1-2171: I.A +
(B.1.21) + (A.3.7), C1-2172: I.A+ (B.1.22) + (A.3.7), C1-2173: I.A+ (B.1.23) + (A.3.7), C1-2174: I.A+ (B.1.25) + (A.3.7), C1-2175: I.A+ (B.1.26) + (A.3.7), C1-2176: I.A+ (B.1.29) + (A.3.7), C1- 2177: LA + (B.1.33) + (A.3.7), C1-2178: I.A+ (B.1.34) + (A.3.7), C1-2179: I.A+ (B.1.37) + (A.3.7), C1-2180: I.A+ (B.1.38) + (A.3.7), C1-2181: I.A+ (B.1.43) + (A.3.7), C1-2182: I.A +
(B.1.46) + (A.3.7), C1-2183: I.A+ (B.2.4) + (A.3.7), C1-2184: I.A+ (B.2.5) + (A.3.7), C1-2185: LA + (B.2.6) + (A.3.7), C1-2186: I.A + (B.2.8) + (A.3.7), C1-2187: I.A+ (C.1.1) + (A.3.7), C1- 2188: LA + (C.1.2) + (A.3.7), C1-2189: I.A+ (C.1.4) + (A.3.7), C1-2190: I.A+ (C.1.5) + (A.3.7), C1-2191 : LA + (C.2.6) + (A.3.7), C1-2192: I.A+ (C.2.7) + (A.3.7), C1-2193: I.A+ (C.2.8) + (A.3.7), C1-2194: I.A+ (D.1.1) + (A.3.7), C1-2195: I.A+ (D.1.2) + (A.3.7), C1-2196: I.A+ (D.1.5) + (A.3.7), C1-2197: I.A + (D.2.4) + (A.3.7), C1-2198: I.A + (D.2.6) + (A.3.7), C1-2199: I.A + (D.2.7) + (A.3.7), C1-2200: I.A+ (E.1.1) + (A.3.7), C1-2201: I.A + (E.1.3) + (A.3.7), C1-2202: I.A + (E.2.2) + (A.3.7), C1-2203: I.A+ (E.2.3) + (A.3.7), C1-2204: I.A+ (F.1.2) + (A.3.7), C1-2205:
I.A+ (F.1.4) + (A.3.7), C1-2206: I.A+ (F.1.5) + (A.3.7), C1-2207: I.A+ (G.3.1) + (A.3.7), C1- 2208: I.A + (G.3.3) + (A.3.7), C1-2209: I.A + (G.3.6) + (A.3.7), C1-2210: I.A + (G.5.1) + (A.3.7), C1-2211: LA + (G.5.2) + (A.3.7), C1-2212: I.A+ (G.5.3) + (A.3.7), C1-2213: I.A+ (G.5.4) + (A.3.7), C1-2214: I.A + (G.5.5) + (A.3.7), C1-2215: I.A + (G.5.6) + (A.3.7), C1-2216: I.A +
(G.5.7) + (A.3.7), C1-2217: I.A + (G.5.8) + (A.3.7), C1-2218: I.A + (G.5.9) + (A.3.7), C1-2219:
LA + (G.5.10) + (A.3.7), C1-2220: I.A+ (G.5.11) + (A.3.7), C1-2221: I.A + (H.1.5) + (A.3.7), C1- 2222: I.A + (H.1.7) + (A.3.7), C1-2223: I.A+ (H.2.2) + (A.3.7), C1-2224: I.A+ (H.2.3) + (A.3.7), C1-2225: I.A + (H.2.5) + (A.3.7), C1-2226: I.A + (H.2.7) + (A.3.7), C1-2227: I.A + (H.2.8) + (A.3.7), C1-2228: I.A + (H.3.2) + (A.3.7), C1-2229: I.A + (H.3.4) + (A.3.7), C1-2230: I.A + (H.3.5) + (A.3.7), C1-2231 : LA + (H.4.9) + (A.3.7), C1-2232: I.A+ (H.4.10) + (A.3.7), C1-2233: I.A + (I.2.2) + (A.3.7), C1-2234: I.A+ (I.2.5) + (A.3.7), C1-2235: I.A + (J.1.2) + (A.3.7), C1-2236: I.A + (J.1.5) + (A.3.7), C 1-2237: I.A + (J.1.8) + (A.3.7), C1-2238: I.A + (J.1.11) + (A.3.7), C1-2239: I.A + (J.1.12) + (A.3.7), C1-2240: LA + (K.1.3) + (A.3.7), C1-2241: I.A+ (K.1.29) + (A.3.7), C1- 2242: LA + (K.1.30) + (A.3.7), C1-2243: I.A+ (K.1.31) + (A.3.7), C1-2244: I.A+ (K.1.32) + (A.3.7), C1-2245: I.A+ (K.1.41) + (A.3.7), C1-2246: I.A+ (K.1.42) + (A.3.7), C1-2247: I.A +
(K.1.44) + (A.3.7), C1-2248: I.A+ (K.1.45) + (A.3.7), C1-2249: I.A+ (K.1.47) + (A.3.7), C1-2250: LA + (K.1.49) + (A.3.7), C1-2251: I.A + (K.1.53) + (A.3.7), C1-2252: I.A + (K.1.54) + (A.3.7), C1- 2253: LA + (A.1.4) + (A.3.9), C1-2254: I.A+ (A.1.12) + (A.3.9), C1-2255: I.A+ (A.1.21) +
(A.3.9), C1-2256: I.A + (A.121a) + (A.3.9), C1-2257: LA + (A.1.24) + (A.3.9), C1-2258: I.A + (A.1.26) + (A.3.9), C1-2259: LA + (A.1.27) + (A.3.9), C1-2260: LA + (A.1.30) + (A.3.9), C1-2261: LA + (A.1.31) + (A.3.9), C1-2262: I.A+ (A.1.32) + (A.3.9), C1-2263: I.A+ (A.1.35) + (A.3.9), C1- 2264: I.A + (A.2.1) + (A.3.9), C1-2265: I.A + (A.2.3) + (A.3.9), C1-2266: I.A + (A.2.5) + (A.3.9),
C 1-2267: I.A+ (A.3.11) + (A.3.9), C1-2268: I.A+ (A.3.12) + (A.3.9), C1-2269: I.A+ (A.3.15) + (A.3.9), C1-2270: I.A+ (A.3.16) + (A.3.9), C1-2271: I.A+ (A.3.17) + (A.3.9), C1-2272: I.A + (A.3.18) + (A.3.9), C1-2273: I.A + (A.3.19) + (A.3.9), C1-2274: I.A + (A.3.20) + (A.3.9), C1-2275: I.A + (A.3.21) + (A.3.9), C1-2276: I.A + (A.3.22) + (A.3.9), C1-2277: I.A + (A.3.23) + (A.3.9), C1- 2278: I.A + (A.3.24) + (A.3.9), C1-2279: I.A + (A.3.25) + (A.3.9), C1-2280: I.A + (A.3.26) + (A.3.9), C1-2281 : I.A+ (A.3.27) + (A.3.9), C1-2282: I.A+ (A.3.28) + (A.3.9), C1-2283: I.A + (A.3.29) + (A.3.9), C1-2284: I.A + (A.3.31) + (A.3.9), C1-2285: I.A + (A.3.32) + (A.3.9), C1-2286: I.A + (A.3.33) + (A.3.9), C1-2287: I.A + (A.3.34) + (A.3.9), C1-2288: I.A + (A.3.35) + (A.3.9), C1- 2289: I.A + (A.3.36) + (A.3.9), C1-2290: I.A+ (A.3.37) + (A.3.9), C1-2291: I.A+ (A.3.38) + (A.3.9), C1-2292: I.A + (A.3.39) + (A.3.9), C1-2293: I.A + (A.4.5) + (A.3.9), C1-2294: I.A + (A.4.11) + (A.3.9), C1-2295: I.A+ (B.1.4) + (A.3.9), C1-2296: I.A+ (B.1.5) + (A.3.9), C1-2297: LA + (B.1.8.) + (A.3.9), C1-2298: I.A+ (B.1.10) + (A.3.9), C1-2299: I.A+ (B.1.11) + (A.3.9), C1- 2300: LA + (B.1.12) + (A.3.9), C1-2301: LA + (B.1.13) + (A.3.9), C1-2302: I.A+ (B.1.17) + (A.3.9), C1-2303: I.A + (B.1.18) + (A.3.9), C1-2304: I.A + (B.1.21) + (A.3.9), C1-2305: I.A + (B.1.22) + (A.3.9), C1-2306: I.A + (B.1.23) + (A.3.9), C1-2307: I.A + (B.1.25) + (A.3.9), C1-2308: I.A + (B.1.26) + (A.3.9), C1-2309: I.A + (B.1.29) + (A.3.9), C1-2310: I.A + (B.1.33) + (A.3.9), C1- 2311: LA + (B.1.34) + (A.3.9), C1-2312: LA + (B.1.37) + (A.3.9), C1-2313: LA + (B.1.38) + (A.3.9), C1-2314: I.A + (B.1.43) + (A.3.9), C1-2315: I.A + (B.1.46) + (A.3.9), C1-2316: I.A + (B.2.4) + (A.3.9), C1-2317: I.A + (B.2.5) + (A.3.9), C1-2318: I.A + (B.2.6) + (A.3.9), C1-2319: I.A + (B.2.8) + (A.3.9), C1-2320: I.A+ (C.1.1) + (A.3.9), C1-2321: I.A+ (C.1.2) + (A.3.9), C1-2322:
I.A+ (C.1.4) + (A.3.9), C1-2323: I.A+ (C.1.5) + (A.3.9), C1-2324: I.A+ (C.2.6) + (A.3.9), C1- 2325: I.A+ (C.2.7) + (A.3.9), C1-2326: I.A+ (C.2.8) + (A.3.9), C1-2327: I.A+ (D.1.1) + (A.3.9), C1-2328: I.A+ (D.1.2) + (A.3.9), C1-2329: I.A+ (D.1.5) + (A.3.9), C1-2330: I.A+ (D.2.4) + (A.3.9), C1-2331 : I.A+ (D.2.6) + (A.3.9), C1-2332: I.A+ (D.2.7) + (A.3.9), C1-2333: I.A+ (E.1.1) + (A.3.9), C1-2334: I.A+ (E.1.3) + (A.3.9), C1-2335: I.A+ (E.2.2) + (A.3.9), C1-2336: I.A + (E.2.3) + (A.3.9), C1-2337: I.A+ (F.1.2) + (A.3.9), C1-2338: I.A+ (F.1.4) + (A.3.9), C1-2339: I.A + (F.1.5) + (A.3.9), C1-2340: I.A+ (G.3.1) + (A.3.9), C1-2341: I.A+ (G.3.3) + (A.3.9), C1-2342: I.A + (G.3.6) + (A.3.9), C1-2343: I.A + (G.5.1) + (A.3.9), C1-2344: I.A + (G.5.2) + (A.3.9), C1- 2345: I.A + (G.5.3) + (A.3.9), C1-2346: I.A + (G.5.4) + (A.3.9), C1-2347: I.A + (G.5.5) + (A.3.9), C1-2348: I.A + (G.5.6) + (A.3.9), C1-2349: I.A + (G.5.7) + (A.3.9), C1-2350: I.A + (G.5.8) + (A.3.9), C1-2351 : I.A+ (G.5.9) + (A.3.9), C1-2352: I.A+ (G.5.10) + (A.3.9), C1-2353: I.A +
(G.5.11) + (A.3.9), C1-2354: I.A + (H.1.5) + (A.3.9), C1-2355: I.A + (H.1.7) + (A.3.9), C1-2356: I.A + (H.2.2) + (A.3.9), C1-2357: I.A + (H.2.3) + (A.3.9), C1-2358: I.A + (H.2.5) + (A.3.9), C1- 2359: I.A + (H.2.7) + (A.3.9), C1-2360: I.A+ (H.2.8) + (A.3.9), C1-2361: I.A+ (H.3.2) + (A.3.9), C1-2362: I.A + (H.3.4) + (A.3.9), C1-2363: I.A + (H.3.5) + (A.3.9), C1-2364: I.A + (H.4.9) + (A.3.9), C1-2365: I.A + (H.4.10) + (A.3.9), C1-2366: I.A + (I.2.2) + (A.3.9), C1-2367: I.A + (I.2.5) + (A.3.9), C1-2368: I.A + (J.1.2) + (A.3.9), C1-2369: I.A + (J.1.5) + (A.3.9), C1-2370: I.A +
(J.1.8) + (A.3.9), C1-2371 : I.A + (J.1.11) + (A.3.9), C1-2372: I.A + (J.1.12) + (A.3.9), C1-2373: I.A+ (K.1.3) + (A.3.9), C1-2374: I.A+ (K.1.29) + (A.3.9), C1-2375: I.A+ (K.1.30) + (A.3.9), C1- 2376: I.A+ (K.1.31) + (A.3.9), C1-2377: I.A+ (K.1.32) + (A.3.9), C1-2378: I.A+ (K.1.41) + (A.3.9), C1-2379: I.A+ (K.1.42) + (A.3.9), C1-2380: I.A+ (K.1.44) + (A.3.9), C1-2381: I.A + (K.1.45) + (A.3.9), C1-2382: I.A+ (K.1.47) + (A.3.9), C1-2383: I.A+ (K.1.49) + (A.3.9), C1-2384: I.A+ (K.1.53) + (A.3.9), C1-2385: I.A+ (K.1.54) + (A.3.9), C1-2386: I.A + (A.1.4) + (A.3.17), C1- 2387: I.A+ (A.1.12) + (A.3.17), C1-2388: LA + (A.1.21) + (A.3.17), C1-2389: I.A + (A.121a) + (A.3.17), C1-2390: LA + (A.1.24) + (A.3.17), C1-2391: LA + (A.1.26) + (A.3.17), C1-2392: I.A + (A.1.27) + (A.3.17), C1-2393: LA + (A.1.30) + (A.3.17), C1-2394: I.A+ (A.1.31) + (A.3.17), C1- 2395: LA + (A.1.32) + (A.3.17), C1-2396: LA + (A.1.35) + (A.3.17), C1-2397: I.A+ (A.2.1) + (A.3.17), C1-2398: I.A + (A.2.3) + (A.3.17), C1-2399: I.A + (A.2.5) + (A.3.17), C1-2400: I.A + (A.3.11) + (A.3.17), C1-2401 : LA + (A.3.12) + (A.3.17), C1-2402: I.A+ (A.3.15) + (A.3.17), C1- 2403: I.A + (A.3.16) + (A.3.17), C1-2404: I.A + (A.3.18) + (A.3.17), C1-2405: I.A + (A.3.19) + (A.3.17), C1-2406: I.A + (A.3.20) + (A.3.17), C1-2407: I.A + (A.3.21) + (A.3.17), C1-2408: I.A + (A.3.22) + (A.3.17), C1-2409: I.A + (A.3.23) + (A.3.17), C1-2410: I.A + (A.3.24) + (A.3.17), C1- 2411: LA + (A.3.25) + (A.3.17), C1-2412: I.A+ (A.3.26) + (A.3.17), C1-2413: I.A+ (A.3.27) + (A.3.17), C1-2414: I.A + (A.3.28) + (A.3.17), C1-2415: I.A + (A.3.29) + (A.3.17), C1-2416: I.A + (A.3.31) + (A.3.17), C1-2417: I.A + (A.3.32) + (A.3.17), C1-2418: I.A + (A.3.33) + (A.3.17), C1- 2419: I.A + (A.3.34) + (A.3.17), C1-2420: I.A+ (A.3.35) + (A.3.17), C1-2421: I.A+ (A.3.36) + (A.3.17), C1-2422: I.A + (A.3.37) + (A.3.17), C1-2423: I.A + (A.3.38) + (A.3.17), C1-2424: I.A + (A.3.39) + (A.3.17), C1-2425: I.A+ (A.4.5) + (A.3.17), C1-2426: LA + (A.4.11) + (A.3.17), C1- 2427: I.A+ (B.1.4) + (A.3.17), C1-2428: LA + (B.1.5) + (A.3.17), C1-2429: LA + (B.1.8.) + (A.3.17), C1-2430: LA + (B.1.10) + (A.3.17), C1-2431: LA + (B.1.11) + (A.3.17), C1-2432: I.A + (B.1.12) + (A.3.17), C1-2433: LA + (B.1.13) + (A.3.17), C1-2434: I.A+ (B.1.17) + (A.3.17), C1- 2435: I.A+ (B.1.18) + (A.3.17), C1-2436: LA + (B.1.21) + (A.3.17), C1-2437: I.A+ (B.1.22) +
(A.3.17), C1-2438: I.A+ (B.1.23) + (A.3.17), C1-2439: I.A+ (B.1.25) + (A.3.17), C1-2440: I.A + (B.1.26) + (A.3.17), C1-2441: I.A+ (B.1.29) + (A.3.17), C1-2442: I.A+ (B.1.33) + (A.3.17), C1- 2443: I.A+ (B.1.34) + (A.3.17), C1-2444: I.A+ (B.1.37) + (A.3.17), C1-2445: I.A+ (B.1.38) + (A.3.17), C1-2446: I.A+ (B.1.43) + (A.3.17), C1-2447: I.A+ (B.1.46) + (A.3.17), C1-2448: I.A + (B.2.4) + (A.3.17), C1-2449: I.A+ (B.2.5) + (A.3.17), C1-2450: I.A+ (B.2.6) + (A.3.17), C1-2451: I.A+ (B.2.8) + (A.3.17), C1-2452: I.A+ (C.1.1) + (A.3.17), C1-2453: I.A+ (C.1.2) + (A.3.17), C1- 2454: I.A+ (C.1.4) + (A.3.17), C1-2455: I.A+ (C.1.5) + (A.3.17), C1-2456: I.A+ (C.2.6) + (A.3.17), C 1-2457: I. A + (C.2.7) + (A.3.17), C1-2458: I.A + (C.2.8) + (A.3.17), C1-2459: I.A + (D.1.1) + (A.3.17), C1-2460: LA + (D.1.2) + (A.3.17), C1-2461: LA + (D.1.5) + (A.3.17), C1- 2462: I.A + (D.2.4) + (A.3.17), C1-2463: I.A + (D.2.6) + (A.3.17), C1-2464: I.A + (D.2.7) + (A.3.17), C1-2465: LA + (E.1.1) + (A.3.17), C1-2466: I.A+ (E.1.3) + (A.3.17), C1-2467: I.A + (E.2.2) + (A.3.17), C1-2468: I.A+ (E.2.3) + (A.3.17), C1-2469: I.A+ (F.1.2) + (A.3.17), C1-2470: I.A+ (F.1.4) + (A.3.17), C1-2471: I.A+ (F.1.5) + (A.3.17), C1-2472: I.A+ (G.3.1) + (A.3.17), C1- 2473: I.A + (G.3.3) + (A.3.17), C1-2474: I.A + (G.3.6) + (A.3.17), C1-2475: I.A + (G.5.1) + (A.3.17), C1-2476: I.A + (G.5.2) + (A.3.17), C1-2477: I.A + (G.5.3) + (A.3.17), C1-2478: I.A + (G.5.4) + (A.3.17), C1-2479: I.A + (G.5.5) + (A.3.17), C1-2480: I.A + (G.5.6) + (A.3.17), C1- 2481: LA + (G.5.7) + (A.3.17), C1-2482: I.A+ (G.5.8) + (A.3.17), C1-2483: I.A+ (G.5.9) + (A.3.17), C1-2484: I.A+ (G.5.10) + (A.3.17), C1-2485: I.A + (G.5.11) + (A.3.17), C1-2486: I.A + (H.1.5) + (A.3.17), C1-2487: I.A + (H.1.7) + (A.3.17), C1-2488: I.A+ (H.2.2) + (A.3.17), C1- 2489: LA + (H.2.3) + (A.3.17), C1-2490: I.A+ (H.2.5) + (A.3.17), C1-2491: I.A+ (H.2.7) + (A.3.17), C1-2492: I.A + (H.2.8) + (A.3.17), C1-2493: I.A + (H.3.2) + (A.3.17), C1-2494: I.A + (H.3.4) + (A.3.17), C1-2495: I.A + (H.3.5) + (A.3.17), C1-2496: I.A + (H.4.9) + (A.3.17), C1- 2497: I.A + (H.4.10) + (A.3.17), C1-2498: I.A + (I.2.2) + (A.3.17), C1-2499: I.A + (I.2.5) + (A.3.17), C1-2500: I.A + (J.1.2) + (A.3.17), C1-2501: I.A + (J.1.5) + (A.3.17), C1-2502: I.A + (J.1.8) + (A.3.17), C1-2503: I.A + (J.1.11) + (A.3.17), C1-2504: I.A + (J.1.12) + (A.3.17), C1- 2505: I.A+ (K.1.3) + (A.3.17), C1-2506: I.A+ (K.1.29) + (A.3.17), C1-2507: I.A+ (K.1.30) + (A.3.17), C1-2508: I.A+ (K.1.31) + (A.3.17), C1-2509: I.A+ (K.1.32) + (A.3.17), C1-2510: I.A + (K.1.41) + (A.3.17), C1-2511: I.A+ (K.1.42) + (A.3.17), C1-2512: I.A+ (K.1.44) + (A.3.17), C1- 2513: I.A+ (K.1.45) + (A.3.17), C1-2514: I.A+ (K.1.47) + (A.3.17), C1-2515: LA + (K.1.49) + (A.3.17), C1-2516: I.A+ (K.1.53) + (A.3.17), C1-2517: I.A+ (K.1.54) + (A.3.17), C1-2518: I.A + (A.1.4) + (A.3.24), C1-2519: I.A+ (A.1.12) + (A.3.24), C1-2520: I.A+ (A.1.21) + (A.3.24), C1- 2521: LA + (A.121a) + (A.3.24), C1-2522: LA + (A.1.24) + (A.3.24), C1-2523: LA + (A.1.26) + (A.3.24), C1-2524: LA + (A.1.27) + (A.3.24), C1-2525: I.A+ (A.1.30) + (A.3.24), C1-2526: I.A + (A.1.31) + (A.3.24), C1-2527: I.A+ (A.1.32) + (A.3.24), C1-2528: I.A+ (A.1.35) + (A.3.24), C1- 2529: LA + (A.2.1) + (A.3.24), C1-2530: I.A+ (A.2.3) + (A.3.24), C1-2531: I.A+ (A.2.5) + (A.3.24), C1-2532: I.A+ (A.3.11) + (A.3.24), C1-2533: I.A+ (A.3.12) + (A.3.24), C1-2534: I.A + (A.3.15) + (A.3.24), C1-2535: I.A + (A.3.16) + (A.3.24), C1-2536: I.A + (A.3.18) + (A.3.24), C1- 2537: I.A + (A.3.19) + (A.3.24), C1-2538: I.A + (A.3.20) + (A.3.24), C1-2539: I.A + (A.3.21) + (A.3.24), C1-2540: I.A+ (A.3.22) + (A.3.24), C1-2541: I.A+ (A.3.23) + (A.3.24), C1-2542: I.A + (A.3.25) + (A.3.24), C1-2543: I.A + (A.3.26) + (A.3.24), C1-2544: I.A + (A.3.27) + (A.3.24), C1- 2545: I.A + (A.3.28) + (A.3.24), C1-2546: I.A + (A.3.29) + (A.3.24), C1-2547: I.A + (A.3.31) + (A.3.24), C1-2548: I.A + (A.3.32) + (A.3.24), C1-2549: I.A + (A.3.33) + (A.3.24), C1-2550: I.A +
(A.3.34) + (A.3.24), C1-2551: I.A+ (A.3.35) + (A.3.24), C1-2552: I.A+ (A.3.36) + (A.3.24), C1- 2553: I.A + (A.3.37) + (A.3.24), C1-2554: I.A + (A.3.38) + (A.3.24), C1-2555: I.A + (A.3.39) + (A.3.24), C1-2556: I.A+ (A.4.5) + (A.3.24), C1-2557: LA + (A.4.11) + (A.3.24), C1-2558: I.A + (B.1.4) + (A.3.24), C1-2559: LA + (B.1.5) + (A.3.24), C1-2560: LA + (B.1.8.) + (A.3.24), C1- 2561: I.A+ (B.1.10) + (A.3.24), C1-2562: LA + (B.1.11) + (A.3.24), C1-2563: LA + (B.1.12) + (A.3.24), C1-2564: LA + (B.1.13) + (A.3.24), C1-2565: LA + (B.1.17) + (A.3.24), C1-2566: I.A + (B.1.18) + (A.3.24), C1-2567: LA + (B.1.21) + (A.3.24), C1-2568: LA + (B.1.22) + (A.3.24), C1- 2569: LA + (B.1.23) + (A.3.24), C1-2570: LA + (B.1.25) + (A.3.24), C1-2571: LA + (B.1.26) + (A.3.24), C1-2572: LA + (B.1.29) + (A.3.24), C1-2573: LA + (B.1.33) + (A.3.24), C1-2574: I.A + (B.1.34) + (A.3.24), C1-2575: LA + (B.1.37) + (A.3.24), C1-2576: LA + (B.1.38) + (A.3.24), C1- 2577: LA + (B.1.43) + (A.3.24), C1-2578: LA + (B.1.46) + (A.3.24), C1-2579: I.A+ (B.2.4) + (A.3.24), C1-2580: I.A+ (B.2.5) + (A.3.24), C1-2581: I.A+ (B.2.6) + (A.3.24), C1-2582: I.A + (B.2.8) + (A.3.24), C1-2583: LA + (C.1.1) + (A.3.24), C1-2584: LA + (C.1.2) + (A.3.24), C1-2585: I.A+ (C.1.4) + (A.3.24), C1-2586: LA + (C.1.5) + (A.3.24), C1-2587: I.A + (C.2.6) + (A.3.24), C1- 2588: I.A + (C.2.7) + (A.3.24), C1-2589: I.A+ (C.2.8) + (A.3.24), C1-2590: LA + (D.1.1) + (A.3.24), C1-2591 : LA + (D.1.2) + (A.3.24), C1-2592: LA + (D.1.5) + (A.3.24), C1-2593: I.A + (D.2.4) + (A.3.24), C1-2594: I.A + (D.2.6) + (A.3.24), C1-2595: I.A + (D.2.7) + (A.3.24), C1- 2596: I.A + (E.1.1) + (A.3.24), C1-2597: I.A+ (E.1.3) + (A.3.24), C1-2598: I.A+ (E.2.2) + (A.3.24), C1-2599: I.A+ (E.2.3) + (A.3.24), C1-2600: I.A+ (F.1.2) + (A.3.24), C1-2601: I.A + (F.1.4) + (A.3.24), C1-2602: I.A+ (F.1.5) + (A.3.24), C1-2603: I.A+ (G.3.1) + (A.3.24), C1-2604: I.A + (G.3.3) + (A.3.24), C1-2605: I.A + (G.3.6) + (A.3.24), C1-2606: I.A + (G.5.1) + (A.3.24), C1-2607: I.A + (G.5.2) + (A.3.24), C1-2608: I.A + (G.5.3) + (A.3.24), C1-2609: I.A + (G.5.4) + (A.3.24), C1-2610: I.A+ (G.5.5) + (A.3.24), C1-2611: I.A+ (G.5.6) + (A.3.24), C1-2612: I.A + (G.5.7) + (A.3.24), C1-2613: I.A + (G.5.8) + (A.3.24), C1-2614: I.A + (G.5.9) + (A.3.24), C1- 2615: LA + (G.5.10) + (A.3.24), C1-2616: I.A + (G.5.11) + (A.3.24), C1-2617: I.A + (H.1.5) + (A.3.24), C1-2618: I.A + (H.1.7) + (A.3.24), C1-2619: I.A+ (H.2.2) + (A.3.24), C1-2620: I.A + (H.2.3) + (A.3.24), C1-2621: I.A+ (H.2.5) + (A.3.24), C1-2622: I.A+ (H.2.7) + (A.3.24), C1- 2623: I.A + (H.2.8) + (A.3.24), C1-2624: I.A + (H.3.2) + (A.3.24), C1-2625: I.A + (H.3.4) + (A.3.24), C1-2626: I.A + (H.3.5) + (A.3.24), C1-2627: I.A + (H.4.9) + (A.3.24), C1-2628: I.A + (H.4.10) + (A.3.24), C1-2629: I.A+ (I.2.2) + (A.3.24), C1-2630: I.A+ (I.2.5) + (A.3.24), C1-2631: I.A + (J.1.2) + (A.3.24), C1-2632: I.A + (J.1.5) + (A.3.24), C1-2633: I.A + (J.1.8) + (A.3.24), C1- 2634: I.A + (J.1.11) + (A.3.24), C1-2635: I.A + (J.1.12) + (A.3.24), C1-2636: I.A+ (K.1.3) + (A.3.24), C1-2637: I.A+ (K.1.29) + (A.3.24), C1-2638: LA + (K.1.30) + (A.3.24), C1-2639: I.A + (K.1.31) + (A.3.24), C1-2640: I.A+ (K.1.32) + (A.3.24), C1-2641: I.A+ (K.1.41) + (A.3.24), C1- 2642: LA + (K.1.42) + (A.3.24), C1-2643: I.A+ (K.1.44) + (A.3.24), C1-2644: I.A+ (K.1.45) + (A.3.24), C1-2645: I.A+ (K.1.47) + (A.3.24), C1-2646: I.A+ (K.1.49) + (A.3.24), C1-2647: I.A + (K.1.53) + (A.3.24), C1-2648: I.A+ (K.1.54) + (A.3.24), C1-2649: LA + (A.1.4) + (A.3.28), C1- 2650: I.A+ (A.1.12) + (A.3.28), C1-2651: I.A+ (A.1.21) + (A.3.28), C1-2652: I.A + (A.121a) + (A.3.28), C1-2653: I.A+ (A.1.24) + (A.3.28), C1-2654: I.A+ (A.1.26) + (A.3.28), C1-2655: I.A + (A.1.27) + (A.3.28), C1-2656: I.A+ (A.1.30) + (A.3.28), C1-2657: I.A+ (A.1.31) + (A.3.28), C1- 2658: I.A + (A.1.32) + (A.3.28), C1-2659: I.A+ (A.1.35) + (A.3.28), C1-2660: LA + (A.2.1) + (A.3.28), C1-2661 : I.A+ (A.2.3) + (A.3.28), C1-2662: I.A+ (A.2.5) + (A.3.28), C1-2663: I.A +
(A.3.11) + (A.3.28), C1-2664: I.A+ (A.3.12) + (A.3.28), C1-2665: I.A+ (A.3.15) + (A.3.28), C1- 2666: I.A + (A.3.16) + (A.3.28), C1-2667: I.A + (A.3.18) + (A.3.28), C1-2668: I.A + (A.3.19) + (A.3.28), C1-2669: I.A+ (A.3.20) + (A.3.28), C1-2670: LA + (A.3.21) + (A.3.28), C1-2671: I.A + (A.3.22) + (A.3.28), C1-2672: I.A + (A.3.23) + (A.3.28), C1-2673: I.A + (A.3.25) + (A.3.28), C1- 2674: I.A + (A.3.26) + (A.3.28), C1-2675: I.A + (A.3.27) + (A.3.28), C1-2676: I.A + (A.3.29) + (A.3.28), C 1-2677: I.A + (A.3.31) + (A.3.28), C1-2678: I.A + (A.3.32) + (A.3.28), C1-2679: I.A + (A.3.33) + (A.3.28), C1-2680: I.A+ (A.3.34) + (A.3.28), C1-2681: I.A+ (A.3.35) + (A.3.28), C1- 2682: I.A + (A.3.36) + (A.3.28), C1-2683: I.A + (A.3.37) + (A.3.28), C1-2684: I.A + (A.3.38) + (A.3.28), C1-2685: I.A + (A.3.39) + (A.3.28), C1-2686: I.A + (A.4.5) + (A.3.28), C1-2687: I.A + (A.4.11) + (A.3.28), C1-2688: I.A+ (B.1.4) + (A.3.28), C1-2689: I.A+ (B.1.5) + (A.3.28), C1- 2690: I.A+ (B.1.8.) + (A.3.28), C1-2691: I.A+ (B.1.10) + (A.3.28), C1-2692: I.A+ (B.1.11) + (A.3.28), C1-2693: I.A+ (B.1.12) + (A.3.28), C1-2694: I.A+ (B.1.13) + (A.3.28), C1-2695: I.A + (B.1.17) + (A.3.28), C1-2696: I.A+ (B.1.18) + (A.3.28), C1-2697: I.A+ (B.1.21) + (A.3.28), C1- 2698: LA + (B.1.22) + (A.3.28), C1-2699: I.A+ (B.1.23) + (A.3.28), C1-2700: LA + (B.1.25) + (A.3.28), C1-2701 : I.A+ (B.1.26) + (A.3.28), C1-2702: I.A+ (B.1.29) + (A.3.28), C1-2703: I.A + (B.1.33) + (A.3.28), C1-2704: I.A+ (B.1.34) + (A.3.28), C1-2705: I.A+ (B.1.37) + (A.3.28), C1- 2706: LA + (B.1.38) + (A.3.28), C1-2707: I.A+ (B.1.43) + (A.3.28), C1-2708: LA + (B.1.46) + (A.3.28), C1-2709: I.A+ (B.2.4) + (A.3.28), C1-2710: I.A+ (B.2.5) + (A.3.28), C1-2711: I.A + (B.2.6) + (A.3.28), C1-2712: I.A+ (B.2.8) + (A.3.28), C1-2713: I.A+ (C.1.1) + (A.3.28), C1-2714: I.A+ (C.1.2) + (A.3.28), C1-2715: LA + (C.1.4) + (A.3.28), C1-2716: I.A+ (C.1.5) + (A.3.28), C1- 2717: I.A + (C.2.6) + (A.3.28), C1-2718: I.A + (C.2.7) + (A.3.28), C1-2719: I.A + (C.2.8) + (A.3.28), C1-2720: I.A+ (D.1.1) + (A.3.28), C1-2721: I.A+ (D.1.2) + (A.3.28), C1-2722: I.A + (D.1.5) + (A.3.28), C1-2723: I.A+ (D.2.4) + (A.3.28), C1-2724: I.A+ (D.2.6) + (A.3.28), C1- 2725: LA + (D.2.7) + (A.3.28), C1-2726: I.A+ (E.1.1) + (A.3.28), C1-2727: I.A+ (E.1.3) + (A.3.28), C1-2728: I.A + (E.2.2) + (A.3.28), C1-2729: I.A + (E.2.3) + (A.3.28), C1-2730: I.A + (F.1.2) + (A.3.28), C1-2731 : LA + (F.1.4) + (A.3.28), C1-2732: I.A+ (F.1.5) + (A.3.28), C1-2733: I.A + (G.3.1) + (A.3.28), C1-2734: I.A + (G.3.3) + (A.3.28), C1-2735: I.A + (G.3.6) + (A.3.28), C1-2736: I.A + (G.5.1) + (A.3.28), C1-2737: I.A + (G.5.2) + (A.3.28), C1-2738: I.A + (G.5.3) + (A.3.28), C1-2739: I.A+ (G.5.4) + (A.3.28), C1-2740: I.A+ (G.5.5) + (A.3.28), C1-2741: I.A + (G.5.6) + (A.3.28), C1-2742: I.A + (G.5.7) + (A.3.28), C1-2743: I.A + (G.5.8) + (A.3.28), C1- 2744: I.A + (G.5.9) + (A.3.28), C1-2745: I.A+ (G.5.10) + (A.3.28), C1-2746: I.A + (G.5.11) + (A.3.28), C1-2747: I.A + (H.1.5) + (A.3.28), C1-2748: I.A + (H.1.7) + (A.3.28), C1-2749: I.A + (H.2.2) + (A.3.28), C1-2750: I.A+ (H.2.3) + (A.3.28), C1-2751: I.A+ (H.2.5) + (A.3.28), C1- 2752: I.A + (H.2.7) + (A.3.28), C1-2753: I.A + (H.2.8) + (A.3.28), C1-2754: I.A + (H.3.2) + (A.3.28), C1-2755: I.A + (H.3.4) + (A.3.28), C1-2756: I.A + (H.3.5) + (A.3.28), C1-2757: I.A + (H.4.9) + (A.3.28), C1-2758: I.A + (H.4.10) + (A.3.28), C1-2759: I.A + (I.2.2) + (A.3.28), C1- 2760: I.A + (I.2.5) + (A.3.28), C1-2761: I.A + (J.1.2) + (A.3.28), C1-2762: I.A + (J.1.5) + (A.3.28), C1-2763: LA + (J.1.8) + (A.3.28), C1-2764: I.A + (J.1.11) + (A.3.28), C1-2765: I.A+ (J.1.12) + (A.3.28), C1-2766: I.A+ (K.1.3) + (A.3.28), C1-2767: I.A+ (K.1.29) + (A.3.28), C1-2768: I.A + (K.1.30) + (A.3.28), C1-2769: I.A+ (K.1.31) + (A.3.28), C1-2770: I.A+ (K.1.32) + (A.3.28), C1- 2771: LA + (K.1.41) + (A.3.28), C1-2772: I.A+ (K.1.42) + (A.3.28), C1-2773: LA + (K.1.44) + (A.3.28), C1-2774: I.A+ (K.1.45) + (A.3.28), C1-2775: I.A+ (K.1.47) + (A.3.28), C1-2776: I.A +
(K.1.49) + (A.3.28), C1-2777: I.A+ (K.1.53) + (A.3.28), C1-2778: I.A+ (K.1.54) + (A.3.28), C1- 2779: I.A + (A.1.4) + (A.3.29), C1-2780: I.A+ (A.1.12) + (A.3.29), C1-2781: I.A+ (A.1.21) + (A.3.29), C1-2782: I.A + (A.121a) + (A.3.29), C1-2783: I.A + (A.1.24) + (A.3.29), C1-2784: I.A + (A.1.26) + (A.3.29), C1-2785: LA + (A.1.27) + (A.3.29), C1-2786: LA + (A.1.30) + (A.3.29), C1- 2787: LA + (A.1.31) + (A.3.29), C1-2788: LA + (A.1.32) + (A.3.29), C1-2789: LA + (A.1.35) + (A.3.29), C1-2790: LA + (A.2.1) + (A.3.29), C1-2791: I.A+ (A.2.3) + (A.3.29), C1-2792: I.A + (A.2.5) + (A.3.29), C1-2793: LA + (A.3.11) + (A.3.29), C1-2794: LA + (A.3.12) + (A.3.29), C1- 2795: I.A + (A.3.15) + (A.3.29), C1-2796: I.A + (A.3.16) + (A.3.29), C1-2797: I.A + (A.3.18) + (A.3.29), C1-2798: I.A + (A.3.19) + (A.3.29), C1-2799: I.A + (A.3.20) + (A.3.29), C1-2800: I.A + (A.3.21) + (A.3.29), C1-2801: I.A+ (A.3.22) + (A.3.29), C1-2802: I.A+ (A.3.23) + (A.3.29), C1- 2803: I.A + (A.3.25) + (A.3.29), C1-2804: I.A + (A.3.26) + (A.3.29), C1-2805: I.A + (A.3.27) + (A.3.29), C1-2806: I.A + (A.3.31) + (A.3.29), C1-2807: I.A + (A.3.32) + (A.3.29), C1-2808: I.A + (A.3.33) + (A.3.29), C1-2809: I.A + (A.3.34) + (A.3.29), C1-2810: I.A + (A.3.35) + (A.3.29), C1- 2811: I.A + (A.3.36) + (A.3.29), C1-2812: I.A+ (A.3.37) + (A.3.29), C1-2813: I.A+ (A.3.38) + (A.3.29), C1-2814: I.A + (A.3.39) + (A.3.29), C1-2815: I.A + (A.4.5) + (A.3.29), C1-2816: I.A + (A.4.11) + (A.3.29), C1-2817: I.A+ (B.1.4) + (A.3.29), C1-2818: I.A+ (B.1.5) + (A.3.29), C1- 2819: I.A+ (B.1.8.) + (A.3.29), C1-2820: I.A+ (B.1.10) + (A.3.29), C1-2821: I.A+ (B.1.11) + (A.3.29), C1-2822: I.A+ (B.1.12) + (A.3.29), C1-2823: I.A+ (B.1.13) + (A.3.29), C1-2824: I.A + (B.1.17) + (A.3.29), C1-2825: I.A+ (B.1.18) + (A.3.29), C1-2826: I.A+ (B.1.21) + (A.3.29), C1- 2827: LA + (B.1.22) + (A.3.29), C1-2828: I.A+ (B.1.23) + (A.3.29), C1-2829: LA + (B.1.25) + (A.3.29), C1-2830: I.A+ (B.1.26) + (A.3.29), C1-2831: I.A+ (B.1.29) + (A.3.29), C1-2832: I.A + (B.1.33) + (A.3.29), C1-2833: I.A+ (B.1.34) + (A.3.29), C1-2834: I.A+ (B.1.37) + (A.3.29), C1- 2835: I.A + (B.1.38) + (A.3.29), C1-2836: I.A + (B.1.43) + (A.3.29), C1-2837: I.A + (B.1.46) + (A.3.29), C1-2838: I.A + (B.2.4) + (A.3.29), C1-2839: I.A + (B.2.5) + (A.3.29), C1-2840: I.A + (B.2.6) + (A.3.29), C1-2841: I.A+ (B.2.8) + (A.3.29), C1-2842: I.A+ (C.1.1) + (A.3.29), C1-2843: I.A+ (C.1.2) + (A.3.29), C1-2844: I.A+ (C.1.4) + (A.3.29), C1-2845: I.A+ (C.1.5) + (A.3.29), C1- 2846: I.A + (C.2.6) + (A.3.29), C1-2847: I.A + (C.2.7) + (A.3.29), C1-2848: I.A + (C.2.8) + (A.3.29), C1-2849: I.A+ (D.1.1) + (A.3.29), C1-2850: LA + (D.1.2) + (A.3.29), C1-2851: I.A + (D.1.5) + (A.3.29), C1-2852: I.A+ (D.2.4) + (A.3.29), C1-2853: I.A+ (D.2.6) + (A.3.29), C1- 2854: LA + (D.2.7) + (A.3.29), C1-2855: I.A+ (E.1.1) + (A.3.29), C1-2856: I.A+ (E.1.3) + (A.3.29), C 1-2857: I.A + (E.2.2) + (A.3.29), C1-2858: I.A + (E.2.3) + (A.3.29), C1-2859: I.A + (F.1.2) + (A.3.29), C1-2860: I.A+ (F.1.4) + (A.3.29), C1-2861: I.A+ (F.1.5) + (A.3.29), C1-2862: I.A + (G.3.1) + (A.3.29), C1-2863: I.A + (G.3.3) + (A.3.29), C1-2864: I.A + (G.3.6) + (A.3.29), C1-2865: I.A + (G.5.1) + (A.3.29), C1-2866: I.A + (G.5.2) + (A.3.29), C1-2867: I.A + (G.5.3) + (A.3.29), C1-2868: I.A + (G.5.4) + (A.3.29), C1-2869: I.A + (G.5.5) + (A.3.29), C1-2870: I.A + (G.5.6) + (A.3.29), C1-2871: I.A+ (G.5.7) + (A.3.29), C1-2872: I.A+ (G.5.8) + (A.3.29), C1- 2873: I.A + (G.5.9) + (A.3.29), C1-2874: I.A+ (G.5.10) + (A.3.29), C1-2875: I.A + (G.5.11) + (A.3.29), C1-2876: I.A + (H.1.5) + (A.3.29), C1-2877: I.A + (H.1.7) + (A.3.29), C1-2878: I.A + (H.2.2) + (A.3.29), C1-2879: I.A + (H.2.3) + (A.3.29), C1-2880: I.A + (H.2.5) + (A.3.29), C1- 2881: I.A + (H.2.7) + (A.3.29), C1-2882: I.A+ (H.2.8) + (A.3.29), C1-2883: I.A+ (H.3.2) + (A.3.29), C1-2884: I.A + (H.3.4) + (A.3.29), C1-2885: I.A + (H.3.5) + (A.3.29), C1-2886: I.A + (H.4.9) + (A.3.29), C1-2887: I.A + (H.4.10) + (A.3.29), C1-2888: I.A + (I.2.2) + (A.3.29), C1-
2889: I.A+ (1.2.5) + (A.3.29), C1-2890: I.A+ (J.1.2) + (A.3.29), C1-2891: I.A+ (J.1.5) + (A.3.29), C1-2892: I.A+ (J.1.8) + (A.3.29), C1-2893: I.A + (J.1.11) + (A.3.29), C1-2894: I.A+ (J.1.12) + (A.3.29), C1-2895: I.A+ (K.1.3) + (A.3.29), C1-2896: I.A+ (K.1.29) + (A.3.29), C1-2897: I.A + (K.1.30) + (A.3.29), C1-2898: I.A+ (K.1.31) + (A.3.29), C1-2899: I.A+ (K.1.32) + (A.3.29), C1- 2900: I.A+ (K.1.41) + (A.3.29), C1-2901: I.A+ (K.1.42) + (A.3.29), C1-2902: I.A+ (K.1.44) + (A.3.29), C1-2903: I.A+ (K.1.45) + (A.3.29), C1-2904: I.A+ (K.1.47) + (A.3.29), C1-2905: I.A + (K.1.49) + (A.3.29), C1-2906: I.A+ (K.1.53) + (A.3.29), C1-2907: I.A+ (K.1.54) + (A.3.29), C1- 2908: I.A + (A.1.4) + (A.3.31), C1-2909: I.A+ (A.1.12) + (A.3.31), C1-2910: I.A+ (A.1.21) + (A.3.31), C1-2911: I.A + (A.121a) + (A.3.31), C1-2912: I.A + (A.1.24) + (A.3.31), C1-2913: I.A + (A.1.26) + (A.3.31), C1-2914: LA + (A.1.27) + (A.3.31), C1-2915: LA + (A.1.30) + (A.3.31), C1- 2916: LA + (A.1.31) + (A.3.31), C1-2917: LA + (A.1.32) + (A.3.31), C1-2918: LA + (A.1.35) + (A.3.31), C1-2919: LA + (A.2.1) + (A.3.31), C1-2920: I.A+ (A.2.3) + (A.3.31), C1-2921: I.A + (A.2.5) + (A.3.31), C1-2922: LA + (A.3.11) + (A.3.31), C1-2923: LA + (A.3.12) + (A.3.31), C1- 2924: I.A + (A.3.15) + (A.3.31), C1-2925: I.A + (A.3.16) + (A.3.31), C1-2926: I.A + (A.3.18) + (A.3.31), C1-2927: I.A + (A.3.19) + (A.3.31), C1-2928: I.A + (A.3.20) + (A.3.31), C1-2929: I.A + (A.3.21) + (A.3.31), C1-2930: I.A+ (A.3.22) + (A.3.31), C1-2931: I.A+ (A.3.23) + (A.3.31), C1- 2932: I.A + (A.3.25) + (A.3.31), C1-2933: I.A + (A.3.26) + (A.3.31), C1-2934: I.A + (A.3.27) + (A.3.31), C1-2935: I.A + (A.3.32) + (A.3.31), C1-2936: I.A + (A.3.33) + (A.3.31), C1-2937: I.A + (A.3.34) + (A.3.31), C1-2938: I.A + (A.3.35) + (A.3.31), C1-2939: I.A + (A.3.36) + (A.3.31), C1- 2940: I.A + (A.3.37) + (A.3.31), C1-2941: I.A+ (A.3.38) + (A.3.31), C1-2942: I.A+ (A.3.39) + (A.3.31), C1-2943: I.A+ (A.4.5) + (A.3.31), C1-2944: I.A+ (A.4.11) + (A.3.31), C1-2945: I.A + (B.1.4) + (A.3.31), C1-2946: I.A+ (B.1.5) + (A.3.31), C1-2947: I.A+ (B.1.8.) + (A.3.31), C1- 2948: I.A+ (B.1.10) + (A.3.31), C1-2949: I.A+ (B.1.11) + (A.3.31), C1-2950: LA + (B.1.12) + (A.3.31), C1-2951 : I.A+ (B.1.13) + (A.3.31), C1-2952: I.A+ (B.1.17) + (A.3.31), C1-2953: I.A + (B.1.18) + (A.3.31), C1-2954: I.A+ (B.1.21) + (A.3.31), C1-2955: I.A+ (B.1.22) + (A.3.31), C1- 2956: LA + (B.1.23) + (A.3.31), C1-2957: I.A+ (B.1.25) + (A.3.31), C1-2958: LA + (B.1.26) + (A.3.31), C1-2959: I.A+ (B.1.29) + (A.3.31), C1-2960: I.A+ (B.1.33) + (A.3.31), C1-2961: I.A + (B.1.34) + (A.3.31), C1-2962: I.A+ (B.1.37) + (A.3.31), C1-2963: I.A+ (B.1.38) + (A.3.31), C1- 2964: LA + (B.1.43) + (A.3.31), C1-2965: I.A+ (B.1.46) + (A.3.31), C1-2966: I.A+ (B.2.4) + (A.3.31), C1-2967: I.A + (B.2.5) + (A.3.31), C1-2968: I.A + (B.2.6) + (A.3.31), C1-2969: I.A + (B.2.8) + (A.3.31), C1-2970: I.A+ (C.1.1) + (A.3.31), C1-2971: I.A+ (C.1.2) + (A.3.31), C1-2972: I.A+ (C.1.4) + (A.3.31), C1-2973: LA + (C.1.5) + (A.3.31), C1-2974: I.A+ (C.2.6) + (A.3.31), C1- 2975: LA + (C.2.7) + (A.3.31), C1-2976: I.A+ (C.2.8) + (A.3.31), C1-2977: I.A+ (D.1.1) + (A.3.31), C1-2978: I.A+ (D.1.2) + (A.3.31), C1-2979: LA + (D.1.5) + (A.3.31), C1-2980: I.A + (D.2.4) + (A.3.31), C1-2981 : I.A+ (D.2.6) + (A.3.31), C1-2982: I.A+ (D.2.7) + (A.3.31), C1- 2983: I.A + (E.1.1) + (A.3.31), C1-2984: I.A+ (E.1.3) + (A.3.31), C1-2985: I.A+ (E.2.2) + (A.3.31), C1-2986: I.A+ (E.2.3) + (A.3.31), C1-2987: I.A+ (F.1.2) + (A.3.31), C1-2988: I.A + (F.1.4) + (A.3.31), C1-2989: I.A+ (F.1.5) + (A.3.31), C1-2990: LA + (G.3.1) + (A.3.31), C1-2991: I.A + (G.3.3) + (A.3.31), C1-2992: I.A + (G.3.6) + (A.3.31), C1-2993: I.A + (G.5.1) + (A.3.31), C1-2994: I.A + (G.5.2) + (A.3.31), C1-2995: I.A + (G.5.3) + (A.3.31), C1-2996: I.A + (G.5.4) + (A.3.31), C1-2997: I.A + (G.5.5) + (A.3.31), C1-2998: I.A + (G.5.6) + (A.3.31), C1-2999: I.A + (G.5.7) + (A.3.31), C1-3000: I.A+ (G.5.8) + (A.3.31), C1-3001: I.A+ (G.5.9) + (A.3.31), C1-
3002: I.A+ (G.5.10) + (A.3.31), C1-3003: I.A+ (G.5.11) + (A.3.31), C1-3004: I.A+ (H.1.5) + (A.3.31), C1-3005: I.A+ (H.1.7) + (A.3.31), C1-3006: I.A+ (H.2.2) + (A.3.31), C1-3007: I.A + (H.2.3) + (A.3.31), C1-3008: I. A + (H.2.5) + (A.3.31), C1-3009: I. A + (H.2.7) + (A.3.31), C1- 3010: I.A+ (H.2.8) + (A.3.31), C1-3011: I.A+ (H.3.2) + (A.3.31), C1-3012: I.A+ (H.3.4) + (A.3.31), C1-3013: I. A + (H.3.5) + (A.3.31), C1-3014: I.A + (H.4.9) + (A.3.31), C1-3015: I.A + (H.4.10) + (A.3.31), C1-3016: I.A + (I.2.2) + (A.3.31), C1-3017: I.A + (I.2.5) + (A.3.31), C1-3018: I.A + (J.1.2) + (A.3.31), C1-3019: I.A + (J.1.5) + (A.3.31), C1-3020: I.A + (J.1.8) + (A.3.31), C1- 3021: I.A + (J.1.11) + (A.3.31), C1-3022: I.A + (J.1.12) + (A.3.31), C1-3023: I.A+ (K.1.3) + (A.3.31), C1-3024: LA + (K.1.29) + (A.3.31), C1-3025: I.A+ (K.1.30) + (A.3.31), C1-3026: I.A + (K.1.31) + (A.3.31), C1-3027: LA + (K.1.32) + (A.3.31), C1-3028: I.A+ (K.1.41) + (A.3.31), C1- 3029: LA + (K.1.42) + (A.3.31), C1-3030: I.A+ (K.1.44) + (A.3.31), C1-3031: I.A+ (K.1.45) + (A.3.31), C1-3032: LA + (K.1.47) + (A.3.31), C1-3033: I.A+ (K.1.49) + (A.3.31), C1-3034: I.A + (K.1.53) + (A.3.31), C1-3035: I.A+ (K.1.54) + (A.3.31), C1-3036: LA + (A.1.4) + (A.3.32), C1- 3037: I.A+ (A.1.12) + (A.3.32), C1-3038: I.A+ (A.1.21) + (A.3.32), C1-3039: I.A + (A.121a) + (A.3.32), C1-3040: LA + (A.1.24) + (A.3.32), C1-3041: LA + (A.1.26) + (A.3.32), C1-3042: I.A + (A.1.27) + (A.3.32), C1-3043: I.A+ (A.1.30) + (A.3.32), C1-3044: LA + (A.1.31) + (A.3.32), C1- 3045: LA + (A.1.32) + (A.3.32), C1-3046: LA + (A.1.35) + (A.3.32), C1-3047: LA + (A.2.1) + (A.3.32), C1-3048: I.A + (A.2.3) + (A.3.32), C1-3049: I.A + (A.2.5) + (A.3.32), C1-3050: I.A + (A.3.11) + (A.3.32), C1-3051: I.A+ (A.3.12) + (A.3.32), C1-3052: LA + (A.3.15) + (A.3.32), C1- 3053: I.A + (A.3.16) + (A.3.32), C1-3054: I.A + (A.3.18) + (A.3.32), C1-3055: I.A + (A.3.19) + (A.3.32), C1-3056: I.A + (A.3.20) + (A.3.32), C1-3057: I.A + (A.3.21) + (A.3.32), C1-3058: I.A + (A.3.22) + (A.3.32), C1-3059: I.A + (A.3.23) + (A.3.32), C1-3060: I.A + (A.3.25) + (A.3.32), C1- 3061: LA + (A.3.26) + (A.3.32), C1-3062: I.A+ (A.3.27) + (A.3.32), C1-3063: I.A+ (A.3.33) + (A.3.32), C1-3064: I.A + (A.3.34) + (A.3.32), C1-3065: I.A + (A.3.35) + (A.3.32), C1-3066: I.A + (A.3.36) + (A.3.32), C1-3067: I.A + (A.3.37) + (A.3.32), C1-3068: I.A + (A.3.38) + (A.3.32), C1- 3069: I.A + (A.3.39) + (A.3.32), C1-3070: I.A+ (A.4.5) + (A.3.32), C1-3071: LA + (A.4.11) + (A.3.32), C1-3072: LA + (B.1.4) + (A.3.32), C1-3073: I.A+ (B.1.5) + (A.3.32), C1-3074: I.A + (B.1.8.) + (A.3.32), C1-3075: I.A+ (B.1.10) + (A.3.32), C1-3076: I.A+ (B.1.11) + (A.3.32), C1- 3077: I.A+ (B.1.12) + (A.3.32), C1-3078: I.A+ (B.1.13) + (A.3.32), C1-3079: I.A+ (B.1.17) + (A.3.32), C1-3080: I.A+ (B.1.18) + (A.3.32), C1-3081: I.A+ (B.1.21) + (A.3.32), C1-3082: I.A + (B.1.22) + (A.3.32), C1-3083: I.A+ (B.1.23) + (A.3.32), C1-3084: LA + (B.1.25) + (A.3.32), C1- 3085: I.A+ (B.1.26) + (A.3.32), C1-3086: I.A+ (B.1.29) + (A.3.32), C1-3087: LA + (B.1.33) + (A.3.32), C1-3088: I.A+ (B.1.34) + (A.3.32), C1-3089: I.A+ (B.1.37) + (A.3.32), C1-3090: I.A + (B.1.38) + (A.3.32), C1-3091: I.A+ (B.1.43) + (A.3.32), C1-3092: LA + (B.1.46) + (A.3.32), C1- 3093: I.A + (B.2.4) + (A.3.32), C1-3094: I.A + (B.2.5) + (A.3.32), C1-3095: I.A + (B.2.6) + (A.3.32), C1-3096: I.A+ (B.2.8) + (A.3.32), C1-3097: LA + (C.1.1) + (A.3.32), C1-3098: I.A + (C.1.2) + (A.3.32), C1-3099: I.A+ (C.1.4) + (A.3.32), C1-3100: I.A+ (C.1.5) + (A.3.32), C1- 3101: LA + (C.2.6) + (A.3.32), C1-3102: I.A+ (C.2.7) + (A.3.32), C1-3103: I.A+ (C.2.8) + (A.3.32), C1-3104: LA + (D.1.1) + (A.3.32), C1-3105: I.A + (D.1.2) + (A.3.32), C1-3106: I.A + (D.1.5) + (A.3.32), C1-3107: I.A+ (D.2.4) + (A.3.32), C1-3108: I.A+ (D.2.6) + (A.3.32), C1- 3109: LA + (D.2.7) + (A.3.32), C1-3110: I.A + (E.1.1) + (A.3.32), C1-3111: I.A+ (E.1.3) + (A.3.32), C1-3112: I.A+ (E.2.2) + (A.3.32), C1-3113: I.A+ (E.2.3) + (A.3.32), C1-3114: I.A +
(F.1.2) + (A.3.32), C1-3115: I.A+ (F.1.4) + (A.3.32), C1-3116: I.A+ (F.1.5) + (A.3.32), C1-3117: I.A+ (G.3.1) + (A.3.32), C1-3118: I.A+ (G.3.3) + (A.3.32), C1-3119: I.A+ (G.3.6) + (A.3.32), C1-3120: I.A+ (G.5.1) + (A.3.32), C1-3121: I.A+ (G.5.2) + (A.3.32), C1-3122: I.A+ (G.5.3) + (A.3.32), C1-3123: I. A + (G.5.4) + (A.3.32), C1-3124: I. A + (G.5.5) + (A.3.32), C1-3125: I.A + (G.5.6) + (A.3.32), C1-3126: I.A + (G.5.7) + (A.3.32), C1-3127: I.A + (G.5.8) + (A.3.32), C1- 3128: I.A + (G.5.9) + (A.3.32), C1-3129: I.A+ (G.5.10) + (A.3.32), C1-3130: I.A + (G.5.11) + (A.3.32), C1-3131 : I.A + (H.1.5) + (A.3.32), C1-3132: I.A + (H.1.7) + (A.3.32), C1-3133: I.A + (H.2.2) + (A.3.32), C1-3134: I.A + (H.2.3) + (A.3.32), C1-3135: I.A + (H.2.5) + (A.3.32), C1- 3136: I.A + (H.2.7) + (A.3.32), C1-3137: I.A + (H.2.8) + (A.3.32), C1-3138: I.A + (H.3.2) + (A.3.32), C1-3139: I.A+ (H.3.4) + (A.3.32), C1-3140: I.A+ (H.3.5) + (A.3.32), C1-3141: I.A + (H.4.9) + (A.3.32), C1-3142: I.A + (H.4.10) + (A.3.32), C1-3143: I.A + (I.2.2) + (A.3.32), C1- 3144: I.A + (I.2.5) + (A.3.32), C1-3145: I.A + (J.1.2) + (A.3.32), C1-3146: I.A + (J.1.5) + (A.3.32), C1-3147: I.A+ (J.1.8) + (A.3.32), C1-3148: I.A+ (J.1.11) + (A.3.32), C1-3149: I.A + (J.1.12) + (A.3.32), C1-3150: I.A+ (K.1.3) + (A.3.32), C1-3151: I.A+ (K.1.29) + (A.3.32), C1-3152: I.A + (K.1.30) + (A.3.32), C1-3153: I.A+ (K.1.31) + (A.3.32), C1-3154: I.A+ (K.1.32) + (A.3.32), C1- 3155: I.A+ (K.1.41) + (A.3.32), C1-3156: I.A + (K.1.42) + (A.3.32), C1-3157: I.A+ (K.1.44) + (A.3.32), C1-3158: LA + (K.1.45) + (A.3.32), C1-3159: LA + (K.1.47) + (A.3.32), C1-3160: I.A + (K.1.49) + (A.3.32), C1-3161: LA + (K.1.53) + (A.3.32), C1-3162: I.A+ (K.1.54) + (A.3.32), C1- 3163: LA + (A.1.4) + (A.3.33), C1-3164: I.A+ (A.1.12) + (A.3.33), C1-3165: LA + (A.1.21) + (A.3.33), C1-3166: I.A + (A.121a) + (A.3.33), C1-3167: I.A+ (A.1.24) + (A.3.33), C1-3168: I.A + (A.1.26) + (A.3.33), C1-3169: I.A+ (A.1.27) + (A.3.33), C1-3170: I.A+ (A.1.30) + (A.3.33), C1- 3171: LA + (A.1.31) + (A.3.33), C1-3172: I.A+ (A.1.32) + (A.3.33), C1-3173: I.A+ (A.1.35) + (A.3.33), C1-3174: I.A + (A.2.1) + (A.3.33), C1-3175: I.A + (A.2.3) + (A.3.33), C1-3176: I.A + (A.2.5) + (A.3.33), C1-3177: I.A+ (A.3.11) + (A.3.33), C1-3178: I.A+ (A.3.12) + (A.3.33), C1- 3179: I.A + (A.3.15) + (A.3.33), C1-3180: I.A+ (A.3.16) + (A.3.33), C1-3181: I.A+ (A.3.18) + (A.3.33), C1-3182: I.A + (A.3.19) + (A.3.33), C1-3183: I.A + (A.3.20) + (A.3.33), C1-3184: I.A + (A.3.21) + (A.3.33), C1-3185: I.A + (A.3.22) + (A.3.33), C1-3186: I.A + (A.3.23) + (A.3.33), C1- 3187: I.A + (A.3.25) + (A.3.33), C1-3188: I.A + (A.3.26) + (A.3.33), C1-3189: I.A + (A.3.27) + (A.3.33), C1-3190: I.A+ (A.3.34) + (A.3.33), C1-3191: I.A+ (A.3.35) + (A.3.33), C1-3192: I.A + (A.3.36) + (A.3.33), C1-3193: I.A + (A.3.37) + (A.3.33), C1-3194: I.A + (A.3.38) + (A.3.33), C1- 3195: I.A + (A.3.39) + (A.3.33), C1-3196: I.A+ (A.4.5) + (A.3.33), C1-3197: I.A+ (A.4.11) + (A.3.33), C1-3198: LA + (B.1.4) + (A.3.33), C1-3199: LA + (B.1.5) + (A.3.33), C1-3200: I.A + (B.1.8.) + (A.3.33), C1-3201 : LA + (B.1.10) + (A.3.33), C1-3202: I.A+ (B.1.11) + (A.3.33), C1- 3203: I.A+ (B.1.12) + (A.3.33), C1-3204: I.A+ (B.1.13) + (A.3.33), C1-3205: LA + (B.1.17) + (A.3.33), C1-3206: LA + (B.1.18) + (A.3.33), C1-3207: I.A+ (B.1.21) + (A.3.33), C1-3208: I.A + (B.1.22) + (A.3.33), C1-3209: LA + (B.1.23) + (A.3.33), C1-3210: LA + (B.1.25) + (A.3.33), C1- 3211: I.A+ (B.1.26) + (A.3.33), C1-3212: I.A+ (B.1.29) + (A.3.33), C1-3213: LA + (B.1.33) + (A.3.33), C1-3214: I.A+ (B.1.34) + (A.3.33), C1-3215: LA + (B.1.37) + (A.3.33), C1-3216: I.A + (B.1.38) + (A.3.33), C1-3217: I.A+ (B.1.43) + (A.3.33), C1-3218: LA + (B.1.46) + (A.3.33), C1- 3219: I.A + (B.2.4) + (A.3.33), C1-3220: I.A + (B.2.5) + (A.3.33), C1-3221: I.A+ (B.2.6) + (A.3.33), C1-3222: I.A+ (B.2.8) + (A.3.33), C1-3223: LA + (C.1.1) + (A.3.33), C1-3224: I.A + (C.1.2) + (A.3.33), C1-3225: LA + (C.1.4) + (A.3.33), C1-3226: LA + (C.1.5) + (A.3.33), C1-
3227: I.A + (C.2.6) + (A.3.33), C1-3228: I.A + (C.2.7) + (A.3.33), C1-3229: I.A + (C.2.8) + (A.3.33), C1-3230: LA + (D.1.1) + (A.3.33), C1-3231: LA + (D.1.2) + (A.3.33), C1-3232: I.A +
(D.1.5) + (A.3.33), C1-3233: I.A + (D.2.4) + (A.3.33), C1-3234: I.A + (D.2.6) + (A.3.33), C1- 3235: LA + (D.2.7) + (A.3.33), C1-3236: I.A+ (E.1.1) + (A.3.33), C1-3237: LA + (E.1.3) + (A.3.33), C1-3238: I.A + (E.2.2) + (A.3.33), C1-3239: I.A + (E.2.3) + (A.3.33), C1-3240: I.A + (F.1.2) + (A.3.33), C1-3241 : LA + (F.1.4) + (A.3.33), C1-3242: LA + (F.1.5) + (A.3.33), C1-3243: I.A + (G.3.1) + (A.3.33), C1-3244: I.A + (G.3.3) + (A.3.33), C1-3245: I.A + (G.3.6) + (A.3.33), C1-3246: I.A + (G.5.1) + (A.3.33), C1-3247: I.A + (G.5.2) + (A.3.33), C1-3248: I.A + (G.5.3) + (A.3.33), C1-3249: I.A+ (G.5.4) + (A.3.33), C1-3250: I.A+ (G.5.5) + (A.3.33), C1-3251: I.A + (G.5.6) + (A.3.33), C1-3252: I.A + (G.5.7) + (A.3.33), C1-3253: I.A + (G.5.8) + (A.3.33), C1- 3254: I.A + (G.5.9) + (A.3.33), C1-3255: I.A+ (G.5.10) + (A.3.33), C1-3256: I.A + (G.5.11) + (A.3.33), C1-3257: I.A + (H.1.5) + (A.3.33), C1-3258: I.A + (H.1.7) + (A.3.33), C1-3259: I.A + (H.2.2) + (A.3.33), C1-3260: I.A+ (H.2.3) + (A.3.33), C1-3261: I.A+ (H.2.5) + (A.3.33), C1- 3262: I.A + (H.2.7) + (A.3.33), C1-3263: I.A + (H.2.8) + (A.3.33), C1-3264: I.A + (H.3.2) + (A.3.33), C1-3265: I.A + (H.3.4) + (A.3.33), C1-3266: I.A + (H.3.5) + (A.3.33), C1-3267: I.A + (H.4.9) + (A.3.33), C1-3268: I.A + (H.4.10) + (A.3.33), C1-3269: I.A + (I.2.2) + (A.3.33), C1- 3270: I.A + (I.2.5) + (A.3.33), C1-3271: I.A + (J.1.2) + (A.3.33), C1-3272: I.A + (J.1.5) + (A.3.33), C1-3273: I.A+ (J.1.8) + (A.3.33), C1-3274: LA + (J.1.11) + (A.3.33), C1-3275: I.A+ (J.1.12) + (A.3.33), C1-3276: I.A+ (K.1.3) + (A.3.33), C1-3277: LA + (K.1.29) + (A.3.33), C1-3278: I.A + (K.1.30) + (A.3.33), C1-3279: I.A+ (K.1.31) + (A.3.33), C1-3280: I.A+ (K.1.32) + (A.3.33), C1- 3281: LA + (K.1.41) + (A.3.33), C1-3282: LA + (K.1.42) + (A.3.33), C1-3283: I.A+ (K.1.44) + (A.3.33), C1-3284: LA + (K.1.45) + (A.3.33), C1-3285: I.A+ (K.1.47) + (A.3.33), C1-3286: I.A + (K.1.49) + (A.3.33), C1-3287: I.A + (K.1.53) + (A.3.33), C1-3288: I.A + (K.1.54) + (A.3.33), C1- 3289: LA + (A.1.4) + (A.3.34), C1-3290: I.A+ (A.1.12) + (A.3.34), C1-3291: I.A+ (A.1.21) + (A.3.34), C1-3292: I.A + (A.121a) + (A.3.34), C1-3293: LA + (A.1.24) + (A.3.34), C1-3294: I.A + (A.1.26) + (A.3.34), C1-3295: LA + (A.1.27) + (A.3.34), C1-3296: I.A+ (A.1.30) + (A.3.34), C1- 3297: LA + (A.1.31) + (A.3.34), C1-3298: LA + (A.1.32) + (A.3.34), C1-3299: I.A+ (A.1.35) + (A.3.34), C1-3300: I.A+ (A.2.1) + (A.3.34), C1-3301: I.A+ (A.2.3) + (A.3.34), C1-3302: I.A + (A.2.5) + (A.3.34), C1-3303: I.A+ (A.3.11) + (A.3.34), C1-3304: LA + (A.3.12) + (A.3.34), C1- 3305: I.A + (A.3.15) + (A.3.34), C1-3306: I.A + (A.3.16) + (A.3.34), C1-3307: I.A + (A.3.18) + (A.3.34), C1-3308: I.A + (A.3.19) + (A.3.34), C1-3309: I.A + (A.3.20) + (A.3.34), C1-3310: I.A + (A.3.21) + (A.3.34), C1-3311: I.A+ (A.3.22) + (A.3.34), C1-3312: I.A+ (A.3.23) + (A.3.34), C1- 3313: I.A + (A.3.25) + (A.3.34), C1-3314: I.A + (A.3.26) + (A.3.34), C1-3315: I.A + (A.3.27) + (A.3.34), C1-3316: I.A + (A.3.35) + (A.3.34), C1-3317: I.A + (A.3.36) + (A.3.34), C1-3318: I.A + (A.3.37) + (A.3.34), C1-3319: I.A + (A.3.38) + (A.3.34), C1-3320: I.A + (A.3.39) + (A.3.34), C1- 3321: I.A + (A.4.5) + (A.3.34), C1-3322: LA + (A.4.11) + (A.3.34), C1-3323: I.A+ (B.1.4) + (A.3.34), C1-3324: LA + (B.1.5) + (A.3.34), C1-3325: I.A+ (B.1.8.) + (A.3.34), C1-3326: I.A +
(B.1.10) + (A.3.34), C1-3327: LA + (B.1.11) + (A.3.34), C1-3328: I.A+ (B.1.12) + (A.3.34), C1- 3329: I.A+ (B.1.13) + (A.3.34), C1-3330: I.A+ (B.1.17) + (A.3.34), C1-3331: I.A+ (B.1.18) + (A.3.34), C1-3332: LA + (B.1.21) + (A.3.34), C1-3333: I.A+ (B.1.22) + (A.3.34), C1-3334: I.A + (B.1.23) + (A.3.34), C1-3335: I.A+ (B.1.25) + (A.3.34), C1-3336: I.A+ (B.1.26) + (A.3.34), C1- 3337: LA + (B.1.29) + (A.3.34), C1-3338: I.A+ (B.1.33) + (A.3.34), C1-3339: I.A+ (B.1.34) +
(A.3.34), C1-3340: I.A+ (B.1.37) + (A.3.34), C1-3341: I.A+ (B.1.38) + (A.3.34), C1-3342: I.A + (B.1.43) + (A.3.34), C1-3343: I.A+ (B.1.46) + (A.3.34), C1-3344: I.A+ (B.2.4) + (A.3.34), C1- 3345: I.A + (B.2.5) + (A.3.34), C1-3346: I.A + (B.2.6) + (A.3.34), C1-3347: I.A + (B.2.8) + (A.3.34), C1-3348: LA + (C.1.1) + (A.3.34), C1-3349: LA + (C.1.2) + (A.3.34), C1-3350: I.A + (C.1.4) + (A.3.34), C1-3351 : LA + (C.1.5) + (A.3.34), C1-3352: I.A+ (C.2.6) + (A.3.34), C1- 3353: LA + (C.2.7) + (A.3.34), C1-3354: I.A+ (C.2.8) + (A.3.34), C1-3355: LA + (D.1.1) + (A.3.34), C1-3356: LA + (D.1.2) + (A.3.34), C1-3357: LA + (D.1.5) + (A.3.34), C1-3358: I.A + (D.2.4) + (A.3.34), C1-3359: I.A + (D.2.6) + (A.3.34), C1-3360: I.A + (D.2.7) + (A.3.34), C1- 3361: I.A + (E.1.1) + (A.3.34), C1-3362: I.A+ (E.1.3) + (A.3.34), C1-3363: I.A+ (E.2.2) + (A.3.34), C1-3364: I.A + (E.2.3) + (A.3.34), C1-3365: I.A + (F.1.2) + (A.3.34), C1-3366: I.A + (F.1.4) + (A.3.34), C1-3367: LA + (F.1.5) + (A.3.34), C1-3368: LA + (G.3.1) + (A.3.34), C1-3369: I.A + (G.3.3) + (A.3.34), C1-3370: I.A+ (G.3.6) + (A.3.34), C1-3371: LA + (G.5.1) + (A.3.34), C1-3372: I.A + (G.5.2) + (A.3.34), C1-3373: I.A + (G.5.3) + (A.3.34), C1-3374: I.A + (G.5.4) + (A.3.34), C1-3375: I.A + (G.5.5) + (A.3.34), C1-3376: I.A + (G.5.6) + (A.3.34), C1-3377: I.A + (G.5.7) + (A.3.34), C1-3378: I.A + (G.5.8) + (A.3.34), C1-3379: I.A + (G.5.9) + (A.3.34), C1- 3380: LA + (G.5.10) + (A.3.34), C1-3381: LA + (G.5.11) + (A.3.34), C1-3382: I.A + (H.1.5) + (A.3.34), C1-3383: I.A + (H.1.7) + (A.3.34), C1-3384: I.A+ (H.2.2) + (A.3.34), C1-3385: I.A + (H.2.3) + (A.3.34), C1-3386: I.A + (H.2.5) + (A.3.34), C1-3387: I.A + (H.2.7) + (A.3.34), C1- 3388: I.A + (H.2.8) + (A.3.34), C1-3389: I.A + (H.3.2) + (A.3.34), C1-3390: I.A + (H.3.4) + (A.3.34), C1-3391 : LA + (H.3.5) + (A.3.34), C1-3392: I.A+ (H.4.9) + (A.3.34), C1-3393: I.A + (H.4.10) + (A.3.34), C1-3394: I.A + (I.2.2) + (A.3.34), C1-3395: I.A + (I.2.5) + (A.3.34), C1-3396: I.A + (J.1.2) + (A.3.34), C1-3397: I.A + (J.1.5) + (A.3.34), C1-3398: I.A + (J.1.8) + (A.3.34), C1- 3399: I.A + (J.1.11) + (A.3.34), C1-3400: I.A + (J.1.12) + (A.3.34), C1-3401: LA + (K.1.3) + (A.3.34), C1-3402: I.A+ (K.1.29) + (A.3.34), C1-3403: LA + (K.1.30) + (A.3.34), C1-3404: I.A + (K.1.31) + (A.3.34), C1-3405: LA + (K.1.32) + (A.3.34), C1-3406: LA + (K.1.41) + (A.3.34), C1- 3407: LA + (K.1.42) + (A.3.34), C1-3408: LA + (K.1.44) + (A.3.34), C1-3409: LA + (K.1.45) + (A.3.34), C1-3410: LA + (K.1.47) + (A.3.34), C1-3411: I.A+ (K.1.49) + (A.3.34), C1-3412: I.A + (K.1.53) + (A.3.34), C1-3413: LA + (K.1.54) + (A.3.34), C1-3414: LA + (A.1.4) + (A.3.35), C1- 3415: I.A+ (A.1.12) + (A.3.35), C1-3416: LA + (A.1.21) + (A.3.35), C1-3417: I.A + (A.121a) + (A.3.35), C1-3418: I.A+ (A.1.24) + (A.3.35), C1-3419: I.A+ (A.1.26) + (A.3.35), C1-3420: I.A + (A.1.27) + (A.3.35), C1-3421: I.A+ (A.1.30) + (A.3.35), C1-3422: I.A+ (A.1.31) + (A.3.35), C1- 3423: I.A + (A.1.32) + (A.3.35), C1-3424: I.A+ (A.1.35) + (A.3.35), C1-3425: LA + (A.2.1) + (A.3.35), C1-3426: I.A + (A.2.3) + (A.3.35), C1-3427: I.A + (A.2.5) + (A.3.35), C1-3428: I.A + (A.3.11) + (A.3.35), C1-3429: I.A+ (A.3.12) + (A.3.35), C1-3430: I.A+ (A.3.15) + (A.3.35), C1- 3431: I.A + (A.3.16) + (A.3.35), C1-3432: I.A+ (A.3.18) + (A.3.35), C1-3433: I.A+ (A.3.19) + (A.3.35), C1-3434: I.A + (A.3.20) + (A.3.35), C1-3435: I.A + (A.3.21) + (A.3.35), C1-3436: I.A + (A.3.22) + (A.3.35), C1-3437: I.A + (A.3.23) + (A.3.35), C1-3438: I.A + (A.3.25) + (A.3.35), C1- 3439: I.A + (A.3.26) + (A.3.35), C1-3440: I.A + (A.3.27) + (A.3.35), C1-3441: I.A + (A.3.36) + (A.3.35), C1-3442: I.A + (A.3.37) + (A.3.35), C1-3443: I.A + (A.3.38) + (A.3.35), C1-3444: I.A + (A.3.39) + (A.3.35), C1-3445: I.A+ (A.4.5) + (A.3.35), C1-3446: LA + (A.4.11) + (A.3.35), C1- 3447: I.A+ (B.1.4) + (A.3.35), C1-3448: LA + (B.1.5) + (A.3.35), C1-3449: LA + (B.1.8.) + (A.3.35), C1-3450: LA + (B.1.10) + (A.3.35), C1-3451: LA + (B.1.11) + (A.3.35), C1-3452: I.A +
(B.1.12) + (A.3.35), C1-3453: I.A+ (B.1.13) + (A.3.35), C1-3454: I.A+ (B.1.17) + (A.3.35), C1- 3455: I.A+ (B.1.18) + (A.3.35), C1-3456: I.A+ (B.1.21) + (A.3.35), C1-3457: I.A+ (B.1.22) + (A.3.35), C1-3458: I.A+ (B.1.23) + (A.3.35), C1-3459: I.A+ (B.1.25) + (A.3.35), C1-3460: I.A + (B.1.26) + (A.3.35), C1-3461: I.A+ (B.1.29) + (A.3.35), C1-3462: I.A+ (B.1.33) + (A.3.35), C1- 3463: I.A+ (B.1.34) + (A.3.35), C1-3464: I.A+ (B.1.37) + (A.3.35), C1-3465: I.A+ (B.1.38) + (A.3.35), C1-3466: I.A+ (B.1.43) + (A.3.35), C1-3467: I.A+ (B.1.46) + (A.3.35), C1-3468: I.A + (B.2.4) + (A.3.35), C1-3469: I. A + (B.2.5) + (A.3.35), C1-3470: I. A + (B.2.6) + (A.3.35), C1-3471: I.A+ (B.2.8) + (A.3.35), C1-3472: I.A+ (C.1.1) + (A.3.35), C1-3473: I.A+ (C.1.2) + (A.3.35), C1- 3474: I.A + (C.1.4) + (A.3.35), C1-3475: I.A + (C.1.5) + (A.3.35), C1-3476: LA + (C.2.6) + (A.3.35), C1-3477: I.A + (C.2.7) + (A.3.35), C1-3478: I.A + (C.2.8) + (A.3.35), C1-3479: I.A + (D.1.1) + (A.3.35), C1-3480: I.A+ (D.1.2) + (A.3.35), C1-3481: I.A+ (D.1.5) + (A.3.35), C1- 3482: I.A + (D.2.4) + (A.3.35), C1-3483: I.A + (D.2.6) + (A.3.35), C1-3484: I.A + (D.2.7) + (A.3.35), C1-3485: I.A+ (E.1.1) + (A.3.35), C1-3486: I.A+ (E.1.3) + (A.3.35), C1-3487: I.A + (E.2.2) + (A.3.35), C1-3488: I.A+ (E.2.3) + (A.3.35), C1-3489: I.A+ (F.1.2) + (A.3.35), C1-3490: I.A+ (F.1.4) + (A.3.35), C1-3491: I.A+ (F.1.5) + (A.3.35), C1-3492: I.A+ (G.3.1) + (A.3.35), C1- 3493: I.A + (G.3.3) + (A.3.35), C1-3494: I.A + (G.3.6) + (A.3.35), C1-3495: I.A + (G.5.1) + (A.3.35), C1-3496: I.A + (G.5.2) + (A.3.35), C1-3497: I.A + (G.5.3) + (A.3.35), C1-3498: I.A + (G.5.4) + (A.3.35), C1-3499: I.A + (G.5.5) + (A.3.35), C1-3500: I.A + (G.5.6) + (A.3.35), C1- 3501: LA + (G.5.7) + (A.3.35), C1-3502: I.A+ (G.5.8) + (A.3.35), C1-3503: I.A+ (G.5.9) + (A.3.35), C1-3504: I.A+ (G.5.10) + (A.3.35), C1-3505: I.A + (G.5.11) + (A.3.35), C1-3506: I.A + (H.1.5) + (A.3.35), C1-3507: I.A + (H.1.7) + (A.3.35), C1-3508: I.A+ (H.2.2) + (A.3.35), C1- 3509: LA + (H.2.3) + (A.3.35), C1-3510: I.A+ (H.2.5) + (A.3.35), C1-3511: I.A+ (H.2.7) + (A.3.35), C1-3512: I.A + (H.2.8) + (A.3.35), C1-3513: I.A + (H.3.2) + (A.3.35), C1-3514: I.A + (H.3.4) + (A.3.35), C1-3515: I.A + (H.3.5) + (A.3.35), C1-3516: I.A + (H.4.9) + (A.3.35), C1- 3517: I.A + (H.4.10) + (A.3.35), C1-3518: I.A + (I.2.2) + (A.3.35), C1-3519: I.A + (I.2.5) + (A.3.35), C1-3520: I.A + (J.1.2) + (A.3.35), C1-3521: I.A + (J.1.5) + (A.3.35), C1-3522: I.A + (J.1.8) + (A.3.35), C1-3523: I.A + (J.1.11) + (A.3.35), C1-3524: I.A + (J.1.12) + (A.3.35), C1- 3525: I.A+ (K.1.3) + (A.3.35), C1-3526: I.A+ (K.1.29) + (A.3.35), C1-3527: I.A+ (K.1.30) + (A.3.35), C1-3528: I.A+ (K.1.31) + (A.3.35), C1-3529: I.A+ (K.1.32) + (A.3.35), C1-3530: I.A + (K.1.41) + (A.3.35), C1-3531 : I.A+ (K.1.42) + (A.3.35), C1-3532: I.A+ (K.1.44) + (A.3.35), C1- 3533: I.A+ (K.1.45) + (A.3.35), C1-3534: I.A+ (K.1.47) + (A.3.35), C1-3535: I.A+ (K.1.49) + (A.3.35), C1-3536: I.A+ (K.1.53) + (A.3.35), C1-3537: LA + (K.1.54) + (A.3.35), C1-3538: I.A + (A.1.4) + (A.3.36), C1-3539: I.A+ (A.1.12) + (A.3.36), C1-3540: I.A+ (A.1.21) + (A.3.36), C1- 3541: LA + (A.121a) + (A.3.36), C1-3542: LA + (A.1.24) + (A.3.36), C1-3543: LA + (A.1.26) + (A.3.36), C 1-3544: LA + (A.1.27) + (A.3.36), C1-3545: I.A+ (A.1.30) + (A.3.36), C1-3546: I.A + (A.1.31) + (A.3.36), C1-3547: I.A+ (A.1.32) + (A.3.36), C1-3548: I.A+ (A.1.35) + (A.3.36), C1- 3549: LA + (A.2.1) + (A.3.36), C1-3550: I.A+ (A.2.3) + (A.3.36), C1-3551: I.A+ (A.2.5) + (A.3.36), C1-3552: I.A+ (A.3.11) + (A.3.36), C1-3553: I.A+ (A.3.12) + (A.3.36), C1-3554: I.A + (A.3.15) + (A.3.36), C1-3555: I.A + (A.3.16) + (A.3.36), C1-3556: I.A + (A.3.18) + (A.3.36), C1- 3557: I.A + (A.3.19) + (A.3.36), C1-3558: I.A + (A.3.20) + (A.3.36), C1-3559: I.A + (A.3.21) + (A.3.36), C1-3560: I.A+ (A.3.22) + (A.3.36), C1-3561: I.A+ (A.3.23) + (A.3.36), C1-3562: I.A + (A.3.25) + (A.3.36), C1-3563: I.A + (A.3.26) + (A.3.36), C1-3564: I.A + (A.3.27) + (A.3.36), C1-
3565: I.A + (A.3.37) + (A.3.36), C1-3566: I.A + (A.3.38) + (A.3.36), C1-3567: A + (A.3.39) + (A.3.36), C1-3568: LA + (A.4.5) + (A.3.36), C1-3569: LA + (A.4.11) + (A.3.36), C1-3570: I.A + (B.1.4) + (A.3.36), C1-3571 : LA + (B.1.5) + (A.3.36), C1-3572: LA + (B.1.8.) + (A.3.36), C1- 3573: I.A+ (B.1.10) + (A.3.36), C1-3574: LA + (B.1.11) + (A.3.36), C1-3575: LA + (B.1.12) + (A.3.36), C1-3576: LA + (B.1.13) + (A.3.36), C1-3577: LA + (B.1.17) + (A.3.36), C1-3578: I.A + (B.1.18) + (A.3.36), C1-3579: LA + (B.1.21) + (A.3.36), C1-3580: LA + (B.1.22) + (A.3.36), C1- 3581: LA + (B.1.23) + (A.3.36), C1-3582: LA + (B.1.25) + (A.3.36), C1-3583: LA + (B.1.26) + (A.3.36), C1-3584: LA + (B.1.29) + (A.3.36), C1-3585: LA + (B.1.33) + (A.3.36), C1-3586: I.A + (B.1.34) + (A.3.36), C1-3587: LA + (B.1.37) + (A.3.36), C1-3588: LA + (B.1.38) + (A.3.36), C1- 3589: LA + (B.1.43) + (A.3.36), C1-3590: LA + (B.1.46) + (A.3.36), C1-3591: I.A+ (B.2.4) + (A.3.36), C1-3592: I.A + (B.2.5) + (A.3.36), C1-3593: I.A + (B.2.6) + (A.3.36), C1-3594: I.A + (B.2.8) + (A.3.36), C1-3595: LA + (C.1.1) + (A.3.36), C1-3596: I.A+ (C.1.2) + (A.3.36), C1-3597: I.A+ (C.1.4) + (A.3.36), C1-3598: LA + (C.1.5) + (A.3.36), C1-3599: I.A+ (C.2.6) + (A.3.36), C1- 3600: I.A + (C.2.7) + (A.3.36), C1-3601: I.A+ (C.2.8) + (A.3.36), C1-3602: I.A+ (D.1.1) + (A.3.36), C1-3603: I.A+ (D.1.2) + (A.3.36), C1-3604: LA + (D.1.5) + (A.3.36), C1-3605: I.A + (D.2.4) + (A.3.36), C1-3606: I.A + (D.2.6) + (A.3.36), C1-3607: I.A + (D.2.7) + (A.3.36), C1- 3608: I.A + (E.1.1) + (A.3.36), C1-3609: I.A+ (E.1.3) + (A.3.36), C1-3610: I.A+ (E.2.2) + (A.3.36), C1-3611: I.A+ (E.2.3) + (A.3.36), C1-3612: I.A+ (F.1.2) + (A.3.36), C1-3613: I.A + (F.1.4) + (A.3.36), C1-3614: I.A+ (F.1.5) + (A.3.36), C1-3615: I.A+ (G.3.1) + (A.3.36), C1-3616: I.A + (G.3.3) + (A.3.36), C1-3617: I.A + (G.3.6) + (A.3.36), C1-3618: I.A + (G.5.1) + (A.3.36), C1-3619: I.A+ (G.5.2) + (A.3.36), C1-3620: I.A+ (G.5.3) + (A.3.36), C1-3621: I.A+ (G.5.4) + (A.3.36), C1-3622: I.A + (G.5.5) + (A.3.36), C1-3623: I.A + (G.5.6) + (A.3.36), C1-3624: I.A + (G.5.7) + (A.3.36), C1-3625: I.A + (G.5.8) + (A.3.36), C1-3626: I.A + (G.5.9) + (A.3.36), C1- 3627: LA + (G.5.10) + (A.3.36), C1-3628: I.A + (G.5.11) + (A.3.36), C1-3629: I.A + (H.1.5) + (A.3.36), C1-3630: I.A + (H.1.7) + (A.3.36), C1-3631: I.A+ (H.2.2) + (A.3.36), C1-3632: I.A + (H.2.3) + (A.3.36), C1-3633: I.A + (H.2.5) + (A.3.36), C1-3634: I.A + (H.2.7) + (A.3.36), C1- 3635: I.A + (H.2.8) + (A.3.36), C1-3636: I.A + (H.3.2) + (A.3.36), C1-3637: I.A + (H.3.4) + (A.3.36), C1-3638: I.A + (H.3.5) + (A.3.36), C1-3639: I.A + (H.4.9) + (A.3.36), C1-3640: I.A + (H.4.10) + (A.3.36), C1-3641: I.A+ (I.2.2) + (A.3.36), C1-3642: I.A+ (I.2.5) + (A.3.36), C1-3643: I.A + (J.1.2) + (A.3.36), C1-3644: I.A + (J.1.5) + (A.3.36), C1-3645: I.A + (J.1.8) + (A.3.36), C1- 3646: I.A + (J.1.11) + (A.3.36), C1-3647: I.A + (J.1.12) + (A.3.36), C1-3648: I.A+ (K.1.3) + (A.3.36), C1-3649: I.A+ (K.1.29) + (A.3.36), C1-3650: I.A+ (K.1.30) + (A.3.36), C1-3651: I.A + (K.1.31) + (A.3.36), C1-3652: I.A+ (K.1.32) + (A.3.36), C1-3653: I.A+ (K.1.41) + (A.3.36), C1- 3654: LA + (K.1.42) + (A.3.36), C1-3655: I.A+ (K.1.44) + (A.3.36), C1-3656: LA + (K.1.45) + (A.3.36), C1-3657: I.A+ (K.1.47) + (A.3.36), C1-3658: I.A+ (K.1.49) + (A.3.36), C1-3659: I.A + (K.1.53) + (A.3.36), C1-3660: I.A+ (K.1.54) + (A.3.36), C1-3661: LA + (A.1.4) + (A.3.37), C1- 3662: I.A+ (A.1.12) + (A.3.37), C1-3663: I.A+ (A.1.21) + (A.3.37), C1-3664: I.A + (A.121a) + (A.3.37), C1-3665: LA + (A.1.24) + (A.3.37), C1-3666: LA + (A.1.26) + (A.3.37), C1-3667: I.A + (A.1.27) + (A.3.37), C1-3668: I.A+ (A.1.30) + (A.3.37), C1-3669: I.A+ (A.1.31) + (A.3.37), C1- 3670: LA + (A.1.32) + (A.3.37), C1-3671: LA + (A.1.35) + (A.3.37), C1-3672: I.A+ (A.2.1) + (A.3.37), C1-3673: I.A + (A.2.3) + (A.3.37), C1-3674: I.A + (A.2.5) + (A.3.37), C1-3675: I.A + (A.3.11) + (A.3.37), C1-3676: I.A+ (A.3.12) + (A.3.37), C1-3677: I.A+ (A.3.15) + (A.3.37), C1-
3678: I.A + (A.3.16) + (A.3.37), C1-3679: I.A + (A.3.18) + (A.3.37), C1-3680: A + (A.3.19) + (A.3.37), C1-3681 : LA + (A.3.20) + (A.3.37), C1-3682: LA + (A.3.21) + (A.3.37), C1-3683: I.A + (A.3.22) + (A.3.37), C1-3684: I.A + (A.3.23) + (A.3.37), C1-3685: I.A + (A.3.25) + (A.3.37), C1- 3686: I.A + (A.3.26) + (A.3.37), C1-3687: I.A + (A.3.27) + (A.3.37), C1-3688: I.A + (A.3.38) + (A.3.37), C1-3689: I.A+ (A.3.39) + (A.3.37), C1-3690: I.A+ (A.4.5) + (A.3.37), C1-3691: I.A + (A.4.11) + (A.3.37), C1-3692: I.A+ (B.1.4) + (A.3.37), C1-3693: I.A+ (B.1.5) + (A.3.37), C1- 3694: I.A+ (B.1.8.) + (A.3.37), C1-3695: I.A+ (B.1.10) + (A.3.37), C1-3696: I.A+ (B.1.11) + (A.3.37), C1-3697: I.A+ (B.1.12) + (A.3.37), C1-3698: I.A+ (B.1.13) + (A.3.37), C1-3699: I.A + (B.1.17) + (A.3.37), C1-3700: I.A+ (B.1.18) + (A.3.37), C1-3701: I.A+ (B.1.21) + (A.3.37), C1- 3702: I.A+ (B.1.22) + (A.3.37), C1-3703: I.A+ (B.1.23) + (A.3.37), C1-3704: I.A+ (B.1.25) + (A.3.37), C1-3705: I.A+ (B.1.26) + (A.3.37), C1-3706: I.A+ (B.1.29) + (A.3.37), C1-3707: I.A + (B.1.33) + (A.3.37), C1-3708: I.A+ (B.1.34) + (A.3.37), C1-3709: I.A+ (B.1.37) + (A.3.37), C1- 3710: LA + (B.1.38) + (A.3.37), C1-3711: I.A+ (B.1.43) + (A.3.37), C1-3712: I.A+ (B.1.46) + (A.3.37), C1-3713: I.A + (B.2.4) + (A.3.37), C1-3714: I.A + (B.2.5) + (A.3.37), C1-3715: I.A + (B.2.6) + (A.3.37), C1-3716: I.A+ (B.2.8) + (A.3.37), C1-3717: I.A+ (C.1.1) + (A.3.37), C1-3718: I.A+ (C.1.2) + (A.3.37), C1-3719: LA + (C.1.4) + (A.3.37), C1-3720: I.A+ (C.1.5) + (A.3.37), C1- 3721: LA + (C.2.6) + (A.3.37), C1-3722: I.A+ (C.2.7) + (A.3.37), C1-3723: I.A+ (C.2.8) + (A.3.37), C1-3724: I.A+ (D.1.1) + (A.3.37), C1-3725: LA + (D.1.2) + (A.3.37), C1-3726: I.A + (D.1.5) + (A.3.37), C1-3727: I.A+ (D.2.4) + (A.3.37), C1-3728: I.A+ (D.2.6) + (A.3.37), C1- 3729: LA + (D.2.7) + (A.3.37), C1-3730: I.A+ (E.1.1) + (A.3.37), C1-3731: I.A + (E.1.3) + (A.3.37), C1-3732: I.A + (E.2.2) + (A.3.37), C1-3733: I.A + (E.2.3) + (A.3.37), C1-3734: I.A + (F.1.2) + (A.3.37), C1-3735: I.A+ (F.1.4) + (A.3.37), C1-3736: I.A+ (F.1.5) + (A.3.37), C1-3737: I.A + (G.3.1) + (A.3.37), C1-3738: I.A + (G.3.3) + (A.3.37), C1-3739: I.A + (G.3.6) + (A.3.37), C1-3740: LA + (G.5.1) + (A.3.37), C1-3741: I.A+ (G.5.2) + (A.3.37), C1-3742: I.A+ (G.5.3) + (A.3.37), C1-3743: I.A + (G.5.4) + (A.3.37), C1-3744: I.A + (G.5.5) + (A.3.37), C1-3745: I.A + (G.5.6) + (A.3.37), C1-3746: I.A + (G.5.7) + (A.3.37), C1-3747: I.A + (G.5.8) + (A.3.37), C1- 3748: I.A + (G.5.9) + (A.3.37), C1-3749: I.A+ (G.5.10) + (A.3.37), C1-3750: I.A + (G.5.11) + (A.3.37), C1-3751 : I.A + (H.1.5) + (A.3.37), C1-3752: I.A + (H.1.7) + (A.3.37), C1-3753: I.A + (H.2.2) + (A.3.37), C1-3754: I.A + (H.2.3) + (A.3.37), C1-3755: I.A + (H.2.5) + (A.3.37), C1- 3756: I.A + (H.2.7) + (A.3.37), C1-3757: I.A + (H.2.8) + (A.3.37), C1-3758: I.A + (H.3.2) + (A.3.37), C1-3759: I.A+ (H.3.4) + (A.3.37), C1-3760: LA + (H.3.5) + (A.3.37), C1-3761: I.A + (H.4.9) + (A.3.37), C1-3762: I.A + (H.4.10) + (A.3.37), C1-3763: I.A + (I.2.2) + (A.3.37), C1- 3764: I.A + (I.2.5) + (A.3.37), C1-3765: I.A + (J.1.2) + (A.3.37), C1-3766: I.A + (J.1.5) + (A.3.37), C1-3767: I.A+ (J.1.8) + (A.3.37), C1-3768: LA + (J.1.11) + (A.3.37), C1-3769: I.A+ (J.1.12) + (A.3.37), C1-3770: I.A+ (K.1.3) + (A.3.37), C1-3771: I.A+ (K.1.29) + (A.3.37), C1-3772: I.A + (K.1.30) + (A.3.37), C1-3773: I.A+ (K.1.31) + (A.3.37), C1-3774: I.A+ (K.1.32) + (A.3.37), C1- 3775: LA + (K.1.41) + (A.3.37), C1-3776: I.A+ (K.1.42) + (A.3.37), C1-3777: I.A+ (K.1.44) + (A.3.37), C1-3778: I.A+ (K.1.45) + (A.3.37), C1-3779: I.A+ (K.1.47) + (A.3.37), C1-3780: I.A + (K.1.49) + (A.3.37), C1-3781: I.A+ (K.1.53) + (A.3.37), C1-3782: I.A+ (K.1.54) + (A.3.37), C1- 3783: LA + (A.1.4) + (A.3.38), C1-3784: I.A+ (A.1.12) + (A.3.38), C1-3785: I.A+ (A.1.21) + (A.3.38), C1-3786: I.A + (A.121a) + (A.3.38), C1-3787: LA + (A.1.24) + (A.3.38), C1-3788: I.A + (A.1.26) + (A.3.38), C1-3789: LA + (A.1.27) + (A.3.38), C1-3790: I.A+ (A.1.30) + (A.3.38), C1-
3791: I.A+ (A.1.31) + (A.3.38), C1-3792: I.A+ (A.1.32) + (A.3.38), C1-3793: I.A+ (A.1.35) + (A.3.38), C1-3794: I.A+ (A.2.1) + (A.3.38), C1-3795: I.A+ (A.2.3) + (A.3.38), C1-3796: I.A + (A.2.5) + (A.3.38), C1-3797: I.A+ (A.3.11) + (A.3.38), C1-3798: I.A+ (A.3.12) + (A.3.38), C1- 3799: I.A+ (A.3.15) + (A.3.38), C1-3800: I.A+ (A.3.16) + (A.3.38), C1-3801: I.A+ (A.3.18) + (A.3.38), C1-3802: I. A + (A.3.19) + (A.3.38), C1-3803: I.A + (A.3.20) + (A.3.38), C1-3804: I.A + (A.3.21) + (A.3.38), C1-3805: I.A + (A.3.22) + (A.3.38), C1-3806: I.A + (A.3.23) + (A.3.38), C1- 3807: I.A + (A.3.25) + (A.3.38), C1-3808: I.A + (A.3.26) + (A.3.38), C1-3809: I.A + (A.3.27) + (A.3.38), C1-3810: LA + (A.3.39) + (A.3.38), C1-3811: LA + (A.4.5) + (A.3.38), C1-3812: I.A + (A.4.11) + (A.3.38), C1-3813: LA + (B.1.4) + (A.3.38), C1-3814: I.A+ (B.1.5) + (A.3.38), C1- 3815: I.A+ (B.1.8.) + (A.3.38), C1-3816: LA + (B.1.10) + (A.3.38), C1-3817: I.A+ (B.1.11) + (A.3.38), C1-3818: LA + (B.1.12) + (A.3.38), C1-3819: LA + (B.1.13) + (A.3.38), C1-3820: I.A + (B.1.17) + (A.3.38), C1-3821: I.A+ (B.1.18) + (A.3.38), C1-3822: I.A+ (B.1.21) + (A.3.38), C1- 3823: LA + (B.1.22) + (A.3.38), C1-3824: I.A+ (B.1.23) + (A.3.38), C1-3825: LA + (B.1.25) + (A.3.38), C1-3826: LA + (B.1.26) + (A.3.38), C1-3827: I.A+ (B.1.29) + (A.3.38), C1-3828: I.A + (B.1.33) + (A.3.38), C1-3829: I.A + (B.1.34) + (A.3.38), C1-3830: I.A + (B.1.37) + (A.3.38), C1- 3831: I.A + (B.1.38) + (A.3.38), C1-3832: I.A + (B.1.43) + (A.3.38), C1-3833: I.A + (B.1.46) + (A.3.38), C1-3834: I.A + (B.2.4) + (A.3.38), C1-3835: I.A + (B.2.5) + (A.3.38), C1-3836: I.A + (B.2.6) + (A.3.38), C1-3837: I.A+ (B.2.8) + (A.3.38), C1-3838: LA + (C.1.1) + (A.3.38), C1-3839: I.A+ (C.1.2) + (A.3.38), C1-3840: LA + (C.1.4) + (A.3.38), C1-3841: LA + (C.1.5) + (A.3.38), C1- 3842: I.A + (C.2.6) + (A.3.38), C1-3843: I.A + (C.2.7) + (A.3.38), C1-3844: I.A + (C.2.8) + (A.3.38), C1-3845: LA + (D.1.1) + (A.3.38), C1-3846: LA + (D.1.2) + (A.3.38), C1-3847: I.A + (D.1.5) + (A.3.38), C1-3848: I.A+ (D.2.4) + (A.3.38), C1-3849: I.A+ (D.2.6) + (A.3.38), C1- 3850: I.A + (D.2.7) + (A.3.38), C1-3851: LA + (E.1.1) + (A.3.38), C1-3852: I.A+ (E.1.3) + (A.3.38), C1-3853: I.A + (E.2.2) + (A.3.38), C1-3854: I.A + (E.2.3) + (A.3.38), C1-3855: I.A + (F.1.2) + (A.3.38), C1-3856: LA + (F.1.4) + (A.3.38), C1-3857: LA + (F.1.5) + (A.3.38), C1-3858: I.A + (G.3.1) + (A.3.38), C1-3859: I.A + (G.3.3) + (A.3.38), C1-3860: I.A + (G.3.6) + (A.3.38), C1-3861 : LA + (G.5.1) + (A.3.38), C1-3862: I.A+ (G.5.2) + (A.3.38), C1-3863: I.A+ (G.5.3) + (A.3.38), C1-3864: I.A + (G.5.4) + (A.3.38), C1-3865: I.A + (G.5.5) + (A.3.38), C1-3866: I.A + (G.5.6) + (A.3.38), C1-3867: I.A + (G.5.7) + (A.3.38), C1-3868: I.A + (G.5.8) + (A.3.38), C1- 3869: I.A + (G.5.9) + (A.3.38), C1-3870: LA + (G.5.10) + (A.3.38), C1-3871: LA + (G.5.11) + (A.3.38), C1-3872: I.A + (H.1.5) + (A.3.38), C1-3873: I.A + (H.1.7) + (A.3.38), C1-3874: I.A + (H.2.2) + (A.3.38), C1-3875: I.A + (H.2.3) + (A.3.38), C1-3876: I.A + (H.2.5) + (A.3.38), C1- 3877: I.A + (H.2.7) + (A.3.38), C1-3878: I.A + (H.2.8) + (A.3.38), C1-3879: I.A + (H.3.2) + (A.3.38), C1-3880: LA + (H.3.4) + (A.3.38), C1-3881: LA + (H.3.5) + (A.3.38), C1-3882: I.A + (H.4.9) + (A.3.38), C1-3883: I.A + (H.4.10) + (A.3.38), C1-3884: I.A + (I.2.2) + (A.3.38), C1- 3885: I.A + (I.2.5) + (A.3.38), C1-3886: I.A + (J.1.2) + (A.3.38), C1-3887: I.A + (J.1.5) + (A.3.38), C1-3888: LA + (J.1.8) + (A.3.38), C1-3889: LA + (J.1.11) + (A.3.38), C1-3890: LA + (J.1.12) + (A.3.38), C1-3891 : LA + (K.1.3) + (A.3.38), C1-3892: I.A+ (K.1.29) + (A.3.38), C1-3893: I.A + (K.1.30) + (A.3.38), C1-3894: I.A+ (K.1.31) + (A.3.38), C1-3895: LA + (K.1.32) + (A.3.38), C1- 3896: LA + (K.1.41) + (A.3.38), C1-3897: LA + (K.1.42) + (A.3.38), C1-3898: LA + (K.1.44) + (A.3.38), C1-3899: LA + (K.1.45) + (A.3.38), C1-3900: LA + (K.1.47) + (A.3.38), C1-3901: I.A + (K.1.49) + (A.3.38), C1-3902: I.A+ (K.1.53) + (A.3.38), C1-3903: LA + (K.1.54) + (A.3.38), C1-
3904: I.A + (A.1.4) + (A.3.39), C1-3905: I.A+ (A.1.12) + (A.3.39), C1-3906: I.A+ (A.1.21) + (A.3.39), C1-3907: I.A + (A.121a) + (A.3.39), C1-3908: I.A + (A.1.24) + (A.3.39), C1-3909: I.A + (A.1.26) + (A.3.39), C1-3910: LA + (A.1.27) + (A.3.39), C1-3911: LA + (A.1.30) + (A.3.39), C1- 3912: LA + (A.1.31) + (A.3.39), C1-3913: LA + (A.1.32) + (A.3.39), C1-3914: LA + (A.1.35) + (A.3.39), C1-3915: I.A + (A.2.1) + (A.3.39), C1-3916: I.A + (A.2.3) + (A.3.39), C1-3917: I.A + (A.2.5) + (A.3.39), C1-3918: I.A+ (A.3.11) + (A.3.39), C1-3919: I.A+ (A.3.12) + (A.3.39), C1- 3920: LA + (A.3.15) + (A.3.39), C1-3921: I.A+ (A.3.16) + (A.3.39), C1-3922: I.A+ (A.3.18) + (A.3.39), C1-3923: I.A + (A.3.19) + (A.3.39), C1-3924: I.A + (A.3.20) + (A.3.39), C1-3925: I.A + (A.3.21) + (A.3.39), C1-3926: I.A + (A.3.22) + (A.3.39), C1-3927: I.A + (A.3.23) + (A.3.39), C1- 3928: I.A + (A.3.25) + (A.3.39), C1-3929: I.A + (A.3.26) + (A.3.39), C1-3930: I.A + (A.3.27) + (A.3.39), C1-3931 : I.A+ (A.4.5) + (A.3.39), C1-3932: I.A+ (A.4.11) + (A.3.39), C1-3933: I.A + (B.1.4) + (A.3.39), C1-3934: I.A+ (B.1.5) + (A.3.39), C1-3935: I.A+ (B.1.8.) + (A.3.39), C1- 3936: I.A+ (B.1.10) + (A.3.39), C1-3937: I.A+ (B.1.11) + (A.3.39), C1-3938: I.A+ (B.1.12) + (A.3.39), C1-3939: I.A+ (B.1.13) + (A.3.39), C1-3940: I.A+ (B.1.17) + (A.3.39), C1-3941: I.A + (B.1.18) + (A.3.39), C1-3942: I.A+ (B.1.21) + (A.3.39), C1-3943: I.A+ (B.1.22) + (A.3.39), C1- 3944: LA + (B.1.23) + (A.3.39), C1-3945: I.A+ (B.1.25) + (A.3.39), C1-3946: I.A+ (B.1.26) + (A.3.39), C1-3947: LA + (B.1.29) + (A.3.39), C1-3948: I.A+ (B.1.33) + (A.3.39), C1-3949: I.A + (B.1.34) + (A.3.39), C1-3950: I.A + (B.1.37) + (A.3.39), C1-3951: I.A + (B.1.38) + (A.3.39), C1- 3952: I.A + (B.1.43) + (A.3.39), C1-3953: I.A + (B.1.46) + (A.3.39), C1-3954: I.A+ (B.2.4) + (A.3.39), C1-3955: I.A + (B.2.5) + (A.3.39), C1-3956: I.A + (B.2.6) + (A.3.39), C1-3957: I.A + (B.2.8) + (A.3.39), C1-3958: LA + (C.1.1) + (A.3.39), C1-3959: I.A+ (C.1.2) + (A.3.39), C1-3960: I.A+ (C.1.4) + (A.3.39), C1-3961: I.A+ (C.1.5) + (A.3.39), C1-3962: I.A+ (C.2.6) + (A.3.39), C1- 3963: LA + (C.2.7) + (A.3.39), C1-3964: I.A+ (C.2.8) + (A.3.39), C1-3965: I.A+ (D.1.1) + (A.3.39), C1-3966: I.A+ (D.1.2) + (A.3.39), C1-3967: I.A+ (D.1.5) + (A.3.39), C1-3968: I.A + (D.2.4) + (A.3.39), C1-3969: I.A + (D.2.6) + (A.3.39), C1-3970: I.A + (D.2.7) + (A.3.39), C1- 3971: I.A + (E.1.1) + (A.3.39), C1-3972: I.A+ (E.1.3) + (A.3.39), C1-3973: I.A+ (E.2.2) + (A.3.39), C1-3974: I.A + (E.2.3) + (A.3.39), C1-3975: I.A + (F.1.2) + (A.3.39), C1-3976: I.A + (F.1.4) + (A.3.39), C1-3977: I.A+ (F.1.5) + (A.3.39), C1-3978: I.A+ (G.3.1) + (A.3.39), C1-3979: LA + (G.3.3) + (A.3.39), C1-3980: I.A+ (G.3.6) + (A.3.39), C1-3981: I.A+ (G.5.1) + (A.3.39), C1-3982: I.A + (G.5.2) + (A.3.39), C1-3983: I.A + (G.5.3) + (A.3.39), C1-3984: I.A + (G.5.4) + (A.3.39), C1-3985: I.A + (G.5.5) + (A.3.39), C1-3986: I.A + (G.5.6) + (A.3.39), C1-3987: I.A + (G.5.7) + (A.3.39), C1-3988: I.A + (G.5.8) + (A.3.39), C1-3989: I.A + (G.5.9) + (A.3.39), C1- 3990: LA + (G.5.10) + (A.3.39), C1-3991: I.A+ (G.5.11) + (A.3.39), C1-3992: I.A + (H.1.5) + (A.3.39), C1-3993: I.A + (H.1.7) + (A.3.39), C1-3994: LA + (H.2.2) + (A.3.39), C1-3995: I.A + (H.2.3) + (A.3.39), C1-3996: I.A + (H.2.5) + (A.3.39), C1-3997: I.A + (H.2.7) + (A.3.39), C1- 3998: I.A + (H.2.8) + (A.3.39), C1-3999: I.A + (H.3.2) + (A.3.39), C1-4000: I.A + (H.3.4) + (A.3.39), C1-4001 : I.A+ (H.3.5) + (A.3.39), C1-4002: LA + (H.4.9) + (A.3.39), C1-4003: I.A + (H.4.10) + (A.3.39), C1-4004: I.A + (I.2.2) + (A.3.39), C1-4005: I.A + (I.2.5) + (A.3.39), C1-4006: I.A + (J.1.2) + (A.3.39), C1-4007: I.A + (J.1.5) + (A.3.39), C1-4008: I.A + (J.1.8) + (A.3.39), C1- 4009: LA + (J.1.11) + (A.3.39), C1-4010: I.A + (J.1.12) + (A.3.39), C1-4011: I.A+ (K.1.3) + (A.3.39), C1-4012: I.A+ (K.1.29) + (A.3.39), C1-4013: I.A+ (K.1.30) + (A.3.39), C1-4014: I.A + (K.1.31) + (A.3.39), C1-4015: I.A+ (K.1.32) + (A.3.39), C1-4016: I.A+ (K.1.41) + (A.3.39), C1-
4017: I.A+ (K.1.42) + (A.3.39), C1-4018: I.A+ (K.1.44) + (A.3.39), C1-4019: I.A+ (K.1.45) + (A.3.39), C1-4020: I.A+ (K.1.47) + (A.3.39), C1-4021: I.A+ (K.1.49) + (A.3.39), C1-4022: I.A + (K.1.53) + (A.3.39), C1-4023: I.A+ (K.1.54) + (A.3.39), C1-4024: I.A+ (A.1.4) + (B.1.4), C1- 4025: I.A+ (A.1.12) + (B.1.4), C1-4026: I.A+ (A.1.21) + (B.1.4), C1-4027: I. A + (A.121a) + (B.1.4), C1-4028: I.A+ (A.1.24) + (B.1.4), C1-4029: I.A+ (A.1.26) + (B.1.4), C1-4030: I.A +
(A.1.27) + (B.1.4), C1-4031 : I.A+ (A.1.30) + (B.1.4), C1-4032: I.A+ (A.1.31) + (B.1.4), C1-4033: I .A + (A.1.32) + (B.1.4), C1-4034: I.A+ (A.1.35) + (B.1.4), C1-4035: I.A+ (A.2.1) + (B.1.4), C1- 4036: I.A+ (A.2.3) + (B.1.4), C1-4037: I.A+ (A.2.5) + (B.1.4), C1-4038: I.A+ (A.3.11) + (B.1.4), C1-4039: I.A+ (A.3.12) + (B.1.4), C1-4040: I.A+ (A.3.15) + (B.1.4), C1-4041: I.A+ (A.3.16) + (B.1.4), C1-4042: I.A+ (A.3.18) + (B.1.4), C1-4043: I.A+ (A.3.19) + (B.1.4), C1-4044: I.A + (A.3.20) + (B.1.4), C1-4045: I.A+ (A.3.21) + (B.1.4), C1-4046: I.A+ (A.3.22) + (B.1.4), C1-4047: I.A+ (A.3.23) + (B.1.4), C1-4048: I.A+ (A.3.25) + (B.1.4), C1-4049: I.A+ (A.3.26) + (B.1.4), C1- 4050: I.A+ (A.3.27) + (B.1.4), C1-4051: I.A+ (A.4.5) + (B.1.4), C1-4052: I.A+ (A.4.11) +
(B.1.4), C1-4053: I.A+ (B.1.5) + (B.1.4), C1-4054: I.A+ (B.1.8.) + (B.1.4), C1-4055: I.A +
(B.1.10) + (B.1.4), C1-4056: I.A+ (B.1.11) + (B.1.4), C1-4057: I.A+ (B.1.12) + (B.1.4), C1-4058: I.A+ (B.1.13) + (B.1.4), C1-4059: I.A+ (B.1.17) + (B.1.4), C1-4060: I.A+ (B.1.18) + (B.1.4), C1- 4061: I.A+ (B.1.21) + (B.1.4), C1-4062: I.A+ (B.1.22) + (B.1.4), C1-4063: I.A+ (B.1.23) + (B.1.4), C1-4064: I.A+ (B.1.25) + (B.1.4), C1-4065: I.A+ (B.1.26) + (B.1.4), C1-4066: I.A + (B.1.29) + (B.1.4), C1-4067: I.A+ (B.1.33) + (B.1.4), C1-4068: I.A+ (B.1.34) + (B.1.4), C1-4069: I.A+ (B.1.37) + (B.1.4), C1-4070: I.A+ (B.1.38) + (B.1.4), C1-4071: I.A+ (B.1.43) + (B.1.4), C1- 4072: I.A+ (B.1.46) + (B.1.4), C1-4073: I.A+ (B.2.4) + (B.1.4), C1-4074: I.A+ (B.2.5) + (B.1.4), C1-4075: I.A+ (B.2.6) + (B.1.4), C1-4076: I.A+ (B.2.8) + (B.1.4), C1-4077: I.A+ (C.1.1) + (B.1.4), C1-4078: I.A+ (C.1.2) + (B.1.4), C1-4079: I.A+ (C.1.4) + (B.1.4), C1-4080: I.A+ (C.1.5) + (B.1.4), C1-4081 : I.A+ (C.2.6) + (B.1.4), C1-4082: I.A+ (C.2.7) + (B.1.4), C1-4083: I.A + (C.2.8) + (B.1.4), C1-4084: I.A+ (D.1.1) + (B.1.4), C1-4085: I.A+ (D.1.2) + (B.1.4), C1-4086: I.A + (D.1.5) + (B.1.4), C1-4087: I.A+ (D.2.4) + (B.1.4), C1-4088: I.A+ (D.2.6) + (B.1.4), C1-4089: I.A + (D.2.7) + (B.1.4), C1-4090: I.A+ (E.1.1) + (B.1.4), C1-4091: I.A+ (E.1.3) + (B.1.4), C1- 4092: I.A + (E.2.2) + (B.1.4), C1-4093: I.A+ (E.2.3) + (B.1.4), C1-4094: I.A+ (F.1.2) + (B.1.4), C1-4095: I.A+ (F.1.4) + (B.1.4), C1-4096: I.A+ (F.1.5) + (B.1.4), C1-4097: I.A+ (G.3.1) + (B.1.4), C1-4098: I.A+ (G.3.3) + (B.1.4), C1-4099: I.A+ (G.3.6) + (B.1.4), C1-4100: I.A +
(G.5.1) + (B.1.4), C1-4101 : I.A+ (G.5.2) + (B.1.4), C1-4102: I.A+ (G.5.3) + (B.1.4), C1-4103:
I.A + (G.5.4) + (B.1.4), C1-4104: I.A+ (G.5.5) + (B.1.4), C1-4105: I.A+ (G.5.6) + (B.1.4), C1- 4106: I.A + (G.5.7) + (B.1.4), C1-4107: I.A+ (G.5.8) + (B.1.4), C1-4108: I.A+ (G.5.9) + (B.1.4), C1-4109: I.A + (G.5.10) + (B.1.4), C1-4110: I.A + (G.5.11) + (B.1.4), C1-4111: I.A+ (H.1.5) + (B.1.4), C1-4112: I.A + (H.1.7) + (B.1.4), C1-4113: I.A+ (H.2.2) + (B.1.4), C1-4114: I.A+ (H.2.3) + (B.1.4), C1-4115: I.A+ (H.2.5) + (B.1.4), C1-4116: I.A+ (H.2.7) + (B.1.4), C1-4117: I.A + (H.2.8) + (B.1.4), C1-4118: I.A+ (H.3.2) + (B.1.4), C1-4119: I.A+ (H.3.4) + (B.1.4), C1-4120: I.A + (H.3.5) + (B.1.4), C1-4121 : I.A+ (H.4.9) + (B.1.4), C1-4122: I.A+ (H.4.10) + (B.1.4), C1-4123: I.A + (1.2.2) + (B.1.4), C1-4124: I.A+ (I.2.5) + (B.1.4), C1-4125: I.A + (J.1.2) + (B.1.4), C1-4126: I.A + (J.1.5) + (B.1.4), C1-4127: I.A + (J.1.8) + (B.1.4), C1-4128: I.A + (J.1.11) + (B.1.4), C1- 4129: I.A + (J.1.12) + (B.1.4), C1-4130: I.A+ (K.1.3) + (B.1.4), C1-4131: I.A+ (K.1.29) + (B.1.4), C1-4132: I.A+ (K.1.30) + (B.1.4), C1-4133: I.A+ (K.1.31) + (B.1.4), C1-4134: I.A+ (K.1.32) +
(B.1.4), C1-4135: I.A+ (K.1.41) + (B.1.4), C1-4136: I.A+ (K.1.42) + (B.1.4), C1-4137: I.A + (K.1.44) + (B.1.4), C1-4138: I.A + (K.1.45) + (B.1.4), C1-4139: I.A+ (K.1.47) + (B.1.4), C1-4140: I.A+ (K.1.49) + (B.1.4), C1-4141: I.A+ (K.1.53) + (B.1.4), C1-4142: I.A+ (K.1.54) + (B.1.4), C1- 4143: I.A + (A.1.4) + (B.1.5), C1-4144: LA + (A.1.12) + (B.1.5), C1-4145: LA + (A.1.21) +
(B.1.5), C1-4146: I.A + (A.121a) + (B.1.5), C1-4147: LA + (A.1.24) + (B.1.5), C1-4148: I.A + (A.1.26) + (B.1.5), C1-4149: LA + (A.1.27) + (B.1.5), C1-4150: LA + (A.1.30) + (B.1.5), C1-4151: LA + (A.1.31) + (B.1.5), C1-4152: LA + (A.1.32) + (B.1.5), C1-4153: LA + (A.1.35) + (B.1.5), C1- 4154: LA + (A.2.1) + (B.1.5), C1-4155: I.A+ (A.2.3) + (B.1.5), C1-4156: I.A+ (A.2.5) + (B.1.5), C1-4157: LA + (A.3.11) + (B.1.5), C1-4158: I.A+ (A.3.12) + (B.1.5), C1-4159: I.A+ (A.3.15) + (B.1.5), C1-4160: I.A + (A.3.16) + (B.1.5), C1-4161: I.A+ (A.3.18) + (B.1.5), C1-4162: I.A + (A.3.19) + (B.1.5), C1-4163: I.A+ (A.3.20) + (B.1.5), C1-4164: I.A+ (A.3.21) + (B.1.5), C1-4165: I.A + (A.3.22) + (B.1.5), C1-4166: I.A+ (A.3.23) + (B.1.5), C1-4167: I.A+ (A.3.25) + (B.1.5), C1- 4168: I.A + (A.3.26) + (B.1.5), C1-4169: I.A+ (A.3.27) + (B.1.5), C1-4170: I.A+ (A.4.5) +
(B.1.5), C1-4171 : I.A+ (A.4.11) + (B.1.5), C1-4172: I.A+ (B.1.8.) + (B.1.5), C1-4173: I.A +
(B.1.10) + (B.1.5), C1-4174: I.A+ (B.1.11) + (B.1.5), C1-4175: I.A+ (B.1.12) + (B.1.5), C1-4176: I.A+ (B.1.13) + (B.1.5), C1-4177: I.A+ (B.1.17) + (B.1.5), C1-4178: I.A+ (B.1.18) + (B.1.5), C1- 4179: LA + (B.1.21) + (B.1.5), C1-4180: I.A+ (B.1.22) + (B.1.5), C1-4181: I.A+ (B.1.23) + (B.1.5), C1-4182: I.A + (B.1.25) + (B.1.5), C1-4183: I.A+ (B.1.26) + (B.1.5), C1-4184: I.A +
(B.1.29) + (B.1.5), C1-4185: I.A+ (B.1.33) + (B.1.5), C1-4186: I.A+ (B.1.34) + (B.1.5), C1-4187: LA + (B.1.37) + (B.1.5), C1-4188: LA + (B.1.38) + (B.1.5), C1-4189: LA + (B.1.43) + (B.1.5), C1- 4190: LA + (B.1.46) + (B.1.5), C1-4191: I.A+ (B.2.4) + (B.1.5), C1-4192: I.A+ (B.2.5) + (B.1.5), C1-4193: I.A+ (B.2.6) + (B.1.5), C1-4194: I.A+ (B.2.8) + (B.1.5), C1-4195: I.A+ (C.1.1) + (B.1.5), C1-4196: I.A+ (C.1.2) + (B.1.5), C1-4197: I.A+ (C.1.4) + (B.1.5), C1-4198: I.A+ (C.1.5) + (B.1.5), C1-4199: I.A+ (C.2.6) + (B.1.5), C1-4200: I.A+ (C.2.7) + (B.1.5), C1-4201: I.A + (C.2.8) + (B.1.5), C1-4202: I.A+ (D.1.1) + (B.1.5), C1-4203: LA + (D.1.2) + (B.1.5), C1-4204: I.A + (D.1.5) + (B.1.5), C1-4205: I.A+ (D.2.4) + (B.1.5), C1-4206: I.A+ (D.2.6) + (B.1.5), C1-4207: LA + (D.2.7) + (B.1.5), C1-4208: I.A+ (E.1.1) + (B.1.5), C1-4209: I.A+ (E.1.3) + (B.1.5), C1- 4210: LA + (E.2.2) + (B.1.5), C1-4211: I.A+ (E.2.3) + (B.1.5), C1-4212: I.A+ (F.1.2) + (B.1.5), C1-4213: LA + (F.1.4) + (B.1.5), C1-4214: I.A+ (F.1.5) + (B.1.5), C1-4215: I.A+ (G.3.1) + (B.1.5), C1-4216: I.A+ (G.3.3) + (B.1.5), C1-4217: I.A+ (G.3.6) + (B.1.5), C1-4218: I.A +
(G.5.1) + (B.1.5), C1-4219: I.A+ (G.5.2) + (B.1.5), C1-4220: I.A+ (G.5.3) + (B.1.5), C1-4221:
LA + (G.5.4) + (B.1.5), C1-4222: I.A+ (G.5.5) + (B.1.5), C1-4223: I.A+ (G.5.6) + (B.1.5), C1- 4224: LA + (G.5.7) + (B.1.5), C1-4225: I.A+ (G.5.8) + (B.1.5), C1-4226: I.A+ (G.5.9) + (B.1.5),
C 1-4227: LA + (G.5.10) + (B.1.5), C1-4228: I.A+ (G.5.11) + (B.1.5), C1-4229: LA + (H.1.5) + (B.1.5), C1-4230: I.A + (H.1.7) + (B.1.5), C1-4231: I.A+ (H.2.2) + (B.1.5), C1-4232: I.A+ (H.2.3) + (B.1.5), C1-4233: I.A+ (H.2.5) + (B.1.5), C1-4234: I.A+ (H.2.7) + (B.1.5), C1-4235: I.A + (H.2.8) + (B.1.5), C1-4236: I.A+ (H.3.2) + (B.1.5), C1-4237: I.A+ (H.3.4) + (B.1.5), C1-4238: I.A + (H.3.5) + (B.1.5), C1-4239: I.A+ (H.4.9) + (B.1.5), C1-4240: I.A+ (H.4.10) + (B.1.5), C1-4241: I.A + (1.2.2) + (B.1.5), C 1-4242: I.A+ (I.2.5) + (B.1.5), C1-4243: I.A + (J.1.2) + (B.1.5), C1-4244: I.A + (J.1.5) + (B.1.5), C1-4245: I.A + (J.1.8) + (B.1.5), C1-4246: I.A + (J.1.11) + (B.1.5), C1- 4247: I.A + (J.1.12) + (B.1.5), C1-4248: I.A+ (K.1.3) + (B.1.5), C1-4249: LA + (K.1.29) + (B.1.5), C1-4250: LA + (K.1.30) + (B.1.5), C1-4251: I.A+ (K.1.31) + (B.1.5), C1-4252: I.A+ (K.1.32) +
(B.1.5), C1-4253: I.A+ (K.1.41) + (B.1.5), C1-4254: I.A+ (K.1.42) + (B.1.5), C1-4255: I.A + (K.1.44) + (B.1.5), C1-4256: I.A+ (K.1.45) + (B.1.5), C1-4257: I.A+ (K.1.47) + (B.1.5), C1-4258: I.A+ (K.1.49) + (B.1.5), C1-4259: I.A+ (K.1.53) + (B.1.5), C1-4260: I.A+ (K.1.54) + (B.1.5), C1- 4261: I.A + (A.1.4) + (B.1.8), C1-4262: I.A+ (A.1.12) + (B.1.8), C1-4263: I.A+ (A.1.21) +
(B.1.8), C 1-4264: I.A + (A.121a) + (B.1.8), C1-4265: I.A + (A.1.24) + (B.1.8), C1-4266: I.A + (A.1.26) + (B.1.8), C 1-4267: LA + (A.1.27) + (B.1.8), C1-4268: LA + (A.1.30) + (B.1.8), C1-4269: LA + (A.1.31) + (B.1.8), C1-4270: LA + (A.1.32) + (B.1.8), C1-4271: LA + (A.1.35) + (B.1.8), C1- 4272: LA + (A.2.1) + (B.1.8), C1-4273: I.A+ (A.2.3) + (B.1.8), C1-4274: I.A+ (A.2.5) + (B.1.8), C1-4275: LA + (A.3.11) + (B.1.8), C1-4276: LA + (A.3.12) + (B.1.8), C1-4277: LA + (A.3.15) + (B.1.8), C1-4278: LA + (A.3.16) + (B.1.8), C1-4279: LA + (A.3.18) + (B.1.8), C1-4280: I.A + (A.3.19) + (B.1.8), C1-4281 : I.A+ (A.3.20) + (B.1.8), C1-4282: LA + (A.3.21) + (B.1.8), C1-4283: LA + (A.3.22) + (B.1.8), C1-4284: I.A+ (A.3.23) + (B.1.8), C1-4285: I.A+ (A.3.25) + (B.1.8), C1- 4286: LA + (A.3.26) + (B.1.8), C1-4287: I.A+ (A.3.27) + (B.1.8), C1-4288: I.A+ (A.4.5) +
(B.1.8), C1-4289: LA + (A.4.11) + (B.1.8), C1-4290: LA + (B.1.10) + (B.1.8), C1-4291: I.A + (B.1.11) + (B.1.8), C1-4292: LA + (B.1.12) + (B.1.8), C1-4293: LA + (B.1.13) + (B.1.8), C1-4294: I.A+ (B.1.17) + (B.1.8), C1-4295: LA + (B.1.18) + (B.1.8), C1-4296: LA + (B.1.21) + (B.1.8), C1- 4297: LA + (B.1.22) + (B.1.8), C1-4298: LA + (B.1.23) + (B.1.8), C1-4299: LA + (B.1.25) + (B.1.8), C1-4300: LA + (B.1.26) + (B.1.8), C1-4301: LA + (B.1.29) + (B.1.8), C1-4302: I.A + (B.1.33) + (B.1.8), C1-4303: LA + (B.1.34) + (B.1.8), C1-4304: LA + (B.1.37) + (B.1.8), C1-4305: LA + (B.1.38) + (B.1.8), C1-4306: LA + (B.1.43) + (B.1.8), C1-4307: LA + (B.1.46) + (B.1.8), C1- 4308: I.A + (B.2.4) + (B.1.8), C1-4309: I.A+ (B.2.5) + (B.1.8), C1-4310: I.A+ (B.2.6) + (B.1.8), C1-4311: I.A + (B.2.8) + (B.1.8), C1-4312: I.A + (C.1.1) + (B.1.8), C1-4313: I.A+ (C.1.2) + (B.1.8), C1-4314: I.A+ (C.1.4) + (B.1.8), C1-4315: I.A+ (C.1.5) + (B.1.8), C1-4316: I.A+ (C.2.6) + (B.1.8), C1-4317: I.A+ (C.2.7) + (B.1.8), C1-4318: I.A+ (C.2.8) + (B.1.8), C1-4319: I.A + (D.1.1) + (B.1.8), C1-4320: I.A+ (D.1.2) + (B.1.8), C1-4321: I.A+ (D.1.5) + (B.1.8), C1-4322: I.A + (D.2.4) + (B.1.8), C1-4323: I.A+ (D.2.6) + (B.1.8), C1-4324: I.A+ (D.2.7) + (B.1.8), C1-4325: I.A + (E.1.1) + (B.1.8), C1-4326: I.A + (E.1.3) + (B.1.8), C1-4327: I.A+ (E.2.2) + (B.1.8), C1- 4328: LA + (E.2.3) + (B.1.8), C1-4329: I.A+ (F.1.2) + (B.1.8), C1-4330: I.A+ (F.1.4) + (B.1.8), C1-4331 : LA + (F.1.5) + (B.1.8), C1-4332: I.A+ (G.3.1) + (B.1.8), C1-4333: I.A+ (G.3.3) + (B.1.8), C1-4334: I.A+ (G.3.6) + (B.1.8), C1-4335: I.A+ (G.5.1) + (B.1.8), C1-4336: I.A +
(G.5.2) + (B.1.8), C1-4337: I.A+ (G.5.3) + (B.1.8), C1-4338: I.A+ (G.5.4) + (B.1.8), C1-4339:
I.A + (G.5.5) + (B.1.8), C1-4340: I.A+ (G.5.6) + (B.1.8), C1-4341: I.A+ (G.5.7) + (B.1.8), C1- 4342: I.A + (G.5.8) + (B.1.8), C1-4343: I.A+ (G.5.9) + (B.1.8), C1-4344: I.A+ (G.5.10) + (B.1.8), C1-4345: LA + (G.5.11) + (B.1.8), C1-4346: I.A + (H.1.5) + (B.1.8), C1-4347: I.A + (H.1.7) + (B.1.8), C1-4348: I.A+ (H.2.2) + (B.1.8), C1-4349: I.A+ (H.2.3) + (B.1.8), C1-4350: I.A+ (H.2.5) + (B.1.8), C1-4351 : I.A+ (H.2.7) + (B.1.8), C1-4352: I.A+ (H.2.8) + (B.1.8), C1-4353: I.A + (H.3.2) + (B.1.8), C1-4354: I.A+ (H.3.4) + (B.1.8), C1-4355: LA + (H.3.5) + (B.1.8), C1-4356: I.A + (H.4.9) + (B.1.8), C1-4357: I.A+ (H.4.10) + (B.1.8), C1-4358: I.A+ (I.2.2) + (B.1.8), C1-4359: I.A + (1.2.5) + (B.1.8), C1-4360: I.A + (J.1.2) + (B.1.8), C1-4361: I.A + (J.1.5) + (B.1.8), C1-4362: I.A + (J.1.8) + (B.1.8), C1-4363: I.A + (J.1.11) + (B.1.8), C1-4364: I.A + (J.1.12) + (B.1.8), C1- 4365: I.A+ (K.1.3) + (B.1.8), C1-4366: I.A+ (K.1.29) + (B.1.8), C1-4367: I.A+ (K.1.30) +
(B.1.8), C1-4368: I.A+ (K.1.31) + (B.1.8), C1-4369: I.A+ (K.1.32) + (B.1.8), C1-4370: I.A +
(K.1.41) + (B.1.8), C1-4371 : I.A+ (K.1.42) + (B.1.8), C1-4372: I.A+ (K.1.44) + (B.1.8), C1-4373: I.A+ (K.1.45) + (B.1.8), C1-4374: I.A+ (K.1.47) + (B.1.8), C1-4375: I.A + (K.1.49) + (B.1.8), C1- 4376: I.A+ (K.1.53) + (B.1.8), C1-4377: I.A+ (K.1.54) + (B.1.8), C1-4378: I.A+ (A.1.4) +
(B.1.17), C1-4379: I.A+ (A.1.12) + (B.1.17), C1-4380: I.A+ (A.1.21) + (B.1.17), C1-4381: I.A + (A.121a) + (B.1.17), C1-4382: I.A + (A.1.24) + (B.1.17), C1-4383: I.A + (A.1.26) + (B.1.17), C1- 4384: LA + (A.1.27) + (B.1.17), C1-4385: LA + (A.1.30) + (B.1.17), C1-4386: LA + (A.1.31) + (B.1.17), C1-4387: LA + (A.1.32) + (B.1.17), C1-4388: LA + (A.1.35) + (B.1.17), C1-4389: I.A + (A.2.1) + (B.1.17), C1-4390: I.A+ (A.2.3) + (B.1.17), C1-4391: I.A+ (A.2.5) + (B.1.17), C1-4392: I.A+ (A.3.11) + (B.1.17), C1-4393: LA + (A.3.12) + (B.1.17), C1-4394: LA + (A.3.15) + (B.1.17), C1-4395: LA + (A.3.16) + (B.1.17), C1-4396: LA + (A.3.18) + (B.1.17), C1-4397: LA + (A.3.19) + (B.1.17), C1-4398: I.A+ (A.3.20) + (B.1.17), C1-4399: LA + (A.3.21) + (B.1.17), C1-4400: I.A + (A.3.22) + (B.1.17), C1-4401: I.A+ (A.3.23) + (B.1.17), C1-4402: I.A+ (A.3.25) + (B.1.17), C1- 4403: LA + (A.3.26) + (B.1.17), C1-4404: I.A+ (A.3.27) + (B.1.17), C1-4405: I.A+ (A.4.5) + (B.1.17), C1-4406: LA + (A.4.11) + (B.1.17), C1-4407: LA + (B.1.10) + (B.1.17), C1-4408: I.A + (B.1.11) + (B.1.17), C1-4409: LA + (B.1.12) + (B.1.17), C1-4410: LA + (B.1.13) + (B.1.17), C1- 4411: I.A+ (B.1.18) + (B.1.17), C1-4412: LA + (B.1.21) + (B.1.17), C1-4413: LA + (B.1.22) + (B.1.17), C1-4414: LA + (B.1.23) + (B.1.17), C1-4415: LA + (B.1.25) + (B.1.17), C1-4416: I.A + (B.1.26) + (B.1.17), C1-4417: LA + (B.1.29) + (B.1.17), C1-4418: LA + (B.1.33) + (B.1.17), C1- 4419: LA + (B.1.34) + (B.1.17), C1-4420: LA + (B.1.37) + (B.1.17), C1-4421: LA + (B.1.38) + (B.1.17), C1-4422: LA + (B.1.43) + (B.1.17), C1-4423: LA + (B.1.46) + (B.1.17), C1-4424: I.A + (B.2.4) + (B.1.17), C1-4425: I.A+ (B.2.5) + (B.1.17), C1-4426: I.A+ (B.2.6) + (B.1.17), C1-4427: I.A + (B.2.8) + (B.1.17), C1-4428: LA + (C.1.1) + (B.1.17), C1-4429: LA + (C.1.2) + (B.1.17), C1- 4430: LA + (C.1.4) + (B.1.17), C1-4431: LA + (C.1.5) + (B.1.17), C1-4432: I.A+ (C.2.6) + (B.1.17), C1-4433: I.A+ (C.2.7) + (B.1.17), C1-4434: I.A+ (C.2.8) + (B.1.17), C1-4435: I.A + (D.1.1) + (B.1.17), C1-4436: LA + (D.1.2) + (B.1.17), C1-4437: LA + (D.1.5) + (B.1.17), C1- 4438: I.A + (D.2.4) + (B.1.17), C1-4439: I.A+ (D.2.6) + (B.1.17), C1-4440: I.A+ (D.2.7) + (B.1.17), C1-4441 : I.A+ (E.1.1) + (B.1.17), C1-4442: I.A+ (E.1.3) + (B.1.17), C1-4443: I.A + (E.2.2) + (B.1.17), C1-4444: I.A+ (E.2.3) + (B.1.17), C1-4445: I.A+ (F.1.2) + (B.1.17), C1-4446: I.A+ (F.1.4) + (B.1.17), C1-4447: I.A+ (F.1.5) + (B.1.17), C1-4448: I.A+ (G.3.1) + (B.1.17), C1- 4449: I.A + (G.3.3) + (B.1.17), C1-4450: I.A+ (G.3.6) + (B.1.17), C1-4451: I.A+ (G.5.1) + (B.1.17), C1-4452: I.A+ (G.5.2) + (B.1.17), C1-4453: I.A+ (G.5.3) + (B.1.17), C1-4454: I.A + (G.5.4) + (B.1.17), C1-4455: I.A+ (G.5.5) + (B.1.17), C1-4456: I.A+ (G.5.6) + (B.1.17), C1- 4457: I.A + (G.5.7) + (B.1.17), C1-4458: I.A+ (G.5.8) + (B.1.17), C1-4459: I.A+ (G.5.9) + (B.1.17), C1-4460: I.A+ (G.5.10) + (B.1.17), C1-4461: I.A+ (G.5.11) + (B.1.17), C1-4462: I.A + (H.1.5) + (B.1.17), C1-4463: I.A + (H.1.7) + (B.1.17), C1-4464: I.A+ (H.2.2) + (B.1.17), C1- 4465: LA + (H.2.3) + (B.1.17), C1-4466: I.A+ (H.2.5) + (B.1.17), C1-4467: I.A+ (H.2.7) + (B.1.17), C1-4468: I.A+ (H.2.8) + (B.1.17), C1-4469: I.A+ (H.3.2) + (B.1.17), C1-4470: I.A + (H.3.4) + (B.1.17), C1-4471 : I.A+ (H.3.5) + (B.1.17), C1-4472: I.A+ (H.4.9) + (B.1.17), C1- 4473: LA + (H.4.10) + (B.1.17), C1-4474: I.A+ (I.2.2) + (B.1.17), C1-4475: I.A+ (I.2.5) + (B.1.17), C1-4476: I.A + (J.1.2) + (B.1.17), C1-4477: I.A + (J.1.5) + (B.1.17), C1-4478: I.A + (J.1.8) + (B.1.17), C1-4479: I.A + (J.1.11) + (B.1.17), C1-4480: I.A + (J.1.12) + (B.1.17), C1- 4481: I.A+ (K.1.3) + (B.1.17), C1-4482: I.A+ (K.1.29) + (B.1.17), C1-4483: I.A + (K.1.30) +
(B.1.17), C1-4484: I.A+ (K.1.31) + (B.1.17), C1-4485: I.A+ (K.1.32) + (B.1.17), C1-4486: I.A + (K.1.41) + (B.1.17), C 1-4487: I.A+ (K.1.42) + (B.1.17), C1-4488: I.A+ (K.1.44) + (B.1.17), C1- 4489: I.A+ (K.1.45) + (B.1.17), C1-4490: I.A+ (K.1.47) + (B.1.17), C1-4491: I.A+ (K.1.49) + (B.1.17), C1-4492: I.A+ (K.1.53) + (B.1.17), C1-4493: I.A+ (K.1.54) + (B.1.17), C1-4494: I.A + (A.1.4) + (B.1.22), C1-4495: I.A+ (A.1.12) + (B.1.22), C1-4496: I.A+ (A.1.21) + (B.1.22), C1- 4497: I .A + (A.1.21 a) + (B.1.22), C1-4498: I.A+ (A.1.24) + (B.1.22), C1-4499: I.A+ (A.1.26) + (B.1.22), C1-4500: I.A+ (A.1.27) + (B.1.22), C1-4501: I.A+ (A.1.30) + (B.1.22), C1-4502: I.A + (A.1.31) + (B.1.22), C1-4503: I.A+ (A.1.32) + (B.1.22), C1-4504: I.A+ (A.1.35) + (B.1.22), C1- 4505: I.A+ (A.2.1) + (B.1.22), C1-4506: I.A+ (A.2.3) + (B.1.22), C1-4507: I.A+ (A.2.5) + (B.1.22), C1-4508: I.A+ (A.3.11) + (B.1.22), C1-4509: I.A+ (A.3.12) + (B.1.22), C1-4510: I.A + (A.3.15) + (B.1.22), C1-4511: I.A+ (A.3.16) + (B.1.22), C1-4512: I.A+ (A.3.18) + (B.1.22), C1- 4513: I.A+ (A.3.19) + (B.1.22), C1-4514: I.A+ (A.3.20) + (B.1.22), C1-4515: I.A+ (A.3.21) + (B.1.22), C1-4516: I.A+ (A.3.22) + (B.1.22), C1-4517: I.A+ (A.3.23) + (B.1.22), C1-4518: I.A + (A.3.25) + (B.1.22), C1-4519: I.A+ (A.3.26) + (B.1.22), C1-4520: I.A+ (A.3.27) + (B.1.22), C1- 4521: I.A+ (A.4.5) + (B.1.22), C1-4522: I.A+ (A.4.11) + (B.1.22), C1-4523: I.A+ (B.1.10) + (B.1.22), C1-4524: I.A+ (B.1.11) + (B.1.22), C1-4525: I.A+ (B.1.12) + (B.1.22), C1-4526: I.A + (B.1.13) + (B.1.22), C 1-4527: I.A+ (B.1.18) + (B.1.22), C1-4528: I.A+ (B.1.21) + (B.1.22), C1- 4529: I.A+ (B.1.23) + (B.1.22), C1-4530: I.A+ (B.1.25) + (B.1.22), C1-4531: I.A+ (B.1.26) + (B.1.22), C1-4532: I.A+ (B.1.29) + (B.1.22), C1-4533: I.A + (B.1.33) + (B.1.22), C1-4534: I.A + (B.1.34) + (B.1.22), C1-4535: I.A+ (B.1.37) + (B.1.22), C1-4536: I.A+ (B.1.38) + (B.1.22), C1- 4537: I.A+ (B.1.43) + (B.1.22), C1-4538: I.A+ (B.1.46) + (B.1.22), C1-4539: I.A+ (B.2.4) + (B.1.22), C 1-4540: I.A + (B.2.5) + (B.1.22), C1-4541: I.A+ (B.2.6) + (B.1.22), C1-4542: I.A + (B.2.8) + (B.1.22), C1-4543: I.A+ (C.1.1) + (B.1.22), C1-4544: I.A+ (C.1.2) + (B.1.22), C1-4545: I.A+ (C.1.4) + (B.1.22), C1-4546: I.A+ (C.1.5) + (B.1.22), C1-4547: I.A+ (C.2.6) + (B.1.22), C1- 4548: I.A+ (C.2.7) + (B.1.22), C1-4549: I.A+ (C.2.8) + (B.1.22), C1-4550: I.A+ (D.1.1) + (B.1.22), C1-4551 : I.A+ (D.1.2) + (B.1.22), C1-4552: I.A+ (D.1.5) + (B.1.22), C1-4553: I.A + (D.2.4) + (B.1.22), C1-4554: I.A+ (D.2.6) + (B.1.22), C1-4555: I.A+ (D.2.7) + (B.1.22), C1- 4556: I.A+ (E.1.1) + (B.1.22), C1-4557: I.A+ (E.1.3) + (B.1.22), C1-4558: I.A+ (E.2.2) + (B.1.22), C1-4559: I.A+ (E.2.3) + (B.1.22), C1-4560: I.A+ (F.1.2) + (B.1.22), C1-4561: I.A + (F.1.4) + (B.1.22), C 1-4562: I.A+ (F.1.5) + (B.1.22), C1-4563: I.A+ (G.3.1) + (B.1.22), C1-4564: I.A+ (G.3.3) + (B.1.22), C1-4565: I.A+ (G.3.6) + (B.1.22), C1-4566: I.A+ (G.5.1) + (B.1.22),
C 1-4567: I.A+ (G.5.2) + (B.1.22), C1-4568: I.A+ (G.5.3) + (B.1.22), C1-4569: I.A+ (G.5.4) + (B.1.22), C1-4570: I.A+ (G.5.5) + (B.1.22), C1-4571: I.A+ (G.5.6) + (B.1.22), C1-4572: I.A + (G.5.7) + (B.1.22), C1-4573: I. A + (G.5.8) + (B.1.22), C1-4574: I. A + (G.5.9) + (B.1.22), C1- 4575: I.A+ (G.5.10) + (B.1.22), C1-4576: I.A+ (G.5.11) + (B.1.22), C1-4577: I.A+ (H.1.5) + (B.1.22), C1-4578: I.A+ (H.1.7) + (B.1.22), C1-4579: I.A+ (H.2.2) + (B.1.22), C1-4580: I.A + (H.2.3) + (B.1.22), C1-4581 : I.A+ (H.2.5) + (B.1.22), C1-4582: I.A+ (H.2.7) + (B.1.22), C1- 4583: I.A+ (H.2.8) + (B.1.22), C1-4584: I.A+ (H.3.2) + (B.1.22), C1-4585: I.A+ (H.3.4) + (B.1.22), C1-4586: I.A+ (H.3.5) + (B.1.22), C1-4587: I.A+ (H.4.9) + (B.1.22), C1-4588: I.A + (H.4.10) + (B.1.22), C1-4589: I.A+ (I.2.2) + (B.1.22), C1-4590: I.A+ (I.2.5) + (B.1.22), C1-4591: I.A+ (J.1.2) + (B.1.22), C1-4592: I.A+ (J.1.5) + (B.1.22), C1-4593: I.A+ (J.1.8) + (B.1.22), C1- 4594: I.A+ (J.1.11) + (B.1.22), C1-4595: I.A+ (J.1.12) + (B.1.22), C1-4596: I.A+ (K.1.3) +
(B.1.22), C1-4597: I.A+ (K.1.29) + (B.1.22), C1-4598: I.A+ (K.1.30) + (B.1.22), C1-4599: I.A + (K.1.31) + (B.1.22), C1-4600: I.A+ (K.1.32) + (B.1.22), C1-4601: I.A+ (K.1.41) + (B.1.22), C1- 4602: I.A+ (K.1.42) + (B.1.22), C1-4603: I.A+ (K.1.44) + (B.1.22), C1-4604: I.A+ (K.1.45) + (B.1.22), C1-4605: I.A+ (K.1.47) + (B.1.22), C1-4606: I.A+ (K.1.49) + (B.1.22), C1-4607: I.A + (K.1.53) + (B.1.22), C1-4608: I.A+ (K.1.54) + (B.1.22), C1-4609: I.A+ (A.1.4) + (B.1.23), C1- 4610: I.A+ (A.1.12) + (B.1.23), C1-4611: I.A+ (A.1.21) + (B.1.23), C1-4612: I.A + (A.121a) + (B.1.23), C1-4613: I.A+ (A.1.24) + (B.1.23), C1-4614: I.A+ (A.1.26) + (B.1.23), C1-4615: I.A + (A.1.27) + (B.1.23), C1-4616: I.A+ (A.1.30) + (B.1.23), C1-4617: I.A+ (A.1.31) + (B.1.23), C1- 4618: I.A + (A.1.32) + (B.1.23), C1-4619: I.A+ (A.1.35) + (B.1.23), C1-4620: I.A+ (A.2.1) + (B.1.23), C1-4621 : I.A+ (A.2.3) + (B.1.23), C1-4622: I.A+ (A.2.5) + (B.1.23), C1-4623: I.A + (A.3.11) + (B.1.23), C1-4624: I.A+ (A.3.12) + (B.1.23), C1-4625: I.A+ (A.3.15) + (B.1.23), C1- 4626: I.A + (A.3.16) + (B.1.23), C1-4627: I.A+ (A.3.18) + (B.1.23), C1-4628: I.A+ (A.3.19) + (B.1.23), C1-4629: I.A+ (A.3.20) + (B.1.23), C1-4630: I.A+ (A.3.21) + (B.1.23), C1-4631: I.A + (A.3.22) + (B.1.23), C1-4632: I.A+ (A.3.23) + (B.1.23), C1-4633: I.A+ (A.3.25) + (B.1.23), C1- 4634: I.A + (A.3.26) + (B.1.23), C1-4635: I.A+ (A.3.27) + (B.1.23), C1-4636: I.A+ (A.4.5) + (B.1.23), C1-4637: I.A+ (A.4.11) + (B.1.23), C1-4638: I.A+ (B.1.10) + (B.1.23), C1-4639: I.A + (B.1.11) + (B.1.23), C1-4640: I.A + (B.1.12) + (B.1.23), C1-4641: I.A + (B.1.13) + (B.1.23), C1- 4642: I.A+ (B.1.18) + (B.1.23), C1-4643: I.A+ (B.1.21) + (B.1.23), C1-4644: I.A+ (B.1.25) + (B.1.23), C1-4645: I.A+ (B.1.26) + (B.1.23), C1-4646: I.A+ (B.1.29) + (B.1.23), C1-4647: I.A + (B.1.33) + (B.1.23), C1-4648: I.A+ (B.1.34) + (B.1.23), C1-4649: I.A+ (B.1.37) + (B.1.23), C1- 4650: I.A+ (B.1.38) + (B.1.23), C1-4651: I.A+ (B.1.43) + (B.1.23), C1-4652: I.A+ (B.1.46) + (B.1.23), C1-4653: I.A+ (B.2.4) + (B.1.23), C1-4654: I.A+ (B.2.5) + (B.1.23), C1-4655: I.A + (B.2.6) + (B.1.23), C1-4656: I.A+ (B.2.8) + (B.1.23), C1-4657: I.A+ (C.1.1) + (B.1.23), C1-4658: I.A+ (C.1.2) + (B.1.23), C1-4659: I.A+ (C.1.4) + (B.1.23), C1-4660: I.A+ (C.1.5) + (B.1.23), C1- 4661: I.A + (C.2.6) + (B.1.23), C1-4662: I.A+ (C.2.7) + (B.1.23), C1-4663: I.A+ (C.2.8) + (B.1.23), C1-4664: I.A+ (D.1.1) + (B.1.23), C1-4665: I.A+ (D.1.2) + (B.1.23), C1-4666: I.A + (D.1.5) + (B.1.23), C 1-4667: I.A+ (D.2.4) + (B.1.23), C1-4668: I.A+ (D.2.6) + (B.1.23), C1- 4669: I.A + (D.2.7) + (B.1.23), C1-4670: I.A+ (E.1.1) + (B.1.23), C1-4671: I.A+ (E.1.3) + (B.1.23), C1-4672: I.A+ (E.2.2) + (B.1.23), C1-4673: I.A+ (E.2.3) + (B.1.23), C1-4674: I.A + (F.1.2) + (B.1.23), C1-4675: I.A+ (F.1.4) + (B.1.23), C1-4676: I.A+ (F.1.5) + (B.1.23), C1-4677: I.A + (G.3.1) + (B.1.23), C1-4678: I.A+ (G.3.3) + (B.1.23), C1-4679: I.A+ (G.3.6) + (B.1.23), C1-4680: I.A+ (G.5.1) + (B.1.23), C1-4681: I.A+ (G.5.2) + (B.1.23), C1-4682: I.A+ (G.5.3) + (B.1.23), C1-4683: I.A+ (G.5.4) + (B.1.23), C1-4684: I.A+ (G.5.5) + (B.1.23), C1-4685: I.A + (G.5.6) + (B.1.23), C1-4686: I.A + (G.5.7) + (B.1.23), C1-4687: I.A + (G.5.8) + (B.1.23), C1- 4688: I.A + (G.5.9) + (B.1.23), C1-4689: I.A+ (G.5.10) + (B.1.23), C1-4690: I.A+ (G.5.11) + (B.1.23), C1-4691 : I.A + (H.1.5) + (B.1.23), C1-4692: I.A + (H.1.7) + (B.1.23), C1-4693: I.A + (H.2.2) + (B.1.23), C1-4694: I.A+ (H.2.3) + (B.1.23), C1-4695: I.A+ (H.2.5) + (B.1.23), C1- 4696: I.A + (H.2.7) + (B.1.23), C1-4697: I.A + (H.2.8) + (B.1.23), C1-4698: I.A + (H.3.2) + (B.1.23), C 1-4699: I.A+ (H.3.4) + (B.1.23), C1-4700: I.A+ (H.3.5) + (B.1.23), C1-4701: I.A + (H.4.9) + (B.1.23), C1-4702: I.A+ (H.4.10) + (B.1.23), C1-4703: I.A+ (I.2.2) + (B.1.23), C1- 4704: I.A + (I.2.5) + (B.1.23), C1-4705: I.A + (J.1.2) + (B.1.23), C1-4706: I.A + (J.1.5) + (B.1.23), C1-4707: I.A+ (J.1.8) + (B.1.23), C1-4708: I.A + (J.1.11) + (B.1.23), C1-4709: I.A+ (J.1.12) +
(B.1.23), C1-4710: I.A+ (K.1.3) + (B.1.23), C1-4711: I.A+ (K.1.29) + (B.1.23), C1-4712: I.A + (K.1.30) + (B.1.23), C1-4713: I.A+ (K.1.31) + (B.1.23), C1-4714: I.A+ (K.1.32) + (B.1.23), C1- 4715: I.A+ (K.1.41) + (B.1.23), C1-4716: I.A+ (K.1.42) + (B.1.23), C1-4717: I.A+ (K.1.44) + (B.1.23), C1-4718: I.A+ (K.1.45) + (B.1.23), C1-4719: I.A+ (K.1.47) + (B.1.23), C1-4720: I.A + (K.1.49) + (B.1.23), C1-4721 : I.A+ (K.1.53) + (B.1.23), C1-4722: I.A+ (K.1.54) + (B.1.23), C1- 4723: I.A + (A.1.4) + (B.1.25), C1-4724: I.A+ (A.1.12) + (B.1.25), C1-4725: I.A+ (A.1.21) + (B.1.25), C1-4726: I.A + (A.121a) + (B.1.25), C1-4727: I.A + (A.1.24) + (B.1.25), C1-4728: I.A + (A.1.26) + (B.1.25), C1-4729: LA + (A.1.27) + (B.1.25), C1-4730: LA + (A.1.30) + (B.1.25), C1- 4731: LA + (A.1.31) + (B.1.25), C1-4732: LA + (A.1.32) + (B.1.25), C1-4733: LA + (A.1.35) + (B.1.25), C1-4734: LA + (A.2.1) + (B.1.25), C1-4735: I.A+ (A.2.3) + (B.1.25), C1-4736: I.A + (A.2.5) + (B.1.25), C1-4737: LA + (A.3.11) + (B.1.25), C1-4738: LA + (A.3.12) + (B.1.25), C1- 4739: LA + (A.3.15) + (B.1.25), C1-4740: LA + (A.3.16) + (B.1.25), C1-4741: LA + (A.3.18) + (B.1.25), C1-4742: LA + (A.3.19) + (B.1.25), C1-4743: I.A+ (A.3.20) + (B.1.25), C1-4744: I.A + (A.3.21) + (B.1.25), C1-4745: I.A+ (A.3.22) + (B.1.25), C1-4746: I.A+ (A.3.23) + (B.1.25), C1- 4747: LA + (A.3.25) + (B.1.25), C1-4748: I.A+ (A.3.26) + (B.1.25), C1-4749: I.A + (A.3.27) + (B.1.25), C1-4750: I.A+ (A.4.5) + (B.1.25), C1-4751: LA + (A.4.11) + (B.1.25), C1-4752: I.A +
(B.1.10) + (B.1.25), C1-4753: LA + (B.1.11) + (B.1.25), C1-4754: LA + (B.1.12) + (B.1.25), C1- 4755: I.A+ (B.1.13) + (B.1.25), C1-4756: LA + (B.1.18) + (B.1.25), C1-4757: LA + (B.1.21) + (B.1.25), C1-4758: LA + (B.1.26) + (B.1.25), C1-4759: LA + (B.1.29) + (B.1.25), C1-4760: I.A + (B.1.33) + (B.1.25), C1-4761: LA + (B.1.34) + (B.1.25), C1-4762: LA + (B.1.37) + (B.1.25), C1- 4763: LA + (B.1.38) + (B.1.25), C1-4764: LA + (B.1.43) + (B.1.25), C1-4765: LA + (B.1.46) + (B.1.25), C1-4766: I.A+ (B.2.4) + (B.1.25), C1-4767: I.A+ (B.2.5) + (B.1.25), C1-4768: I.A + (B.2.6) + (B.1.25), C1-4769: I.A+ (B.2.8) + (B.1.25), C1-4770: LA + (C.1.1) + (B.1.25), C1-4771: I.A+ (C.1.2) + (B.1.25), C1-4772: LA + (C.1.4) + (B.1.25), C1-4773: LA + (C.1.5) + (B.1.25), C1- 4774: I.A + (C.2.6) + (B.1.25), C1-4775: I.A + (C.2.7) + (B.1.25), C1-4776: I.A + (C.2.8) + (B.1.25), C 1-4777: I.A+ (D.1.1) + (B.1.25), C1-4778: LA + (D.1.2) + (B.1.25), C1-4779: I.A + (D.1.5) + (B.1.25), C1-4780: I.A+ (D.2.4) + (B.1.25), C1-4781: I.A+ (D.2.6) + (B.1.25), C1- 4782: I.A + (D.2.7) + (B.1.25), C1-4783: I.A+ (E.1.1) + (B.1.25), C1-4784: I.A+ (E.1.3) + (B.1.25), C1-4785: I.A+ (E.2.2) + (B.1.25), C1-4786: I.A+ (E.2.3) + (B.1.25), C1-4787: I.A + (F.1.2) + (B.1.25), C1-4788: I.A+ (F.1.4) + (B.1.25), C1-4789: I.A+ (F.1.5) + (B.1.25), C1-4790: LA + (G.3.1) + (B.1.25), C1-4791: I.A+ (G.3.3) + (B.1.25), C1-4792: I.A+ (G.3.6) + (B.1.25), C1-4793: LA + (G.5.1) + (B.1.25), C1-4794: I.A+ (G.5.2) + (B.1.25), C1-4795: I.A+ (G.5.3) + (B.1.25), C1-4796: I.A+ (G.5.4) + (B.1.25), C1-4797: I.A+ (G.5.5) + (B.1.25), C1-4798: I.A + (G.5.6) + (B.1.25), C1-4799: I.A + (G.5.7) + (B.1.25), C1-4800: I.A + (G.5.8) + (B.1.25), C1- 4801: I.A + (G.5.9) + (B.1.25), C1-4802: I.A+ (G.5.10) + (B.1.25), C1-4803: I.A+ (G.5.11) + (B.1.25), C1-4804: I.A + (H.1.5) + (B.1.25), C1-4805: I.A + (H.1.7) + (B.1.25), C1-4806: I.A + (H.2.2) + (B.1.25), C1-4807: I.A + (H.2.3) + (B.1.25), C1-4808: I.A+ (H.2.5) + (B.1.25), C1- 4809: I.A + (H.2.7) + (B.1.25), C1-4810: I.A+ (H.2.8) + (B.1.25), C1-4811: I.A+ (H.3.2) + (B.1.25), C1-4812: I.A+ (H.3.4) + (B.1.25), C1-4813: LA + (H.3.5) + (B.1.25), C1-4814: I.A + (H.4.9) + (B.1.25), C1-4815: I.A+ (H.4.10) + (B.1.25), C1-4816: I.A+ (I.2.2) + (B.1.25), C1- 4817: I.A + (I.2.5) + (B.1.25), C1-4818: I.A + (J.1.2) + (B.1.25), C1-4819: I.A + (J.1.5) + (B.1.25), C1-4820: LA + (J.1.8) + (B.1.25), C1-4821: I.A + (J.1.11) + (B.1.25), C1-4822: I.A+ (J.1.12) +
(B.1.25), C1-4823: I.A+ (K.1.3) + (B.1.25), C1-4824: I.A+ (K.1.29) + (B.1.25), C1-4825: I.A + (K.1.30) + (B.1.25), C1-4826: I.A+ (K.1.31) + (B.1.25), C1-4827: I.A+ (K.1.32) + (B.1.25), C1- 4828: I.A+ (K.1.41) + (B.1.25), C1-4829: I.A+ (K.1.42) + (B.1.25), C1-4830: I.A+ (K.1.44) + (B.1.25), C1-4831 : I.A+ (K.1.45) + (B.1.25), C1-4832: I.A+ (K.1.47) + (B.1.25), C1-4833: I.A + (K.1.49) + (B.1.25), C1-4834: I.A+ (K.1.53) + (B.1.25), C1-4835: I.A+ (K.1.54) + (B.1.25), C1- 4836: I.A + (A.1.4) + (B.1.29), C1-4837: I.A+ (A.1.12) + (B.1.29), C1-4838: I.A+ (A.1.21) + (B.1.29), C1-4839: I.A + (A.121a) + (B.1.29), C1-4840: I.A + (A.1.24) + (B.1.29), C1-4841: I.A + (A.1.26) + (B.1.29), C1-4842: LA + (A.1.27) + (B.1.29), C1-4843: LA + (A.1.30) + (B.1.29), C1- 4844: LA + (A.1.31) + (B.1.29), C1-4845: LA + (A.1.32) + (B.1.29), C1-4846: LA + (A.1.35) + (B.1.29), C 1-4847: LA + (A.2.1) + (B.1.29), C1-4848: I.A+ (A.2.3) + (B.1.29), C1-4849: I.A + (A.2.5) + (B.1.29), C 1-4850: LA + (A.3.11) + (B.1.29), C1-4851: LA + (A.3.12) + (B.1.29), C1- 4852: LA + (A.3.15) + (B.1.29), C1-4853: LA + (A.3.16) + (B.1.29), C1-4854: LA + (A.3.18) + (B.1.29), C1-4855: LA + (A.3.19) + (B.1.29), C1-4856: I.A+ (A.3.20) + (B.1.29), C1-4857: I.A + (A.3.21) + (B.1.29), C1-4858: I.A+ (A.3.22) + (B.1.29), C1-4859: I.A+ (A.3.23) + (B.1.29), C1- 4860: LA + (A.3.25) + (B.1.29), C1-4861: I.A+ (A.3.26) + (B.1.29), C1-4862: I.A+ (A.3.27) + (B.1.29), C1-4863: I.A+ (A.4.5) + (B.1.29), C1-4864: LA + (A.4.11) + (B.1.29), C1-4865: I.A +
(B.1.10) + (B.1.29), C1-4866: LA + (B.1.11) + (B.1.29), C1-4867: LA + (B.1.12) + (B.1.29), C1- 4868: I.A+ (B.1.13) + (B.1.29), C1-4869: LA + (B.1.18) + (B.1.29), C1-4870: LA + (B.1.21) + (B.1.29), C1-4871 : LA + (B.1.26) + (B.1.29), C1-4872: LA + (B.1.33) + (B.1.29), C1-4873: I.A + (B.1.34) + (B.1.29), C1-4874: LA + (B.1.37) + (B.1.29), C1-4875: LA + (B.1.38) + (B.1.29), C1- 4876: LA + (B.1.43) + (B.1.29), C1-4877: LA + (B.1.46) + (B.1.29), C1-4878: I.A+ (B.2.4) + (B.1.29), C1-4879: I.A+ (B.2.5) + (B.1.29), C1-4880: I.A+ (B.2.6) + (B.1.29), C1-4881: I.A + (B.2.8) + (B.1.29), C1-4882: LA + (C.1.1) + (B.1.29), C1-4883: LA + (C.1.2) + (B.1.29), C1-4884: I.A+ (C.1.4) + (B.1.29), C1-4885: LA + (C.1.5) + (B.1.29), C1-4886: I.A+ (C.2.6) + (B.1.29), C1- 4887: I.A + (C.2.7) + (B.1.29), C1-4888: I.A+ (C.2.8) + (B.1.29), C1-4889: I.A+ (D.1.1) + (B.1.29), C1-4890: I.A+ (D.1.2) + (B.1.29), C1-4891: LA + (D.1.5) + (B.1.29), C1-4892: I.A + (D.2.4) + (B.1.29), C1-4893: I.A+ (D.2.6) + (B.1.29), C1-4894: I.A+ (D.2.7) + (B.1.29), C1- 4895: I.A + (E.1.1) + (B.1.29), C1-4896: I.A+ (E.1.3) + (B.1.29), C1-4897: I.A+ (E.2.2) + (B.1.29), C1-4898: I.A+ (E.2.3) + (B.1.29), C1-4899: I.A+ (F.1.2) + (B.1.29), C1-4900: I.A + (F.1.4) + (B.1.29), C1-4901 : I.A+ (F.1.5) + (B.1.29), C1-4902: I.A+ (G.3.1) + (B.1.29), C1-4903: I.A + (G.3.3) + (B.1.29), C1-4904: I.A+ (G.3.6) + (B.1.29), C1-4905: I.A+ (G.5.1) + (B.1.29), C1-4906: I.A+ (G.5.2) + (B.1.29), C1-4907: I.A+ (G.5.3) + (B.1.29), C1-4908: I.A+ (G.5.4) + (B.1.29), C1-4909: I.A+ (G.5.5) + (B.1.29), C1-4910: I.A+ (G.5.6) + (B.1.29), C1-4911: I.A + (G.5.7) + (B.1.29), C1-4912: I.A+ (G.5.8) + (B.1.29), C1-4913: I.A+ (G.5.9) + (B.1.29), C1- 4914: LA + (G.5.10) + (B.1.29), C1-4915: I.A + (G.5.11) + (B.1.29), C1-4916: I.A + (H.1.5) + (B.1.29), C1-4917: I.A + (H.1.7) + (B.1.29), C1-4918: I.A+ (H.2.2) + (B.1.29), C1-4919: I.A + (H.2.3) + (B.1.29), C1-4920: I.A+ (H.2.5) + (B.1.29), C1-4921: I.A+ (H.2.7) + (B.1.29), C1- 4922: I.A + (H.2.8) + (B.1.29), C1-4923: I.A + (H.3.2) + (B.1.29), C1-4924: I.A + (H.3.4) + (B.1.29), C1-4925: I.A+ (H.3.5) + (B.1.29), C1-4926: LA + (H.4.9) + (B.1.29), C1-4927: I.A + (H.4.10) + (B.1.29), C1-4928: I.A+ (I.2.2) + (B.1.29), C1-4929: I.A+ (I.2.5) + (B.1.29), C1-4930: I.A + (J.1.2) + (B.1.29), C1-4931 : I.A + (J.1.5) + (B.1.29), C1-4932: I.A + (J.1.8) + (B.1.29), C1- 4933: I.A + (J.1.11) + (B.1.29), C1-4934: I.A + (J.1.12) + (B.1.29), C1-4935: I.A + (K.1.3) +
(B.1.29), C1-4936: I.A+ (K.1.29) + (B.1.29), C1-4937: I.A+ (K.1.30) + (B.1.29), C1-4938: I.A + (K.1.31) + (B.1.29), C1-4939: I.A+ (K.1.32) + (B.1.29), C1-4940: I.A+ (K.1.41) + (B.1.29), C1- 4941: I.A+ (K.1.42) + (B.1.29), C1-4942: I.A+ (K.1.44) + (B.1.29), C1-4943: I.A+ (K.1.45) + (B.1.29), C 1-4944: I.A+ (K.1.47) + (B.1.29), C1-4945: I.A+ (K.1.49) + (B.1.29), C1-4946: I.A + (K.1.53) + (B.1.29), C1-4947: I.A+ (K.1.54) + (B.1.29), C1-4948: I.A+ (A.1.4) + (B.1.38), C1- 4949: I.A+ (A.1.12) + (B.1.38), C1-4950: I.A+ (A.1.21) + (B.1.38), C1-4951: I.A + (A.121a) + (B.1.38), C1-4952: I.A+ (A.1.24) + (B.1.38), C1-4953: I.A+ (A.1.26) + (B.1.38), C1-4954: I.A + (A.1.27) + (B.1.38), C1-4955: I.A+ (A.1.30) + (B.1.38), C1-4956: I.A+ (A.1.31) + (B.1.38), C1- 4957: I.A + (A.1.32) + (B.1.38), C1-4958: I.A+ (A.1.35) + (B.1.38), C1-4959: I.A+ (A.2.1) + (B.1.38), C1-4960: I.A+ (A.2.3) + (B.1.38), C1-4961: I.A+ (A.2.5) + (B.1.38), C1-4962: I.A + (A.3.11) + (B.1.38), C1-4963: I.A+ (A.3.12) + (B.1.38), C1-4964: I.A+ (A.3.15) + (B.1.38), C1- 4965: I.A + (A.3.16) + (B.1.38), C1-4966: I.A+ (A.3.18) + (B.1.38), C1-4967: I.A+ (A.3.19) + (B.1.38), C1-4968: I.A+ (A.3.20) + (B.1.38), C1-4969: I.A+ (A.3.21) + (B.1.38), C1-4970: I.A + (A.3.22) + (B.1.38), C1-4971: I.A+ (A.3.23) + (B.1.38), C1-4972: I.A+ (A.3.25) + (B.1.38), C1- 4973: I.A + (A.3.26) + (B.1.38), C1-4974: I.A+ (A.3.27) + (B.1.38), C1-4975: I.A+ (A.4.5) + (B.1.38), C1-4976: I.A+ (A.4.11) + (B.1.38), C1-4977: I.A+ (B.1.10) + (B.1.38), C1-4978: I.A + (B.1.11) + (B.1.38), C1-4979: I.A + (B.1.12) + (B.1.38), C1-4980: I.A + (B.1.13) + (B.1.38), C1- 4981: I.A+ (B.1.18) + (B.1.38), C1-4982: I.A+ (B.1.21) + (B.1.38), C1-4983: I.A+ (B.1.26) + (B.1.38), C1-4984: I.A+ (B.1.33) + (B.1.38), C1-4985: I.A+ (B.1.34) + (B.1.38), C1-4986: I.A + (B.1.37) + (B.1.38), C1-4987: I.A+ (B.1.43) + (B.1.38), C1-4988: I.A+ (B.1.46) + (B.1.38), C1- 4989: I.A + (B.2.4) + (B.1.38), C1-4990: I.A+ (B.2.5) + (B.1.38), C1-4991: I.A+ (B.2.6) + (B.1.38), C1-4992: I.A+ (B.2.8) + (B.1.38), C1-4993: I.A+ (C.1.1) + (B.1.38), C1-4994: I.A + (C.1.2) + (B.1.38), C1-4995: I.A+ (C.1.4) + (B.1.38), C1-4996: I.A+ (C.1.5) + (B.1.38), C1- 4997: I.A + (C.2.6) + (B.1.38), C1-4998: I.A + (C.2.7) + (B.1.38), C1-4999: I.A + (C.2.8) + (B.1.38), C1-5000: I.A+ (D.1.1) + (B.1.38), C1-5001: I.A + (D.1.2) + (B.1.38), C1-5002: I.A + (D.1.5) + (B.1.38), C1-5003: I.A+ (D.2.4) + (B.1.38), C1-5004: I.A+ (D.2.6) + (B.1.38), C1- 5005: I.A + (D.2.7) + (B.1.38), C1-5006: I.A+ (E.1.1) + (B.1.38), C1-5007: I.A+ (E.1.3) + (B.1.38), C1-5008: I.A+ (E.2.2) + (B.1.38), C1-5009: I.A+ (E.2.3) + (B.1.38), C1-5010: I.A + (F.1.2) + (B.1.38), C1-5011: I.A+ (F.1.4) + (B.1.38), C1-5012: I.A+ (F.1.5) + (B.1.38), C1-5013: I.A + (G.3.1) + (B.1.38), C1-5014: I.A+ (G.3.3) + (B.1.38), C1-5015: I.A+ (G.3.6) + (B.1.38), C1-5016: I.A + (G.5.1) + (B.1.38), C1-5017: I.A+ (G.5.2) + (B.1.38), C1-5018: I.A+ (G.5.3) + (B.1.38), C1-5019: I.A+ (G.5.4) + (B.1.38), C1-5020: I.A+ (G.5.5) + (B.1.38), C1-5021: I.A + (G.5.6) + (B.1.38), C1-5022: I.A + (G.5.7) + (B.1.38), C1-5023: I.A + (G.5.8) + (B.1.38), C1- 5024: I.A + (G.5.9) + (B.1.38), C1-5025: I.A+ (G.5.10) + (B.1.38), C1-5026: I.A+ (G.5.11) + (B.1.38), C1-5027: I.A + (H.1.5) + (B.1.38), C1-5028: I.A + (H.1.7) + (B.1.38), C1-5029: I.A + (H.2.2) + (B.1.38), C1-5030: I.A+ (H.2.3) + (B.1.38), C1-5031: I.A+ (H.2.5) + (B.1.38), C1- 5032: I.A + (H.2.7) + (B.1.38), C1-5033: I.A + (H.2.8) + (B.1.38), C1-5034: I.A + (H.3.2) + (B.1.38), C1-5035: I.A+ (H.3.4) + (B.1.38), C1-5036: I.A+ (H.3.5) + (B.1.38), C1-5037: I.A + (H.4.9) + (B.1.38), C1-5038: I.A+ (H.4.10) + (B.1.38), C1-5039: I.A+ (I.2.2) + (B.1.38), C1- 5040: I.A + (I.2.5) + (B.1.38), C1-5041: I.A + (J.1.2) + (B.1.38), C1-5042: I.A + (J.1.5) + (B.1.38), C1-5043: I.A+ (J.1.8) + (B.1.38), C1-5044: I.A+ (J.1.11) + (B.1.38), C1-5045: I.A + (J.1.12) + (B.1.38), C1-5046: I.A+ (K.1.3) + (B.1.38), C1-5047: I.A + (K.1.29) + (B.1.38), C1-5048: I.A +
(K.1.30) + (B.1.38), C1-5049: I.A+ (K.1.31) + (B.1.38), C1-5050: I.A+ (K.1.32) + (B.1.38), C1- 5051: I.A+ (K.1.41) + (B.1.38), C1-5052: I.A + (K.1.42) + (B.1.38), C1-5053: I.A+ (K.1.44) + (B.1.38), C1-5054: I.A+ (K.1.45) + (B.1.38), C1-5055: I.A+ (K.1.47) + (B.1.38), C1-5056: I.A + (K.1.49) + (B.1.38), C1-5057: I.A+ (K.1.53) + (B.1.38), C1-5058: I.A+ (K.1.54) + (B.1.38), C1- 5059: I.A + (A.1.4) + (B.2.4), C1-5060: LA + (A.1.12) + (B.2.4), C1-5061: LA + (A.1.21) +
(B.2.4), C1-5062: I.A + (A.121a) + (B.2.4), C1-5063: LA + (A.1.24) + (B.2.4), C1-5064: I.A + (A.1.26) + (B.2.4), C1-5065: LA + (A.1.27) + (B.2.4), C1-5066: LA + (A.1.30) + (B.2.4), C1-5067: LA + (A.1.31) + (B.2.4), C1-5068: LA + (A.1.32) + (B.2.4), C1-5069: LA + (A.1.35) + (B.2.4), C1- 5070: LA + (A.2.1) + (B.2.4), C1-5071: I.A+ (A.2.3) + (B.2.4), C1-5072: I.A+ (A.2.5) + (B.2.4), C1-5073: LA + (A.3.11) + (B.2.4), C1-5074: LA + (A.3.12) + (B.2.4), C1-5075: LA + (A.3.15) + (B.2.4), C1-5076: I.A + (A.3.16) + (B.2.4), C1-5077: I.A + (A.3.18) + (B.2.4), C1-5078: I.A + (A.3.19) + (B.2.4), C1-5079: I.A+ (A.3.20) + (B.2.4), C1-5080: I.A+ (A.3.21) + (B.2.4), C1-5081: I.A + (A.3.22) + (B.2.4), C1-5082: I.A + (A.3.23) + (B.2.4), C1-5083: I.A + (A.3.25) + (B.2.4), C1- 5084: I.A + (A.3.26) + (B.2.4), C1-5085: I.A + (A.3.27) + (B.2.4), C1-5086: I.A + (A.4.5) +
(B.2.4), C 1-5087: I.A+ (A.4.11) + (B.2.4), C1-5088: I.A+ (B.1.10) + (B.2.4), C1-5089: I.A + (B.1.11) + (B.2.4), C1-5090: I.A+ (B.1.12) + (B.2.4), C1-5091: I.A+ (B.1.13) + (B.2.4), C1-5092: I.A+ (B.1.18) + (B.2.4), C1-5093: I.A+ (B.1.21) + (B.2.4), C1-5094: I.A+ (B.1.26) + (B.2.4), C1- 5095: I.A + (B.1.33) + (B.2.4), C1-5096: I.A + (B.1.34) + (B.2.4), C1-5097: I.A + (B.1.37) + (B.2.4), C1-5098: I.A + (B.1.43) + (B.2.4), C1-5099: I.A + (B.1.46) + (B.2.4), C1-5100: I.A + (B.2.5) + (B.2.4), C1-5101 : I.A+ (B.2.6) + (B.2.4), C1-5102: I.A+ (B.2.8) + (B.2.4), C1-5103: I.A + (C.1.1) + (B.2.4), C1-5104: I.A+ (C.1.2) + (B.2.4), C1-5105: I.A+ (C.1.4) + (B.2.4), C1-5106: I.A+ (C.1.5) + (B.2.4), C1-5107: I.A+ (C.2.6) + (B.2.4), C1-5108: I.A+ (C.2.7) + (B.2.4), C1- 5109: LA + (C.2.8) + (B.2.4), C1-5110: I.A + (D.1.1) + (B.2.4), C1-5111: I.A+ (D.1.2) + (B.2.4), C1-5112: LA + (D.1.5) + (B.2.4), C1-5113: I.A+ (D.2.4) + (B.2.4), C1-5114: I.A+ (D.2.6) + (B.2.4), C1-5115: I.A+ (D.2.7) + (B.2.4), C1-5116: I.A+ (E.1.1) + (B.2.4), C1-5117: I.A+ (E.1.3) + (B.2.4), C1-5118: I.A+ (E.2.2) + (B.2.4), C1-5119: I.A+ (E.2.3) + (B.2.4), C1-5120: I.A + (F.1.2) + (B.2.4), C1-5121 : LA + (F.1.4) + (B.2.4), C1-5122: LA + (F.1.5) + (B.2.4), C1-5123: I.A + (G.3.1) + (B.2.4), C1-5124: I.A + (G.3.3) + (B.2.4), C1-5125: I.A + (G.3.6) + (B.2.4), C1-5126: I.A + (G.5.1) + (B.2.4), C1-5127: I.A + (G.5.2) + (B.2.4), C1-5128: I.A + (G.5.3) + (B.2.4), C1- 5129: I.A + (G.5.4) + (B.2.4), C1-5130: I.A + (G.5.5) + (B.2.4), C1-5131: I.A + (G.5.6) + (B.2.4), C1-5132: I.A + (G.5.7) + (B.2.4), C1-5133: I.A + (G.5.8) + (B.2.4), C1-5134: I.A + (G.5.9) + (B.2.4), C1-5135: I.A+ (G.5.10) + (B.2.4), C1-5136: I.A + (G.5.11) + (B.2.4), C1-5137: I.A + (H.1.5) + (B.2.4), C1-5138: I.A + (H.1.7) + (B.2.4), C1-5139: I.A+ (H.2.2) + (B.2.4), C1-5140: I.A + (H.2.3) + (B.2.4), C1-5141 : I.A + (H.2.5) + (B.2.4), C1-5142: I.A + (H.2.7) + (B.2.4), C1-5143: I.A + (H.2.8) + (B.2.4), C1-5144: I.A + (H.3.2) + (B.2.4), C1-5145: I.A + (H.3.4) + (B.2.4), C1- 5146: I.A + (H.3.5) + (B.2.4), C1-5147: I.A + (H.4.9) + (B.2.4), C1-5148: I.A + (H.4.10) + (B.2.4), C1-5149: I.A+ (I.2.2) + (B.2.4), C1-5150: I.A+ (I.2.5) + (B.2.4), C1-5151: I.A + (J.1.2) + (B.2.4), C1-5152: I.A + (J.1.5) + (B.2.4), C1-5153: I.A + (J.1.8) + (B.2.4), C1-5154: I.A + (J.1.11) + (B.2.4), C1-5155: I.A + (J.1.12) + (B.2.4), C1-5156: I.A+ (K.1.3) + (B.2.4), C1-5157: I.A + (K.1.29) + (B.2.4), C1-5158: I.A + (K.1.30) + (B.2.4), C1-5159: I.A + (K.1.31) + (B.2.4), C1-5160: I.A + (K.1.32) + (B.2.4), C1-5161: I.A + (K.1.41) + (B.2.4), C1-5162: I.A+ (K.1.42) + (B.2.4), C1- 5163: I.A + (K.1.44) + (B.2.4), C1-5164: I.A + (K.1.45) + (B.2.4), C1-5165: I.A + (K.1.47) +
(B.2.4), C1-5166: I. A + (K.1.49) + (B.2.4), C1-5167: I. A + (K.1.53) + (B.2.4), C1-5168: I.A + (K.1.54) + (B.2.4), C1-5169: I.A + (A.1.4) + (B.2.6), C1-5170: LA + (A.1.12) + (B.2.6), C1-5171: LA + (A.1.21) + (B.2.6), C1-5172: I.A + (A.121a) + (B.2.6), C1-5173: LA + (A.1.24) + (B.2.6), C1-5174: I.A + (A.1.26) + (B.2.6), C1-5175: I.A + (A.1.27) + (B.2.6), C1-5176: I.A + (A.1.30) + (B.2.6), C1-5177: I.A + (A.1.31) + (B.2.6), C1-5178: I.A + (A.1.32) + (B.2.6), C1-5179: I.A + (A.1.35) + (B.2.6), C1-5180: LA + (A.2.1) + (B.2.6), C1-5181: I.A+ (A.2.3) + (B.2.6), C1-5182:
LA + (A.2.5) + (B.2.6), C1-5183: LA + (A.3.11) + (B.2.6), C1-5184: I.A+ (A.3.12) + (B.2.6), C1- 5185: I.A + (A.3.15) + (B.2.6), C1-5186: I.A + (A.3.16) + (B.2.6), C1-5187: I.A + (A.3.18) + (B.2.6), C1-5188: I.A + (A.3.19) + (B.2.6), C1-5189: I.A + (A.3.20) + (B.2.6), C1-5190: I.A + (A.3.21) + (B.2.6), C1-5191 : I.A+ (A.3.22) + (B.2.6), C1-5192: I.A+ (A.3.23) + (B.2.6), C1-5193: I.A + (A.3.25) + (B.2.6), C1-5194: I.A + (A.3.26) + (B.2.6), C1-5195: I.A + (A.3.27) + (B.2.6), C1- 5196: I.A + (A.4.5) + (B.2.6), C1-5197: I.A+ (A.4.11) + (B.2.6), C1-5198: LA + (B.1.10) +
(B.2.6), C1-5199: LA + (B.1.11) + (B.2.6), C1-5200: LA + (B.1.12) + (B.2.6), C1-5201: I.A +
(B.1.13) + (B.2.6), C1-5202: I.A+ (B.1.18) + (B.2.6), C1-5203: LA + (B.1.21) + (B.2.6), C1-5204: I.A + (B.1.26) + (B.2.6), C1-5205: I.A + (B.1.33) + (B.2.6), C1-5206: I.A + (B.1.34) + (B.2.6), C1- 5207: I.A + (B.1.37) + (B.2.6), C1-5208: I.A + (B.1.43) + (B.2.6), C1-5209: I.A + (B.1.46) + (B.2.6), C1-5210: I.A+ (B.2.5) + (B.2.6), C1-5211: I.A+ (B.2.8) + (B.2.6), C1-5212: I.A+ (C.1.1) + (B.2.6), C1-5213: LA + (C.1.2) + (B.2.6), C1-5214: I.A+ (C.1.4) + (B.2.6), C1-5215: I.A + (C.1.5) + (B.2.6), C1-5216: I.A+ (C.2.6) + (B.2.6), C1-5217: I.A+ (C.2.7) + (B.2.6), C1-5218: I.A + (C.2.8) + (B.2.6), C1-5219: LA + (D.1.1) + (B.2.6), C1-5220: LA + (D.1.2) + (B.2.6), C1-5221: I.A+ (D.1.5) + (B.2.6), C1-5222: I.A + (D.2.4) + (B.2.6), C1-5223: I.A+ (D.2.6) + (B.2.6), C1- 5224: I.A + (D.2.7) + (B.2.6), C1-5225: I.A + (E.1.1) + (B.2.6), C1-5226: LA + (E.1.3) + (B.2.6),
C 1-5227: I.A+ (E.2.2) + (B.2.6), C1-5228: I.A+ (E.2.3) + (B.2.6), C1-5229: LA + (F.1.2) + (B.2.6), C1-5230: LA + (F.1.4) + (B.2.6), C1-5231: LA + (F.1.5) + (B.2.6), C1-5232: I.A+ (G.3.1) + (B.2.6), C1-5233: I.A + (G.3.3) + (B.2.6), C1-5234: I.A + (G.3.6) + (B.2.6), C1-5235: I.A + (G.5.1) + (B.2.6), C1-5236: I.A + (G.5.2) + (B.2.6), C1-5237: I.A + (G.5.3) + (B.2.6), C1-5238:
I.A + (G.5.4) + (B.2.6), C1-5239: I.A + (G.5.5) + (B.2.6), C1-5240: I.A + (G.5.6) + (B.2.6), C1- 5241: I.A + (G.5.7) + (B.2.6), C1-5242: I.A+ (G.5.8) + (B.2.6), C1-5243: I.A+ (G.5.9) + (B.2.6), C1-5244: LA + (G.5.10) + (B.2.6), C1-5245: I.A + (G.5.11) + (B.2.6), C1-5246: I.A + (H.1.5) + (B.2.6), C 1-5247: I.A + (H.1.7) + (B.2.6), C1-5248: I.A+ (H.2.2) + (B.2.6), C1-5249: LA + (H.2.3) + (B.2.6), C1-5250: I.A+ (H.2.5) + (B.2.6), C1-5251: I.A+ (H.2.7) + (B.2.6), C1-5252: I.A + (H.2.8) + (B.2.6), C1-5253: I.A + (H.3.2) + (B.2.6), C1-5254: I.A + (H.3.4) + (B.2.6), C1-5255: I.A + (H.3.5) + (B.2.6), C1-5256: I.A + (H.4.9) + (B.2.6), C1-5257: I.A + (H.4.10) + (B.2.6), C1-5258: I.A + (1.2.2) + (B.2.6), C1-5259: I.A+ (I.2.5) + (B.2.6), C1-5260: I.A + (J.1.2) + (B.2.6), C1-5261: I.A + (J.1.5) + (B.2.6), C1-5262: I.A + (J.1.8) + (B.2.6), C1-5263: I.A + (J.1.11) + (B.2.6), C1- 5264: I.A + (J.1.12) + (B.2.6), C1-5265: I.A + (K.1.3) + (B.2.6), C1-5266: I.A + (K.1.29) + (B.2.6), C 1-5267: I.A + (K.1.30) + (B.2.6), C1-5268: I.A + (K.1.31) + (B.2.6), C1-5269: I.A + (K.1.32) + (B.2.6), C1-5270: LA + (K.1.41) + (B.2.6), C1-5271: LA + (K.1.42) + (B.2.6), C1-5272: I.A + (K.1.44) + (B.2.6), C1-5273: I.A + (K.1.45) + (B.2.6), C1-5274: I.A + (K.1.47) + (B.2.6), C1-5275: I.A + (K.1.49) + (B.2.6), C1-5276: I.A + (K.1.53) + (B.2.6), C1-5277: I.A + (K.1.54) + (B.2.6), C1- 5278: LA + (A.1.4) + (D.2.6), C1-5279: I.A + (A.1.12) + (D.2.6), C1-5280: LA + (A.1.21) +
(D.2.6), C1-5281 : I.A + (A.121a) + (D.2.6), C1-5282: I.A + (A.1.24) + (D.2.6), C1-5283: I.A +
(A.1.26) + (D.2.6), C1-5284: I.A+ (A.1.27) + (D.2.6), C1-5285: I.A+ (A.1.30) + (D.2.6), C1- 5286: I.A+ (A.1.31) + (D.2.6), C1-5287: I.A+ (A.1.32) + (D.2.6), C1-5288: I.A+ (A.1.35) + (D.2.6), C1-5289: I.A+ (A.2.1) + (D.2.6), C1-5290: I.A+ (A.2.3) + (D.2.6), C1-5291: I.A+ (A.2.5) + (D.2.6), C1-5292: I.A+ (A.3.11) + (D.2.6), C1-5293: I.A+ (A.3.12) + (D.2.6), C1-5294: I.A + (A.3.15) + (D.2.6), C1-5295: I. A + (A.3.16) + (D.2.6), C1-5296: I. A + (A.3.18) + (D.2.6), C1- 5297: I.A + (A.3.19) + (D.2.6), C1-5298: I.A + (A.3.20) + (D.2.6), C1-5299: LA + (A.3.21) + (D.2.6), C1-5300: I.A+ (A.3.22) + (D.2.6), C1-5301: I.A+ (A.3.23) + (D.2.6), C1-5302: I.A + (A.3.25) + (D.2.6), C1-5303: I.A + (A.3.26) + (D.2.6), C1-5304: I.A + (A.3.27) + (D.2.6), C1- 5305: LA + (A.4.5) + (D.2.6), C1-5306: I.A+ (A.4.11) + (D.2.6), C1-5307: LA + (B.1.10) +
(D.2.6), C1-5308: I.A+ (B.1.11) + (D.2.6), C1-5309: I.A+ (B.1.12) + (D.2.6), C1-5310: I.A +
(B.1.13) + (D.2.6), C1-5311: I.A + (B.1.18) + (D.2.6), C1-5312: LA + (B.1.21) + (D.2.6), C1- 5313: I.A+ (B.1.26) + (D.2.6), C1-5314: LA + (B.1.33) + (D.2.6), C1-5315: I.A+ (B.1.34) + (D.2.6), C1-5316: I.A+ (B.1.37) + (D.2.6), C1-5317: LA + (B.1.43) + (D.2.6), C1-5318: I.A + (B.1.46) + (D.2.6), C1-5319: I.A+ (B.2.5) + (D.2.6), C1-5320: I.A+ (B.2.8) + (D.2.6), C1-5321: I.A+ (C.1.1) + (D.2.6), C1-5322: LA + (C.1.2) + (D.2.6), C1-5323: I.A+ (C.1.4) + (D.2.6), C1- 5324: I.A + (C.1.5) + (D.2.6), C1-5325: I.A + (C.2.6) + (D.2.6), C1-5326: I.A + (C.2.7) + (D.2.6), C1-5327: I.A+ (C.2.8) + (D.2.6), C1-5328: I.A+ (D.1.1) + (D.2.6), C1-5329: I.A+ (D.1.2) + (D.2.6), C1-5330: I.A+ (D.1.5) + (D.2.6), C1-5331: I.A+ (D.2.4) + (D.2.6), C1-5332: I.A +
(D.2.7) + (D.2.6), C1-5333: I.A + (E.1.1) + (D.2.6), C1-5334: I.A + (E.1.3) + (D.2.6), C1-5335: I.A + (E.2.2) + (D.2.6), C1-5336: I.A + (E.2.3) + (D.2.6), C1-5337: I.A + (F.1.2) + (D.2.6), C1-5338: I.A+ (F.1.4) + (D.2.6), C1-5339: I.A+ (F.1.5) + (D.2.6), C1-5340: I.A+ (G.3.1) + (D.2.6), C1- 5341: LA + (G.3.3) + (D.2.6), C1-5342: I.A+ (G.3.6) + (D.2.6), C1-5343: I.A+ (G.5.1) + (D.2.6), C1-5344: I.A + (G.5.2) + (D.2.6), C1-5345: I.A + (G.5.3) + (D.2.6), C1-5346: I.A + (G.5.4) + (D.2.6), C1-5347: I.A + (G.5.5) + (D.2.6), C1-5348: I.A + (G.5.6) + (D.2.6), C1-5349: I.A +
(G.5.7) + (D.2.6), C1-5350: I.A + (G.5.8) + (D.2.6), C1-5351: I.A + (G.5.9) + (D.2.6), C1-5352:
LA + (G.5.10) + (D.2.6), C1-5353: I.A+ (G.5.11) + (D.2.6), C1-5354: I.A + (H.1.5) + (D.2.6), C1- 5355: I.A + (H.1.7) + (D.2.6), C1-5356: I.A + (H.2.2) + (D.2.6), C1-5357: I.A + (H.2.3) + (D.2.6), C1-5358: I.A + (H.2.5) + (D.2.6), C1-5359: I.A + (H.2.7) + (D.2.6), C1-5360: I.A + (H.2.8) + (D.2.6), C1-5361 : I.A + (H.3.2) + (D.2.6), C1-5362: I.A + (H.3.4) + (D.2.6), C1-5363: I.A +
(H.3.5) + (D.2.6), C1-5364: I.A + (H.4.9) + (D.2.6), C1-5365: I.A + (H.4.10) + (D.2.6), C1-5366: I.A + (1.2.2) + (D.2.6), C1-5367: I.A+ (I.2.5) + (D.2.6), C1-5368: I.A + (J.1.2) + (D.2.6), C1-5369: I.A + (J.1.5) + (D.2.6), C1-5370: I.A + (J.1.8) + (D.2.6), C1-5371: I.A + (J.1.11) + (D.2.6), C1- 5372: I.A + (J.1.12) + (D.2.6), C1-5373: I.A+ (K.1.3) + (D.2.6), C1-5374: LA + (K.1.29) +
(D.2.6), C1-5375: I.A+ (K.1.30) + (D.2.6), C1-5376: I.A+ (K.1.31) + (D.2.6), C1-5377: I.A + (K.1.32) + (D.2.6), C1-5378: I.A + (K.1.41) + (D.2.6), C1-5379: I.A+ (K.1.42) + (D.2.6), C1- 5380: LA + (K.1.44) + (D.2.6), C1-5381: I.A+ (K.1.45) + (D.2.6), C1-5382: LA + (K.1.47) + (D.2.6), C1-5383: I.A + (K.1.49) + (D.2.6), C1-5384: I.A + (K.1.53) + (D.2.6), C1-5385: I.A +
(K.1.54) + (D.2.6), C1-5386: LA + (A.1.4) + (D.2.7), C1-5387: LA + (A.1.12) + (D.2.7), C1-5388: LA + (A.1.21) + (D.2.7), C1-5389: I.A + (A.121a) + (D.2.7), C1-5390: I.A+ (A.1.24) + (D.2.7), C1-5391 : I.A + (A.1.26) + (D.2.7), C1-5392: I.A + (A.1.27) + (D.2.7), C1-5393: I.A + (A.1.30) + (D.2.7), C1-5394: I.A + (A.1.31) + (D.2.7), C1-5395: I.A + (A.1.32) + (D.2.7), C1-5396: I.A + (A.1.35) + (D.2.7), C1-5397: I.A + (A.2.1) + (D.2.7), C1-5398: I.A + (A.2.3) + (D.2.7), C1-5399:
I.A+ (A.2.5) + (D.2.7), C1-5400: I.A+ (A.3.11) + (D.2.7), C1-5401: I.A+ (A.3.12) + (D.2.7), C1- 5402: I.A + (A.3.15) + (D.2.7), C1-5403: I.A + (A.3.16) + (D.2.7), C1-5404: I.A + (A.3.18) + (D.2.7), C1-5405: I.A + (A.3.19) + (D.2.7), C1-5406: I.A + (A.3.20) + (D.2.7), C1-5407: I.A + (A.3.21) + (D.2.7), C1-5408: I.A + (A.3.22) + (D.2.7), C1-5409: I.A + (A.3.23) + (D.2.7), C1- 5410: LA + (A.3.25) + (D.2.7), C1-5411: I.A+ (A.3.26) + (D.2.7), C1-5412: I.A+ (A.3.27) + (D.2.7), C1-5413: I.A+ (A.4.5) + (D.2.7), C1-5414: LA + (A.4.11) + (D.2.7), C1-5415: I.A +
(B.1.10) + (D.2.7), C1-5416: I.A+ (B.1.11) + (D.2.7), C1-5417: LA + (B.1.12) + (D.2.7), C1- 5418: I.A+ (B.1.13) + (D.2.7), C1-5419: I.A+ (B.1.18) + (D.2.7), C1-5420: I.A+ (B.1.21) + (D.2.7), C1-5421 : LA + (B.1.26) + (D.2.7), C1-5422: LA + (B.1.33) + (D.2.7), C1-5423: I.A + (B.1.34) + (D.2.7), C1-5424: LA + (B.1.37) + (D.2.7), C1-5425: I.A+ (B.1.43) + (D.2.7), C1- 5426: I.A + (B.1.46) + (D.2.7), C1-5427: I.A + (B.2.5) + (D.2.7), C1-5428: I.A + (B.2.8) + (D.2.7), C1-5429: I.A+ (C.1.1) + (D.2.7), C1-5430: I.A+ (C.1.2) + (D.2.7), C1-5431: I.A+ (C.1.4) + (D.2.7), C1-5432: LA + (C.1.5) + (D.2.7), C1-5433: I.A+ (C.2.6) + (D.2.7), C1-5434: I.A +
(C.2.7) + (D.2.7), C1-5435: I.A+ (C.2.8) + (D.2.7), C1-5436: I.A+ (D.1.1) + (D.2.7), C1-5437: I.A+ (D.1.2) + (D.2.7), C1-5438: I.A+ (D.1.5) + (D.2.7), C1-5439: I.A+ (D.2.4) + (D.2.7), C1- 5440: I.A + (E.1.1) + (D.2.7), C1-5441: I.A + (E.1.3) + (D.2.7), C1-5442: I.A+ (E.2.2) + (D.2.7), C1-5443: I.A+ (E.2.3) + (D.2.7), C1-5444: LA + (F.1.2) + (D.2.7), C1-5445: I.A+ (F.1.4) + (D.2.7), C1-5446: I.A+ (F.1.5) + (D.2.7), C1-5447: LA + (G.3.1) + (D.2.7), C1-5448: I.A +
(G.3.3) + (D.2.7), C1-5449: I.A+ (G.3.6) + (D.2.7), C1-5450: I.A+ (G.5.1) + (D.2.7), C1-5451:
I.A + (G.5.2) + (D.2.7), C1-5452: I.A + (G.5.3) + (D.2.7), C1-5453: I.A + (G.5.4) + (D.2.7), C1- 5454: I.A + (G.5.5) + (D.2.7), C1-5455: I.A + (G.5.6) + (D.2.7), C1-5456: I.A + (G.5.7) + (D.2.7), C 1-5457: I.A + (G.5.8) + (D.2.7), C1-5458: I.A + (G.5.9) + (D.2.7), C1-5459: I.A + (G.5.10) + (D.2.7), C1-5460: I.A+ (G.5.11) + (D.2.7), C1-5461: I.A + (H.1.5) + (D.2.7), C1-5462: I.A +
(H.1.7) + (D.2.7), C1-5463: I.A + (H.2.2) + (D.2.7), C1-5464: I.A + (H.2.3) + (D.2.7), C1-5465:
I.A + (H.2.5) + (D.2.7), C1-5466: I.A + (H.2.7) + (D.2.7), C1-5467: I.A + (H.2.8) + (D.2.7), C1- 5468: I.A + (H.3.2) + (D.2.7), C1-5469: I.A + (H.3.4) + (D.2.7), C1-5470: I.A + (H.3.5) + (D.2.7), C1-5471 : LA + (H.4.9) + (D.2.7), C1-5472: LA + (H.4.10) + (D.2.7), C1-5473: I.A+ (I.2.2) + (D.2.7), C1-5474: I.A+ (I.2.5) + (D.2.7), C1-5475: I.A + (J.1.2) + (D.2.7), C1-5476: I.A + (J.1.5) + (D.2.7), C 1-5477: I.A + (J.1.8) + (D.2.7), C1-5478: I.A + (J.1.11) + (D.2.7), C1-5479: I.A + (J.1.12) + (D.2.7), C1-5480: I.A+ (K.1.3) + (D.2.7), C1-5481: I.A+ (K.1.29) + (D.2.7), C1-5482: LA + (K.1.30) + (D.2.7), C1-5483: I.A+ (K.1.31) + (D.2.7), C1-5484: LA + (K.1.32) + (D.2.7), C1- 5485: LA + (K.1.41) + (D.2.7), C1-5486: I.A+ (K.1.42) + (D.2.7), C1-5487: LA + (K.1.44) + (D.2.7), C1-5488: I.A + (K.1.45) + (D.2.7), C1-5489: I.A + (K.1.47) + (D.2.7), C1-5490: I.A +
(K.1.49) + (D.2.7), C1-5491 : I.A + (K.1.53) + (D.2.7), C1-5492: I.A + (K.1.54) + (D.2.7), C1- 5493: LA + (A.1.4) + (E.1.1), C1-5494: LA + (A.1.12) + (E.1.1), C1-5495: I.A+ (A.1.21) +
(E.1.1), C1-5496: I.A + (A.121a) + (E.1.1), C1-5497: LA + (A.1.24) + (E.1.1), C1-5498: I.A +
(A.1.26) + (E.1.1), C1-5499: LA + (A.1.27) + (E.1.1), C1-5500: LA + (A.1.30) + (E.1.1), C1-5501: LA + (A.1.31) + (E.1.1), C1-5502: LA + (A.1.32) + (E.1.1), C1-5503: I.A+ (A.1.35) + (E.1.1), C1- 5504: LA + (A.2.1) + (E.1.1), C1-5505: I.A+ (A.2.3) + (E.1.1), C1-5506: I.A + (A.2.5) + (E.1.1), C1-5507: I.A + (A.3.11) + (E.1.1), C1-5508: I.A + (A.3.12) + (E.1.1), C1-5509: I.A + (A.3.15) + (E.1.1), C1-5510: I.A+ (A.3.16) + (E.1.1), C1-5511: I.A+ (A.3.18) + (E.1.1), C1-5512: I.A + (A.3.19) + (E.1.1), C1-5513: I.A + (A.3.20) + (E.1.1), C1-5514: I.A + (A.3.21) + (E.1.1), C1-5515:
I.A+ (A.3.22) + (E.1.1), C1-5516: I.A+ (A.3.23) + (E.1.1), C1-5517: I.A+ (A.3.25) + (E.1.1), C1- 5518: I.A+ (A.3.26) + (E.1.1), C1-5519: I.A+ (A.3.27) + (E.1.1), C1-5520: I.A+ (A.4.5) +
(E.1.1), C1-5521 : I.A+ (A.4.11) + (E.1.1), C1-5522: I.A+ (B.1.10) + (E.1.1), C1-5523: I.A + (B.1.11) + (E.1.1), C1-5524: I.A+ (B.1.12) + (E.1.1), C1-5525: I.A+ (B.1.13) + (E.1.1), C1-5526: I.A+ (B.1.18) + (E.1.1), C 1-5527: I.A+ (B.1.21) + (E.1.1), C1-5528: I.A+ (B.1.26) + (E.1.1), C1- 5529: I.A+ (B.1.33) + (E.1.1), C1-5530: I.A+ (B.1.34) + (E.1.1), C1-5531: I.A+ (B.1.37) + (E.1.1), C1-5532: I.A+ (B.1.43) + (E.1.1), C1-5533: I.A+ (B.1.46) + (E.1.1), C1-5534: I.A + (B.2.5) + (E.1.1), C1-5535: I.A+ (B.2.8) + (E.1.1), C1-5536: I.A+ (C.1.1) + (E.1.1), C1-5537: I.A + (C.1.2) + (E.1.1), C1-5538: I.A+ (C.1.4) + (E.1.1), C1-5539: I.A+ (C.1.5) + (E.1.1), C1-5540: I.A+ (C.2.6) + (E.1.1), C1-5541 : I.A+ (C.2.7) + (E.1.1), C1-5542: I.A+ (C.2.8) + (E.1.1), C1- 5543: I.A+ (D.1.1) + (E.1.1), C1-5544: I.A+ (D.1.2) + (E.1.1), C1-5545: I.A+ (D.1.5) + (E.1.1), C1-5546: I.A+ (D.2.4) + (E.1.1), C1-5547: I.A+ (E.1.3) + (E.1.1), C1-5548: I.A+ (E.2.2) + (E.1.1), C1-5549: I.A+ (E.2.3) + (E.1.1), C1-5550: I.A+ (F.1.2) + (E.1.1), C1-5551: I.A+ (F.1.4) + (E.1.1), C1-5552: I.A+ (F.1.5) + (E.1.1), C1-5553: I.A+ (G.3.1) + (E.1.1), C1-5554: I.A + (G.3.3) + (E.1.1), C1-5555: I.A+ (G.3.6) + (E.1.1), C1-5556: I.A+ (G.5.1) + (E.1.1), C1-5557:
I.A + (G.5.2) + (E.1.1), C1-5558: I.A+ (G.5.3) + (E.1.1), C1-5559: I.A+ (G.5.4) + (E.1.1), C1- 5560: I.A + (G.5.5) + (E.1.1), C1-5561: I.A+ (G.5.6) + (E.1.1), C1-5562: I.A+ (G.5.7) + (E.1.1), C1-5563: I.A+ (G.5.8) + (E.1.1), C1-5564: I.A+ (G.5.9) + (E.1.1), C1-5565: I.A+ (G.5.10) + (E.1.1), C1-5566: I.A+ (G.5.11) + (E.1.1), C1-5567: I.A + (H.1.5) + (E.1.1), C1-5568: I.A + (H.1.7) + (E.1.1), C1-5569: I.A+ (H.2.2) + (E.1.1), C1-5570: I.A+ (H.2.3) + (E.1.1), C1-5571: I.A + (H.2.5) + (E.1.1), C1-5572: I.A+ (H.2.7) + (E.1.1), C1-5573: I.A+ (H.2.8) + (E.1.1), C1-5574: I.A + (H.3.2) + (E.1.1), C1-5575: I.A+ (H.3.4) + (E.1.1), C1-5576: I.A+ (H.3.5) + (E.1.1), C1- 5577: I.A + (H.4.9) + (E.1.1), C1-5578: I.A+ (H.4.10) + (E.1.1), C1-5579: I.A+ (I.2.2) + (E.1.1), C1-5580: I.A+ (I.2.5) + (E.1.1), C1-5581: I.A + (J.1.2) + (E.1.1), C1-5582: I.A + (J.1.5) + (E.1.1), C1-5583: I.A + (J.1.8) + (E.1.1), C1-5584: I.A + (J.1.11) + (E.1.1), C1-5585: I.A + (J.1.12) + (E.1.1), C1-5586: I.A+ (K.1.3) + (E.1.1), C1-5587: I.A+ (K.1.29) + (E.1.1), C1-5588: I.A + (K.1.30) + (E.1.1), C1-5589: I.A+ (K.1.31) + (E.1.1), C1-5590: I.A+ (K.1.32) + (E.1.1), C1-5591: I.A+ (K.1.41) + (E.1.1), C1-5592: I.A+ (K.1.42) + (E.1.1), C1-5593: I.A + (K.1.44) + (E.1.1), C1- 5594: I.A+ (K.1.45) + (E.1.1), C1-5595: I.A+ (K.1.47) + (E.1.1), C1-5596: I.A+ (K.1.49) + (E.1.1), C 1-5597: I.A+ (K.1.53) + (E.1.1), C1-5598: I.A+ (K.1.54) + (E.1.1), C1-5599: I.A +
(A.1.4) + (H.1.5), C1-5600: I.A+ (A.1.12) + (H.1.5), C1-5601: I.A+ (A.1.21) + (H.1.5), C1-5602: I.A + (A.121a) + (H.1.5), C1-5603: I.A + (A.1.24) + (H.1.5), C1-5604: LA + (A.1.26) + (H.1.5), C1-5605: LA + (A.1.27) + (H.1.5), C1-5606: I.A+ (A.1.30) + (H.1.5), C1-5607: LA + (A.1.31) + (H.1.5), C1-5608: LA + (A.1.32) + (H.1.5), C1-5609: LA + (A.1.35) + (H.1.5), C1-5610: I.A + (A.2.1) + (H.1.5), C1-5611: I.A+ (A.2.3) + (H.1.5), C1-5612: I.A+ (A.2.5) + (H.1.5), C1-5613: I.A + (A.3.11) + (H.1.5), C1-5614: LA + (A.3.12) + (H.1.5), C1-5615: I.A+ (A.3.15) + (H.1.5), C1- 5616: LA + (A.3.16) + (H.1.5), C1-5617: LA + (A.3.18) + (H.1.5), C1-5618: I.A+ (A.3.19) + (H.1.5), C1-5619: I.A+ (A.3.20) + (H.1.5), C1-5620: I.A+ (A.3.21) + (H.1.5), C1-5621: I.A + (A.3.22) + (H.1.5), C1-5622: I.A + (A.3.23) + (H.1.5), C1-5623: I.A + (A.3.25) + (H.1.5), C1- 5624: I.A + (A.3.26) + (H.1.5), C1-5625: I.A + (A.3.27) + (H.1.5), C1-5626: I.A + (A.4.5) +
(H.1.5), C 1-5627: I.A + (A.4.11) + (H.1.5), C1-5628: I.A + (B.1.10) + (H.1.5), C1-5629: I.A + (B.1.11) + (H.1.5), C1-5630: I.A+ (B.1.12) + (H.1.5), C1-5631: I.A+ (B.1.13) + (H.1.5), C1-
5632: I.A+ (B.1.18) + (H.1.5), C1-5633: I.A+ (B.1.21) + (H.1.5), C1-5634: I.A+ (B.1.26) + (H.1.5), C1-5635: I.A+ (B.1.33) + (H.1.5), C1-5636: I.A+ (B.1.34) + (H.1.5), C1-5637: I.A + (B.1.37) + (H.1.5), C1-5638: I.A+ (B.1.43) + (H.1.5), C1-5639: I.A+ (B.1.46) + (H.1.5), C1- 5640: I.A+ (B.2.5) + (H.1.5), C1-5641: I.A+ (B.2.8) + (H.1.5), C1-5642: I.A+ (C.1.1) + (H.1.5), C1-5643: I.A+ (C.1.2) + (H.1.5), C1-5644: I.A+ (C.1.4) + (H.1.5), C1-5645: I.A+ (C.1.5) + (H.1.5), C1-5646: I.A+ (C.2.6) + (H.1.5), C1-5647: I.A+ (C.2.7) + (H.1.5), C1-5648: I.A +
(C.2.8) + (H.1.5), C1-5649: I.A+ (D.1.1) + (H.1.5), C1-5650: I.A+ (D.1.2) + (H.1.5), C1-5651: I.A+ (D.1.5) + (H.1.5), C 1-5652: I.A+ (D.2.4) + (H.1.5), C1-5653: I.A+ (E.1.3) + (H.1.5), C1- 5654: I.A+ (E.2.2) + (H.1.5), C1-5655: I.A+ (E.2.3) + (H.1.5), C1-5656: I.A+ (F.1.2) + (H.1.5),
C 1-5657: I.A+ (F.1.4) + (H.1.5), C1-5658: I.A+ (F.1.5) + (H.1.5), C1-5659: I.A+ (G.3.1) + (H.1.5), C1-5660: I.A+ (G.3.3) + (H.1.5), C1-5661: I.A+ (G.3.6) + (H.1.5), C1-5662: I.A +
(G.5.1) + (H.1.5), C1-5663: I.A+ (G.5.2) + (H.1.5), C1-5664: I.A+ (G.5.3) + (H.1.5), C1-5665: I.A+ (G.5.4) + (H.1.5), C1-5666: I.A+ (G.5.5) + (H.1.5), C1-5667: I.A+ (G.5.6) + (H.1.5), C1- 5668: I.A+ (G.5.7) + (H.1.5), C1-5669: I.A+ (G.5.8) + (H.1.5), C1-5670: I.A+ (G.5.9) + (H.1.5), C1-5671 : I.A+ (G.5.10) + (H.1.5), C1-5672: I.A+ (G.5.11) + (H.1.5), C1-5673: I.A+ (H.1.7) + (H.1.5), C1-5674: I.A+ (H.2.2) + (H.1.5), C1-5675: I.A+ (H.2.3) + (H.1.5), C1-5676: I.A +
(H.2.5) + (H.1.5), C 1-5677: I.A+ (H.2.7) + (H.1.5), C1-5678: I.A+ (H.2.8) + (H.1.5), C1-5679: I.A+ (H.3.2) + (H.1.5), C1-5680: I.A+ (H.3.4) + (H.1.5), C1-5681: I.A+ (H.3.5) + (H.1.5), C1- 5682: I.A+ (H.4.9) + (H.1.5), C1-5683: I.A+ (H.4.10) + (H.1.5), C1-5684: I.A+ (I.2.2) + (H.1.5), C1-5685: I.A+ (I.2.5) + (H.1.5), C1-5686: I.A+ (J.1.2) + (H.1.5), C1-5687: I.A+ (J.1.5) + (H.1.5), C1-5688: I.A+ (J.1.8) + (H.1.5), C1-5689: I.A+ (J.1.11) + (H.1.5), C1-5690: I.A+ (J.1.12) + (H.1.5), C1-5691 : I.A+ (K.1.3) + (H.1.5), C1-5692: I.A+ (K.1.29) + (H.1.5), C1-5693: I.A + (K.1.30) + (H.1.5), C1-5694: I.A+ (K.1.31) + (H.1.5), C1-5695: I.A+ (K.1.32) + (H.1.5), C1- 5696: I.A+ (K.1.41) + (H.1.5), C1-5697: I.A+ (K.1.42) + (H.1.5), C1-5698: I.A+ (K.1.44) + (H.1.5), C1-5699: I.A+ (K.1.45) + (H.1.5), C1-5700: I.A+ (K.1.47) + (H.1.5), C1-5701: I.A + (K.1.49) + (H.1.5), C1-5702: I.A+ (K.1.53) + (H.1.5), C1-5703: I.A+ (K.1.54) + (H.1.5), C1- 5704: I.A + (A.1.4) + (H.1.7), C1-5705: I.A+ (A.1.12) + (H.1.7), C1-5706: I.A+ (A.1.21) +
(H.1.7), C1-5707: I.A + (A.121a) + (H.1.7), C1-5708: I.A + (A.1.24) + (H.1.7), C1-5709: I.A + (A.1.26) + (H.1.7), C1-5710: LA + (A.1.27) + (H.1.7), C1-5711: LA + (A.1.30) + (H.1.7), C1- 5712: LA + (A.1.31) + (H.1.7), C1-5713: LA + (A.1.32) + (H.1.7), C1-5714: LA + (A.1.35) + (H.1.7), C1-5715: LA + (A.2.1) + (H.1.7), C1-5716: I.A+ (A.2.3) + (H.1.7), C1-5717: I.A+ (A.2.5) + (H.1.7), C1-5718: LA + (A.3.11) + (H.1.7), C1-5719: LA + (A.3.12) + (H.1.7), C1-5720: I.A + (A.3.15) + (H.1.7), C1-5721 : LA + (A.3.16) + (H.1.7), C1-5722: LA + (A.3.18) + (H.1.7), C1- 5723: LA + (A.3.19) + (H.1.7), C1-5724: I.A+ (A.3.20) + (H.1.7), C1-5725: LA + (A.3.21) + (H.1.7), C1-5726: I.A+ (A.3.22) + (H.1.7), C1-5727: I.A+ (A.3.23) + (H.1.7), C1-5728: I.A + (A.3.25) + (H.1.7), C1-5729: I.A+ (A.3.26) + (H.1.7), C1-5730: I.A+ (A.3.27) + (H.1.7), C1- 5731: LA + (A.4.5) + (H.1.7), C1-5732: LA + (A.4.11) + (H.1.7), C1-5733: LA + (B.1.10) +
(H.1.7), C1-5734: LA + (B.1.11) + (H.1.7), C1-5735: LA + (B.1.12) + (H.1.7), C1-5736: I.A +
(B.1.13) + (H.1.7), C1-5737: I.A + (B.1.18) + (H.1.7), C1-5738: I.A + (B.1.21) + (H.1.7), C1- 5739: I.A + (B.1.26) + (H.1.7), C1-5740: I.A + (B.1.33) + (H.1.7), C1-5741: I.A + (B.1.34) + (H.1.7), C1-5742: I.A + (B.1.37) + (H.1.7), C1-5743: I.A + (B.1.43) + (H.1.7), C1-5744: I.A + (B.1.46) + (H.1.7), C1-5745: I.A + (B.2.5) + (H.1.7), C1-5746: I.A + (B.2.8) + (H.1.7), C1-5747:
I.A+ (C.1.1) + (H.1.7), C1-5748: I.A+ (C.1.2) + (H.1.7), C1-5749: I.A+ (C.1.4) + (H.1.7), C1- 5750: I.A+ (C.1.5) + (H.1.7), C1-5751: I.A+ (C.2.6) + (H.1.7), C1-5752: I.A+ (C.2.7) + (H.1.7), C1-5753: I.A+ (C.2.8) + (H.1.7), C1-5754: I.A+ (D.1.1) + (H.1.7), C1-5755: I.A+ (D.1.2) + (H.1.7), C1-5756: I.A+ (D.1.5) + (H.1.7), C1-5757: I.A+ (D.2.4) + (H.1.7), C1-5758: I.A+ (E.1.3) + (H.1.7), C1-5759: I.A+ (E.2.2) + (H.1.7), C1-5760: I.A+ (E.2.3) + (H.1.7), C1-5761: I.A + (F.1.2) + (H.1.7), C1-5762: I.A+ (F.1.4) + (H.1.7), C1-5763: I.A+ (F.1.5) + (H.1.7), C1-5764: I.A + (G.3.1) + (H.1.7), C1-5765: I.A+ (G.3.3) + (H.1.7), C1-5766: I.A+ (G.3.6) + (H.1.7), C1-5767: I.A + (G.5.1) + (H.1.7), C1-5768: I.A+ (G.5.2) + (H.1.7), C1-5769: I.A+ (G.5.3) + (H.1.7), C1- 5770: I.A + (G.5.4) + (H.1.7), C1-5771: I.A+ (G.5.5) + (H.1.7), C1-5772: I.A+ (G.5.6) + (H.1.7), C1-5773: I.A+ (G.5.7) + (H.1.7), C1-5774: I.A+ (G.5.8) + (H.1.7), C1-5775: I.A+ (G.5.9) + (H.1.7), C1-5776: I.A+ (G.5.10) + (H.1.7), C1-5777: I.A+ (G.5.11) + (H.1.7), C1-5778: I.A + (H.2.2) + (H.1.7), C1-5779: I.A+ (H.2.3) + (H.1.7), C1-5780: I.A+ (H.2.5) + (H.1.7), C1-5781:
I.A + (H.2.7) + (H.1.7), C1-5782: I.A+ (H.2.8) + (H.1.7), C1-5783: I.A+ (H.3.2) + (H.1.7), C1- 5784: I.A + (H.3.4) + (H.1.7), C1-5785: I.A+ (H.3.5) + (H.1.7), C1-5786: I.A+ (H.4.9) + (H.1.7), C1-5787: I.A+ (H.4.10) + (H.1.7), C1-5788: I.A+ (I.2.2) + (H.1.7), C1-5789: I.A+ (I.2.5) + (H.1.7), C1-5790: I.A + (J.1.2) + (H.1.7), C1-5791: I.A + (J.1.5) + (H.1.7), C1-5792: I.A + (J.1.8)
+ (H.1.7), C1-5793: I.A + (J.1.11) + (H.1.7), C1-5794: I.A + (J.1.12) + (H.1.7), C1-5795: I.A + (K.1.3) + (H.1.7), C1-5796: I.A+ (K.1.29) + (H.1.7), C1-5797: I.A+ (K.1.30) + (H.1.7), C1-5798: I.A+ (K.1.31) + (H.1.7), C1-5799: I.A+ (K.1.32) + (H.1.7), C1-5800: I.A+ (K.1.41) + (H.1.7), C1- 5801: I.A+ (K.1.42) + (H.1.7), C1-5802: I.A+ (K.1.44) + (H.1.7), C1-5803: I.A+ (K.1.45) + (H.1.7), C1-5804: I.A+ (K.1.47) + (H.1.7), C1-5805: I.A+ (K.1.49) + (H.1.7), C1-5806: I.A + (K.1.53) + (H.1.7), C1-5807: I.A+ (K.1.54) + (H.1.7), C1-5808: I.A + (A.1.4) + (H.2.2), C1-5809: I.A+ (A.1.12) + (H.2.2), C1-5810: I.A+ (A.1.21) + (H.2.2), C1-5811: I.A + (A.121a) + (H.2.2), C1-5812: LA + (A.1.24) + (H.2.2), C1-5813: LA + (A.1.26) + (H.2.2), C1-5814: LA + (A.1.27) + (H.2.2), C1-5815: I.A+ (A.1.30) + (H.2.2), C1-5816: I.A+ (A.1.31) + (H.2.2), C1-5817: I.A + (A.1.32) + (H.2.2), C1-5818: I.A+ (A.1.35) + (H.2.2), C1-5819: I.A+ (A.2.1) + (H.2.2), C1-5820: LA + (A.2.3) + (H.2.2), C1-5821: I.A+ (A.2.5) + (H.2.2), C1-5822: LA + (A.3.11) + (H.2.2), C1- 5823: I.A + (A.3.12) + (H.2.2), C1-5824: I.A + (A.3.15) + (H.2.2), C1-5825: I.A + (A.3.16) + (H.2.2), C1-5826: I.A + (A.3.18) + (H.2.2), C1-5827: I.A + (A.3.19) + (H.2.2), C1-5828: I.A + (A.3.20) + (H.2.2), C1-5829: I.A + (A.3.21) + (H.2.2), C1-5830: I.A + (A.3.22) + (H.2.2), C1- 5831: LA + (A.3.23) + (H.2.2), C1-5832: I.A+ (A.3.25) + (H.2.2), C1-5833: I.A+ (A.3.26) + (H.2.2), C1-5834: I.A + (A.3.27) + (H.2.2), C1-5835: I.A + (A.4.5) + (H.2.2), C1-5836: I.A + (A.4.11) + (H.2.2), C1-5837: LA + (B.1.10) + (H.2.2), C1-5838: I.A + (B.1.11) + (H.2.2), C1- 5839: I.A+ (B.1.12) + (H.2.2), C1-5840: I.A+ (B.1.13) + (H.2.2), C1-5841: LA + (B.1.18) + (H.2.2), C1-5842: LA + (B.1.21) + (H.2.2), C1-5843: I.A+ (B.1.26) + (H.2.2), C1-5844: I.A + (B.1.33) + (H.2.2), C1-5845: I.A+ (B.1.34) + (H.2.2), C1-5846: I.A+ (B.1.37) + (H.2.2), C1- 5847: I.A + (B.1.43) + (H.2.2), C1-5848: I.A + (B.1.46) + (H.2.2), C1-5849: I.A + (B.2.5) +
(H.2.2), C1-5850: I.A+ (B.2.8) + (H.2.2), C1-5851: I.A + (C.1.1) + (H.2.2), C1-5852: I.A + (C.1.2) + (H.2.2), C1-5853: I.A + (C.1.4) + (H.2.2), C1-5854: I.A + (C.1.5) + (H.2.2), C1-5855: I.A + (C.2.6) + (H.2.2), C1-5856: I.A + (C.2.7) + (H.2.2), C1-5857: I.A + (C.2.8) + (H.2.2), C1-5858:
I.A + (D.1.1) + (H.2.2), C1-5859: I.A + (D.1.2) + (H.2.2), C1-5860: I.A + (D.1.5) + (H.2.2), C1- 5861: I.A + (D.2.4) + (H.2.2), C1-5862: I.A + (E.1.3) + (H.2.2), C1-5863: I.A + (E.2.2) + (H.2.2),
C1-5864: I.A+ (E.2.3) + (H.2.2), C1-5865: I.A+ (F.1.2) + (H.2.2), C1-5866: I.A+ (F.1.4) + (H.2.2), C 1-5867: I.A+ (F.1.5) + (H.2.2), C1-5868: I.A+ (G.3.1) + (H.2.2), C1-5869: I.A +
(G.3.3) + (H.2.2), C1-5870: I.A+ (G.3.6) + (H.2.2), C1-5871: I.A+ (G.5.1) + (H.2.2), C1-5872:
I.A + (G.5.2) + (H.2.2), C1-5873: I.A + (G.5.3) + (H.2.2), C1-5874: I.A + (G.5.4) + (H.2.2), C1- 5875: I.A + (G.5.5) + (H.2.2), C1-5876: I.A + (G.5.6) + (H.2.2), C1-5877: I.A + (G.5.7) + (H.2.2), C1-5878: I.A + (G.5.8) + (H.2.2), C1-5879: I.A + (G.5.9) + (H.2.2), C1-5880: I.A + (G.5.10) + (H.2.2), C1-5881 : I.A+ (G.5.11) + (H.2.2), C1-5882: I.A+ (H.2.3) + (H.2.2), C1-5883: I.A + (H.2.5) + (H.2.2), C1-5884: I.A + (H.2.7) + (H.2.2), C1-5885: I.A + (H.2.8) + (H.2.2), C1-5886:
I.A + (H.3.2) + (H.2.2), C1-5887: I.A + (H.3.4) + (H.2.2), C1-5888: I.A + (H.3.5) + (H.2.2), C1- 5889: LA + (H.4.9) + (H.2.2), C1-5890: I.A+ (H.4.10) + (H.2.2), C1-5891: I.A+ (I.2.2) + (H.2.2), C1-5892: I.A+ (I.2.5) + (H.2.2), C1-5893: I.A + (J.1.2) + (H.2.2), C1-5894: I.A + (J.1.5) + (H.2.2), C1-5895: I.A + (J.1.8) + (H.2.2), C1-5896: I.A + (J.1.11) + (H.2.2), C1-5897: I.A + (J.1.12) + (H.2.2), C1-5898: I.A+ (K.1.3) + (H.2.2), C1-5899: I.A+ (K.1.29) + (H.2.2), C1-5900: I.A + (K.1.30) + (H.2.2), C1-5901 : I.A+ (K.1.31) + (H.2.2), C1-5902: I.A+ (K.1.32) + (H.2.2), C1- 5903: LA + (K.1.41) + (H.2.2), C1-5904: I.A+ (K.1.42) + (H.2.2), C1-5905: I.A+ (K.1.44) + (H.2.2), C1-5906: I.A + (K.1.45) + (H.2.2), C1-5907: I.A + (K.1.47) + (H.2.2), C1-5908: I.A +
(K.1.49) + (H.2.2), C1-5909: LA + (K.1.53) + (H.2.2), C1-5910: LA + (K.1.54) + (H.2.2), C1- 5911: LA + (A.1.4) + (H.3.2), C1-5912: I.A+ (A.1.12) + (H.3.2), C1-5913: I.A+ (A.1.21) +
(H.3.2), C1-5914: I.A + (A.121a) + (H.3.2), C1-5915: LA + (A.1.24) + (H.3.2), C1-5916: I.A +
(A.1.26) + (H.3.2), C1-5917: LA + (A.1.27) + (H.3.2), C1-5918: LA + (A.1.30) + (H.3.2), C1- 5919: LA + (A.1.31) + (H.3.2), C1-5920: I.A+ (A.1.32) + (H.3.2), C1-5921: I.A+ (A.1.35) + (H.3.2), C1-5922: I.A + (A.2.1) + (H.3.2), C1-5923: I.A + (A.2.3) + (H.3.2), C1-5924: I.A + (A.2.5) + (H.3.2), C1-5925: I.A+ (A.3.11) + (H.3.2), C1-5926: I.A+ (A.3.12) + (H.3.2), C1-5927: I.A + (A.3.15) + (H.3.2), C1-5928: I.A + (A.3.16) + (H.3.2), C1-5929: I.A + (A.3.18) + (H.3.2), C1- 5930: LA + (A.3.19) + (H.3.2), C1-5931: I.A+ (A.3.20) + (H.3.2), C1-5932: I.A+ (A.3.21) + (H.3.2), C1-5933: I.A + (A.3.22) + (H.3.2), C1-5934: I.A + (A.3.23) + (H.3.2), C1-5935: I.A + (A.3.25) + (H.3.2), C1-5936: I.A + (A.3.26) + (H.3.2), C1-5937: I.A + (A.3.27) + (H.3.2), C1- 5938: LA + (A.4.5) + (H.3.2), C1-5939: I.A+ (A.4.11) + (H.3.2), C1-5940: I.A+ (B.1.10) +
(H.3.2), C1-5941 : I.A+ (B.1.11) + (H.3.2), C1-5942: I.A+ (B.1.12) + (H.3.2), C1-5943: I.A +
(B.1.13) + (H.3.2), C1-5944: I.A+ (B.1.18) + (H.3.2), C1-5945: I.A+ (B.1.21) + (H.3.2), C1- 5946: I.A + (B.1.26) + (H.3.2), C1-5947: I.A + (B.1.33) + (H.3.2), C1-5948: I.A + (B.1.34) + (H.3.2), C1-5949: I.A + (B.1.37) + (H.3.2), C1-5950: I.A + (B.1.43) + (H.3.2), C1-5951: I.A +
(B.1.46) + (H.3.2), C1-5952: I.A + (B.2.5) + (H.3.2), C1-5953: I.A + (B.2.8) + (H.3.2), C1-5954: I.A+ (C.1.1) + (H.3.2), C1-5955: I.A+ (C.1.2) + (H.3.2), C1-5956: I.A+ (C.1.4) + (H.3.2), C1- 5957: I.A + (C.1.5) + (H.3.2), C1-5958: I.A + (C.2.6) + (H.3.2), C1-5959: I.A + (C.2.7) + (H.3.2), C1-5960: I.A+ (C.2.8) + (H.3.2), C1-5961: I.A+ (D.1.1) + (H.3.2), C1-5962: I.A+ (D.1.2) + (H.3.2), C1-5963: I.A+ (D.1.5) + (H.3.2), C1-5964: I.A+ (D.2.4) + (H.3.2), C1-5965: I.A + (E.1.3) + (H.3.2), C1-5966: I.A + (E.2.2) + (H.3.2), C1-5967: I.A + (E.2.3) + (H.3.2), C1-5968: I.A + (F.1.2) + (H.3.2), C1-5969: I.A + (F.1.4) + (H.3.2), C1-5970: I.A + (F.1.5) + (H.3.2), C1-5971: I.A + (G.3.1) + (H.3.2), C1-5972: I.A + (G.3.3) + (H.3.2), C1-5973: I.A + (G.3.6) + (H.3.2), C1-5974: I.A + (G.5.1) + (H.3.2), C1-5975: I.A + (G.5.2) + (H.3.2), C1-5976: I.A + (G.5.3) + (H.3.2), C1- 5977: I.A + (G.5.4) + (H.3.2), C1-5978: I.A + (G.5.5) + (H.3.2), C1-5979: I.A + (G.5.6) + (H.3.2),
C1-5980: I.A+ (G.5.7) + (H.3.2), C1-5981: I.A+ (G.5.8) + (H.3.2), C1-5982: I.A+ (G.5.9) + (H.3.2), C1-5983: I.A+ (G.5.10) + (H.3.2), C1-5984: I.A+ (G.5.11) + (H.3.2), C1-5985: I.A + (H.2.3) + (H.3.2), C1-5986: I. A + (H.2.5) + (H.3.2), C1-5987: I. A + (H.2.7) + (H.3.2), C1-5988:
I.A + (H.2.8) + (H.3.2), C1-5989: I.A + (H.3.4) + (H.3.2), C1-5990: I.A + (H.3.5) + (H.3.2), C1- 5991: I.A + (H.4.9) + (H.3.2), C1-5992: I.A + (H.4.10) + (H.3.2), C1-5993: I.A + (I.2.2) + (H.3.2), C1-5994: I.A+ (I.2.5) + (H.3.2), C1-5995: I.A + (J.1.2) + (H.3.2), C1-5996: I.A + (J.1.5) + (H.3.2), C1-5997: I.A + (J.1.8) + (H.3.2), C1-5998: I.A + (J.1.11) + (H.3.2), C1-5999: I.A + (J.1.12) + (H.3.2), C1-6000: I.A+ (K.1.3) + (H.3.2), C1-6001: I.A+ (K.1.29) + (H.3.2), C1-6002: I.A + (K.1.30) + (H.3.2), C1-6003: I.A+ (K.1.31) + (H.3.2), C1-6004: I.A+ (K.1.32) + (H.3.2), C1- 6005: LA + (K.1.41) + (H.3.2), C1-6006: I.A+ (K.1.42) + (H.3.2), C1-6007: I.A+ (K.1.44) + (H.3.2), C1-6008: I.A+ (K.1.45) + (H.3.2), C1-6009: I.A+ (K.1.47) + (H.3.2), C1-6010: I.A +
(K.1.49) + (H.3.2), C1-6011: I.A+ (K.1.53) + (H.3.2), C1-6012: I.A+ (K.1.54) + (H.3.2), C1- 6013: LA + (A.1.4) + (H.3.5), C1-6014: I.A+ (A.1.12) + (H.3.5), C1-6015: I.A+ (A.1.21) +
(H.3.5), C1-6016: I.A + (A.121a) + (H.3.5), C1-6017: LA + (A.1.24) + (H.3.5), C1-6018: I.A +
(A.1.26) + (H.3.5), C1-6019: LA + (A.1.27) + (H.3.5), C1-6020: LA + (A.1.30) + (H.3.5), C1- 6021: LA + (A.1.31) + (H.3.5), C1-6022: I.A + (A.1.32) + (H.3.5), C1-6023: I.A+ (A.1.35) + (H.3.5), C1-6024: I.A + (A.2.1) + (H.3.5), C1-6025: I.A + (A.2.3) + (H.3.5), C1-6026: I.A + (A.2.5) + (H.3.5), C 1-6027: I.A+ (A.3.11) + (H.3.5), C1-6028: I.A+ (A.3.12) + (H.3.5), C1-6029: I.A + (A.3.15) + (H.3.5), C1-6030: I.A+ (A.3.16) + (H.3.5), C1-6031: I.A+ (A.3.18) + (H.3.5), C1- 6032: I.A + (A.3.19) + (H.3.5), C1-6033: I.A + (A.3.20) + (H.3.5), C1-6034: I.A + (A.3.21) + (H.3.5), C1-6035: I.A + (A.3.22) + (H.3.5), C1-6036: I.A + (A.3.23) + (H.3.5), C1-6037: I.A + (A.3.25) + (H.3.5), C1-6038: I.A + (A.3.26) + (H.3.5), C1-6039: I.A + (A.3.27) + (H.3.5), C1- 6040: LA + (A.4.5) + (H.3.5), C1-6041: I.A+ (A.4.11) + (H.3.5), C1-6042: I.A+ (B.1.10) +
(H.3.5), C1-6043: I.A+ (B.1.11) + (H.3.5), C1-6044: I.A+ (B.1.12) + (H.3.5), C1-6045: I.A +
(B.1.13) + (H.3.5), C1-6046: I.A+ (B.1.18) + (H.3.5), C1-6047: I.A+ (B.1.21) + (H.3.5), C1- 6048: I.A + (B.1.26) + (H.3.5), C1-6049: I.A + (B.1.33) + (H.3.5), C1-6050: I.A + (B.1.34) + (H.3.5), C1-6051 : I.A + (B.1.37) + (H.3.5), C1-6052: I.A + (B.1.43) + (H.3.5), C1-6053: I.A +
(B.1.46) + (H.3.5), C1-6054: I.A + (B.2.5) + (H.3.5), C1-6055: I.A + (B.2.8) + (H.3.5), C1-6056: I.A+ (C.1.1) + (H.3.5), C 1-6057: I.A+ (C.1.2) + (H.3.5), C1-6058: I.A+ (C.1.4) + (H.3.5), C1- 6059: LA + (C.1.5) + (H.3.5), C1-6060: I.A+ (C.2.6) + (H.3.5), C1-6061: I.A+ (C.2.7) + (H.3.5), C1-6062: I.A+ (C.2.8) + (H.3.5), C1-6063: I.A+ (D.1.1) + (H.3.5), C1-6064: I.A+ (D.1.2) + (H.3.5), C1-6065: I.A+ (D.1.5) + (H.3.5), C1-6066: I.A+ (D.2.4) + (H.3.5), C1-6067: I.A + (E.1.3) + (H.3.5), C1-6068: I.A + (E.2.2) + (H.3.5), C1-6069: I.A + (E.2.3) + (H.3.5), C1-6070: I.A + (F.1.2) + (H.3.5), C1-6071 : I.A+ (F.1.4) + (H.3.5), C1-6072: I.A+ (F.1.5) + (H.3.5), C1-6073: I.A + (G.3.1) + (H.3.5), C1-6074: I.A + (G.3.3) + (H.3.5), C1-6075: I.A + (G.3.6) + (H.3.5), C1-6076: I.A + (G.5.1) + (H.3.5), C1-6077: I.A + (G.5.2) + (H.3.5), C1-6078: I.A + (G.5.3) + (H.3.5), C1- 6079: I.A + (G.5.4) + (H.3.5), C1-6080: I.A + (G.5.5) + (H.3.5), C1-6081: I.A + (G.5.6) + (H.3.5), C1-6082: I.A + (G.5.7) + (H.3.5), C1-6083: I.A + (G.5.8) + (H.3.5), C1-6084: I.A + (G.5.9) + (H.3.5), C1-6085: I.A + (G.5.10) + (H.3.5), C1-6086: I.A + (G.5.11) + (H.3.5), C1-6087: I.A + (H.2.3) + (H.3.5), C1-6088: I.A + (H.2.5) + (H.3.5), C1-6089: I.A + (H.2.7) + (H.3.5), C1-6090:
I.A + (H.2.8) + (H.3.5), C1-6091: I.A + (H.3.4) + (H.3.5), C1-6092: I.A + (H.4.9) + (H.3.5), C1- 6093: I.A + (H.4.10) + (H.3.5), C1-6094: I.A + (I.2.2) + (H.3.5), C1-6095: I.A + (I.2.5) + (H.3.5),
C1-6096: I.A+ (J.1.2) + (H.3.5), C1-6097: I.A+ (J.1.5) + (H.3.5), C1-6098: I.A+ (J.1.8) +
(H.3.5), C1-6099: I.A+ (J.1.11) + (H.3.5), C1-6100: I.A+ (J.1.12) + (H.3.5), C1-6101: I.A + (K.1.3) + (H.3.5), C1-6102: I.A+ (K.1.29) + (H.3.5), C1-6103: I.A+ (K.1.30) + (H.3.5), C1-6104: I.A+ (K.1.31) + (H.3.5), C1-6105: I.A+ (K.1.32) + (H.3.5), C1-6106: I.A+ (K.1.41) + (H.3.5), C1- 6107: I.A + (K.1.42) + (H.3.5), C1-6108: I.A + (K.1.44) + (H.3.5), C1-6109: LA + (K.1.45) + (H.3.5), C1-6110: LA + (K.1.47) + (H.3.5), C1-6111: LA + (K.1.49) + (H.3.5), C1-6112: I.A + (K.1.53) + (H.3.5), C1-6113: LA + (K.1.54) + (H.3.5), C1-6114: LA + (A.1.4) + (K.1.3), C1-6115: I.A+ (A.1.12) + (K.1.3), C1-6116: LA + (A.1.21) + (K.1.3), C1-6117: I.A + (A.121a) + (K.1.3), C1-6118: LA + (A.1.24) + (K.1.3), C1-6119: LA + (A.1.26) + (K.1.3), C1-6120: LA + (A.1.27) + (K.1.3), C1-6121 : LA + (A.1.30) + (K.1.3), C1-6122: LA + (A.1.31) + (K.1.3), C1-6123: I.A + (A.1.32) + (K.1.3), C1-6124: LA + (A.1.35) + (K.1.3), C1-6125: LA + (A.2.1) + (K.1.3), C1-6126: LA + (A.2.3) + (K.1.3), C1-6127: I.A+ (A.2.5) + (K.1.3), C1-6128: LA + (A.3.11) + (K.1.3), C1- 6129: LA + (A.3.12) + (K.1.3), C1-6130: LA + (A.3.15) + (K.1.3), C1-6131: I.A+ (A.3.16) + (K.1.3), C1-6132: I.A+ (A.3.18) + (K.1.3), C1-6133: I.A+ (A.3.19) + (K.1.3), C1-6134: I.A + (A.3.20) + (K.1.3), C1-6135: I.A+ (A.3.21) + (K.1.3), C1-6136: I.A+ (A.3.22) + (K.1.3), C1-6137: I.A + (A.3.23) + (K.1.3), C1-6138: I.A+ (A.3.25) + (K.1.3), C1-6139: I.A+ (A.3.26) + (K.1.3), C1- 6140: I.A + (A.3.27) + (K.1.3), C1-6141: I.A+ (A.4.5) + (K.1.3), C1-6142: I.A+ (A.4.11) +
(K.1.3), C1-6143: I.A+ (B.1.10) + (K.1.3), C1-6144: I.A+ (B.1.11) + (K.1.3), C1-6145: I.A + (B.1.12) + (K.1.3), C1-6146: I.A+ (B.1.13) + (K.1.3), C1-6147: I.A+ (B.1.18) + (K.1.3), C1-6148: LA + (B.1.21) + (K.1.3), C1-6149: I.A+ (B.1.26) + (K.1.3), C1-6150: I.A+ (B.1.33) + (K.1.3), C1- 6151: LA + (B.1.34) + (K.1.3), C1-6152: I.A+ (B.1.37) + (K.1.3), C1-6153: I.A+ (B.1.43) + (K.1.3), C1-6154: LA + (B.1.46) + (K.1.3), C1-6155: I.A+ (B.2.5) + (K.1.3), C1-6156: I.A +
(B.2.8) + (K.1.3), C1-6157: I.A+ (C.1.1) + (K.1.3), C1-6158: I.A+ (C.1.2) + (K.1.3), C1-6159: I.A + (C.1.4) + (K.1.3), C1-6160: I.A+ (C.1.5) + (K.1.3), C1-6161: I.A+ (C.2.6) + (K.1.3), C1-6162: LA + (C.2.7) + (K.1.3), C1-6163: I.A+ (C.2.8) + (K.1.3), C1-6164: LA + (D.1.1) + (K.1.3), C1- 6165: LA + (D.1.2) + (K.1.3), C1-6166: I.A+ (D.1.5) + (K.1.3), C1-6167: I.A+ (D.2.4) + (K.1.3), C1-6168: I.A + (E.1.3) + (K.1.3), C1-6169: I.A+ (E.2.2) + (K.1.3), C1-6170: I.A+ (E.2.3) + (K.1.3), C1-6171 : I.A+ (F.1.2) + (K.1.3), C1-6172: I.A+ (F.1.4) + (K.1.3), C1-6173: I.A+ (F.1.5)
+ (K.1.3), C1-6174: I.A+ (G.3.1) + (K.1.3), C1-6175: I.A+ (G.3.3) + (K.1.3), C1-6176: I.A + (G.3.6) + (K.1.3), C1-6177: I.A+ (G.5.1) + (K.1.3), C1-6178: I.A+ (G.5.2) + (K.1.3), C1-6179:
LA + (G.5.3) + (K.1.3), C1-6180: I.A+ (G.5.4) + (K.1.3), C1-6181: I.A+ (G.5.5) + (K.1.3), C1- 6182: LA + (G.5.6) + (K.1.3), C1-6183: I.A+ (G.5.7) + (K.1.3), C1-6184: I.A+ (G.5.8) + (K.1.3), C1-6185: I.A+ (G.5.9) + (K.1.3), C1-6186: I.A+ (G.5.10) + (K.1.3), C1-6187: I.A+ (G.5.11) + (K.1.3), C1-6188: I.A+ (H.2.3) + (K.1.3), C1-6189: I.A+ (H.2.5) + (K.1.3), C1-6190: I.A+ (H.2.7) + (K.1.3), C1-6191 : I.A+ (H.2.8) + (K.1.3), C1-6192: I.A+ (H.3.4) + (K.1.3), C1-6193: I.A + (H.4.9) + (K.1.3), C1-6194: I.A+ (H.4.10) + (K.1.3), C1-6195: I.A+ (I.2.2) + (K.1.3), C1-6196: I.A + (I.2.5) + (K.1.3), C1-6197: I.A + (J.1.2) + (K.1.3), C1-6198: I.A + (J.1.5) + (K.1.3), C1-6199: I.A + (J.1.8) + (K.1.3), C1-6200: I.A + (J.1.11) + (K.1.3), C1-6201: I.A + (J.1.12) + (K.1.3), C1-6202: I.A + (K.1.3) + (K.1.3), C1-6203: I.A + (K.1.29) + (K.1.3), C1-6204: I.A + (K.1.30) + (K.1.3), C1- 6205: I.A + (K.1.31) + (K.1.3), C1-6206: I.A + (K.1.32) + (K.1.3), C1-6207: I.A + (K.1.41) + (K.1.3), C1-6208: LA + (K.1.42) + (K.1.3), C1-6209: LA + (K.1.44) + (K.1.3), C1-6210: I.A +
(K.1.45) + (K.1.3), C1-6211: LA + (K.1.47) + (K.1.3), C1-6212: LA + (K.1.49) + (K.1.3), C1-6213:
I.A+ (K.1.53) + (K.1.3), C1-6214: I.A+ (K.1.54) + (K.1.3), C1-6215: I.A+ (A.1.4) + (K.1.29), C1- 6216: I.A+ (A.1.12) + (K.1.29), C1-6217: I.A+ (A.1.21) + (K.1.29), C1-6218: I.A + (A.121a) + (K.1.29), C1-6219: I.A+ (A.1.24) + (K.1.29), C1-6220: I.A+ (A.1.26) + (K.1.29), C1-6221: I.A + (A.1.27) + (K.1.29), C 1-6222: I.A+ (A.1.30) + (K.1.29), C1-6223: I.A+ (A.1.31) + (K.1.29), C1- 6224: I.A+ (A.1.32) + (K.1.29), C1-6225: I.A+ (A.1.35) + (K.1.29), C1-6226: I.A+ (A.2.1) + (K.1.29), C 1-6227: I.A+ (A.2.3) + (K.1.29), C1-6228: I.A+ (A.2.5) + (K.1.29), C1-6229: I.A + (A.3.11) + (K.1.29), C1-6230: I.A+ (A.3.12) + (K.1.29), C1-6231: I.A+ (A.3.15) + (K.1.29), C1- 6232: I.A+ (A.3.16) + (K.1.29), C1-6233: I.A+ (A.3.18) + (K.1.29), C1-6234: I.A+ (A.3.19) + (K.1.29), C1-6235: I.A+ (A.3.20) + (K.1.29), C1-6236: I.A+ (A.3.21) + (K.1.29), C1-6237: I.A + (A.3.22) + (K.1.29), C1-6238: I.A+ (A.3.23) + (K.1.29), C1-6239: I.A+ (A.3.25) + (K.1.29), C1- 6240: I.A+ (A.3.26) + (K.1.29), C1-6241: I.A+ (A.3.27) + (K.1.29), C1-6242: I.A+ (A.4.5) + (K.1.29), C1-6243: I.A+ (A.4.11) + (K.1.29), C1-6244: I.A+ (B.1.10) + (K.1.29), C1-6245: I.A + (B.1.11) + (K.1.29), C1-6246: I.A + (B.1.12) + (K.1.29), C1-6247: I.A + (B.1.13) + (K.1.29), C1- 6248: I.A+ (B.1.18) + (K.1.29), C1-6249: I.A+ (B.1.21) + (K.1.29), C1-6250: I.A+ (B.1.26) + (K.1.29), C1-6251 : I.A+ (B.1.33) + (K.1.29), C1-6252: I.A+ (B.1.34) + (K.1.29), C1-6253: I.A + (B.1.37) + (K.1.29), C1-6254: I.A+ (B.1.43) + (K.1.29), C1-6255: I.A+ (B.1.46) + (K.1.29), C1- 6256: I.A+ (B.2.5) + (K.1.29), C1-6257: I.A+ (B.2.8) + (K.1.29), C1-6258: I.A+ (C.1.1) + (K.1.29), C1-6259: I.A+ (C.1.2) + (K.1.29), C1-6260: I.A+ (C.1.4) + (K.1.29), C1-6261: I.A + (C.1.5) + (K.1.29), C1-6262: I.A+ (C.2.6) + (K.1.29), C1-6263: I.A+ (C.2.7) + (K.1.29), C1- 6264: I.A+ (C.2.8) + (K.1.29), C1-6265: I.A+ (D.1.1) + (K.1.29), C1-6266: I.A+ (D.1.2) + (K.1.29), C 1-6267: I.A+ (D.1.5) + (K.1.29), C1-6268: I.A+ (D.2.4) + (K.1.29), C1-6269: I.A + (E.1.3) + (K.1.29), C1-6270: I.A+ (E.2.2) + (K.1.29), C1-6271: I.A+ (E.2.3) + (K.1.29), C1-6272: I.A+ (F.1.2) + (K.1.29), C1-6273: I.A+ (F.1.4) + (K.1.29), C1-6274: I.A+ (F.1.5) + (K.1.29), C1- 6275: I.A+ (G.3.1) + (K.1.29), C1-6276: I.A+ (G.3.3) + (K.1.29), C1-6277: I.A+ (G.3.6) + (K.1.29), C1-6278: I.A+ (G.5.1) + (K.1.29), C1-6279: I.A+ (G.5.2) + (K.1.29), C1-6280: I.A + (G.5.3) + (K.1.29), C1-6281 : I.A+ (G.5.4) + (K.1.29), C1-6282: I.A+ (G.5.5) + (K.1.29), C1- 6283: I.A + (G.5.6) + (K.1.29), C1-6284: I.A + (G.5.7) + (K.1.29), C1-6285: I.A + (G.5.8) + (K.1.29), C1-6286: I.A+ (G.5.9) + (K.1.29), C1-6287: I.A+ (G.5.10) + (K.1.29), C1-6288: I.A + (G.5.11) + (K.1.29), C1-6289: I.A+ (H.2.3) + (K.1.29), C1-6290: I.A+ (H.2.5) + (K.1.29), C1- 6291: I.A+ (H.2.7) + (K.1.29), C1-6292: I.A+ (H.2.8) + (K.1.29), C1-6293: I.A+ (H.3.4) + (K.1.29), C1-6294: I.A+ (H.4.9) + (K.1.29), C1-6295: I.A+ (H.4.10) + (K.1.29), C1-6296: I.A + (I.2.2) + (K.1.29), C1-6297: I.A+ (I.2.5) + (K.1.29), C1-6298: I.A+ (J.1.2) + (K.1.29), C1-6299: I.A+ (J.1.5) + (K.1.29), C1-6300: I.A+ (J.1.8) + (K.1.29), C1-6301: I.A+ (J.1.11) + (K.1.29), C1- 6302: I.A+ (J.1.12) + (K.1.29), C1-6303: I.A+ (K.1.41) + (K.1.29), C1-6304: I.A+ (K.1.44) + (K.1.29), C1-6305: I.A+ (K.1.45) + (K.1.29), C1-6306: I.A+ (K.1.47) + (K.1.29), C1-6307: I.A + (K.1.49) + (K.1.29), C1-6308: I.A+ (A.1.4) + (K.1.30), C1-6309: I.A+ (A.1.12) + (K.1.30), C1- 6310: I.A+ (A.1.21) + (K.1.30), C1-6311: I.A + (A.121a) + (K.1.30), C1-6312: I.A+ (A.1.24) + (K.1.30), C1-6313: I.A+ (A.1.26) + (K.1.30), C1-6314: I.A+ (A.1.27) + (K.1.30), C1-6315: I.A + (A.1.30) + (K.1.30), C1-6316: I.A+ (A.1.31) + (K.1.30), C1-6317: I.A+ (A.1.32) + (K.1.30), C1- 6318: I.A+ (A.1.35) + (K.1.30), C1-6319: I.A+ (A.2.1) + (K.1.30), C1-6320: I.A+ (A.2.3) + (K.1.30), C1-6321 : I.A+ (A.2.5) + (K.1.30), C1-6322: I.A+ (A.3.11) + (K.1.30), C1-6323: I.A + (A.3.12) + (K.1.30), C1-6324: I.A+ (A.3.15) + (K.1.30), C1-6325: I.A+ (A.3.16) + (K.1.30), C1-
6326: I.A+ (A.3.18) + (K.1.30), C1-6327: I.A+ (A.3.19) + (K.1.30), C1-6328: I.A+ (A.3.20) + (K.1.30), C1-6329: I.A+ (A.3.21) + (K.1.30), C1-6330: I.A+ (A.3.22) + (K.1.30), C1-6331: I.A + (A.3.23) + (K.1.30), C1-6332: I.A+ (A.3.25) + (K.1.30), C1-6333: I.A+ (A.3.26) + (K.1.30), C1- 6334: I.A+ (A.3.27) + (K.1.30), C1-6335: I.A+ (A.4.5) + (K.1.30), C1-6336: I.A+ (A.4.11) + (K.1.30), C1-6337: I.A+ (B.1.10) + (K.1.30), C1-6338: I.A+ (B.1.11) + (K.1.30), C1-6339: I.A + (B.1.12) + (K.1.30), C1-6340: I.A+ (B.1.13) + (K.1.30), C1-6341: I.A+ (B.1.18) + (K.1.30), C1- 6342: I.A+ (B.1.21) + (K.1.30), C1-6343: I.A+ (B.1.26) + (K.1.30), C1-6344: I.A+ (B.1.33) + (K.1.30), C1-6345: I.A+ (B.1.34) + (K.1.30), C1-6346: I.A+ (B.1.37) + (K.1.30), C1-6347: I.A + (B.1.43) + (K.1.30), C1-6348: I.A+ (B.1.46) + (K.1.30), C1-6349: I.A+ (B.2.5) + (K.1.30), C1- 6350: I.A+ (B.2.8) + (K.1.30), C1-6351: I.A+ (C.1.1) + (K.1.30), C1-6352: I.A+ (C.1.2) + (K.1.30), C1-6353: I.A+ (C.1.4) + (K.1.30), C1-6354: I.A+ (C.1.5) + (K.1.30), C1-6355: I.A + (C.2.6) + (K.1.30), C1-6356: I.A+ (C.2.7) + (K.1.30), C1-6357: I.A+ (C.2.8) + (K.1.30), C1- 6358: I.A+ (D.1.1) + (K.1.30), C1-6359: I.A+ (D.1.2) + (K.1.30), C1-6360: I.A+ (D.1.5) + (K.1.30), C1-6361 : I.A+ (D.2.4) + (K.1.30), C1-6362: I.A+ (E.1.3) + (K.1.30), C1-6363: I.A + (E.2.2) + (K.1.30), C1-6364: I. A + (E.2.3) + (K.1.30), C1-6365: I. A + (F.1.2) + (K.1.30), C1-6366: I.A+ (F.1.4) + (K.1.30), C1-6367: I.A+ (F.1.5) + (K.1.30), C1-6368: I.A+ (G.3.1) + (K.1.30), C1- 6369: I.A+ (G.3.3) + (K.1.30), C1-6370: I.A+ (G.3.6) + (K.1.30), C1-6371: I.A+ (G.5.1) + (K.1.30), C1-6372: I.A+ (G.5.2) + (K.1.30), C1-6373: I. A + (G.5.3) + (K.1.30), C1-6374: I.A + (G.5.4) + (K.1.30), C1-6375: I. A + (G.5.5) + (K.1.30), C1-6376: I. A + (G.5.6) + (K.1.30), C1- 6377: I.A + (G.5.7) + (K.1.30), C1-6378: I.A + (G.5.8) + (K.1.30), C1-6379: LA + (G.5.9) + (K.1.30), C1-6380: LA + (G.5.10) + (K.1.30), C1-6381: LA + (G.5.11) + (K.1.30), C1-6382: I.A + (H.2.3) + (K.1.30), C1-6383: LA + (H.2.5) + (K.1.30), C1-6384: LA + (H.2.7) + (K.1.30), C1- 6385: I.A + (H.2.8) + (K.1.30), C1-6386: I.A + (H.3.4) + (K.1.30), C1-6387: I.A + (H.4.9) + (K.1.30), C1-6388: I.A+ (H.4.10) + (K.1.30), C1-6389: I.A+ (I.2.2) + (K.1.30), C1-6390: I.A + (I.2.5) + (K.1.30), C1-6391 : I.A + (J.1.2) + (K.1.30), C1-6392: I.A + (J.1.5) + (K.1.30), C1-6393: I.A + (J.1.8) + (K.1.30), C1-6394: I.A + (J.1.11) + (K.1.30), C1-6395: I.A + (J.1.12) + (K.1.30), C1-6396: I.A+ (K.1.41) + (K.1.30), C1-6397: LA + (K.1.44) + (K.1.30), C1-6398: LA + (K.1.45) + (K.1.30), C1-6399: I.A + (K.1.47) + (K.1.30), C1-6400: I.A + (K.1.49) + (K.1.30), C1-6401: I.A + (A.1.4) + (K.1.31), C 1-6402: LA + (A.1.12) + (K.1.31), C1-6403: I.A+ (A.1.21) + (K.1.31), C1- 6404: LA + (A.121a) + (K.1.31), C1-6405: LA + (A.1.24) + (K.1.31), C1-6406: LA + (A.1.26) + (K.1.31), C1-6407: LA + (A.1.27) + (K.1.31), C1-6408: I.A+ (A.1.30) + (K.1.31), C1-6409: I.A + (A.1.31) + (K.1.31), C1-6410: I.A+ (A.1.32) + (K.1.31), C1-6411: LA + (A.1.35) + (K.1.31), C1- 6412: LA + (A.2.1) + (K.1.31), C1-6413: I.A+ (A.2.3) + (K.1.31), C1-6414: I.A+ (A.2.5) +
(K.1.31), C1-6415: I.A+ (A.3.11) + (K.1.31), C1-6416: I.A+ (A.3.12) + (K.1.31), C1-6417: I.A + (A.3.15) + (K.1.31), C1-6418: I.A+ (A.3.16) + (K.1.31), C1-6419: I.A + (A.3.18) + (K.1.31), C1- 6420: I.A + (A.3.19) + (K.1.31), C1-6421: I.A + (A.3.20) + (K.1.31), C1-6422: I.A + (A.3.21) + (K.1.31), C1-6423: I.A + (A.3.22) + (K.1.31), C1-6424: I.A + (A.3.23) + (K.1.31), C1-6425: I.A + (A.3.25) + (K.1.31), C1-6426: I.A + (A.3.26) + (K.1.31), C1-6427: I.A + (A.3.27) + (K.1.31), C1- 6428: I.A + (A.4.5) + (K.1.31), C1-6429: I.A + (A.4.11) + (K.1.31), C1-6430: I.A + (B.1.10) +
(K.1.31), C1-6431 : I.A + (B.1.11) + (K.1.31), C1-6432: I.A + (B.1.12) + (K.1.31), C1-6433: I.A + (B.1.13) + (K.1.31), C1-6434: I.A + (B.1.18) + (K.1.31), C1-6435: I.A + (B.1.21) + (K.1.31), C1- 6436: I.A + (B.1.26) + (K.1.31), C1-6437: I.A + (B.1.33) + (K.1.31), C1-6438: I.A + (B.1.34) +
(K.1.31), C1-6439: I.A+ (B.1.37) + (K.1.31), C1-6440: I.A+ (B.1.43) + (K.1.31), C1-6441: I.A + (B.1.46) + (K.1.31), C1-6442: I.A+ (B.2.5) + (K.1.31), C1-6443: I.A+ (B.2.8) + (K.1.31), C1- 6444: I.A+ (C.1.1) + (K.1.31), C1-6445: I.A+ (C.1.2) + (K.1.31), C1-6446: I.A+ (C.1.4) + (K.1.31), C 1-6447: I.A+ (C.1.5) + (K.1.31), C1-6448: I.A+ (C.2.6) + (K.1.31), C1-6449: I.A + (C.2.7) + (K.1.31), C1-6450: I.A+ (C.2.8) + (K.1.31), C1-6451: I.A+ (D.1.1) + (K.1.31), C1- 6452: I.A+ (D.1.2) + (K.1.31), C1-6453: I.A+ (D.1.5) + (K.1.31), C1-6454: I.A+ (D.2.4) + (K.1.31), C1-6455: I.A+ (E.1.3) + (K.1.31), C1-6456: I.A+ (E.2.2) + (K.1.31), C1-6457: I.A + (E.2.3) + (K.1.31), C1-6458: I.A+ (F.1.2) + (K.1.31), C1-6459: I.A+ (F.1.4) + (K.1.31), C1-6460: I.A+ (F.1.5) + (K.1.31), C1-6461 : I.A+ (G.3.1) + (K.1.31), C1-6462: I.A+ (G.3.3) + (K.1.31), C1- 6463: I.A+ (G.3.6) + (K.1.31), C1-6464: I.A+ (G.5.1) + (K.1.31), C1-6465: I.A+ (G.5.2) + (K.1.31), C1-6466: I.A+ (G.5.3) + (K.1.31), C1-6467: I.A+ (G.5.4) + (K.1.31), C1-6468: I.A + (G.5.5) + (K.1.31), C1-6469: I.A+ (G.5.6) + (K.1.31), C1-6470: I.A+ (G.5.7) + (K.1.31), C1- 6471: I.A+ (G.5.8) + (K.1.31), C1-6472: I.A+ (G.5.9) + (K.1.31), C1-6473: I.A+ (G.5.10) + (K.1.31), C1-6474: LA + (G.5.11) + (K.1.31), C1-6475: I.A+ (H.2.3) + (K.1.31), C1-6476: I.A + (H.2.5) + (K.1.31), C 1-6477: I.A+ (H.2.7) + (K.1.31), C1-6478: I.A+ (H.2.8) + (K.1.31), C1- 6479: I.A+ (H.3.4) + (K.1.31), C1-6480: I.A+ (H.4.9) + (K.1.31), C1-6481: I.A+ (H.4.10) + (K.1.31), C1-6482: I.A+ (I.2.2) + (K.1.31), C1-6483: I.A+ (I.2.5) + (K.1.31), C1-6484: I.A + (J.1.2) + (K.1.31), C1-6485: I.A+ (J.1.5) + (K.1.31), C1-6486: I.A+ (J.1.8) + (K.1.31), C1-6487: I.A+ (J.1.11) + (K.1.31), C1-6488: I.A+ (J.1.12) + (K.1.31), C1-6489: I.A+ (K.1.41) + (K.1.31), C1-6490: I.A+ (K.1.44) + (K.1.31), C1-6491: I.A + (K.1.45) + (K.1.31), C1-6492: I.A+ (K.1.47) + (K.1.31), C1-6493: I.A+ (K.1.49) + (K.1.31), C1-6494: I.A + (A.1.4) + (K.1.32), C1-6495: I.A + (A.1.12) + (K.1.32), C1-6496: LA + (A.1.21) + (K.1.32), C1-6497: I.A + (A.121a) + (K.1.32), C1- 6498: LA + (A.1.24) + (K.1.32), C1-6499: LA + (A.1.26) + (K.1.32), C1-6500: LA + (A.1.27) + (K.1.32), C1-6501 : LA + (A.1.30) + (K.1.32), C1-6502: LA + (A.1.31) + (K.1.32), C1-6503: I.A + (A.1.32) + (K.1.32), C1-6504: LA + (A.1.35) + (K.1.32), C1-6505: LA + (A.2.1) + (K.1.32), C1- 6506: LA + (A.2.3) + (K.1.32), C1-6507: I.A+ (A.2.5) + (K.1.32), C1-6508: LA + (A.3.11) + (K.1.32), C1-6509: LA + (A.3.12) + (K.1.32), C1-6510: LA + (A.3.15) + (K.1.32), C1-6511: I.A + (A.3.16) + (K.1.32), C1-6512: LA + (A.3.18) + (K.1.32), C1-6513: LA + (A.3.19) + (K.1.32), C1- 6514: LA + (A.3.20) + (K.1.32), C1-6515: LA + (A.3.21) + (K.1.32), C1-6516: I.A+ (A.3.22) + (K.1.32), C1-6517: I.A+ (A.3.23) + (K.1.32), C1-6518: I.A+ (A.3.25) + (K.1.32), C1-6519: I.A + (A.3.26) + (K.1.32), C1-6520: I.A+ (A.3.27) + (K.1.32), C1-6521: I.A+ (A.4.5) + (K.1.32), C1- 6522: I.A+ (A.4.11) + (K.1.32), C1-6523: LA + (B.1.10) + (K.1.32), C1-6524: LA + (B.1.11) + (K.1.32), C1-6525: LA + (B.1.12) + (K.1.32), C1-6526: LA + (B.1.13) + (K.1.32), C1-6527: I.A + (B.1.18) + (K.1.32), C1-6528: LA + (B.1.21) + (K.1.32), C1-6529: LA + (B.1.26) + (K.1.32), C1- 6530: LA + (B.1.33) + (K.1.32), C1-6531: LA + (B.1.34) + (K.1.32), C1-6532: I.A + (B.1.37) + (K.1.32), C1-6533: I.A + (B.1.43) + (K.1.32), C1-6534: I.A + (B.1.46) + (K.1.32), C1-6535: I.A + (B.2.5) + (K.1.32), C1-6536: I.A + (B.2.8) + (K.1.32), C1-6537: I.A + (C.1.1) + (K.1.32), C1-6538: I.A + (C.1.2) + (K.1.32), C1-6539: I.A + (C.1.4) + (K.1.32), C1-6540: I.A + (C.1.5) + (K.1.32), C1- 6541: I.A + (C.2.6) + (K.1.32), C1-6542: I.A + (C.2.7) + (K.1.32), C1-6543: I.A + (C.2.8) + (K.1.32), C1-6544: I.A + (D.1.1) + (K.1.32), C1-6545: I.A + (D.1.2) + (K.1.32), C1-6546: I.A + (D.1.5) + (K.1.32), C 1-6547: I.A + (D.2.4) + (K.1.32), C1-6548: I.A + (E.1.3) + (K.1.32), C1-6549: I.A + (E.2.2) + (K.1.32), C1-6550: I.A + (E.2.3) + (K.1.32), C1-6551: I.A + (F.1.2) + (K.1.32), C1-
6552: I.A+ (F.1.4) + (K.1.32), C1-6553: I.A+ (F.1.5) + (K.1.32), C1-6554: I.A+ (G.3.1) + (K.1.32), C1-6555: I.A+ (G.3.3) + (K.1.32), C1-6556: I.A+ (G.3.6) + (K.1.32), C1-6557: I.A + (G.5.1) + (K.1.32), C1-6558: I.A+ (G.5.2) + (K.1.32), C1-6559: I.A+ (G.5.3) + (K.1.32), C1- 6560: I.A+ (G.5.4) + (K.1.32), C1-6561: I.A+ (G.5.5) + (K.1.32), C1-6562: I.A+ (G.5.6) + (K.1.32), C1-6563: I.A+ (G.5.7) + (K.1.32), C1-6564: I.A+ (G.5.8) + (K.1.32), C1-6565: I.A + (G.5.9) + (K.1.32), C1-6566: I.A+ (G.5.10) + (K.1.32), C1-6567: I.A+ (G.5.11) + (K.1.32), C1- 6568: I.A + (H.2.3) + (K.1.32), C1-6569: I.A + (H.2.5) + (K.1.32), C1-6570: I.A + (H.2.7) + (K.1.32), C1-6571 : LA + (H.2.8) + (K.1.32), C1-6572: LA + (H.3.4) + (K.1.32), C1-6573: I.A + (H.4.9) + (K.1.32), C1-6574: LA + (H.4.10) + (K.1.32), C1-6575: I.A+ (I.2.2) + (K.1.32), C1- 6576: I.A + (I.2.5) + (K.1.32), C1-6577: I.A + (J.1.2) + (K.1.32), C1-6578: I.A + (J.1.5) + (K.1.32), C1-6579: LA + (J.1.8) + (K.1.32), C1-6580: LA + (J.1.11) + (K.1.32), C1-6581: I.A+ (J.1.12) + (K.1.32), C1-6582: I.A+ (K.1.41) + (K.1.32), C1-6583: LA + (K.1.44) + (K.1.32), C1-6584: I.A + (K.1.45) + (K.1.32), C1-6585: I.A + (K.1.47) + (K.1.32), C1-6586: I.A + (K.1.49) + (K.1.32), C1- 6587: LA + (A.1.4) + (K.1.42), C1-6588: I.A+ (A.1.12) + (K.1.42), C1-6589: I.A+ (A.1.21) +
(K.1.42), C1-6590: I.A + (A.121a) + (K.1.42), C1-6591: LA + (A.1.24) + (K.1.42), C1-6592: I.A + (A.1.26) + (K.1.42), C1-6593: LA + (A.1.27) + (K.1.42), C1-6594: I.A+ (A.1.30) + (K.1.42), C1- 6595: LA + (A.1.31) + (K.1.42), C1-6596: LA + (A.1.32) + (K.1.42), C1-6597: I.A+ (A.1.35) + (K.1.42), C1-6598: I.A+ (A.2.1) + (K.1.42), C1-6599: I.A+ (A.2.3) + (K.1.42), C1-6600: I.A + (A.2.5) + (K.1.42), C1-6601 : I.A+ (A.3.11) + (K.1.42), C1-6602: I.A+ (A.3.12) + (K.1.42), C1- 6603: LA + (A.3.15) + (K.1.42), C1-6604: I.A+ (A.3.16) + (K.1.42), C1-6605: LA + (A.3.18) + (K.1.42), C1-6606: I.A+ (A.3.19) + (K.1.42), C1-6607: I.A+ (A.3.20) + (K.1.42), C1-6608: I.A + (A.3.21) + (K.1.42), C1-6609: I.A+ (A.3.22) + (K.1.42), C1-6610: I.A+ (A.3.23) + (K.1.42), C1- 6611: LA + (A.3.25) + (K.1.42), C1-6612: I.A+ (A.3.26) + (K.1.42), C1-6613: I.A+ (A.3.27) + (K.1.42), C1-6614: I.A+ (A.4.5) + (K.1.42), C1-6615: I.A+ (A.4.11) + (K.1.42), C1-6616: I.A +
(B.1.10) + (K.1.42), C1-6617: I.A+ (B.1.11) + (K.1.42), C1-6618: LA + (B.1.12) + (K.1.42), C1- 6619: I.A+ (B.1.13) + (K.1.42), C1-6620: I.A+ (B.1.18) + (K.1.42), C1-6621: LA + (B.1.21) + (K.1.42), C1-6622: I.A+ (B.1.26) + (K.1.42), C1-6623: I.A+ (B.1.33) + (K.1.42), C1-6624: I.A + (B.1.34) + (K.1.42), C1-6625: LA + (B.1.37) + (K.1.42), C1-6626: I.A+ (B.1.43) + (K.1.42), C1- 6627: I.A+ (B.1.46) + (K.1.42), C1-6628: I.A+ (B.2.5) + (K.1.42), C1-6629: I.A+ (B.2.8) +
(K.1.42), C1-6630: I.A+ (C.1.1) + (K.1.42), C1-6631: LA + (C.1.2) + (K.1.42), C1-6632: I.A + (C.1.4) + (K.1.42), C1-6633: I.A+ (C.1.5) + (K.1.42), C1-6634: I.A+ (C.2.6) + (K.1.42), C1- 6635: LA + (C.2.7) + (K.1.42), C1-6636: I.A+ (C.2.8) + (K.1.42), C1-6637: I.A+ (D.1.1) +
(K.1.42), C1-6638: I.A+ (D.1.2) + (K.1.42), C1-6639: LA + (D.1.5) + (K.1.42), C1-6640: I.A + (D.2.4) + (K.1.42), C1-6641 : I.A + (E.1.3) + (K.1.42), C1-6642: I.A+ (E.2.2) + (K.1.42), C1-6643: LA + (E.2.3) + (K.1.42), C1-6644: I.A+ (F.1.2) + (K.1.42), C1-6645: I.A + (F.1.4) + (K.1.42), C1- 6646: I.A + (F.1.5) + (K.1.42), C1-6647: I.A + (G.3.1) + (K.1.42), C1-6648: I.A + (G.3.3) +
(K.1.42), C1-6649: I.A + (G.3.6) + (K.1.42), C1-6650: I.A + (G.5.1) + (K.1.42), C1-6651: I.A + (G.5.2) + (K.1.42), C1-6652: I.A + (G.5.3) + (K.1.42), C1-6653: I.A + (G.5.4) + (K.1.42), C1- 6654: LA + (G.5.5) + (K.1.42), C1-6655: I.A + (G.5.6) + (K.1.42), C1-6656: I.A + (G.5.7) +
(K.1.42), C 1-6657: I.A + (G.5.8) + (K.1.42), C1-6658: I.A + (G.5.9) + (K.1.42), C1-6659: I.A + (G.5.10) + (K.1.42), C1-6660: I.A + (G.5.11) + (K.1.42), C1-6661: I.A + (H.2.3) + (K.1.42), C1- 6662: I.A + (H.2.5) + (K.1.42), C1-6663: I.A + (H.2.7) + (K.1.42), C1-6664: I.A + (H.2.8) +
(K.1.42), C1-6665: I.A+ (H.3.4) + (K.1.42), C1-6666: I.A+ (H.4.9) + (K.1.42), C1-6667: I.A + (H.4.10) + (K.1.42), C1-6668: I.A+ (I.2.2) + (K.1.42), C1-6669: I.A+ (I.2.5) + (K.1.42), C1-6670: I.A+ (J.1.2) + (K.1.42), C1-6671 : I.A+ (J.1.5) + (K.1.42), C1-6672: I.A+ (J.1.8) + (K.1.42), C1- 6673: I.A+ (J.1.11) + (K.1.42), C1-6674: I.A+ (J.1.12) + (K.1.42), C1-6675: I.A+ (K.1.41) + (K.1.42), C1-6676: I.A+ (K.1.44) + (K.1.42), C1-6677: I.A+ (K.1.45) + (K.1.42), C1-6678: I.A + (K.1.47) + (K.1.42), C1-6679: I.A+ (K.1.49) + (K.1.42), C1-6680: I.A+ (A.1.4) + (K.1.53), C1- 6681: I.A+ (A.1.12) + (K.1.53), C1-6682: I.A+ (A.1.21) + (K.1.53), C1-6683: I.A + (A.121a) + (K.1.53), C1-6684: I.A+ (A.1.24) + (K.1.53), C1-6685: I.A+ (A.1.26) + (K.1.53), C1-6686: I.A + (A.1.27) + (K.1.53), C 1-6687: I.A+ (A.1.30) + (K.1.53), C1-6688: I.A+ (A.1.31) + (K.1.53), C1- 6689: I.A + (A.1.32) + (K.1.53), C1-6690: I.A + (A.1.35) + (K.1.53), C1-6691: I.A+ (A.2.1) + (K.1.53), C1-6692: I.A+ (A.2.3) + (K.1.53), C1-6693: I.A+ (A.2.5) + (K.1.53), C1-6694: I.A + (A.3.11) + (K.1.53), C1-6695: I.A+ (A.3.12) + (K.1.53), C1-6696: I.A+ (A.3.15) + (K.1.53), C1- 6697: I.A + (A.3.16) + (K.1.53), C1-6698: I.A+ (A.3.18) + (K.1.53), C1-6699: I.A+ (A.3.19) + (K.1.53), C1-6700: I.A+ (A.3.20) + (K.1.53), C1-6701: I.A+ (A.3.21) + (K.1.53), C1-6702: I.A + (A.3.22) + (K.1.53), C1-6703: I.A+ (A.3.23) + (K.1.53), C1-6704: I.A+ (A.3.25) + (K.1.53), C1- 6705: I.A + (A.3.26) + (K.1.53), C1-6706: I.A+ (A.3.27) + (K.1.53), C1-6707: I.A+ (A.4.5) + (K.1.53), C1-6708: I.A+ (A.4.11) + (K.1.53), C1-6709: I.A+ (B.1.10) + (K.1.53), C1-6710: I.A + (B.1.11) + (K.1.53), C1-6711: I.A + (B.1.12) + (K.1.53), C1-6712: I.A + (B.1.13) + (K.1.53), C1- 6713: I.A+ (B.1.18) + (K.1.53), C1-6714: I.A+ (B.1.21) + (K.1.53), C1-6715: I.A+ (B.1.26) + (K.1.53), C1-6716: I.A+ (B.1.33) + (K.1.53), C1-6717: I.A+ (B.1.34) + (K.1.53), C1-6718: I.A + (B.1.37) + (K.1.53), C1-6719: I.A+ (B.1.43) + (K.1.53), C1-6720: I.A+ (B.1.46) + (K.1.53), C1- 6721: I.A + (B.2.5) + (K.1.53), C1-6722: I.A+ (B.2.8) + (K.1.53), C1-6723: I.A+ (C.1.1) + (K.1.53), C1-6724: I.A+ (C.1.2) + (K.1.53), C1-6725: I.A+ (C.1.4) + (K.1.53), C1-6726: I.A + (C.1.5) + (K.1.53), C1-6727: I.A+ (C.2.6) + (K.1.53), C1-6728: I.A+ (C.2.7) + (K.1.53), C1- 6729: I.A + (C.2.8) + (K.1.53), C1-6730: I.A+ (D.1.1) + (K.1.53), C1-6731: I.A+ (D.1.2) + (K.1.53), C1-6732: I.A+ (D.1.5) + (K.1.53), C1-6733: I.A+ (D.2.4) + (K.1.53), C1-6734: I.A + (E.1.3) + (K.1.53), C1-6735: I.A+ (E.2.2) + (K.1.53), C1-6736: I.A+ (E.2.3) + (K.1.53), C1-6737: I.A+ (F.1.2) + (K.1.53), C1-6738: I.A+ (F.1.4) + (K.1.53), C1-6739: I.A+ (F.1.5) + (K.1.53), C1- 6740: I.A + (G.3.1) + (K.1.53), C1-6741: I.A+ (G.3.3) + (K.1.53), C1-6742: I.A+ (G.3.6) + (K.1.53), C1-6743: I.A+ (G.5.1) + (K.1.53), C1-6744: I.A+ (G.5.2) + (K.1.53), C1-6745: I.A + (G.5.3) + (K.1.53), C1-6746: I.A+ (G.5.4) + (K.1.53), C1-6747: I.A+ (G.5.5) + (K.1.53), C1- 6748: I.A + (G.5.6) + (K.1.53), C1-6749: I.A + (G.5.7) + (K.1.53), C1-6750: I.A + (G.5.8) + (K.1.53), C1-6751 : I.A+ (G.5.9) + (K.1.53), C1-6752: I.A+ (G.5.10) + (K.1.53), C1-6753: I.A + (G.5.11) + (K.1.53), C1-6754: I.A+ (H.2.3) + (K.1.53), C1-6755: I.A+ (H.2.5) + (K.1.53), C1- 6756: I.A + (H.2.7) + (K.1.53), C1-6757: I.A + (H.2.8) + (K.1.53), C1-6758: I.A + (H.3.4) + (K.1.53), C1-6759: I.A + (H.4.9) + (K.1.53), C1-6760: I.A + (H.4.10) + (K.1.53), C1-6761: I.A + (I.2.2) + (K.1.53), C1-6762: I.A+ (I.2.5) + (K.1.53), C1-6763: I.A + (J.1.2) + (K.1.53), C1-6764: I.A + (J.1.5) + (K.1.53), C1-6765: I.A + (J.1.8) + (K.1.53), C1-6766: I.A + (J.1.11) + (K.1.53), C1- 6767: I.A + (J.1.12) + (K.1.53), C1-6768: I.A + (K.1.41) + (K.1.53), C1-6769: I.A + (K.1.44) + (K.1.53), C1-6770: I.A + (K.1.45) + (K.1.53), C1-6771: I.A + (K.1.47) + (K.1.53), C1-6772: I.A + (K.1.49) + (K.1.53), C1-6773: I.A + (A.1.4) + (K.1.54), C1-6774: I.A + (A.1.12) + (K.1.54), C1- 6775: I.A + (A.1.21) + (K.1.54), C1-6776: I.A + (A.121a) + (K.1.54), C1-6777: I.A + (A.1.24) +
(K.1.54), C1-6778: I.A+ (A.1.26) + (K.1.54), C1-6779: I.A+ (A.1.27) + (K.1.54), C1-6780: I.A + (A.1.30) + (K.1.54), C1-6781 : I.A+ (A.1.31) + (K.1.54), C1-6782: I.A+ (A.1.32) + (K.1.54), C1- 6783: I.A+ (A.1.35) + (K.1.54), C1-6784: I.A+ (A.2.1) + (K.1.54), C1-6785: I.A+ (A.2.3) + (K.1.54), C1-6786: I.A+ (A.2.5) + (K.1.54), C1-6787: I.A+ (A.3.11) + (K.1.54), C1-6788: I.A + (A.3.12) + (K.1.54), C1-6789: I.A+ (A.3.15) + (K.1.54), C1-6790: I.A+ (A.3.16) + (K.1.54), C1- 6791: I.A+ (A.3.18) + (K.1.54), C1-6792: I.A+ (A.3.19) + (K.1.54), C1-6793: I.A+ (A.3.20) + (K.1.54), C1-6794: I.A+ (A.3.21) + (K.1.54), C1-6795: I.A+ (A.3.22) + (K.1.54), C1-6796: I.A + (A.3.23) + (K.1.54), C1-6797: I.A+ (A.3.25) + (K.1.54), C1-6798: I.A+ (A.3.26) + (K.1.54), C1- 6799: I.A+ (A.3.27) + (K.1.54), C1-6800: I.A+ (A.4.5) + (K.1.54), C1-6801: I.A+ (A.4.11) + (K.1.54), C1-6802: I.A+ (B.1.10) + (K.1.54), C1-6803: I.A+ (B.1.11) + (K.1.54), C1-6804: I.A + (B.1.12) + (K.1.54), C1-6805: I.A+ (B.1.13) + (K.1.54), C1-6806: I.A+ (B.1.18) + (K.1.54), C1- 6807: I.A+ (B.1.21) + (K.1.54), C1-6808: I.A+ (B.1.26) + (K.1.54), C1-6809: I.A+ (B.1.33) + (K.1.54), C1-6810: I.A+ (B.1.34) + (K.1.54), C1-6811: I.A+ (B.1.37) + (K.1.54), C1-6812: I.A + (B.1.43) + (K.1.54), C1-6813: I.A+ (B.1.46) + (K.1.54), C1-6814: I.A+ (B.2.5) + (K.1.54), C1- 6815: I.A+ (B.2.8) + (K.1.54), C1-6816: I.A+ (C.1.1) + (K.1.54), C1-6817: I.A+ (C.1.2) + (K.1.54), C1-6818: I.A+ (C.1.4) + (K.1.54), C1-6819: I.A+ (C.1.5) + (K.1.54), C1-6820: I.A + (C.2.6) + (K.1.54), C1-6821 : I.A+ (C.2.7) + (K.1.54), C1-6822: I.A+ (C.2.8) + (K.1.54), C1- 6823: I.A+ (D.1.1) + (K.1.54), C1-6824: I.A+ (D.1.2) + (K.1.54), C1-6825: I.A+ (D.1.5) + (K.1.54), C1-6826: I.A+ (D.2.4) + (K.1.54), C1-6827: I.A+ (E.1.3) + (K.1.54), C1-6828: I.A + (E.2.2) + (K.1.54), C1-6829: I.A+ (E.2.3) + (K.1.54), C1-6830: I.A+ (F.1.2) + (K.1.54), C1-6831: I.A+ (F.1.4) + (K.1.54), C1-6832: I.A+ (F.1.5) + (K.1.54), C1-6833: I.A+ (G.3.1) + (K.1.54), C1- 6834: I.A + (G.3.3) + (K.1.54), C1-6835: I.A+ (G.3.6) + (K.1.54), C1-6836: I.A+ (G.5.1) + (K.1.54), C1-6837: I.A+ (G.5.2) + (K.1.54), C1-6838: I.A+ (G.5.3) + (K.1.54), C1-6839: I.A + (G.5.4) + (K.1.54), C1-6840: I.A+ (G.5.5) + (K.1.54), C1-6841: I.A+ (G.5.6) + (K.1.54), C1- 6842: I.A + (G.5.7) + (K.1.54), C1-6843: I.A + (G.5.8) + (K.1.54), C1-6844: I.A + (G.5.9) + (K.1.54), C1-6845: LA + (G.5.10) + (K.1.54), C1-6846: LA + (G.5.11) + (K.1.54), C1-6847: I.A + (H.2.3) + (K.1.54), C1-6848: LA + (H.2.5) + (K.1.54), C1-6849: LA + (H.2.7) + (K.1.54), C1- 6850: LA + (H.2.8) + (K.1.54), C1-6851: LA + (H.3.4) + (K.1.54), C1-6852: LA + (H.4.9) + (K.1.54), C1-6853: LA + (H.4.10) + (K.1.54), C1-6854: I.A+ (I.2.2) + (K.1.54), C1-6855: I.A + (I.2.5) + (K.1.54), C1-6856: I.A + (J.1.2) + (K.1.54), C1-6857: I.A + (J.1.5) + (K.1.54), C1-6858: I.A + (J.1.8) + (K.1.54), C1-6859: I.A + (J.1.11) + (K.1.54), C1-6860: I.A + (J.1.12) + (K.1.54), C1-6861 : I.A+ (K.1.41) + (K.1.54), C1-6862: LA + (K.1.44) + (K.1.54), C1-6863: LA + (K.1.45) + (K.1.54), C1-6864: I.A + (K.1.47) + (K.1.54), C1-6865: I.A + (K.1.49) + (K.1.54).
Table C2: Mixtures C2-1 to C2-6865 are defined as mixtures C1-1 to C1-6865 of Table C1, wherein compound I.A in each mixture is replaced with compound I.B.
Table C3: Mixtures C3-1 to C3-6865 are defined as mixtures C1-1 to C1-6865 of Table C1, wherein compound I.A in each mixture is replaced with compound I.C.
Table C4: Mixtures C4-1 to C4-6865 are defined as mixtures C1-1 to C1-6865 of Table C1, wherein compound I.A in each mixture is replaced with compound I.D.
Table C5: Mixtures C5-1 to C5-6865 are defined as mixtures C1-1 to C1-6865 of Table C1, wherein compound I.A in each mixture is replaced with compound I.E.
Table C6: Mixtures C6-1 to C6-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I. A in each mixture is replaced with compound I.F.
Table C7: Mixtures C7-1 to C7-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I. A in each mixture is replaced with compound I.G.
Table C8: Mixtures C8-1 to C8-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I .A in each mixture is replaced with compound I.H.
Table C9: Mixtures C9-1 to C9-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I .A in each mixture is replaced with compound I.J.
Table C10: Mixtures C10-1 to C10-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I .A in each mixture is replaced with compound I.K.
Table C11 : Mixtures C11-1 to C11-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I .A in each mixture is replaced with compound I.L.
Table C12: Mixtures C12-1 to C12-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I .A in each mixture is replaced with compound I.M.
Table C13: Mixtures C13-1 to C13-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I .A in each mixture is replaced with compound I.N.
Table C14: Mixtures C14-1 to C14-6865 are defined as mixtures C1-1 to C1-6865 of Table C1 , wherein compound I. A in each mixture is replaced with compound I.O.
In one embodiment the weight ratio of compound I to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound III, is between 100:1 and 1 :100 in mixtures C1- 1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound III, is between 50:1 and 1 :50 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound III, is between 20:1 and 1 :20 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound III, is between 5:1 and 1 :5 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound III is, for example, 3:1 , 1 :1 or 1 :3 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1
to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound III, is between 100:1 and 1 :100 in mixtures C1- 1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound III, is between 50:1 and 1 :50 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound III, is between 20:1 and 1 :20 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound III, is between 5:1 and 1 :5 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound III is, for example, 3:1 , 1 :1 or 1 :3 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III, is between 100:1 and 1 :100 in mixtures C1- 1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III, is between 50:1 and 1 :50 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III, is between 20:1 and 1 :20 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-
6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III, is between 5:1 and 1 :5 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III is, for example, 3:1 , 1 :1 or 1 :3 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III, is between 50:1 and 1 :50 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III, is between 20:1 and 1 :20 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6- 6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1- 6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In one embodiment the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III, is between 5:1 and 1 :5 in mixtures C1-1 to C1- 6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In embodiment to one embodiment the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III is, for example, 3:1 , 1 :1 or 1 :3 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5- 6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to CI O- 6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In embodiment the weight ratio of compound I to compound II is 3:1 ; and the weight ratio of compound I to compound III is 3:1 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3- 6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8- 6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In embodiment the weight ratio of compound I to compound II is 3:1 ; and the weight ratio of compound I to compound III is 1 :1 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3- 6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8- 6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In embodiment the weight ratio of compound I to compound II is 3:1 ; and the weight ratio of
compound I to compound III is 1 :3 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3- 6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8- 6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In embodiment the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III is 3:1 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3- 6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8- 6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
According one embodiment the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III is 1 :1 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C11-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In embodiment the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III is 1 :3 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3- 6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8- 6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In embodiment the weight ratio of compound I to compound II is 1 :3; and the weight ratio of compound I to compound III is 3:1 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3- 6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8- 6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In embodiment the weight ratio of compound I to compound II is 1 :3; and the weight ratio of compound I to compound III is 1 :1 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3- 6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8- 6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In embodiment the weight ratio of compound I to compound II is 1 :3; and the weight ratio of compound I to compound III is 1 :3 in mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3- 6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8- 6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14.
In a preferred embodiment the mixtures C1-1 to C1-6865, C2-1 to C2-6865, C3-1 to C3-6865, C4-1 to C4-6865, C5-1 to C5-6865, C6-1 to C6-6865, C7-1 to C7-6865, C8-1 to C8-6865, C9-1 to C9-6865, C10-1 to C10-6865, C11-1 to C1 1-6865, C12-1 to C12-6865, C13-1 to C13-6865, and C14-1 to C14-6865 of Tables C1 to C14 and in particular when the weight ratios of compound I to compound II and of compound I and compound III are as disclosed for these mixtures as herein before mentioned, are used against Phakopsora pachyrhizi and P.
meibomiae on soybeans and/or against Puccinia triticina, P. striiformis, P. hordei, P. graminis or P. recondita on wheat, barley or rye; P. coronata e.g. on oats, P. sorghi und P. polysora on corn; Puccinia spp. on other crops, e.g. P. heiiathion sunflower, P. arachidis on peanuts;
Uromyces spp. on pulses and other crops crops, e.g. Uromyces viciae-fabae, Uromyces vigniae, Uromyces pisi, U. ciceris-arietini, U. betae syn U. beticda.
Other preferred ternary mixtures are listed in Table D below comprising as component 1 ) one of the compounds I .A, I.B, I.C, I.D, I.E, I.F, I.G, I.H, I.J, I.K, I.L, I.M, I.N, or I.O as defined above, and as component 2) one of the compounds II as defined and numbered above, and as component 3) a compound III from groups A) to K) as defined herein. Preferably, the
compositions comprise the active substances in synergistically effective amounts. In the ternary mixtures D-1 to D-476 the components 1 ), 2) and 3) are written down in this order (comp.
1 )+comp. 2)+comp. 3)), so that one mixture, for example mixture D1 -1 , comprises as
component 1 ) compound I .A, as component 2) compound (A.1 .1 ) and as component 3) compound (B.2.4).
Table D:
D-1 : I.A + (B.1.38) + (B.2.4), D-2: I.A + (B.1.38) + (A.1.25), D-3: I.A + (B.1.38) + (A.1.14), D-4: I.A + (B.1 .38) + (A.3.9), D-5: I.A + (B.1.38) + (B.1 .23), D-6: I.A + (B.1.38) + (A.1.1), D-7: I.A + (B.1 .38) + (A.1 .34), D-8: I.A + (B.1.38) + (D.2.6), D-9: I.A + (B.1.38) + (H.2.2), D-10: I.A + (B.1 .38) + (H.1 .5), D-1 1 : I.A + (A.3.9) + (A.1 .14), D-12: I. A + (A.3.9) + (A.1.1), D-13: I.A + (A.3.9) + (A.1 .25), D-14: I.A + (A.3.9) + (A.1 .34), D-15: I.A + (A.3.9) + (D.2.6), D-16: I. A + (A.3.9) + (B.2.4), D-17: I.A + (A.3.9) + (H.2.2), D-18: I. A + (A.3.9) + (H.3.2), D-19: I.A + (A.3.9) + (H.1.5), D-20: I.A + (A.1 .25) + (A.1.1), D-21 : I.A + (A.1.25) + (A.1 .14), D-22: LA + (A.1.25) + (A.1 .34), D- 23: I.A + (A.1.25) + (D.2.6), D-24: I.A + (A.1.25) + (B.2.4), D-25: I.A + (A.1.25) + (H.2.2), D-26: I.A + (A.1 .25) + (H.1 .5), D-27: I.A + (A.3.9) + (B.1 .23), D-28: I.A + (B.1.23) + (B.2.4), D-29: I.A + (B.1 .23) + (H.2.2), D-30: I.A + (B.1.23) + (H.3.2), D-31 : I.A + (B.1 .23) + (H.1.5), D-32: I.A + (B.2.4) + (H.2.2), D-33: I.A + (B.2.4) + (H.1 .5), D-34: I.A + (B.2.4) + (H.3.2), D-35: I.B + (B.1.38) + (B.2.4), D-36: I.B + (B.1.38) + (A.1 .25), D-37: I.B + (B.1.38) + (A.1 .14), D-38: I.B + (B.1.38) + (A.3.9), D-39: I.B + (B.1.38) + (B.1 .23), D-40: I.B + (B.1.38) + (A.1.1), D-41 : I.B + (B.1.38) +
(A.1 .34), D-42: I.B + (B.1.38) + (D.2.6), D-43: I.B + (B.1.38) + (H.2.2), D-44: I.B + (B.1.38) +
(H.1 .5), D-45: I.B + (A.3.9) + (A.1 .14), D-46: I.B + (A.3.9) + (A.1.1), D-47: I.B + (A.3.9) +
(A.1 .25), D-48: I.B + (A.3.9) + (A.1 .34), D-49: I.B + (A.3.9) + (D.2.6), D-50: I.B + (A.3.9) +
(B.2.4), D-51 : I.B + (A.3.9) + (H.2.2), D-52: I.B + (A.3.9) + (H.3.2), D-53: I.B + (A.3.9) + (H.1.5), D-54: I.B + (A.1 .25) + (A.1.1), D-55: I.B + (A.1.25) + (A.1 .14), D-56: I.B + (A.1.25) + (A.1 .34), D- 57: I.B + (A.1.25) + (D.2.6), D-58: I.B + (A.1.25) + (B.2.4), D-59: I.B + (A.1.25) + (H.2.2), D-60: I.B + (A.1 .25) + (H.1 .5), D-61 : I.B + (A.3.9) + (B.1 .23), D-62: I.B + (B.1.23) + (B.2.4), D-63: I.B + (B.1 .23) + (H.2.2), D-64: I.B + (B.1.23) + (H.3.2), D-65: I.B + (B.1 .23) + (H.1 .5), D-66: I.B + (B.2.4) + (H.2.2), D-67: I.B + (B.2.4) + (H.1 .5), D-68: I.B + (B.2.4) + (H.3.2), D-69: I.C + (B.1.38) + (B.2.4), D-70: I.C + (B.1.38) + (A.1 .25), D-71 : I.C + (B.1.38) + (A.1 .14), D-72: I.C + (B.1.38) + (A.3.9), D-73: I.C + (B.1.38) + (B.1 .23), D-74: I.C + (B.1.38) + (A.1.1), D-75: I.C + (B.1.38) +
(A.1 .34), D-76: I.C + (B.1.38) + (D.2.6), D-77: I.C + (B.1.38) + (H.2.2), D-78: I.C + (B.1.38) +
(H.1 .5), D-79: I.C + (A.3.9) + (A.1 .14), D-80: I.C + (A.3.9) + (A.1.1), D-81 : I.C + (A.3.9) +
(A.1 .25), D-82: I.C + (A.3.9) + (A.1 .34), D-83: I.C + (A.3.9) + (D.2.6), D-84: I.C + (A.3.9) + (B.2.4), D-85: I.C + (A.3.9) + (H.2.2), D-86: I.C + (A.3.9) + (H.3.2), D-87: I.C + (A.3.9) + (H.1.5), D-88: I.C + (A.1.25) + (A.1.1), D-89: I.C + (A.1.25) + (A.1 .14), D-90: I.C + (A.1.25) + (A.1 .34), D-
91: I.C + (A.1.25) + (D.2.6), D-92: I.C + (A.1.25) + (B.2.4), D-93: I.C + (A.1.25) + (H.2.2), D-94: I.C + (A.1.25) + (H.1.5), D-95: I.C + (A.3.9) + (B.1.23), D-96: I.C + (B.1.23) + (B.2.4), D-97: I.C + (B.1.23) + (H.2.2), D-98: I.C + (B.1.23) + (H.3.2), D-99: I.C + (B.1.23) + (H.1.5), D-100: I.C + (B.2.4) + (H.2.2), D-101 : I.C + (B.2.4) + (H.1.5), D-102: I.C + (B.2.4) + (H.3.2), D-103: I.D + (B.1.38) + (B.2.4), D-104: I.D + (B.1.38) + (A.1.25), D-105: I.D + (B.1.38) + (A.1.14), D-106: I.D + (B.1.38) + (A.3.9), D-107: I.D + (B.1.38) + (B.1.23), D-108: I.D + (B.1.38) + (A.1.1), D-109: I.D + (B.1.38) + (A.1.34), D-110: I.D + (B.1.38) + (D.2.6), D-111: I.D + (B.1.38) + (H.2.2), D-112: I.D + (B.1.38) + (H.1.5), D-113: I.D + (A.3.9) + (A.1.14), D-114: I.D + (A.3.9) + (A.1.1), D-115: I.D + (A.3.9) + (A.1.25), D-116: I.D + (A.3.9) + (A.1.34), D-117: I.D + (A.3.9) + (D.2.6), D-118: I.D + (A.3.9) + (B.2.4), D-119: I.D + (A.3.9) + (H.2.2), D-120: I.D + (A.3.9) + (H.3.2), D-121: I.D + (A.3.9) + (H.1.5), D-122: I.D + (A.1.25) + (A.1.1), D-123: I.D + (A.1.25) + (A.1.14), D-124: I.D + (A.1.25) + (A.1.34), D-125: I.D + (A.1.25) + (D.2.6), D-126: I.D + (A.1.25) + (B.2.4), D-127: I.D + (A.1.25) + (H.2.2), D-128: I.D + (A.1.25) + (H.1.5), D-129: I.D + (A.3.9) + (B.1.23), D-130: I.D + (B.1.23) + (B.2.4), D-131 : I.D + (B.1.23) + (H.2.2), D-132: I.D + (B.1.23) + (H.3.2), D-133: I.D + (B.1.23) + (H.1.5), D-134: I.D + (B.2.4) + (H.2.2), D-135: I.D + (B.2.4) + (H.1.5), D-136: I.D + (B.2.4) + (H.3.2), D-137: I.E + (B.1.38) + (B.2.4), D-138: I.E + (B.1.38) + (A.1.25), D-139: I.E + (B.1.38) + (A.1.14), D-140: I.E + (B.1.38) + (A.3.9), D-141: I.E + (B.1.38) + (B.1.23), D-142: I.E + (B.1.38) + (A.1.1), D-143: I.E + (B.1.38) + (A.1.34), D-144: I.E + (B.1.38) + (D.2.6), D-145: I.E
+ (B.1.38) + (H.2.2), D-146: I.E + (B.1.38) + (H.1.5), D-147: I.E + (A.3.9) + (A.1.14), D-148: I.E +
(A.3.9) + (A.1.1), D-149: I.E + (A.3.9) + (A.1.25), D-150: I.E + (A.3.9) + (A.1.34), D-151: I.E + (A.3.9) + (D.2.6), D-152: I.E + (A.3.9) + (B.2.4), D-153: I.E + (A.3.9) + (H.2.2), D-154: I.E + (A.3.9) + (H.3.2), D-155: I.E + (A.3.9) + (H.1.5), D-156: I.E + (A.1.25) + (A.1.1), D-157: I.E + (A.1.25) + (A.1.14), D-158: I.E + (A.1.25) + (A.1.34), D-159: I.E + (A.1.25) + (D.2.6), D-160: I.E
+ (A.1.25) + (B.2.4), D-161 : I.E + (A.1.25) + (H.2.2), D-162: I.E + (A.1.25) + (H.1.5), D-163: I.E +
(A.3.9) + (B.1.23), D-164: I.E + (B.1.23) + (B.2.4), D-165: I.E + (B.1.23) + (H.2.2), D-166: I.E + (B.1.23) + (H.3.2), D-167: I.E + (B.1.23) + (H.1.5), D-168: I.E + (B.2.4) + (H.2.2), D-169: I.E + (B.2.4) + (H.1.5), D-170: I.E + (B.2.4) + (H.3.2), D-171: I.F + (B.1.38) + (B.2.4), D-172: I.F + (B.1.38) + (A.1.25), D-173: I.F + (B.1.38) + (A.1.14), D-174: I.F + (B.1.38) + (A.3.9), D-175: I.F + (B.1.38) + (B.1.23), D-176: I.F + (B.1.38) + (A.1.1), D-177: I.F + (B.1.38) + (A.1.34), D-178: I.F + (B.1.38) + (D.2.6), D-179: I.F + (B.1.38) + (H.2.2), D-180: I.F + (B.1.38) + (H.1.5), D-181: I.F + (A.3.9) + (A.1.14), D-182: I.F + (A.3.9) + (A.1.1), D-183: I.F + (A.3.9) + (A.1.25), D-184: I.F + (A.3.9) + (A.1.34), D-185: I.F + (A.3.9) + (D.2.6), D-186: I.F + (A.3.9) + (B.2.4), D-187: I.F + (A.3.9) + (H.2.2), D-188: I.F + (A.3.9) + (H.3.2), D-189: I.F + (A.3.9) + (H.1.5), D-190: I.F + (A.1.25) + (A.1.1), D-191 : I.F + (A.1.25) + (A.1.14), D-192: I.F + (A.1.25) + (A.1.34), D-193: I.F +
(A.1.25) + (D.2.6), D-194: I.F + (A.1.25) + (B.2.4), D-195: I.F + (A.1.25) + (H.2.2), D-196: I.F +
(A.1.25) + (H.1.5), D-197: I.F + (A.3.9) + (B.1.23), D-198: I.F + (B.1.23) + (B.2.4), D-199: I.F +
(B.1.23) + (H.2.2), D-200: I.F + (B.1.23) + (H.3.2), D-201: I.F + (B.1.23) + (H.1.5), D-202: I.F +
(B.2.4) + (H.2.2), D-203: I.F + (B.2.4) + (H.1.5), D-204: I.F + (B.2.4) + (H.3.2), D-205: I.G + (B.1.38) + (B.2.4), D-206: I.G + (B.1.38) + (A.1.25), D-207: I.G + (B.1.38) + (A.1.14), D-208: I.G + (B.1.38) + (A.3.9), D-209: I.G + (B.1.38) + (B.1.23), D-210: I.G + (B.1.38) + (A.1.1), D-211: I.G + (B.1.38) + (A.1.34), D-212: I.G + (B.1.38) + (D.2.6), D-213: I.G + (B.1.38) + (H.2.2), D-214: I.G + (B.1.38) + (H.1.5), D-215: I.G + (A.3.9) + (A.1.14), D-216: I.G + (A.3.9) + (A.1.1), D-217: I.G +
(A.3.9) + (A.1.25), D-218: I.G + (A.3.9) + (A.1.34), D-219: I.G + (A.3.9) + (D.2.6), D-220: I.G + (A.3.9) + (B.2.4), D-221 : I.G + (A.3.9) + (H.2.2), D-222: I.G + (A.3.9) + (H.3.2), D-223: I.G + (A.3.9) + (H.1.5), D-224: I.G + (A.1.25) + (A.1.1), D-225: I.G + (A.1.25) + (A.1.14), D-226: I.G + (A.1.25) + (A.1.34), D-227: I.G + (A.1.25) + (D.2.6), D-228: I.G + (A.1.25) + (B.2.4), D-229: I.G + (A.1.25) + (H.2.2), D-230: I.G + (A.1.25) + (H.1.5), D-231: I.G + (A.3.9) + (B.1.23), D-232: I.G + (B.1.23) + (B.2.4), D-233: I.G + (B.1.23) + (H.2.2), D-234: I.G + (B.1.23) + (H.3.2), D-235: I.G + (B.1.23) + (H.1.5), D-236: I.G + (B.2.4) + (H.2.2), D-237: I.G + (B.2.4) + (H.1.5), D-238: I.G + (B.2.4) + (H.3.2), D-239: I.H + (B.1.38) + (B.2.4), D-240: I.H + (B.1.38) + (A.1.25), D-241: I.H + (B.1.38) + (A.1.14), D-242: I.H + (B.1.38) + (A.3.9), D-243: I.H + (B.1.38) + (B.1.23), D-244: I.H + (B.1.38) + (A.1.1), D-245: I.H + (B.1.38) + (A.1.34), D-246: I.H + (B.1.38) + (D.2.6), D-247: I.H + (B.1.38) + (H.2.2), D-248: I.H + (B.1.38) + (H.1.5), D-249: I.H + (A.3.9) + (A.1.14), D-250: I.H + (A.3.9) + (A.1.1), D-251 : I.H + (A.3.9) + (A.1.25), D-252: I.H + (A.3.9) + (A.1.34), D-253: I.H + (A.3.9) + (D.2.6), D-254: I.H + (A.3.9) + (B.2.4), D-255: I.H + (A.3.9) + (H.2.2), D-256: I.H + (A.3.9) + (H.3.2), D-257: I.H + (A.3.9) + (H.1.5), D-258: I.H + (A.1.25) + (A.1.1), D-259: I.H + (A.1.25) + (A.1.14), D-260: I.H + (A.1.25) + (A.1.34), D-261: I.H + (A.1.25) + (D.2.6), D-262: I.H + (A.1.25) + (B.2.4), D-263: I.H + (A.1.25) + (H.2.2), D-264: I.H + (A.1.25) + (H.1.5), D-265: I.H + (A.3.9) + (B.1.23), D-266: I.H + (B.1.23) + (B.2.4), D-267: I.H + (B.1.23) + (H.2.2), D-268: I.H + (B.1.23) + (H.3.2), D-269: I.H + (B.1.23) + (H.1.5), D-270: I.H + (B.2.4) + (H.2.2), D-271: I.H + (B.2.4) + (H.1.5), D-272: I.H + (B.2.4) + (H.3.2), D-273: I.J + (B.1.38) + (B.2.4), D-274: I.J + (B.1.38) + (A.1.25), D-275: I.J + (B.1.38) + (A.1.14), D-276: I.J + (B.1.38) + (A.3.9), D-277: I.J + (B.1.38) + (B.1.23), D-278: I.J + (B.1.38) + (A.1.1), D-279: I.J + (B.1.38) + (A.1.34), D-280: I.J + (B.1.38) + (D.2.6), D-281 : I.J + (B.1.38) + (H.2.2), D-282: I.J + (B.1.38) + (H.1.5), D-283: I.J + (A.3.9) + (A.1.14), D-284: I.J + (A.3.9) + (A.1.1), D-285: I.J + (A.3.9) + (A.1.25), D-286: I.J + (A.3.9) + (A.1.34), D-287: I.J + (A.3.9) + (D.2.6), D-288: I.J + (A.3.9) + (B.2.4), D-289: I.J + (A.3.9) + (H.2.2), D-290: I.J + (A.3.9) + (H.3.2), D-291: I.J + (A.3.9) + (H.1.5), D-292: I.J + (A.1.25) + (A.1.1), D-293: I.J + (A.1.25) + (A.1.14), D-294: I.J + (A.1.25) + (A.1.34), D-295: I.J + (A.1.25) + (D.2.6), D-296: I.J + (A.1.25) + (B.2.4), D-297: I.J + (A.1.25) + (H.2.2), D-298: I.J + (A.1.25) + (H.1.5), D-299: I.J + (A.3.9) + (B.1.23), D-300: I.J + (B.1.23) + (B.2.4), D-301: I.J + (B.1.23) + (H.2.2), D-302: I.J + (B.1.23) + (H.3.2), D-303: I.J + (B.1.23) + (H.1.5), D-304: I.J + (B.2.4) + (H.2.2), D-305: I.J + (B.2.4) + (H.1.5), D-306: I.J + (B.2.4) + (H.3.2), D-307: I.K + (B.1.38) + (B.2.4), D-308: I.K + (B.1.38) + (A.1.25), D-309: I.K + (B.1.38) + (A.1.14), D-310: I.K + (B.1.38) + (A.3.9), D-311: I.K + (B.1.38) + (B.1.23), D-312: I.K + (B.1.38) + (A.1.1), D-313: I.K + (B.1.38) + (A.1.34), D-314: I.K + (B.1.38) + (D.2.6), D-315: I.K + (B.1.38) + (H.2.2), D-316: I.K + (B.1.38) + (H.1.5), D-317: I.K + (A.3.9) + (A.1.14), D-318: I.K + (A.3.9) + (A.1.1), D-319: I.K + (A.3.9) + (A.1.25), D-320: I.K + (A.3.9) + (A.1.34), D-321 : I.K + (A.3.9) + (D.2.6), D-322: I.K + (A.3.9) + (B.2.4), D-323: I.K + (A.3.9) + (H.2.2), D-324: I.K + (A.3.9) + (H.3.2), D-325: I.K + (A.3.9) + (H.1.5), D-326: I.K + (A.1.25) + (A.1.1), D-327: I.K + (A.1.25) + (A.1.14), D-328: I.K + (A.1.25) + (A.1.34), D-329: I.K + (A.1.25) + (D.2.6), D-330: I.K + (A.1.25) + (B.2.4), D-331: I.K + (A.1.25) + (H.2.2), D-332: I.K + (A.1.25) + (H.1.5), D-333: I.K + (A.3.9) + (B.1.23), D-334: I.K + (B.1.23) + (B.2.4), D-335: I.K + (B.1.23) + (H.2.2), D-336: I.K + (B.1.23) + (H.3.2), D-337: I.K + (B.1.23) + (H.1.5), D-338: I.K + (B.2.4) + (H.2.2), D-339: I.K + (B.2.4) + (H.1.5), D-340: I.K + (B.2.4) + (H.3.2), D-341 : I.L + (B.1.38) + (B.2.4), D-342: I.L + (B.1.38) + (A.1.25), D-343: I.L +
(B.1.38) + (A.1.14), D-344: I.L + (B.1.38) + (A.3.9), D-345: I.L + (B.1.38) + (B.1.23), D-346: I.L + (B.1.38) + (A.1.1), D-347: I.L + (B.1.38) + (A.1.34), D-348: I.L + (B.1.38) + (D.2.6), D-349: I.L + (B.1.38) + (H.2.2), D-350: I.L + (B.1.38) + (H.1.5), D-351: I.L + (A.3.9) + (A.1.14), D-352: I.L + (A.3.9) + (A.1.1), D-353: I.L + (A.3.9) + (A.1.25), D-354: I.L + (A.3.9) + (A.1.34), D-355: I.L + (A.3.9) + (D.2.6), D-356: I.L + (A.3.9) + (B.2.4), D-357: I.L + (A.3.9) + (H.2.2), D-358: I.L +
(A.3.9) + (H.3.2), D-359: I.L + (A.3.9) + (H.1.5), D-360: I.L + (A.1.25) + (A.1.1), D-361: I.L +
(A.1.25) + (A.1.14), D-362: I.L + (A.1.25) + (A.1.34), D-363: I.L + (A.1.25) + (D.2.6), D-364: I.L + (A.1.25) + (B.2.4), D-365: I.L + (A.1.25) + (H.2.2), D-366: I.L + (A.1.25) + (H.1.5), D-367: I.L + (A.3.9) + (B.1.23), D-368: I.L + (B.1.23) + (B.2.4), D-369: I.L + (B.1.23) + (H.2.2), D-370: I.L + (B.1.23) + (H.3.2), D-371 : I.L + (B.1.23) + (H.1.5), D-372: I.L + (B.2.4) + (H.2.2), D-373: I.L + (B.2.4) + (H.1.5), D-374: I.L + (B.2.4) + (H.3.2), D-375: I.M + (B.1.38) + (B.2.4), D-376: I.M + (B.1.38) + (A.1.25), D-377: I.M + (B.1.38) + (A.1.14), D-378: I.M + (B.1.38) + (A.3.9), D-379: I.M + (B.1.38) + (B.1.23), D-380: I.M + (B.1.38) + (A.1.1), D-381: I.M + (B.1.38) + (A.1.34), D-382: I.M + (B.1.38) + (D.2.6), D-383: I.M + (B.1.38) + (H.2.2), D-384: I.M + (B.1.38) + (H.1.5), D-385: I.M + (A.3.9) + (A.1.14), D-386: I.M + (A.3.9) + (A.1.1), D-387: I.M + (A.3.9) + (A.1.25), D-388: I.M + (A.3.9) + (A.1.34), D-389: I.M + (A.3.9) + (D.2.6), D-390: I.M + (A.3.9) + (B.2.4), D-391: I.M + (A.3.9) + (H.2.2), D-392: I.M + (A.3.9) + (H.3.2), D-393: I.M + (A.3.9) + (H.1.5), D-394: I.M + (A.1.25) + (A.1.1), D-395: I.M + (A.1.25) + (A.1.14), D-396: I.M + (A.1.25) + (A.1.34), D-397: I.M + (A.1.25) + (D.2.6), D-398: I.M + (A.1.25) + (B.2.4), D-399: I.M + (A.1.25) + (H.2.2), D-400: I.M + (A.1.25) + (H.1.5), D-401 : I.M + (A.3.9) + (B.1.23), D-402: I.M + (B.1.23) + (B.2.4), D-403: I.M + (B.1.23) + (H.2.2), D-404: I.M + (B.1.23) + (H.3.2), D-405: I.M + (B.1.23) + (H.1.5), D-406: I.M + (B.2.4) + (H.2.2), D-407: I.M + (B.2.4) + (H.1.5), D-408: I.M + (B.2.4) + (H.3.2), D-409: I.N + (B.1.38) + (B.2.4), D-410: I.N + (B.1.38) + (A.1.25), D-411: I.N + (B.1.38) + (A.1.14), D-412: I.N + (B.1.38) + (A.3.9), D-413: I.N + (B.1.38) + (B.1.23), D-414: I.N + (B.1.38) + (A.1.1), D-415: I.N + (B.1.38) + (A.1.34), D-416: I.N + (B.1.38) + (D.2.6), D-417: I.N + (B.1.38) + (H.2.2), D-418: I.N + (B.1.38) + (H.1.5), D-419: I.N + (A.3.9) + (A.1.14), D-420: I.N + (A.3.9) + (A.1.1), D-421: I.N + (A.3.9) + (A.1.25), D-422: I.N + (A.3.9) + (A.1.34), D-423: I.N + (A.3.9) + (D.2.6), D-424: I.N + (A.3.9) + (B.2.4), D-425: I.N + (A.3.9) + (H.2.2), D-426: I.N + (A.3.9) + (H.3.2), D-427: I.N + (A.3.9) + (H.1.5), D-428: I.N + (A.1.25) + (A.1.1), D-429: I.N + (A.1.25) + (A.1.14), D-430: I.N + (A.1.25) + (A.1.34), D-431: I.N + (A.1.25) + (D.2.6), D-432: I.N + (A.1.25) + (B.2.4), D-433: I.N + (A.1.25) + (H.2.2), D-434: I.N + (A.1.25) + (H.1.5), D-435: I.N + (A.3.9) + (B.1.23), D-436: I.N + (B.1.23) + (B.2.4), D-437: I.N + (B.1.23) + (H.2.2), D-438: I.N + (B.1.23) + (H.3.2), D-439: I.N + (B.1.23) + (H.1.5), D-440: I.N + (B.2.4) + (H.2.2), D-441: I.N + (B.2.4) + (H.1.5), D-442: I.N + (B.2.4) + (H.3.2), D-443: I.O + (B.1.38) + (B.2.4), D-444: I.O + (B.1.38) + (A.1.25), D-445: I.O + (B.1.38) + (A.1.14), D-446: I.O + (B.1.38) + (A.3.9), D-447: I.O + (B.1.38) + (B.1.23), D-448: I.O + (B.1.38) + (A.1.1), D-449: I.O + (B.1.38) + (A.1.34), D-450: I.O + (B.1.38) + (D.2.6), D-451: I.O + (B.1.38) + (H.2.2), D-452: I.O + (B.1.38) + (H.1.5), D-453: I.O + (A.3.9) + (A.1.14), D-454: I.O + (A.3.9) + (A.1.1), D-455: I.O + (A.3.9) + (A.1.25), D-456: I.O + (A.3.9) + (A.1.34), D-457: I.O + (A.3.9) + (D.2.6), D-458: I.O + (A.3.9) + (B.2.4), D-459: I.O + (A.3.9) + (H.2.2), D-460: I.O + (A.3.9) + (H.3.2), D-461 : I.O + (A.3.9) + (H.1.5), D-462: I.O + (A.1.25) + (A.1.1), D-463: I.O + (A.1.25) + (A.1.14), D-464: I.O + (A.1.25) + (A.1.34), D-465: I.O + (A.1.25) + (D.2.6), D-466: I.O + (A.1.25) + (B.2.4), D-467: I.O + (A.1.25) + (H.2.2), D-468: I.O + (A.1.25) + (H.1.5), D-469: I.O
+ (A.3.9) + (B.1.23), D-470: I.O + (B.1.23) + (B.2.4), D-471 : I.O + (B.1.23) + (H.2.2), D-472: I.O + (B.1.23) + (H.3.2), D-473: I.O + (B.1.23) + (H.1.5), D-474: I.O + (B.2.4) + (H.2.2), D-475: I.O + (B.2.4) + (H.1.5), D-476: I.O + (B.2.4) + (H.3.2).
In one embodiment the weight ratio of compound to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound I , is between 100:1 and 1 :100 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound I , is between 50:1 and 1 :50 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound I , is between 20:1 and 1 :20 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound I , is between 5:1 and 1 :5 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound I is, for example, 3:1 , 1 :1 or 1 :3 in mixtures D- 1 to D-476 of Table D.
In one embodiment the weight ratio of compound to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound I , is between 100:1 and 1 :100 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound I , is between 50:1 and 1 :50 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound I , is between 20:1 and 1 :20 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound I , is between 5:1 and 1 :5 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound I is 3:1 in mixtures D-1 to D-476 of Table D. In one embodiment the weight ratio of compound to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound I is 1 :1 in mixtures D-1 to D-476 of Table D. In one embodiment the weight ratio of compound to compound II is between 100:1 and 1 :100; and the weight ratio of compound I to compound I is 1 :3 in mixtures D-1 to D-476 of Table D. In one embodiment the weight ratio of compound to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound I , is between 100:1 and 1 :100 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound I , is between 50:1 and 1 :50 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound I , is between 20:1 and 1 :20 in mixtures D-1 to
D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III, is between 5:1 and 1 :5 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III is 3:1 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound III is 1 :1 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 50:1 and 1 :50; and the weight ratio of compound I to compound III is 1 :3 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III, is between 50:1 and 1 :50 in mixtures D-1 to D- 476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III, is between 20:1 and 1 :20 in mixtures D-1 to D- 476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III, is between 2:1 and 1 :10 in mixtures D-1 to D- 476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III, is between 5:1 and 1 :5 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III, is between 2:1 and 1 :5 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 2:1 and 1 :2; and the weight ratio of compound I to compound III, is between 2:1 and 1 :20 in mixtures D-1 to D- 476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 2:1 and 1 :2; and the weight ratio of compound I to compound III, is between 2:1 and 1 :10 in mixtures D-1 to D- 476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 2:1 and 1 :2; and the weight ratio of compound I to compound III, is between 2:1 and 1 :5 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 2:1 and 1 :2; and the weight ratio of compound I to compound III, is between 1 :1 and 1 :5 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III, is between 2:1 and 1 :5 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III, is between 1 :1 and 1 :5 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III is 3:1 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 20:1 and 1 :20;
and the weight ratio of compound I to compound III is 1 :1 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 20:1 and 1 :20; and the weight ratio of compound I to compound III is 1 :3 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III is 3:1 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III is 1 :1 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 5:1 and 1 :5; and the weight ratio of compound I to compound III is 1 :3 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 2:1 and 1 :2; and the weight ratio of compound I to compound III is 3:1 to 1 :3 in mixtures D-1 to D-476 of Table D. In one embodiment the weight ratio of compound I to compound II is between 2:1 and 1 :2; and the weight ratio of compound I to compound III is 2:1 to 1 :2 in mixtures D-1 to D-476 of Table D. In one embodiment the weight ratio of compound I to compound II is between 2:1 and 1 :2; and the weight ratio of compound I to compound III is 1.5:1 to 1 :1.5 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 2:1 and 1 :2; and the weight ratio of compound I to compound III is 1 :1 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 1.5:1 and 1 :1.5; and the weight ratio of compound I to compound III is 3:1 to 1 :3 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 1.5:1 and 1 :1.5; and the weight ratio of compound I to compound III is 2:1 to 1 :2 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 1.5:1 and 1 :1.5; and the weight ratio of compound I to compound III is 1.5:1 to 1 :1.5 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is between 1.5:1 and 1 :1.5; and the weight ratio of compound I to compound III is 1 :1 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is 3:1 ; and the weight ratio of compound I to compound III is 3:1 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is 3:1 ; and the weight ratio of compound I to compound III is 1 :1 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is 3:1 ; and the weight ratio of compound I to compound III is 1 :3 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III is 3:1 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III is 1 :1 in mixtures D-1 to D-476 of Table D.
In one embodiment the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III is 1 :3 in mixtures D-1 to D-476 of Table D.
In a paticular embodiment the weight ratio of compound I to compound II is 1 :1 ; and the weight ratio of compound I to compound III is 1 :11 in mixtures D-1 to D-476 of Table D.
In a paticular embodiment the weight ratio of compound I to compound II is 1 :1 ; and the weight
ratio of compound I to compound III is 1 :4 in mixtures D-1 to D-476 of Table D.
In another embodiment the weight ratio of compound I to compound II is 4:3; and the weight ratio of compound I to compound III is 4:33 in mixtures D-1 to D-476 of Table D.
In another embodiment the weight ratio of compound I to compound II is 4:3; and the weight ratio of compound I to compound III is 4:33 in mixtures D-1 to D-476 of Table D.
In another embodiment the weight ratio of compound I to compound II is 4:2; and the weight ratio of compound I to compound III is 4:5 in mixtures D-1 to D-476 of Table D.
In a preferred embodiment the mixtures D-1 to D-476 of Table D and in particular when the weight ratios of compound I to compound II and of compound I and compound III are as disclosed for these mixtures as herein before mentioned, are used against Phakopsora pachyrhizi and P. meibomiae on soybeans and/or against Puccinia triticina, P. striiformis, P. hordei, P. gra minis ox P. recon dita on wheat, barley or rye; P. coronata e.g. on oats, P. sorghi und P. poiysora on corn; Puccinia spp. on other crops, e.g. P. heiiathion sunflower, P. arachidis on peanuts; Uromyces spp. on pulses and other crops crops, e.g. Uromyces viciae-fabae, Uromyces vigniae, Uromyces pisi, U. ciceris-arietini, U. betae syn U. beticoia.
The binary and ternary mixtures and agrochemical compositions thereof according to the invention can, in the use form as fungicides, also be present together with further active substances, e. g. with herbicides, insecticides, growth regulators, fungicides or else with fertilizers, as pre-mix or, if appropriate, not until immeadiately prior to use (tank mix).
Mixing the active compounds I, II and III and the compositions comprising the mixtures, respectively, in the use form as fungicides with other fungicides results in many cases in an expansion of the fungicidal spectrum of activity being obtained or in a prevention of fungicide resistance development. Furthermore, in many cases, synergistic effects are obtained.
The binary and ternary mixtures and agrochemical compositions thereof according to the invention are suitable as fungicides. They are distinguished by an outstanding effectiveness against a broad spectrum of phytopathogenic fungi, including soil-borne fungi, which derive especially from the following classes or are closely related to any of them: Ascomycota
(Ascomycetes), for example, but not limited to the genus Cocholiobolus, Colletotrichum, Fusarium, Microdochium, Penicillium, Phoma, Magnaporte, Zymoseptoria, and
Pseudocercosporella; Basdiomycota (Basidiomycetes), for example, but not limited to the genus Phakospora, Puccinia, Rhizoctonia, Sphacelotheca, Tilletia, Typhula, and Ustilago;
Chytridiomycota (Chytridiomycetes), for example, but not limited to the genus Chytridiales, and Synchytrium; Deuteromycetes (syn. Fungi imperfecti), for example, but not limited to the genus Ascochyta, Dipiodia, Erysiphe, Fusarium, Phomopsis, and Pyrenophora; Peronosporomycetes (syn. Oomycetes), for example but not limited to the genus Peronospora, Pythium,
Phytophthora; Piasmodiophoromycetes, for example but not limited to the genus
Plasmodiophora; Zygomycetes, for example, but not limited to the genus Rhizopus.
Some of the binary and ternary mixtures and agrochemical compositions thereof according to the invention are systemically effective and they can be used in crop protection as foliar fungicides, fungicides for seed dressing and soil fungicides. Moreover, they are suitable for controlling harmful fungi, which inter alia occur in wood or roots of plants.
The binary and ternary mixtures and agrochemical compositions thereof according to the
invention are particularly important in the control of a multitude of phytopathogenic fungi on various cultivated plants, such as cereals, e. g. wheat, rye, barley, triticale, oats or rice; beet, e. g. sugar beet or fodder beet; fruits, such as pomes, stone fruits or soft fruits, e. g. apples, pears, plums, peaches, almonds, cherries, strawberries, raspberries, blackberries or gooseberries; leguminous plants, such as lentils, peas, alfalfa or soybeans; oil plants, such as oilseed rape, mustard, olives, sunflowers, coconut, cocoa beans, castor oil plants, oil palms, ground nuts or soybeans; cucurbits, such as squashes, cucumber or melons; fiber plants, such as cotton, flax, hemp or jute; citrus fruit, such as oranges, lemons, grapefruits or mandarins; vegetables, such as spinach, lettuce, asparagus, cabbages, carrots, onions, tomatoes, potatoes, cucurbits or paprika; lauraceous plants, such as avocados, cinnamon or camphor; energy and raw material plants, such as corn, soybean, oilseed rape, sugar cane or oil palm; corn; tobacco; nuts; coffee; tea; bananas; vines (table grapes and grape juice grape vines); hop; turf; sweet leaf (also called Stevia); natural rubber plants or ornamental and forestry plants, such as flowers, shrubs, broad- leaved trees or evergreens, e. g. conifers; and on the plant propagation material, such as seeds, and the crop material of these plants.
Preferably, binary and ternary mixtures and agrochemical compositions thereof according to the invention are used for controlling a multitude of fungi on field crops, such as potatoes sugar beets, tobacco, wheat, rye, barley, oats, rice, corn, cotton, soybeans, oilseed rape, legumes, sunflowers, coffee or sugar cane; fruits; vines; ornamentals; or vegetables, such as cucumbers, tomatoes, beans or squashes.
The term "plant propagation material" is to be understood to denote all the generative parts of the plant such as seeds and vegetative plant material such as cuttings and tubers (e. g.
potatoes), which can be used for the multiplication of the plant. This includes seeds, roots, fruits, tubers, bulbs, rhizomes, shoots, sprouts and other parts of plants, including seedlings and young plants, which are to be transplanted after germination or after emergence from soil.
These young plants may also be protected before transplantation by a total or partial treatment by immersion or pouring.
Preferably, treatment of plant propagation materials with binary and ternary mixtures and agrochemical compositions thereof according to the invention is used for controlling a multitude of fungi on cereals, such as wheat, rye, barley and oats; rice, corn, cotton and soybeans.
The term "cultivated plants" is to be understood as including plants which have been modified by mutagenesis or genetic engineering in order to provide a new trait to a plant or to modify an already present trait.
Mutagenesis includes techniques of random mutagenesis using X-rays or mutagenic chemicals, but also techniques of targeted mutagenesis, to create mutations at a specific locus of a plant genome. Targeted mutagenesis techniques frequently use oligonucleotides or proteins like CRISPR/Cas, zinc-finger nucleases, TALENs or meganucleases to achieve the targeting effect. Genetic engineering usually uses recombinant DNA techniques to create modifications in a plant genome which under natural circumstances cannot readily be obtained by cross breeding, mutagenesis or natural recombination. Typically, one or more genes are integrated into the genome of a plant to add a trait or improve a trait. These integrated genes are also referred to as transgenes in the art, while plant comprising such transgenes are referred to as transgenic plants. The process of plant transformation usually produces several transformation events, wich differ in the genomic locus in which a transgene has been integrated. Plants comprising a
specific transgene on a specific genomic locus are usually described as comprising a specific “event”, which is referred to by a specific event name. Traits which have been introduced in plants or have been modified include herbicide tolerance, insect resistance, increased yield and tolerance to abiotic conditions, like drought.
Herbicide tolerance has been created by using mutagenesis as well as using genetic engineering. Plants which have been rendered tolerant to acetolactate synthase (ALS) inhibitor herbicides by mutagenesis and breeding comprise plant varieties commercially available under the name Clearfield®.
Herbicide tolerance has been created via the use of transgenes to glyphosate, glufosinate, 2,4- D, dicamba, oxynil herbicides, like bromoxynil and ioxynil, sulfonylurea herbicides, ALS inhibitors and 4-hydroxyphenylpyruvate dioxygenase (HPPD) inhibitors, like isoxaflutole and mesotrione.
Transgenes which have been used to provide herbicide tolerance traits comprise: for tolerance to glyphosate: cp4 epsps, epsps grg23ace5, mepsps, 2mepsps, gat4601 , gat4621 , goxv247; for tolerance to glufosinate: pat and bar, for tolerance to 2,4-D: aad-1 , aad-12; for tolerance to dicamba: dmo; for tolerance to oxynil herbicies: bxn; for tolerance to sulfonylurea herbicides: zm-hra, csr1-2, gm-hra, S4-HrA; for tolerance to ALS inhibitors: csr1-2; and for tolerance to HPPD inhibitors: hppdPF, W336, avhppd-03.
Insect resistance has mainly been created by transferring bacterial genes for insecticidal proteins to plants: Transgenes which have most frequently been used are toxin genes of Bacillus spp. and synthetic variants thereof, like cry1A, crylAb, cry1Ab-Ac, crylAc, cry1A.105, cry1 F, cry1 Fa2, cry2Ab2, cry2Ae, mcry3A, ecry3.1Ab, cry3Bb1 , cry34Ab1 , cry35Ab1 , cry9C, vip3A(a), vip3Aa20. However, also genes of plant origin, such as genes coding for protease inhibitors, like CpTI and pinll, have been transferred to other plants. A further approach uses transgenes such as dvsnf7 to produce double-stranded RNA in plants.
Increased yield has been created by using the transgene athb17, being present for example in corn event MON87403, or by using the transgene bbx32, being present for example in the soybean event MON87712.
Cultivated plants comprising a modified oil content have been created by using the transgenes: gm-fad2-1 , Pj.D6D, Nc.Fad3, fad2-1A and fatb1-A. Soybean events comprising at least one of these genes are: 260-05, MON87705 and MON87769.
Tolerance to abiotic conditions, such as drought, has been created by using the transgene cspB, comprised by the corn event MON87460 and by using the transgene Hahb-4, comprised by soybean event IND-00410-5.
All traits and genes mentioned above can be used to generate an event that contains only one gene or as a stack of two or multiple genes. Those stacked genes can either provide the same trait or different traits. Therefore, every event can provide one or multiple traits.
Transgenic corn events comprising herbicide tolerance genes, genes for insecticidal proteins, or double stranded RNA, or genes involved in increasing yield or abiotic stress tolerance include, but are not limited to,
33121 , 32138, 3272, 4114, 5307, 59122, 676, 678, 680, 98140, Bt10, Bt11 (X4334CBR, X4734CBR), Bt176 (176), BVLA430101 , CBH-351 , DAS40278, DBT418, DLL25 (B16), GA21 , HCEM485, LY038, MIR162, MIR604, MON801 (MON80100), MON802, MON809, MON810, MON832, MON863, MON87403, MON8741 1 , MON87419, MON87427, MON87460,
MON88017, MON89034, MS3, MS6, MZHGOJG, MZIR098, NK603, T14, T25, TC1507,
TC6275, VCO-01981-5
Transgenic soybean events comprising herbicide tolerance genes, genes for insecticidal proteins, or double stranded RNA, or genes involved in increasing yield or abiotic stress tolerance include, but are not limited to,
260-05 (G94-1 , G94-19, G168), A2704-12, A2704-21 , A5547-127, A5547-35, CV127,
DAS44406-6, DAS68416-4, DAS81419, DP305423, DP356043, FG72 (FG072-2, FG072-3), GTS 40-3-2 (40-3-2), GU262, HB4, MON87701 , MON87705, MON87708, MON87712,
MON87751 , MON87769, MON89788, SYHT0H2, W62, W98, MON87751.IND-00410-5 Transgenic cotton events comprising herbicide tolerance genes, genes for insecticidal proteins, or double stranded RNA, or genes involved in increasing yield or abiotic stress tolerance include, but are not limited to,
19-51 a, 281-24-236, 3006-210-23, 31707, 31803, 31807 , 31808, 42317, 81910, BN LA-601 , BXN10211 (1021 1), BXN10215 (10215), BXN10222 (10222), BXN10224 (10224), COT102 (I R102), COT67B (IR67B), Eventl , GFM Cry1A, GHB119, GHB614, GHB811 , GK12,
LLCotton25, MLS 9124, MON1076, MON1445, MON15985, MON1698, MON531 , MON757, MON88701 , MON88702, MON88913, Ngwe Chi 6 Bt, SGK321 , T303-3, T304-40
Transgenic canola events comprising herbicide tolerance genes, genes for insecticidal proteins, or double stranded RNA, or genes involved in increasing yield or abiotic stress tolerance include, but are not limited to, 23-18-17 (Event 18), 23-198 (Event 23), 61061 , 73496, DHA Canola, GT200 (RT200), GT73 (RT73), HCN10 (Topas 19/2), HCN28 (T45), HCN92 (Topas 19/2), HCR-1 MON88302, MPS961 , MPS962, MPS963, MPS964, MPS965, MS1 (B91-4),
MS1 1 , MS8, OXY-235, PHY14, PHY23, PHY35, PHY36, RF1 (B93-101 ), RF2 (B94-2), RF3 Traits are frequently combined by combining genes in one transformation event or by combining different events during the breeding process resulting in a cultivated plant with stacked traits. Preferred combinations of traits are combinations of herbicide tolerance traits to different groups of herbicides, combinations of insect tolerance to different kind of insects, in particular tolerance to lepidopteran and coleopteran insects, combinations of herbicide tolerance with one or several types of insect resistance, combinations of herbicide tolerance with increased yield as well as combinations of herbicide tolerance and tolerance to abiotic conditions.
Plants comprising singular or stacked traits as well as the genes and events providing these traits are well known in the art. For example, detailed information as to the mutagenized or integrated genes and the respective events are available from websites of the organizations “International Service for the Acquisition of Agri-biotech Applications (ISAAA)”
(http://www.isaaa.org/gmapprovaldatabase) and the“Center for Environmental Risk
Assessment (CERA)” (http://cera-gmc.org/GMCropDatabase). Further information on specific events and methods to detect them can be found for canola events MS1 , MS8, RF3, GT73, MON88302, KK179 in W001/031042, W001/041558, W001/041558, W002/036831 ,
W01 1/153186, W013/003558, for cotton events MON 1445, MON 15985, MON531
(MON 15985), LLCotton25, MON88913, COT102, 281-24-236, 3006-210-23, COT67B,
GHB614, T304-40, GHB119, MON88701 , 81910 in WO02/034946, W002/100163,
W002/100163, WO03/013224, WO04/072235, WO04/039986, WO05/103266, WO05/103266, WO06/128573, W007/017186, WO08/122406, W008/151780, W012/134808, W013/1 12527; for corn events GA21 , MON810, DLL25, TC1507, MON863, MIR604, LY038, MON88017, 3272,
59122, NK603, MIR162, MON89034, 98140, 32138, MON87460, 5307, 41 14, MON87427, DAS40278, MON87411 , 33121 , MON87403, MON87419 in W098/044140, US02/102582, US03/126634, WO04/099447, WO04/01 1601 , WO05/103301 , W005/061720, W005/059103, WO06/098952, WO06/039376, US2007/292854, WO07/142840, WO07/140256,
WO08/1 12019, WO09/103049, WO09/1 11263, W010/077816, W011/084621 , W011/062904, W01 1/022469, W013/169923, W014/1 16854, W015/053998, W015/142571 ; for potato events E 12, F10, J3, J55, V1 1 , C17, U9 in WO14/178910, W014/178913, W014/178941 ,
W014/179276, W016/183445, W017/062831 , W017/062825; for rice events LLRICE06, LLRICE601 , LLRICE62 in WO00/026345, WO00/026356, WO00/026345; and for soybean events H7-1 , MON89788, A2704-12, A5547-127, DP305423, DP356043, MON87701 ,
MON87769, CV127, MON87705, DAS68416-4, MON87708, MON87712, SYHT0H2,
DAS81419, DAS81419 x DAS44406-6, MON87751 in WO04/074492, W006/130436,
WO06/108674, WO06/108675, WO08/054747, W008/002872, WO09/064652, WO09/102873, W010/080829, W010/037016, W01 1/066384, W01 1/034704, WO12/051 199, WO12/082548, W013/016527, WO13/016516, W014/201235.
The use of compounds I and compositions according to the invention, respectively, on cultivated plants may result in effects which are specific to a cultivated plant comprising a certain gene or event. These effects might involve changes in growth behavior or changed resistance to biotic or abiotic stress factors. Such effects may in particular comprise enhanced yield, enhanced resistance or tolerance to insects, nematodes, fungal, bacterial, mycoplasma, viral or viroid pathogens as well as early vigour, early or delayed ripening, cold or heat tolerance as well as changed amino acid or fatty acid spectrum or content.
The binary and ternary mixtures and agrochemical compositions thereof according to the invention are particularly suitable for controlling the following plant diseases:
Albugo spp. (white rust) on ornamentals, vegetables (e. g. A. Candida) and sunflowers (e. g. A. tragopogonis), A Hern aria spp. (Alternaria leaf spot) on vegetables (e.g. A. dauciox A. porri), oilseed rape (A. brass icicoia or brassicae ), sugar beets (A. tenuis ), fruits (e.g. A. grandis ), rice, soybeans, potatoes and tomatoes (e. g. A. soiani, A. grandis or A. alternate), tomatoes (e. g. A. soiani ox A. aiternata) and wheat (e.g. A. triticina), Aphanomyces spp. on sugar beets and vegetables; Ascochyta s . on cereals and vegetables, e. g. A. tritici (anthracnose) on wheat and A. hordeiox\ barley; Aureobasidium zeae (syn. Kapatieiia zeae) on corn; Bipoiaris and Drechsiera spp. (teleomorph: Cochiioboius spp.), e. g. Southern leaf blight (D. maydis) ox Northern leaf blight (B. zeicoia) on corn, e. g. spot blotch (B. sorokiniana) on cereals and e. g.
B. oryzae ox\ rice and turfs; Biumeria (formerly Erysiphe) graminis (powdery mildew) on cereals (e. g. on wheat or barley); Botrytis cinerea (teleomorph: Botryotinia fuckeiianar. grey mold) on fruits and berries (e. g. strawberries), vegetables (e. g. lettuce, carrots, celery and cabbages); B. squamosa ox B. aiiii on onion family), oilseed rape, ornamentals (e.g. B eiiptica), vines, forestry plants and wheat; Bremia iactucae (downy mildew) on lettuce; Ceratocystis { syn. Ophiostoma) spp. (rot or wilt) on broad-leaved trees and evergreens, e. g. C. uimi (Dutch elm disease) on elms; Cercospora spp. (Cercospora leaf spots) on corn (e. g. Gray leaf spot: C. zeae-maydis), rice, sugar beets (e. g. C. beticoia), sugar cane, vegetables, coffee, soybeans (e. g. C. sojina ox
C. kikuchii) and rice; Ciadobotryum (syn. Dactyiium) spp. (e.g. C. mycophi!um
(formerly Dactylium dendroides, teleomorph: Nectria albertinii, Nectria rosella syn. Hypomyces rosellus) on mushrooms; Cladosporium spp. on tomatoes (e. g. C. fulvum. leaf mold) and cereals, e. g. C. herbarum (black ear) on wheat; daviceps purpurea (ergot) on cereals;
Cochliobolus (anamorph: Helminthosporium of Bipoiaris ) spp. (leaf spots) on corn (C.
carbonum ), cereals (e. g. C. sativus, anamorph: B. sorokiniana ) and rice (e. g. C. miyabeanus, anamorph: H. oryzae), Colletotrichum (teleomorph: Glomerella) spp. (anthracnose) on cotton (e. g. C. gossypil), corn (e. g. C. graminicola: Anthracnose stalk rot), soft fruits, potatoes (e. g.
C. coccodes: black dot), beans (e. g. C. Hndemuthianum ), soybeans (e. g. C. truncatumox C. gloeosporioides ), vegetables (e.g. C. lagenariumox C. capsid), fruits (e.g. C. acutatum ), coffee (e.g. C. coffeanumox C. kahawae) and C. gloeosporioides on various crops; Corticium spp., e. g. C. sasakii (sheath blight) on rice; Corynespora cassiicoia (leaf spots) on soybeans, cotton and ornamentals; Cycioconium spp., e. g. C. oieaginumox\ olive trees; Cyiindrocarpon spp.
(e. g. fruit tree canker or young vine decline, teleomorph: Nectria or Neonectria spp.) on fruit trees, vines (e. g. C. iiriodendri, teleomorph: Neonectria iiriodendri. Black Foot Disease) and ornamentals; Dematophora (teleomorph: Roseiiinia) necatrix (root and stem rot) on soybeans; Diaporthe spp., e. g. D. phaseoiorum (damping off) on soybeans; Drechsiera (syn.
Helminthosporium, teleomorph: Pyrenophora) spp. on corn, cereals, such as barley (e. g. D. teres, net blotch) and wheat (e. g. D. tritici-repentis. tan spot), rice and turf; Esca (dieback, apoplexy) on vines, caused by Formitiporia (syn. Pheiiinus) punctata, F. mediterranea,
Phaeomonieiia chiamydospora (formerly Phaeoacremonium chiamydosporum),
Phaeoacremonium aieophiium and/or Botryosphaeria obtusa, E/sinoe spp. on pome fruits (E. pyri), soft fruits ( E . veneta. anthracnose) and vines ( E . ampeiina anthracnose); Entyioma oryzae { leaf smut) on rice; Epicoccum spp. (black mold) on wheat; Erysiphe spp. (powdery mildew) on sugar beets {E. betae), vegetables (e. g. E. pisi), such as cucurbits (e. g. E.
cichoracearum), cabbages, oilseed rape (e. g. E. cruciferarum)·, Eutypa iata (Eutypa canker or dieback, anamorph: Cytosporina iata, syn. Liberteiia biepharis) on fruit trees, vines and ornamental woods; Exserohi/um ( syn. Helminthosporium) spp. on corn (e. g. E. turcicum), Fusarium (teleomorph: Gibbereiia) spp. (wilt, root or stem rot) on various plants, such as F. graminearum or F. cuimorum (root rot, scab or head blight) on cereals (e. g. wheat or barley), F. oxysporum on tomatoes, F. soiani{ . sp. glycines now syn. F. virguiiforme ) and F. tucumaniae and F. brasiiiense each causing sudden death syndrome on soybeans, and F. verticiiiioides on corn; Gaeumannomyces graminis (take-all) on cereals (e. g. wheat or barley) and corn;
Gibbereiia s . on cereals (e. g. G. zeae) and rice (e. g. G. fujikuror. Bakanae disease);
Glomerella cinguiata on vines, pome fruits and other plants and G. gossypiiox\ cotton; Grain- staining complex on rice; Guignardia bidweiiii (black rot) on vines; Gymnosporangium spp. on rosaceous plants and junipers, e. g. G. sabinae (rust) on pears; Helminthosporium spp. (syn. Drechsiera, teleomorph: Cochliobolus) on corn, cereals, potatoes and rice; Hemiieia spp., e. g. H. vastatrix (coffee leaf rust) on coffee; isariopsis ciavispora (syn. Cladosporium vitis) on vines; Macrophomina phaseoiina (syn. phased Ί) (root and stem rot) on soybeans and cotton;
Microdochium (syn. Fusarium) nivaie (pink snow mold) on cereals (e. g. wheat or barley);
Microsphaera diffusa (powdery mildew) on soybeans; Moniiinia spp., e. g. M. iaxa, M. fructicoia and M. fructigena (syn. Moniiia spp.: bloom and twig blight, brown rot) on stone fruits and other rosaceous plants; Mycosphaereiia spp. on cereals, bananas, soft fruits and ground nuts, such as e. g. M. graminicola (anamorph: Zymoseptoria M/c/formerly Septoria triticr. Septoria blotch)
on wheat or M. fijiensis (syn. Pseudocercospora fijiensis. black Sigatoka disease) and M.
musicola on bananas, M. arachidicola (syn. M. arachidis or Cercospora arachid is), M. berke/eyi on peanuts, M. pis ion peas and M. brassicioia on brassicas; Peronospora spp. (downy mildew) on cabbage (e. g. P. brassicae), oilseed rape (e. g. P. parasitica), onions (e. g. P. destructor ), tobacco (P. tabacina) and soybeans (e. g. P. manshurica), Phakopsora pachyrhizi and P.
meibomiae (soybean rust) on soybeans; Phiaiophora spp. e. g. on vines (e. g. P. tracheiphiia and P. tetraspora) and soybeans (e. g. P. gregata. stem rot); Phoma iingam { syn. Leptosphaeria bigiobosa and L macula ns. root and stem rot) on oilseed rape and cabbage, P. betae (root rot, leaf spot and damping-off) on sugar beets and P. zeae-maydis (syn. Phyiiostica zeae) on corn; Phomopsis spp. on sunflowers, vines (e. g. P. viticoia. can and leaf spot) and soybeans (e. g. stem rot: P. phaseoii, teleomorph: Diaporthe phaseoiorum) Physoderma maydis (brown spots) on corn; Phytophthora spp. (wilt, root, leaf, fruit and stem root) on various plants, such as paprika and cucurbits (e. g. P. capsici), soybeans (e. g. P. megasperma, syn. P. sojae), potatoes and tomatoes (e. g. P. infestans. late blight) and broad-leaved trees (e. g. P. ramorum. sudden oak death); Piasmodiophora brassicae { club root) on cabbage, oilseed rape, radish and other plants; Piasmopara spp., e. g. P. viticoia (grapevine downy mildew) on vines and P.
haistedii on sunflowers; Podosphaera spp. (powdery mildew) on rosaceous plants, hop, pome and soft fruits (e. g. P. ieucotricha on apples) and curcurbits ( P '. xanthii)·, Poiymyxa spp., e. g. on cereals, such as barley and wheat ( P '. graminis) and sugar beets ( P '. betae) and thereby transmitted viral diseases; Pseudocercosporeiia herpotrichoides { syn. Ocuiimacuia yaiiundae,
O. acuformis. eyespot, teleomorph: Tapesia yaiiundae) on cereals, e. g. wheat or barley;
Pseudoperonospora (downy mildew) on various plants, e. g. P. cubensis on cucurbits or P. hum Hi on hop; Pseudopezicuia tracheiphiia (te fire disease or .rotbrenner’, anamorph:
Phiaiophora) on vines; Pucci nia spp. (rusts) on various plants, e. g. P. triticina (brown or leaf rust), P. striiformis (stripe or yellow rust), P. hordei (dwarf rust), P. graminis (stem or black rust) or P. recondite (brown or leaf rust) on cereals, such as e. g. wheat, barley or rye, P. kuehnii (orange rust) on sugar cane and P. asparagi on asparagus; Pyrenopeziza spp., e.g. P.
brassicae on oilseed rape; Pyrenophora (anamorph: Drechsiera) tritici-repentis (tan spot) on wheat or P. teres { net blotch) on barley; Pyricuiaria spp., e. g. P. oryzae (teleomorph:
Magnaporthe grisea. rice blast) on rice and P. grisea on turf and cereals; Pythium spp.
(damping-off) on turf, rice, corn, wheat, cotton, oilseed rape, sunflowers, soybeans, sugar beets, vegetables and various other plants (e. g. P. uitimum or P. aphanidermatum) and P. oiigandrum on mushrooms; Ramuiaria s ., e. g. R. coiio-cygni ( amu\ar\a leaf spots, Physiological leaf spots) on barley, R. areoia (teleomorph: Mycosphaereiia areoia) on cotton and R. beticoia on sugar beets; Rhizoctonia spp. on cotton, rice, potatoes, turf, corn, oilseed rape, potatoes, sugar beets, vegetables and various other plants, e. g. R. soiani(roo\ and stem rot) on soybeans, R. soiani (sheath blight) on rice or R. cereaiis (Rhizoctonia spring blight) on wheat or barley;
Rhizopus stoionifer (black mold, soft rot) on strawberries, carrots, cabbage, vines and tomatoes; Rhynchosporium secaiis and R. commune (scald) on barley, rye and triticale; Sarociadium oryzae and S. attenuatum (sheath rot) on rice; Scierotinia spp. (stem rot or white mold) on vegetables (S. minorand S. scierotiorum) and field crops, such as oilseed rape, sunflowers (e. g. S. scierotiorum) and soybeans, S. roifsii{ syn. Atheiia roifsii) on soybeans, peanut, vegetables, corn, cereals and ornamentals; Septoria spp. on various plants, e. g. S. glycines (brown spot) on soybeans, S. tritici (syn. Zymoseptoria tritici, Septoria blotch) on wheat and S.
(syn. Stagonospora ) nodorum (Stagonospora blotch) on cereals; Uncinula (syn. Erysiphe) necator (powdery mildew, anamorph: Oidium tucker!) on vines; Setosphaeria spp. (leaf blight) on corn (e. g. S. turcicum, syn. He!minthosporium turcicum) and turf; Sphace!otheca spp. (smut) on corn, (e. g. S. reiHana, syn. UstHago re!Hana. head smut), sorghum und sugar cane;
Sphaerotheca fuHginea (syn. Podosphaera xanthir. powdery mildew) on cucurbits; Spongospora subterranea (powdery scab) on potatoes and thereby transmitted viral diseases; Stagonospora spp. on cereals, e. g. S. nodorum (Stagonospora blotch, teleomorph: Leptosphaeria [syn.
Phaeosphaeria] nodorum, syn. Septoria nodorum) on wheat; Synchytrium endobioticum on potatoes (potato wart disease); Taphrina ., e. g. T. deformans (leaf curl disease) on peaches and T. pruni{ \um pocket) on plums; Thie!aviopsis s . (black root rot) on tobacco, pome fruits, vegetables, soybeans and cotton, e. g. T. basico!a (syn . Cha!ara e/egans), Tilled a spp.
(common bunt or stinking smut) on cereals, such as e. g. T. tritici (syn. T. caries, wheat bunt) and T. controversa (dwarf bunt) on wheat; Trichoderma harzianum on mushrooms, Typhu/a incarnate ( rey snow mold) on barley or wheat; Urocystis spp., e. g. U. occulta { stem smut) on rye; Uromyces ^ . (rust) on vegetables, such as beans (e. g. U. appendicuiatus, syn. U.
phaseoii), sugar beets (e. g. U. betae or U. beticoia) and on pulses (e.g. U. vignae, U. pisi, U. viciae-fabae and U. fabae , UstHago spp. (loose smut) on cereals (e. g. U. nuda and U.
avaenae ), corn (e. g. Li. maydis corn smut) and sugar cane; Venturis s . (scab) on apples (e. g. V. inaequaiis) and pears; and Verticiiiium spp. (wilt) on various plants, such as fruits and ornamentals, vines, soft fruits, vegetables and field crops, e. g. V. iongisporum on oilseed rape, V. dahiiae on strawberries, oilseed rape, potatoes and tomatoes, and V. fungicoia on
mushrooms; Zymoseptoria tritici on cereals.
In a preferred embodiment the compounds I, their mixtures with other active compounds as defined herein and compositions thereof, respectively, are particularly suitable for controlling the following plant diseases: Puccinia spp. (rusts) on various plants, for example, but not limited to P. triticina (brown or leaf rust), P. striiformis (stripe or yellow rust), P. hordei (dwarf rust), P. graminis (stem or black rust) or P. recondite (brown or leaf rust) on cereals, such as e. g. wheat, barley or rye, P. sorghi (common rust) on maize, P. poiysora (southern rust) on maize; P.
cor on at a e.g. on oats, P. sorghi und P. poiysora on corn; Puccinia spp. on other crops, e.g. P. heiiathi on sunflower, P. arachidis on peanuts; Uromyces spp. on pulses and other crops crops, e.g. Uromyces viciae-fabae, Uromyces vigniae, Uromyces pisi, U. ciceris-arietini, U. betae syn U. beticoia; an Phakopsoraceae spp. on various plants, in particular Phakopsora pachyrhizi and P. meibomiae (soybean rust) on soybeans.
Additionally, to date, no cross-resistance has been observed between the compounds I and the current fungicidal solutions used to control phytopathogenic fungi including but not limited to Zymoseptoria tritici, Phakopsora pachyrhizi, Botrytis cinerea, Biumeria graminis, Pyrenophora tritici-repentis, Pyrenophora teres, A item aria spp., Piasmopara viticoia, preferably selected from Zymospeptoria tritici and Phakopsora pachyrhizi.
Fungicide-resistant strains of the above-mentioned phytopathgenic fungi have been reported, with strains resistant to one or more fungicides from various fungicidal mode of action classes being observed including but not limited to beta-tubulin assembly inhibitors, sterol
demethylation-inhibitors (DMI), quinone-outside-inhibitors (Qol) and succinate dehydrogenase inhibitors (SDHI). Thus, compounds I are useful to control phytopathogenic fungi comprising at least one of the following mutations: E198A/G/K or F200Y in the beta-tubulin gene conferring
resistance to beta-tubulin assembly inhibitors (Phytopathol (2008) 98: 397-404), I365N/S, V368F, Q369H/P, N373S, T447S in the histidine kinase gene Os1 conferring resistance to MAP / histidin kinase inhibitors (dicarboximides; ibida); G143A, G137R or F129L in the mitochondrial cytochrome B Gene (Phytopathol (2003) 93: 891-900; Pest Manag Sci (2016) 72: 121 1-1215) resulting in resistance to Qol; V136A, Y137F (homologous to Y144F/H e.g. in
Parastagonospora nodorum or Y 136F e.g. in Erysiphe necator), K147Q, A379G, 1381V, G461S or S509T, and F120L, Y131 H/F, K142R, I145F, I475T in Phakopsora pachyrhizi (Pest Manag Sci 2014; 70: 378-388) in the Cyp51 gene resulting in resistance to DMI (Phytopathol (2016) 106: 1278-1284); P225T/L/F, N225I/T, R265P, T268I/A, H272R/Y/L, H277Y or N230I in the succinate dehydrogenase iron-sulfur subunit gene SdhB, K49E, R64K, N75S, G79R, T79N/I, W80S, P80H/L, N86S/A, G91 R, H134R, S135R, H146R/LK, R151 S/T/M, H152R, H153R,
1161 S, V166M, T168R and G171 D in the subunit C gene SdhC, and I50F, D124E, M1 14V, H134R, D145G in the subunit D gene SdhD conferring resistance to SDH I (Pest Manag Sci (2002) 58: 876-88; Pest Manag Sci (2014) 70: 378-388; Environ Microbiol (2014) 16: 2253-66; Pest Manag Sci (2018) 74: 672-681 ; http://www.frac.info/working-group/sdhi-fungicides), and I86F in the subunit C gene SdhC {Journal of Plant Diseases and Protection (2018) 125, 21-26).
The binary and ternary mixtures and agrochemical compositions thereof according to the invention are also suitable for controlling harmful fungi in the protection of stored products or harvest and in the protection of materials.
The term "protection of materials" is to be understood to denote the protection of technical and non-living materials, such as adhesives, glues, wood, paper and paperboard, textiles, leather, paint dispersions, plastics, cooling lubricants, fiber or fabrics, against the infestation and destruction by harmful microorganisms, such as fungi and bacteria. As to the protection of wood and other materials, the particular attention is paid to the following harmful fungi: Ascomycetes such as Ophiostoma spp., Ceratocystis s p p . , Aureobasidium pullulans, Sderophoma spp., Chaetomium s p p . , Humicola spp., Petrie I la spp., Trichurus s :, Basidiomycetes such as Coniophora spp., Corioius spp., Gloeophyllum spp., Lentinus s ., P/eurotus spp., Poria spp., Serpuia spp. and Tyromyces spp., Deuteromycetes such as Aspergillus spp., Cladosporium spp., PeniciHium spp., Trichoderma spp., Alternaria spp., PaecHomyces spp. and Zygomycetes such as Mucor spp., and in addition in the protection of stored products and harvest the following yeast fungi are worthy of note: Candida spp. and Saccharomyces cerevisae.
The method of treatment according to the invention can also be used in the field of protecting stored products or harvest against attack of fungi and microorganisms. According to the present invention, the term "stored products" is understood to denote natural substances of plant or animal origin and their processed forms, which have been taken from the natural life cycle and for which long-term protection is desired. Stored products of crop plant origin, such as plants or parts thereof, for example stalks, leafs, tubers, seeds, fruits or grains, can be protected in the freshly harvested state or in processed form, such as pre-dried, moistened, comminuted, ground, pressed or roasted, which process is also known as post-harvest treatment. Also falling under the definition of stored products is timber, whether in the form of crude timber, such as construction timber, electricity pylons and barriers, or in the form of finished articles, such as furniture or objects made from wood. Stored products of animal origin are hides, leather, furs, hairs and the like. The combinations according the present invention can prevent
disadvantageous effects such as decay, discoloration or mold. Preferably "stored products" is understood to denote natural substances of plant origin and their processed forms, more preferably fruits and their processed forms, such as pomes, stone fruits, soft fruits and citrus fruits and their processed forms.
The binary and ternary mixtures and agrochemical compositions thereof according to the invention may be used for improving the health of a plant. The invention also relates to a method for improving plant health by treating a plant, its propagation material and/or the locus where the plant is growing or is to grow with an effective amount of compounds I and compositions thereof, respectively.
The term "plant health" is to be understood to denote a condition of the plant and/or its products which is determined by several indicators alone or in combination with each other such as yield (e. g. increased biomass and/or increased content of valuable ingredients), plant vigor (e. g. improved plant growth and/or greener leaves (“greening effect”)), quality (e. g. improved content or composition of certain ingredients) and tolerance to abiotic and/or biotic stress. The above identified indicators for the health condition of a plant may be interdependent or may result from each other.
The binary and ternary mixtures and agrochemical compositions thereof according to the invention are employed as such or in form of compositions by treating the fungi or the plants, plant propagation materials, such as seeds, soil, surfaces, materials or rooms to be protected from fungal attack with a fungicidally effective amount of the active substances. The application can be carried out both before and after the infection of the plants, plant propagation materials, such as seeds, soil, surfaces, materials or rooms by the fungi.
Plant propagation materials may be treated with binary and ternary mixtures and agrochemical compositions thereof according to the invention as such or a composition comprising at least one compound I prophylactically either at or before planting or transplanting.
An agrochemical composition comprises a fungicidally effective amount of a binary and ternary mixtures according to the invention. The term "effective amount" denotes an amount of the composition or of the compounds I, II and III, which is sufficient for controlling harmful fungi on cultivated plants or in the protection of materials and which does not result in a substantial damage to the treated plants. Such an amount can vary in a broad range and is dependent on various factors, such as the fungal species to be controlled, the treated cultivated plant or material, the climatic conditions and the specific binary or ternary mixtures used.
The binary and ternary mixtures according to the invention can be converted into customary types of agrochemical compositions, e. g. solutions, emulsions, suspensions, dusts, powders, pastes, granules, pressings, capsules, and mixtures thereof. Examples for composition types are suspensions (e. g. SC, OD, FS), emulsifiable concentrates (e. g. EC), emulsions (e. g. EW, EO, ES, ME), capsules (e. g. CS, ZC), pastes, pastilles, wettable powders or dusts (e. g. WP, SP, WS, DP, DS), pressings (e. g. BR, TB, DT), granules (e. g. WG, SG, GR, FG, GG, MG), insecticidal articles (e. g. LN), as well as gel formulations for the treatment of plant propagation materials such as seeds (e. g. GF). These and further compositions types are defined in the “Catalogue of pesticide formulation types and international coding system”, Technical
Monograph No. 2, 6th Ed. May 2008, CropLife International.
The compositions are prepared in a known manner, such as described by Mollet and
Grubemann, Formulation technology, Wiley VCH, Weinheim, 2001 ; or Knowles, New
developments in crop protection product formulation, Agrow Reports DS243, T&F Informa, London, 2005.
The binary or ternary mixtures of active compounds described herein can be prepared as compositions comprising besides the active ingredients at least one inert ingredient (auxiliary) by usual means, e. g. by the means given herein for the compositions of compounds I.
Concerning usual ingredients of such compositions reference is made to the explanations given for the compositions containing compounds I.
Suitable auxiliaries are solvents, liquid carriers, solid carriers or fillers, surfactants, dispersants, emulsifiers, wetters, adjuvants, solubilizers, penetration enhancers, protective colloids, adhesion agents, thickeners, humectants, repellents, attractants, feeding stimulants, compatibilizers, bactericides, anti-freezing agents, anti-foaming agents, colorants, tackifiers and binders.
Suitable solvents and liquid carriers are water and organic solvents, such as mineral oil fractions of medium to high boiling point, e. g. kerosene, diesel oil; oils of vegetable or animal origin; aliphatic, cyclic and aromatic hydrocarbons, e. g. toluene, paraffin,
tetrahydronaphthalene, alkylated naphthalenes; alcohols, e. g. ethanol, propanol, butanol, benzyl alcohol, cyclohexanol; glycols; DMSO; ketones, e. g. cyclohexanone; esters, e. g.
lactates, carbonates, fatty acid esters, gamma-butyrolactone; fatty acids; phosphonates;
amines; amides, e. g. N-methyl pyrrolidone, fatty acid dimethyl amides; and mixtures thereof. Suitable solid carriers or fillers are mineral earths, e. g. silicates, silica gels, talc, kaolins, limestone, lime, chalk, clays, dolomite, diatomaceous earth, bentonite, calcium sulfate, magnesium sulfate, magnesium oxide; polysaccharides, e. g. cellulose, starch; fertilizers, e. g. ammonium sulfate, ammonium phosphate, ammonium nitrate, ureas; products of vegetable origin, e. g. cereal meal, tree bark meal, wood meal, nutshell meal, and mixtures thereof.
Suitable surfactants are surface-active compounds, such as anionic, cationic, nonionic and amphoteric surfactants, block polymers, polyelectrolytes, and mixtures thereof. Such surfactants can be used as emulsifier, dispersant, solubilizer, wetter, penetration enhancer, protective colloid, or adjuvant. Examples of surfactants are listed in McCutcheon’s, Vol.1 : Emulsifiers & Detergents, McCutcheon’s Directories, Glen Rock, USA, 2008 (International Ed. or North American Ed.).
Suitable anionic surfactants are alkali, alkaline earth or ammonium salts of sulfonates, sulfates, phosphates, carboxylates, and mixtures thereof. Examples of sulfonates are alkylaryl sulfonates, diphenyl sulfonates, alpha-olefin sulfonates, lignin sulfonates, sulfonates of fatty acids and oils, sulfonates of ethoxylated alkylphenols, sulfonates of alkoxylated arylphenols, sulfonates of condensed naphthalenes, sulfonates of dodecyl- and tridecylbenzenes, sulfonates of naphthalenes and alkyl naphthalenes, sulfosuccinates or sulfosuccinamates. Examples of sulfates are sulfates of fatty acids and oils, of ethoxylated alkylphenols, of alcohols, of ethoxylated alcohols, or of fatty acid esters. Examples of phosphates are phosphate esters. Examples of carboxylates are alkyl carboxylates, and carboxylated alcohol or alkylphenol ethoxylates.
Suitable nonionic surfactants are alkoxylates, N-substituted fatty acid amides, amine oxides, esters, sugar-based surfactants, polymeric surfactants, and mixtures thereof. Examples of alkoxylates are compounds such as alcohols, alkylphenols, amines, amides, arylphenols, fatty acids or fatty acid esters which have been alkoxylated with 1 to 50 equivalents. Ethylene oxide
and/or propylene oxide may be employed for the alkoxylation, preferably ethylene oxide.
Examples of N-substituted fatty acid amides are fatty acid glucamides or fatty acid
alkanolamides. Examples of esters are fatty acid esters, glycerol esters or monoglycerides. Examples of sugar-based surfactants are sorbitans, ethoxylated sorbitans, sucrose and glucose esters or alkylpolyglucosides. Examples of polymeric surfactants are home- or copolymers of vinyl pyrrolidone, vinyl alcohols, or vinyl acetate.
Suitable cationic surfactants are quaternary surfactants, for example quaternary ammonium compounds with one or two hydrophobic groups, or salts of long-chain primary amines. Suitable amphoteric surfactants are alkylbetains and imidazolines. Suitable block polymers are block polymers of the A-B or A-B-A type comprising blocks of polyethylene oxide and polypropylene oxide, or of the A-B-C type comprising alkanol, polyethylene oxide and polypropylene oxide. Suitable polyelectrolytes are polyacids or polybases. Examples of polyacids are alkali salts of polyacrylic acid or polyacid comb polymers. Examples of polybases are polyvinyl amines or polyethylene amines.
Suitable adjuvants are compounds, which have a negligible or even no pesticidal activity themselves, and which improve the biological performance of the compound I on the target. Examples are surfactants, mineral or vegetable oils, and other auxiliaries. Further examples are listed by Knowles, Adjuvants and additives, Agrow Reports DS256, T&F Informa UK, 2006, chapter 5.
Suitable thickeners are polysaccharides (e. g. xanthan gum, carboxymethyl cellulose), inorganic clays (organically modified or unmodified), polycarboxylates, and silicates.
Suitable bactericides are bronopol and isothiazolinone derivatives such as alkylisothiazolinones and benzisothiazolinones.
Suitable anti-freezing agents are ethylene glycol, propylene glycol, urea and glycerin.
Suitable anti-foaming agents are silicones, long chain alcohols, and salts of fatty acids.
Suitable colorants (e. g. in red, blue, or green) are pigments of low water solubility and water- soluble dyes. Examples are inorganic colorants (e. g. iron oxide, titan oxide, iron
hexacyanoferrate) and organic colorants (e. g. alizarin-, azo- and phthalocyanine colorants). Suitable tackifiers or binders are polyvinyl pyrrolidones, polyvinyl acetates, polyvinyl alcohols, polyacrylates, biological or synthetic waxes, and cellulose ethers.
Examples for composition types and their preparation are:
i) Water-soluble concentrates (SL, LS)
10-60 wt% of a binary or ternary mixture according to the invention and 5-15 wt% wetting agent (e. g. alcohol alkoxylates) are dissolved in water and/or in a water-soluble solvent (e. g.
alcohols) ad 100 wt%. The active compound dissolves upon dilution with water.
ii) Dispersible concentrates (DC)
5-25 wt% of a binary or ternary mixture according to the invention and 1-10 wt% dispersant (e. g. polyvinyl pyrrolidone) are dissolved in organic solvent (e. g. cyclohexanone) ad 100 wt%. Dilution with water gives a dispersion.
iii) Emulsifiable concentrates (EC)
15-70 wt% of a binary or ternary mixture according to the invention and 5-10 wt% emulsifiers (e. g. calcium dodecylbenzenesulfonate and castor oil ethoxylate) are dissolved in water-insoluble organic solvent (e. g. aromatic hydrocarbon) ad 100 wt%. Dilution with water gives an emulsion.
iv) Emulsions (EW, EO, ES)
5-40 wt% of a binary or ternary mixture according to the invention and 1-10 wt% emulsifiers (e. g. calcium dodecylbenzenesulfonate and castor oil ethoxylate) are dissolved in 20-40 wt% water-insoluble organic solvent (e. g. aromatic hydrocarbon). This mixture is introduced into water ad 100 wt% by means of an emulsifying machine and made into a homogeneous emulsion. Dilution with water gives an emulsion.
v) Suspensions (SC, OD, FS)
In an agitated ball mill, 20-60 wt% of a binary or ternary mixture according to the invention are comminuted with addition of 2-10 wt% dispersants and wetting agents (e. g. sodium
lignosulfonate and alcohol ethoxylate), 0.1-2 wt% thickener (e. g. xanthan gum) and water ad 100 wt% to give a fine active compound suspension. Dilution with water gives a stable suspension of the active substance. For FS type composition up to 40 wt% binder (e. g.
polyvinyl alcohol) is added.
For the preparation of an OD type composition the following procedure can be used: in an agitated ball mill, 5-25 wt% of a binary or ternary mixture according to the invention, being not soluble in the continuous phase, are comminuted with addition of 2-10 wt% dispersants, wetting agents and emulsifiers (e. g. sodium lignosulfonate, alcohol ethnoxylate and alkoxylated triglycerides), 0.1-2 wt% rheology modifier (e. g. modified bentonites and xanthan gum) and a water immiscible solvent or oil as continuous phase ad 100 wt% to give a fine active compound suspension.
vi) Water-dispersible granules and water-soluble granules (WG, SG)
50-80 wt% of a binary or ternary mixture according to the invention are ground finely with addition of dispersants and wetting agents (e. g. sodium lignosulfonate and alcohol ethoxylate) ad 100 wt% and prepared as water-dispersible or water-soluble granules by means of technical appliances (e. g. extrusion, spray tower, fluidized bed). Dilution with water gives a stable dispersion or solution of the active substance.
vii) Water-dispersible powders and water-soluble powders (WP, SP, WS)
50-80 wt% of a binary or ternary mixture according to the invention are ground in a rotor-stator mill with addition of 1-5 wt% dispersants (e. g. sodium lignosulfonate), 1-3 wt% wetting agents (e. g. alcohol ethoxylate) and solid carrier (e. g. silica gel) ad 100 wt%. Dilution with water gives a stable dispersion or solution of the active substance.
viii) Gel (GW, GF)
In an agitated ball mill, 5-25 wt% of a binary or ternary mixture according to the invention are comminuted with addition of 3-10 wt% dispersants (e. g. sodium lignosulfonate), 1-5 wt% thickener (e. g. carboxymethyl cellulose) and water ad 100 wt% to give a fine suspension of the active substance. Dilution with water gives a stable suspension of the active substance.
ix) Microemulsion (ME)
5-20 wt% of a binary or ternary mixture according to the invention are added to 5-30 wt% organic solvent blend (e. g. fatty acid dimethyl amide and cyclohexanone), 10-25 wt% surfactant blend (e. g. alcohol ethoxylate and arylphenol ethoxylate), and water ad 100 %. This mixture is stirred for 1 h to produce spontaneously a thermodynamically stable microemulsion.
x) Microcapsules (CS)
An oil phase comprising 5-50 wt% of a compound I, 0-40 wt% water insoluble organic solvent (e. g. aromatic hydrocarbon), 2-15 wt% acrylic monomers (e. g. methylmethacrylate, methacrylic
acid and a di- or triacrylate) are dispersed into an aqueous solution of a protective colloid (e. g. polyvinyl alcohol). Radical polymerization results in the formation of poly(meth)acrylate microcapsules. Alternatively, an oil phase comprising 5-50 wt% of a binary or ternary mixture according to the invention according to the invention, 0-40 wt% water insoluble organic solvent (e. g. aromatic hydrocarbon), and an isocyanate monomer (e. g. diphenylmethene-4,4’- diisocyanatae) are dispersed into an aqueous solution of a protective colloid (e. g. polyvinyl alcohol). The addition of a polyamine (e. g. hexamethylenediamine) results in the formation of polyurea microcapsules. The monomers amount to 1-10 wt%. The wt% relate to the total CS composition.
xi) Dustable powders (DP, DS)
1-10 wt% of a binary or ternary mixture according to the invention are ground finely and mixed intimately with solid carrier (e. g. finely divided kaolin) ad 100 wt%.
xii) Granules (GR, FG)
0.5-30 wt% of a binary or ternary mixture according to the invention is ground finely and associated with solid carrier (e. g. silicate) ad 100 wt%. Granulation is achieved by extrusion, spray-drying or fluidized bed.
xiii) Ultra-low volume liquids (UL)
1-50 wt% of a binary or ternary mixture according to the invention are dissolved in organic solvent (e. g. aromatic hydrocarbon) ad 100 wt%.
The compositions types i) to xiii) may optionally comprise further auxiliaries, such as 0.1-1 wt% bactericides, 5-15 wt% anti-freezing agents, 0.1-1 wt% anti-foaming agents, and 0.1-1 wt% colorants.
The agrochemical compositions generally comprise between 0.01 and 95%, preferably between 0.1 and 90%, more preferably between 1 and 70%, and in particular between 10 and 60%, by weight of active substance. The active substances are employed in a purity of from 90% to 100%, preferably from 95% to 100% (according to NMR spectrum).
For the purposes of treatment of plant propagation materials, particularly seeds, solutions for seed treatment (LS), Suspoemulsions (SE), flowable concentrates (FS), powders for dry treatment (DS), water-dispersible powders for slurry treatment (WS), water-soluble powders (SS), emulsions (ES), emulsifiable concentrates (EC), and gels (GF) are usually employed. The compositions in question give, after two-to-tenfold dilution, active compound concentrations of from 0.01 to 60% by weight, preferably from 0.1 to 40%, in the ready-to-use preparations.
Application can be carried out before or during sowing. Methods for applying compound I and compositions thereof, respectively, onto plant propagation material, especially seeds, include dressing, coating, pelleting, dusting, and soaking as well as in-furrow application methods. Preferably, binary or ternary mixture according to the invention or the compositions thereof, respectively, are applied on to the plant propagation material by a method such that germination is not induced, e. g. by seed dressing, pelleting, coating and dusting.
When employed in plant protection, the amounts of active substances applied are, depending on the kind of effect desired, from 0.001 to 2 kg per ha, preferably from 0.005 to 2 kg per ha, more preferably from 0.05 to 0.9 kg per ha, and in particular from 0.1 to 0.75 kg per ha.
In treatment of plant propagation materials such as seeds, e. g. by dusting, coating or drenching
seed, amounts of active compound of from 0.1 to 1000 g, preferably from 1 to 1000 g, more preferably from 1 to 100 g and most preferably from 5 to 100 g, per 100 kilogram of plant propagation material (preferably seeds) are generally required.
When used in the protection of materials or stored products, the amount of active compound applied depends on the kind of application area and on the desired effect. Amounts customarily applied in the protection of materials are 0.001 g to 2 kg, preferably 0.005 g to 1 kg, of active compound per cubic meter of treated material.
Various types of oils, wetters, adjuvants, fertilizer, or micronutrients, and further pesticides (e. g. herbicides, insecticides, fungicides, growth regulators, safeners, biopesticides) may be added to the active substances or the compositions comprising them as premix or, if appropriate not until immediately prior to use (tank mix). These agents can be admixed with the compositions according to the invention in a weight ratio of 1 :100 to 100:1 , preferably 1 :10 to 10:1.
A pesticide is generally a chemical or biological agent (such as pestidal active ingredient, compound, composition, virus, bacterium, antimicrobial or disinfectant) that through its effect deters, incapacitates, kills or otherwise discourages pests. Target pests can include insects, plant pathogens, weeds, mollusks, birds, mammals, fish, nematodes (roundworms), and microbes that destroy property, cause nuisance, spread disease or are vectors for disease. The term“pesticide” includes also plant growth regulators that alter the expected growth, flowering, or reproduction rate of plants; defoliants that cause leaves or other foliage to drop from a plant, usually to facilitate harvest; desiccants that promote drying of living tissues, such as unwanted plant tops; plant activators that activate plant physiology for defense of against certain pests; safeners that reduce unwanted herbicidal action of pesticides on crop plants; and plant growth promoters that affect plant physiology e.g. to increase plant growth, biomass, yield or any other quality parameter of the harvestable goods of a crop plant.
The user applies the composition according to the invention usually from a predosage device, a knapsack sprayer, a spray tank, a spray plane, or an irrigation system. Usually, the
agrochemical composition is made up with water, buffer, and/or further auxiliaries to the desired application concentration and the ready-to-use spray liquor or the agrochemical composition according to the invention is thus obtained. Usually, 20 to 2000 liters, preferably 50 to 400 liters, of the ready-to-use spray liquor are applied per hectare of agricultural useful area.
According to one embodiment, individual components of the composition according to the invention such as parts of a kit or parts of a binary or ternary mixture may be mixed by the user himself in a spray tank or any other kind of vessel used for applications (e. g. seed treater drums, seed pelleting machinery, knapsack sprayer) and further auxiliaries may be added, if appropriate.
Consequently, one embodiment of the invention is a kit for preparing a usable pesticidal composition, the kit comprising a) a composition comprising component 1) as defined herein and at least one auxiliary; and b) a composition comprising component 2) as defined herein and at least one auxiliary; and optionally c) a composition comprising at least one auxiliary and optionally a further active component 3) as defined herein.
Mixing the binary or ternary mixture according to the invention in the use form as fungicides with other fungicides results in many cases in an expansion of the fungicidal spectrum of activity being obtained or in a prevention of fungicide resistance development. Furthermore, in many cases, synergistic effects are obtained.
By applying binary or ternary mixture according to the invention a synergistic effect can be obtained, i.e. more than simple addition of the individual effects is obtained (synergistic mixtures).
This can be obtained by applying the binary or ternary mixture according to the invention either jointly (e. g. as tank-mix) or seperately, or in succession, wherein the time interval between the individual applications is selected to ensure that the active compound applied first still occurs at the site of action in a sufficient amount at the time of application of the further active
substance(s). The order of application is not essential for working of the present invention. When applying binary or ternary mixture according to the invention sequentially the time between both applications may vary e. g. between 2 hours to 7 days. Also a broader range is possible ranging from 0.25 hour to 30 days, preferably from 0.5 hour to 14 days, particularly from 1 hour to 7 days or from 1.5 hours to 5 days, even more preferred from 2 hours to 1 day.
Biological activity
The fungicidal action of the mixtures according to the invention can be shown by the tests described below. The efficacy (E) is calculated as follows using Abbot's formula:
E = (1 - a/b) 100 a corresponds to the fungicidal infection of the treated plants in % and
b corresponds to the fungicidal infection of the untreated (control) plants in %
An efficacy of 0 means that the infection level of the treated plants corresponds to that of the untreated control plants; an efficacy of 100 means that the treated plants were not infected.
The expected efficacies of active compound combinations may be determined using Colby's formula (Colby, S.R. "Calculating synergistic and antagonistic responses of herbicide combinations", Weeds, 1J5, pp. 20-22, 1967) and compared with the observed efficacies.
Colby's formula:
E = x+y - x -y/100
E expected efficacy, expressed in % of the untreated control, when using the mixture of the active compounds A and B at the concentrations a and b
x efficacy, expressed in % of the untreated control, when using the active compound A at the concentration a
y efficacy, expressed in % of the untreated control, when using the active compound B at the concentration b.
I) Fungicidal activity against Botrytis cinerea
The active compounds were formulated separately as a stock solution having a concentration of 10000 ppm in dimethyl sulfoxide. The stock solutions were mixed according to the ratio, pipetted onto a micro titer plate (MTP) and diluted with water to the stated concentrations. A spore suspension of Botrytis cinerea in an aqueous biomalt or yeast-bactopeptone- sodiumacetate solution was then added. The plates were placed in a water vapor-saturated chamber at a temperature of 18°C. Using an absorption photometer, the MTPs were measured at 405 nm 7 days after the inoculation. The measured parameters were compared to the growth of the active compound-free control variant (100%) and the fungus-free and active compound- free blank value to determine the relative growth in % of the pathogens in the respective active compounds. These percentages were converted into efficacies. An efficacy of 0 means that the growth level of the pathogens corresponds to that of the untreated control; an efficacy of 100 means that the pathogens were not growing.
Table I Use examples of fungicidal activity against Botrytis cinerea
II) Fungicidal activity against Pyricu!aria oryzae
The active compounds were formulated separately as a stock solution having a concentration of 10000 ppm in dimethyl sulfoxide. The stock solutions were mixed according to the ratio, pipetted onto a micro titer plate (MTP) and diluted with water to the stated concentrations. A spore suspension of Pyricularia oryzae in an aqueous biomalt or yeast-bactopeptone- sodiumacetate solution was then added. The plates were placed in a water vapor-saturated chamber at a temperature of 18°C. Using an absorption photometer, the MTPs were measured at 405 nm 7 days after the inoculation. The measured parameters were compared to the growth of the active compound-free control variant (100%) and the fungus-free and active compound- free blank value to determine the relative growth in % of the pathogens in the respective active compounds. These percentages were converted into efficacies. An efficacy of 0 means that the growth level of the pathogens corresponds to that of the untreated control; an efficacy of 100 means that the pathogens were not growing.
Fungicidal activity against Septoria tritici The active compounds were formulated separately as a stock solution having a concentration of 10000 ppm in dimethyl sulfoxide. The stock solutions were mixed according to the ratio, pipetted onto a micro titer plate (MTP) and diluted with water to the stated concentrations. A spore suspension of Septoria triticim an aqueous biomalt or yeast-bactopeptone-sodiumacetate solution was then added. The plates were placed in a water vapor-saturated chamber at a temperature of 18°C. Using an absorption photometer, the MTPs were measured at 405 nm 7 days after the inoculation. The measured parameters were compared to the growth of the active compound-free control variant (100%) and the fungus-free and active compound-free blank value to determine the relative growth in % of the pathogens in the respective active
compounds. These percentages were converted into efficacies. An efficacy of 0 means that the growth level of the pathogens corresponds to that of the untreated control; an efficacy of 100 means that the pathogens were not growing. Table III Use examples of fungicidal activity against Septoria tritici
VI) Fungicidal activity against Leptosphaeria nodorum The active compounds were formulated separately as a stock solution having a concentration of 10000 ppm in dimethyl sulfoxide. The product sulfur was used as a commercial finished formulation and diluted with water to the stated concentration of the active compound. The stock solutions were mixed according to the ratio, pipetted onto a micro titer plate (MTP) and diluted with water to the stated concentrations. A spore suspension of Letosphaeria nodorum in an aqueous biomalt or yeast-bactopeptone-sodiumacetate solution was then added. The plates were placed in a water vapor-saturated chamber at a temperature of 18°C. Using an absorption photometer, the MTPs were measured at 405 nm 7 days after the inoculation. The measured parameters were compared to the growth of the active compound-free control variant (100%) and the fungus-free and active compound-free blank value to determine the relative growth in % of the pathogens in the respective active compounds. These percentages were converted into efficacies. An efficacy of 0 means that the growth level of the pathogens corresponds to that of the untreated control; an efficacy of 100 means that the pathogens were not growing.
Table VI Use examples of fungicidal activity against Leptosphaeria nodorum
V) Fungicidal activity against CoHetotrichum orbiculare
The active compounds were formulated separately as a stock solution having a concentration of 10000 ppm in dimethyl sulfoxide. The stock solutions were mixed according to the ratio, pipetted onto a micro titer plate (MTP) and diluted with water to the stated concentrations. A
spore suspension of CoHetotrichum orbiculare in an aqueous biomalt or yeast-bactopeptone- sodiumacetate solution was then added. The plates were placed in a water vapor-saturated chamber at a temperature of 18°C. Using an absorption photometer, the MTPs were measured at 405 nm 7 days after the inoculation. The measured parameters were compared to the growth of the active compound-free control variant (100%) and the fungus-free and active compound- free blank value to determine the relative growth in % of the pathogens in the respective active compounds. These percentages were converted into efficacies. An efficacy of 0 means that the growth level of the pathogens corresponds to that of the untreated control; an efficacy of 100 means that the pathogens were not growing.
Table V Use examples of fungicidal activity against CoHetotrichum orbiculare
Claims
1 . A fungicidal mixture comprising as active components
1 ) at least one active compound selected from the group consisting of
I.B: N-(1 -bicyclo[1.1 .1 ]pentanyl)-3-fluoro-4-[5-(trifluoromethyl)-1 ,2,4-oxadiazol-3- yl]benzamide
I.C: N-cyclobutyl-2,2-difluoro-2-[4-[5-(trifluoromethyl)-1 ,2,4-oxadiazol-3- yl]phenyl]acetamide
I.D: 2,2-difluoro-N-(1 -methylcyclopropyl)-2-[4-[5-(trifluoromethyl)-1 ,2,4-oxadiazol-3- yl]phenyl]acetamide
I.E: N-[2-(difluoromethoxy)phenyl]-4-[5-(trifluoromethyl)-1 ,2,4-oxadiazol-3-yl]benzamide
I.G: N-cyclopropyl-2,2-difluoro-2-[4-[5-(trifluoromethyl)-1 ,2,4-oxadiazol-3- yl]phenoxy]acetamide
I.G
I.J: N-[(3Z)-3-methoxyimino-1-methyl-butyl]-4-[5-(trifluoromethyl)-1 ,2,4-oxadiazol-3- yl]benzamide
I.M: N-cyclopropyl-2-[4-[5-(trifluoromethyl)-1 ,2,4-oxadiazol-3-yl]phenyl]propenamide
and as component
2) at least one active compound II selected from groups A) to O), or an N-oxide, or an agriculturally useful salt thereof:
A) Respiration inhibitors
Inhibitors of complex III at Q0 site: azoxystrobin (A.1.1), coumethoxystrobin (A.1.2), coumoxystrobin (A.1.3), dimoxystrobin (A.1.4), enestroburin (A.1.5), fenaminstrobin (A.1.6), fenoxystrobin/flufenoxystrobin (A.1.7), fluoxastrobin (A.1.8), kresoxim-methyl (A.1.9), mandestrobin (A.1.10), metominostrobin (A.1.1 1), orysastrobin (A.1.12), picoxy- strobin (A.1.13), pyraclostrobin (A.1.14), pyrametostrobin (A.1.15), pyraoxystrobin (A.1.16), trifloxystrobin (A.1.17), 2-(2-(3-(2,6-dichlorophenyl)-1-methyl-allylidene- aminooxymethyl)-phenyl)-2-methoxyimino-/V-methyl-acetamide (A.1.18), pyribencarb (A.1.19), triclopyricarb/chlorodincarb (A.1.20), famoxadone (A.1.21 ), fenamidone
(A.1.21a), methyl-/V-[2-[(1 ,4-dimethyl-5-phenyl-pyrazol-3-yl)oxylmethyl]phenyl]-/\A methoxy-carbamate (A.1.22), metyltetrapole (A.1.25), {Z,2E)-5-[\ -(2,4-dichloro- phenyl)pyrazol-3-yl]-oxy-2-methoxyimino-/V,3-dimethyl-pent-3-enamide (A.1.34),
(2(2£)-5-[1-(4-chlorophenyl)pyrazol-3-yl]oxy-2-methoxyimino-/V,3-dimethyl-pent-3- enamide (A.1.35), pyriminostrobin (A.1.36), bifujunzhi (A.1.37), 2-(ortho-((2,5-dimeth- ylphenyl-oxymethylen)phenyl)-3-methoxy-acrylic acid methylester (A.1.38);
- inhibitors of complex III at Q, site: cyazofamid (A.2.1), amisulbrom (A.2.2),
[(6S,7/?,8A -8-benzyl-3-[(3-hydroxy-4-methoxy-pyridine-2-carbonyl)amino]-6-methyl-4,9- dioxo-1 ,5-dioxonan-7-yl] 2-methylpropanoate (A.2.3), fenpicoxamid (A.2.4),
florylpicoxamid (A.2.5);
- inhibitors of complex II: benodanil (A.3.1), benzovindiflupyr (A.3.2), bixafen (A.3.3),
boscalid (A.3.4), carboxin (A.3.5), fenfuram (A.3.6), fluopyram (A.3.7), flutolanil (A.3.8), fluxapyroxad (A.3.9), furametpyr (A.3.10), isofetamid (A.3.1 1), isopyrazam (A.3.12), mepronil (A.3.13), oxycarboxin (A.3.14), penflufen (A.3.15), penthiopyrad (A.3.16), pydiflumetofen (A.3.17), pyraziflumid (A.3.18), sedaxane (A.3.19), tecloftalam (A.3.20), thifluzamide (A.3.21), inpyrfluxam (A.3.22), pyrapropoyne (A.3.23), 1 ,3-dnmethyl-N- (1 ,1 ,3-trimethylindan-4-yl)pyrazole-4-carboxamide (A.3.24), fluindapyr (A.3.28), N-[2-[2- chloro^-^rifluoro^methy phenoxylphenyll-S-idifluoromethy -S-fluoro-l-methyl-pyrazole- 4-carboxamide (A.3.29), methyl (£)-2-[2-[(5-cyano-2-methyl-phenoxy)methyl]phenyl]-3- methoxy-prop-2-enoate (A.3.30), isoflucypram (A.3.31), 2-(difluoromethyl)-/V-(1 ,1 ,3- trimethyl-indan-4-yl)pyridine-3-carboxamide (A.3.32), 2-(difluoromethyl)-/V-[(3/\ -1 ,1 ,3- trimethylindan-4-yl]pyridine-3-carboxamide (A.3.33), 2-(difluoromethyl)-/V-(3-ethyl-1 ,1- dimethyl-indan-4-yl)pyridine-3-carboxamide (A.3.34), 2-(difluoromethyl)-/V-[(3/\ -3-ethyl-
1.1-dimethyl-indan-4-yl]pyridine-3-carboxamide (A.3.35), 2-(difluoromethyl)-/V-(1 ,1- dimethyl-3-propyl-indan-4-yl)pyridine-3-carboxamide (A.3.36), 2-(difluoromethyl)-/V-[(3/\ -
1.1-dimethyl-3-propyl-indan-4-yl]pyridine-3-carboxamide (A.3.37), 2-(difluoromethyl)-/V- (3-isobutyl-1 ,1-dimethyl-indan-4-yl)pyridine-3-carboxamide (A.3.38), 2-(difluoromethyl)-/V- [(3/\ -3-isobutyl-1 ,1-dimethyl-indan-4-yl]pyridine-3-carboxamide (A.3.39);
- other respiration inhibitors: diflumetorim (A.4.1); nitrophenyl derivates: binapacryl (A.4.2), dinobuton (A.4.3), dinocap (A.4.4), fluazinam (A.4.5), meptyldinocap (A.4.6), ferimzone (A.4.7); organometal compounds: fentin salts, e. g. fentin-acetate (A.4.8), fentin chloride (A.4.9) or fentin hydroxide (A.4.10); ametoctradin (A.4.1 1); silthiofam (A.4.12);
B) Sterol biosynthesis inhibitors (SBI fungicides)
- C14 demethylase inhibitors: triazoles: azaconazole (B.1.1 ), bitertanol (B.1.2), bromu- conazole (B.1.3), cyproconazole (B.1.4), difenoconazole (B.1.5), diniconazole (B.1.6), diniconazole-M (B.1.7), epoxiconazole (B.1.8), fenbuconazole (B.1.9), fluquinconazole
(B.1.10), flusilazole (B.1.1 1), flutriafol (B.1.12), hexaconazole (B.1.13), imibenconazole (B.1.14), ipconazole (B.1.15), metconazole (B.1.17), myclobutanil (B.1.18), oxpoconazole (B.1.19), paclobutrazole (B.1.20), penconazole (B.1.21 ), propiconazole (B.1.22), prothio- conazole (B.1.23), simeconazole (B.1.24), tebuconazole (B.1.25), tetraconazole (B.1.26), triadimefon (B.1.27), triadimenol (B.1.28), triticonazole (B.1.29), uniconazole (B.1.30), 2-(2,4-difluorophenyl)-1 ,1-difluoro-3-(tetrazol-1-yl)-1-[5-[4-(2,2,2-trifluoroethoxy)phenyl]- 2-pyridyl]propan-2-ol (B.1.31), 2-(2,4-difluorophenyl)-1 ,1-difluoro-3-(tetrazol-1-yl)- 1-[5-[4-(trifluoromethoxy)phenyl]-2-pyridyl]propan-2-ol (B.1.32), 4-[[6-[2-(2,4- difluorophenyl)-1 ,1-difluoro-2-hydroxy-3-(5-sulfanyl-1 ,2,4-triazol-1-yl)propyl]-3- pyridyl]oxy]benzonitrile (B.1.33), ipfentrifluconazole (B.1.37), mefentrifluconazole
(B.1.38), 2-(chloromethyl)-2-methyl-5-(p-tolylmethyl)-1-(1 ,2,4-triazol- 1-ylmethyl)cyclopentanol (B.1.43); imidazoles: imazalil (B.1.44), pefurazoate (B.1.45), prochloraz (B.1.46), triflumizol (B.1.47); pyrimidines, pyridines, piperazines: fenarimol (B.1.49), pyrifenox (B.1.50), triforine (B.1.51 ), [3-(4-chloro-2-fluoro-phenyl)-5-(2,4-di- fluorophenyl)isoxazol-4-yl]-(3-pyridyl)methanol (B.1.52);
- Deltal 4-reductase inhibitors: aldimorph (B.2.1 ), dodemorph (B.2.2), dodemorph-acetate (B.2.3), fenpropimorph (B.2.4), tridemorph (B.2.5), fenpropidin (B.2.6), piperalin (B.2.7), spiroxamine (B.2.8);
- Inhibitors of 3-keto reductase: fenhexamid (B.3.1 );
- Other Sterol biosynthesis inhibitors: chlorphenomizole (B.4.1 );
C) Nucleic acid synthesis inhibitors
- phenylamides or acyl amino acid fungicides: benalaxyl (C.1.1 ), benalaxyl-M (C.1.2), kiralaxyl (C.1.3), metalaxyl (C.1.4), metalaxyl-M (C.1.5), ofurace (C.1.6), oxadixyl (C.1.7);
- other nucleic acid synthesis inhibitors: hymexazole (C.2.1 ), octhilinone (C.2.2), oxolinic acid (C.2.3), bupirimate (C.2.4), 5-fluorocytosine (C.2.5), 5-fluoro-2-(p- tolylmethoxy)pyrimidin-4-amine (C.2.6), 5-fluoro-2-(4-fluorophenylmethoxy)pyrimidin- 4-amine (C.2.7), 5-fluoro-2-(4-chlorophenylmethoxy)pyrimidin-4 amine (C.2.8);
D) Inhibitors of cell division and cytoskeleton
- tubulin inhibitors: benomyl (D.1.1), carbendazim (D.1.2), fuberidazole (D1.3),
thiabendazole (D.1.4), thiophanate-methyl (D.1.5), pyridachlometyl (D.1.6), /V-ethyl-2-[(3- ethynyl-8-methyl-6-quinolyl)oxy]butanamide (D.1.8), /V-ethyl-2-[(3-ethynyl-8-methyl- 6-quinolyl)oxy]-2-methylsulfanyl-acetamide (D.1.9), 2-[(3-ethynyl-8-methyl-6-quinol- yl)oxy]-/V-(2-fluoroethyl)butanamide (D.1.10), 2-[(3-ethynyl-8-methyl-6-quinolyl)oxy]-/V-(2- fluoroethyl)-2-methoxy-acetamide (D.1.1 1), 2-[(3-ethynyl-8-methyl-6-quinolyl)oxy]-/V- propyl-butanamide (D.1.12), 2-[(3-ethynyl-8-methyl-6-quinolyl)oxy]-2-methoxy-/V-propyl- acetamide (D.1.13), 2-[(3-ethynyl-8-methyl-6-quinolyl)oxy]-2-methylsulfanyl-/V-propyl- acetamide (D.1.14), 2-[(3-ethynyl-8-methyl-6-quinolyl)oxy]-/V-(2-fluoroethyl)-2- methylsulfanyl-acetamide (D.1.15), 4-(2-bromo-4-fluoro-phenyl)-/V-(2-chloro-6-fluoro- phenyl)-2,5-dimethyl-pyrazol-3-amine (D.1.16);
- other cell division inhibitors: diethofencarb (D.2.1), ethaboxam (D.2.2), pencycuron
(D.2.3), fluopicolide (D.2.4), zoxamide (D.2.5), metrafenone (D.2.6), pyriofenone (D.2.7), phenamacril (D.2.8);
E) Inhibitors of amino acid and protein synthesis
- methionine synthesis inhibitors: cyprodinil (E.1.1), mepanipyrim (E.1.2), pyrimethanil
(E.1.3);
- protein synthesis inhibitors: blasticidin-S (E.2.1), kasugamycin (E.2.2), kasugamycin hydrochloride-hydrate (E.2.3), mildiomycin (E.2.4), streptomycin (E.2.5), oxytetracyclin (E.2.6);
F) Signal transduction inhibitors
- MAP / histidine kinase inhibitors: fluoroimid (F.1.1), iprodione (F.1.2), procymidone
(F.1.3), vinclozolin (F.1.4), fludioxonil (F.1.5);
- G protein inhibitors: quinoxyfen (F.2.1 );
G) Lipid and membrane synthesis inhibitors
- Phospholipid biosynthesis inhibitors: edifenphos (G .1.1), iprobenfos (G.1.2), pyrazophos (G.1.3), isoprothiolane (G.1.4);
- lipid peroxidation: dicloran (G.2.1), quintozene (G.2.2), tecnazene (G.2.3), tolclofos- methyl (G.2.4), biphenyl (G.2.5), chloroneb (G.2.6), etridiazole (G.2.7), zinc thiazole (G.2.8);
- phospholipid biosynthesis and cell wall deposition: dimethomorph (G.3.1), flumorph
(G.3.2), mandipropamid (G.3.3), pyrimorph (G.3.4), benthiavalicarb (G.3.5), iprovalicarb (G.3.6), valifenalate (G.3.7);
- compounds affecting cell membrane permeability and fatty acides: propamocarb (G.4.1 );
- inhibitors of oxysterol binding protein: oxathiapiprolin (G.5.1 ), fluoxapiprolin (G.5.3), 4-[1- [2-[3-(difluoromethyl)-5-methyl-pyrazol-1-yl]acetyl]-4-piperidyl]-/V-tetralin-1-yl-pyridine-2- carboxamide (G.5.4), 4-[1-[2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetyl]-4-piperidyl]-/V- tetralin-1-yl-pyridine-2-carboxamide (G.5.5), 4-[1-[2-[3-(difluoromethyl)-5-(tri- fluoromethyl)pyrazol-1-yl]acetyl]-4-piperidyl]-/V-tetralin-1-yl-pyridine-2-carboxamide (G.5.6), 4-[1-[2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]acetyl]-4-piperidyl]-/V-tetralin- 1 -yl-pyridine-2-carboxamide (G.5.7), 4-[1 -[2-[5-methyl-3-(trifluoromethyl)pyrazol-1 - yl]acetyl]-4-piperidyl]-/V-tetralin-1-yl-pyridine-2-carboxamide (G.5.8), 4-[1-[2-[5- (difluoromethyl)-3-(trifluoromethyl)pyrazol-1-yl]acetyl]-4-piperidyl]-/V-tetralin-1-yl-pyridine- 2-carboxamide (G.5.9), 4-[1-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]acetyl]-4-piperidyl]-/\A tetralin-1-yl-pyridine-2-carboxamide (G.5.10), (4-[1-[2-[5-cyclopropyl-3- (trifluoromethyl)pyrazol-1-yl]acetyl]-4-piperidyl]-/V-tetralin-1-yl-pyridine-2-carboxamide (G.5.11 );
H) Inhibitors with Multi Site Action
- inorganic active substances: Bordeaux mixture (H.1.1 ), copper (H.1.2), copper acetate (H.1.3), copper hydroxide (H.1.4), copper oxychloride (H.1.5), basic copper sulfate (H.1.6), sulfur (H.1.7);
- thio- and dithiocarbamates: ferbam (H.2.1 ), mancozeb (H.2.2), maneb (H.2.3), metam (H.2.4), metiram (H.2.5), propineb (H.2.6), thiram (H.2.7), zineb (H.2.8), ziram (H.2.9);
- organochlorine compounds: anilazine (H.3.1 ), chlorothalonil (H.3.2), captafol (H.3.3), captan (H.3.4), folpet (H.3.5), dichlofluanid (H.3.6), dichlorophen (H.3.7), hexachloro- benzene (H.3.8), pentachlorphenole (H.3.9) and its salts, phthalide (H.3.10), tolylfluanid (H.3.11 );
- guanidines and others: guanidine (H.4.1), dodine (H.4.2), dodine free base (H.4.3),
guazatine (H.4.4), guazatine-acetate (H.4.5), iminoctadine (H.4.6), iminoctadine- triacetate (H.4.7), iminoctadine-tris(albesilate) (H.4.8), dithianon (H.4.9), 2,6-dimethyl-
1 A/,5A7 1 ,4]dithiino[2,3-c:5,6-c']dipyrrole-1 ,3,5,7(2A/,6/7)-tetraone (H.4.10);
I) Cell wall synthesis inhibitors
- inhibitors of glucan synthesis: validamycin (1.1.1 ), polyoxin B (1.1.2);
- melanin synthesis inhibitors: pyroquilon (1.2.1 ), tricyclazole (I.2.2), carpropamid (1.2.3), dicyclomet (1.2.4), fenoxanil (I.2.5);
J) Plant defence inducers
- acibenzolar-S-methyl (J.1.1 ), probenazole (J.1.2), isotianil (J.1.3), tiadinil (J.1.4),
prohexadione-calcium (J.1.5); phosphonates: fosetyl (J.1.6), fosetyl-aluminum (J.1.7), phosphorous acid and its salts (J.1.8), calcium phosphonate (J.1.1 1), potassium phosphonate (J.1.12), potassium or sodium bicarbonate (J.1.9), 4-cyclopropyl-/V-(2,4-di- methoxyphenyl)thiadiazole-5-carboxamide (J.1.10);
K) Unknown mode of action
- bronopol (K.1.1 ), chinomethionat (K.1.2), cyflufenamid (K.1.3), cymoxanil (K.1.4),
dazomet (K.1.5), debacarb (K.1.6), diclocymet (K.1.7), diclomezine (K.1.8), difenzoquat (K.1.9), difenzoquat-methylsulfate (K.1.10), diphenylamin (K.1.11 ), fenitropan (K.1.12), fenpyrazamine (K.1.13), flumetover (K.1.14), flusulfamide (K.1.15), flutianil (K.1.16), harpin (K.1.17), methasulfocarb (K.1.18), nitrapyrin (K.1.19), nitrothal-isopropyl (K.1.20), tolprocarb (K.1.21 ), oxin-copper (K.1.22), proquinazid (K.1.23), tebufloquin (K.1.24), tecloftalam (K.1.25), triazoxide (K.1.26), /Vi(4-(4-chloro-3-trifluoromethyl-phenoxy)-2,5- dimethyl-phenyl)-/V-ethyl-/V-methyl formamidine (K.1.27), /Vi(4-(4-fluoro-3-trifluoromethyl- phenoxy)-2,5-dimethyl-phenyl)-/V-ethyl-/V-methyl formamidine (K.1.28), /V-[4-[[3-[(4- chlorophenyl)methyl]-1 ,2,4-thiadiazol-5-yl]oxy]-2,5-dimethyl-phenyl]-/V-ethyl-/V-methyl- formamidine (K.1.29), /Vi(5-bromo-6-indan-2-yloxy-2-methyl-3-pyridyl)-/V-ethyl-/V-methyl- formamidine (K.1.30), /Vi[5-bromo-6-[1-(3,5-difluorophenyl)ethoxy]-2-methyl-3-pyridyl]-/V- ethyl-/V-methyl-formamidine (K.1.31), /Vi[5-bromo-6-(4-isopropylcyclohexoxy)-2-methyl- 3-pyridyl]-/V-ethyl-/V-methyl-formamidine (K.1.32), /V^S-bromo^-methyl-e-il- phenylethoxy)-3-pyridyl]-/V-ethyl-/V-methyl-formamidine (K.1.33), /Vi(2-methyl-5- trifluoromethyl-4-(3-trimethylsilanyl-propoxy)-phenyl)-/V-ethyl-/V-methyl formamidine (K.1.34), /Vi(5-difluoromethyl-2-methyl-4-(3-trimethylsilanyl-propoxy)-phenyl)-/V-ethyl-/\A methyl formamidine (K.1.35), 2-(4-chloro-phenyl)-/V-[4-(3,4-dimethoxy-phenyl)-isoxazol- 5-yl]-2-prop-2-ynyloxy-acetamide (K.1.36), 3-[5-(4-chloro-phenyl)-2,3-dimethyl- isoxazolidin-3-yl]-pyridine (pyrisoxazole) (K.1.37), 3-[5-(4-methylphenyl)-2,3-dimethyl- isoxazolidin-3 yl]-pyridine (K.1.38), 5-chloro-1-(4,6-dimethoxy-pyrimidin-2-yl)-2-methyl-
1 TT-benzoimidazole (K.1.39), ethyl (2)-3-amino-2-cyano-3-phenyl-prop-2-enoate (K.1.40), picarbutrazox (K.1.41 ), pentyl /V-[6-[[(2)-[(1-methyltetrazol-5-yl)-phenyl- methylene]amino]oxymethyl]-2-pyridyl]carbamate (K.1.42), but-3-ynyl LA[6-[[(2)-[(1- methyltetrazol-5-yl)-phenyl-methylene]amino]oxymethyl]-2-pyridyl]carbamate (K.1.43), ipflufenoquin (K.1.44), quinofumelin (K.1.47), benziothiazolinone (K.1.48), bromothalonil (K.1.49), 2-(6-benzyl-2-pyridyl)quinazoline (K.1.50), 2-[6-(3-fluoro-4-methoxy-phenyl)-5- methyl-2-pyridyl]quinazoline (K.1.51), dichlobentiazox (K.1.52), /Vi(2,5-dimethyl-4-phen- oxy-phenyl)-/V-ethyl-/V-methyl-formamidine (K.1.53), pyrifenamine (K.1.54), fluopimomide (K.1.55), N'-[5-bromo-2-methyl-6-(1 -methyl-2 propoxy-ethoxy)-3-pyridyl]-N-ethyl-N- methyl-formamidine (K.1.56), N'-[4-(4,5-dichlorothiazol-2-yl)oxy-2,5-dimethyl-phenyl]-N- ethyl-N-methyl-formamidine (K.1.57);
M) Growth regulators
abscisic acid (M.1.1 ), amidochlor, ancymidol, 6-benzylaminopurine, brassinolide, butralin, chlormequat, chlormequat chloride, choline chloride, cyclanilide, daminozide, dikegulac, dimethipin, 2,6-dimethylpuridine, ethephon, flumetralin, flurprimidol, fluthiacet,
forchlorfenuron, gibberellic acid, inabenfide, indole-3-acetic acid , maleic hydrazide, mefluidide, mepiquat, mepiquat chloride, naphthaleneacetic acid, /V-6-benzyladenine, paclobutrazol, prohexadione, prohexadione-calcium, prohydrojasmon, thidiazuron, triapenthenol, tributyl phosphorotrithioate, 2,3,5-tri-iodobenzoic acid , trinexapac-ethyl, uniconazole;
N) Herbicides from classes N.1 to N.15
N.1 Lipid biosynthesis inhibitors: alloxydim, alloxydim-sodium, butroxydim, clethodim,
clodinafop, clodinafop-propargyl, cycloxydim, cyhalofop, cyhalofop-butyl, diclofop, diclofop-methyl, fenoxaprop, fenoxaprop-ethyl, fenoxaprop-P, fenoxaprop-P-ethyl, fluazifop, fluazifop-butyl, fluazifop-P, fluazifop-P-butyl, haloxyfop, haloxyfop-methyl, haloxyfop-P, haloxyfop-P-methyl, metamifop, pinoxaden, profoxydim, propaquizafop, quizalofop, quizalofop-ethyl, quizalofop-tefuryl, quizalofop-P, quizalofop-P-ethyl, quizalofop-P-tefuryl, sethoxydim, tepraloxydim, tralkoxydim, 4-(4'-chloro-4-cyclo~,propyl- 2'-fluoro[1 ,1 '-biphenyl]-3-yl)-5-hydroxy-2,2,6,6-tetramethyl-2 7Lpyran-3(6A75-one
(1312337-72-6); 4-(2',4'-dichloro-4-cyclopropyl[1 ,1 '-biphenyl]-3-yl)-5-hydroxy-2, 2,6,6- tetramethyl-2/7-pyran-3(6A7)-one (1312337-45-3); 4-(4'-chloro-4-ethyl-2'-fluoro[1 ,1 '- biphenyl]-3-yl)-5-hydroxy-2,2,6,6-tetramethyl-2/7-pyran-3(6A)-one (1033757-93-5); 4- (2',4'-dichloro-4-ethyl[1 ,1'-biphenyl]-3-yl)-2,2,6,6-tetramethyl-2A7Lpyran-3,5(4A/,6A7)-dione (1312340-84-3); 5-(acetyloxy)-4-(4'-chloro-4-cyclopropyl-2'-fluoro[1 ,1 '-biphenyl]-3-yl)-3,6- dihydro-2,2,6,6-tetramethyl-277-pyran-3-one (1312337-48-6); 5-(acetyloxy)-4-(2',4'- dichloro-4-cyclopropyl- [1 ,1 '-biphenyl]-3-yl)-3,6-dihydro-2,2,6,6-tetramethyl-2/7-pyran-3- one; 5-(acetyloxy)-4-(4'-chloro-4-ethyl-2'-fluoro[1 ,1'-biphenyl]-3-yl)-3,6-dihydro-2, 2,6,6- tetramethyl^/T-pyran-S-one (1312340-82-1); 5-(acetyloxy)-4-(2',4'-dichloro-4-ethyl[1 ,1'- biphenyl]-3-yl)-3,6-dihydro-2,2,6,6-tetramethyl-277-pyran-3-one (1033760-55-2); 4-(4'- chloro-4-cyclopropyl-2'-fluoro[1 ,1 '-biphenyl]-3-yl)-5,6-dihydro-2,2,6,6-tetramethyl-5-oxo- 2/7-pyran-3-yl carbonic acid methyl ester (1312337-51-1 ); 4-(2',4'-dichloro -4-cyclo- propyl- [1 ,1'-biphenyl]-3-yl)-5,6-dihydro-2,2,6,6-tetramethyl-5-oxo-2/7-pyran-3-yl carbonic acid methyl ester; 4-(4'-chloro-4-ethyl-2'-fluoro[1 ,1 '-biphenyl]-3-yl)-5,6-dihyd ro-2, 2,6,6- tetramethyl-S-oxo^/T-pyran-S-yl carbonic acid methyl ester (1312340-83-2); 4-(2',4'- dichloro-4-ethyh[1 ,1 '-biphenyl]-3-yl)-5,6-dihydro-2,2,6,6-tetramethyl-5-oxo-2ATLpyran-3-yl carbonic acid methyl ester (1033760-58-5); benfuresate, butylate, cycloate, dalapon, dimepiperate, EPTC, esprocarb, ethofumesate, flupropanate, molinate, orbencarb, pebulate, prosulfocarb, TCA, thiobencarb, tiocarbazil, triallate, vernolate;
N.2 ALS inhibitors: amidosulfuron, azimsulfuron, bensulfuron, bensulfuron-methyl,
chlorimuron, chlorimuron-ethyl, chlorsulfuron, cinosulfuron, cyclosulfamuron,
ethametsulfuron, ethametsulfuron-methyl, ethoxysulfuron, flazasulfuron, flucetosulfuron, flupyrsulfuron, flupyrsulfuron-methyl-sodium, foramsulfuron, halosulfuron, halosulfuron- methyl, imazosulfuron, iodosulfuron, iodosulfuron-methyl-sodium, iofensulfuron, iofensul- furon-sodium, mesosulfuron, metazosulfuron, metsulfuron, metsulfuron-methyl, nicosulfuron, orthosulfamuron, oxasulfuron, primisulfuron, primisulfuron-methyl,
propyrisulfuron, prosulfuron, pyrazosulfuron, pyrazosulfuron-ethyl, rimsulfuron, sulfometuron, sulfometuron-methyl, sulfosulfuron, thifensulfuron, thifensulfuron-methyl, triasulfuron, tribenuron, tribenuron-methyl, trifloxysulfuron, triflusulfuron, triflusulfuron- methyl, tritosulfuron, imazamethabenz, imazamethabenz-methyl, imazamox, imazapic, imazapyr, imazaquin, imazethapyr; cloransulam, cloransulam-methyl, diclosulam, flumetsulam, florasulam, metosulam, penoxsulam, pyrimisulfan, pyroxsulam; bispyribac, bispyribac-sodium, pyribenzoxim, pyriftalid, pyriminobac, pyriminobac-methyl, pyrithio- bac, pyrithiobac-sodium, 4-[[[2-[(4,6-dimethoxy-2-pyrimidinyl)oxy]phenyl]methyl]amino]- benzoic acid-1 -methyhethyl ester (420138-41-6), 4-[[[2-[(4,6-dimethoxy-2- pyrimidiny oxylphenyll-Tnethyllaminol-benzoic acid propyl ester (420138-40-5), LA(4- bromophenyl)-2-[(4,6-dimethoxy-2-pyrimidinyl)oxy]benzenemethanamine (420138-01-8); flucarbazone, flucarbazone-sodium, propoxycarbazone, propoxycarbazone-sodium, thiencarbazone, thiencarbazone-methyl; triafamone;
N.3 Photosynthesis inhibitors: amicarbazone; chlorotriazine; ametryn, atrazine,
chloridazone, cyanazine, desmetryn, dimethametryn,hexazinone, metribuzin, prometon, prometryn, propazine, simazine, simetryn, terbumeton, terbuthylazin, terbutryn, trietazin; chlorobromuron, chlorotoluron, chloroxuron, dimefuron, diuron, fluometuron, isoproturon, isouron, linuron, metamitron, methabenzthiazuron, metobenzuron, metoxuron, monolinuron, neburon, siduron, tebuthiuron, thiadiazuron, desmedipham, karbutilat, phenmedipham, phenmedipham-ethyl, bromofenoxim, bromoxynil and its salts and esters, ioxynil and its salts and esters, bromacil, lenacil, terbacil, bentazon, bentazon- sodium, pyridate, pyridafol, pentanochlor, propanil; diquat, diquat-dibromide, paraquat, paraquat-dichloride, paraquat-dimetilsulfate, 1 -(6-tert-butylpyrimidin-4-yl)-2-hydroxy-4- methnoxy-S-methyl^H-pyrrol-S-one (1654744-66-7), 1 -(5-tert-butylisoxazol-3-yl)-2- hydroxy-4 methoxy-3-methyl-2H-pyrrol-5-one (1637455-12-9), 1-(5-tert-butylisoxazol-3- yl)-4-chloro-2 hydroxy-3-methyl-2H-pyrrol-5-one (1637453-94-1 ), 1-(5-tert-butyl-1-methyl- pyrazol-3-yl)-4 chloro-2-hydroxy-3-methyl-2H-pyrrol-5-one (1654057-29-0), 1 -(5-tert- butyl-1 -methyl-pyrazol-3-yl)-3-chloro-2-hydroxy-4-methyl-2H-pyrrol-5-one (1654747-80- 4), 4-hydroxy-1 methoxy-5-methyl-3-[4-(trifluoromethyl)-2-pyridyl]imidazolidin-2-one; (2023785-78-4), 4 hydroxy-1 ,5-dimethyl-3-[4-(trifluoromethyl)-2-pyridyl]imidazolidin-2-one (2023785-79-5), 5 ethoxy-4-hydroxy-1 -methyl-3-[4-(trifluoromethyl)-2-pyridyl]imidazolidin- 2-one (1701416-69-4), 4-hydroxy-1 -methyl-3-[4-(trifluoromethyl)-2-pyridyl]imidazolidin-2- one (1708087-22-2), 4 hydroxy-1 ,5-dimethyl-3-[1 -methyl-5-(trifluoromethyl)pyrazol-3- yl]imidazolidin-2-one (2023785-80-8), 1-(5-tert-butylisoxazol-3-yl)-4-ethoxy-5-hydroxy-3- methyl-imidazolidin-2-one (1844836-64-1 );
N.4 protoporphyrinogen-IX oxidase inhibitors: acifluorfen, acifluorfen-sodium, azafenidin, bencarbazone, benzfendizone, bifenox, butafenacil, carfentrazone, carfentrazone-ethyl, chlormethoxyfen, cinidon-ethyl, fluazolate, flufenpyr, flufenpyr-ethyl, flumiclorac, flumiclorac-pentyl, flumioxazin, fluoroglycofen, fluoroglycofen-ethyl, fluthiacet, fluthiacet- methyl, fomesafen, halosafen, lactofen, oxadiargyl, oxadiazon, oxyfluorfen, pentoxazone, profluazol, pyraclonil, pyraflufen, pyraflufen-ethyl, saflufenacil, sulfentrazone, thidiazimin, tiafenacil, trifludimoxazin, ethyl [3-[2-chloro-4-fluoro-5-(1-methyl-6-trifluoromethyl-2,4- dioxo-1 ,2,3,4-tetrahydropyrimidin-3-yl)phenoxy]-2-pyridyloxy]acetate (353292-31-6), N- ethyl-3-(2,6-dichloro-4-trifluoro-methylphenoxy)-5-methyl-1 A pyrazole-l -carboxamide
(452098-92-9), /V-tetrahydrofurfuryl-3-(2,6-dichloro-4-trifluoromethylphenoxy)-5-methyl- 1 TT-pyrazole-l -carboxamide (915396-43-9), /V-ethyl-3-(2-chloro-6-fluoro-4- trifluoromethyhphenoxy)-5-methyl-1 A pyrazole-l -carboxamide (452099-05-7), N- tetrahydro ,furfuryl-3-(2-chloro-6-fluoro-4-trifluoro-,methylphenoxy)-5-methyl-1 TT-pyrazole- 1 -carboxamide (452100-03-7), 3-[7-fluoro-3-oxo-4-(prop-2-ynyl)-3,4-dihydro-277- benzo[1 ,4]oxazin-6-yl]-1 ,5-dimethyl-6-thioxo-[1 ,3,5]triazinan-2,4-dione (451484-50-7), 2- (2,2,7-trifluoro-3-oxo-4-prop-2-ynyl-3,4-dihydro-2A -benzo[1 , 4]oxazin-6-yl)-4, 5,6,7- tetrahydro-isoindole-1 ,3-dione (13001 18-96-0), 1 -methyl-6-trifluoro-,methyl-3-(2,2,7-tri- fluoro-S-oxo^-prop^-ynyl-S^-dihydro^/T-benzofl ^loxazin-e-y -l TT-pyrimidine^^- dione (13041 13-05-0), methyl (£)-4-[2-chloro-5-[4-chloro-5-(difluoromethoxy)-1 TT-methyl- pyrazol-3-yl]-4-fluoro-phenoxy]-3-methoxy-but-2-enoate (948893-00-3), 3-[7-chloro-5- fluoro-2-(trifluoromethyl)-1 TT-benzimidazol^-yll-l -methyl-6-(trifluoromethyl)-1 H- pyrimidine-2,4-dione (212754-02-4);
N.5 Bleacher herbicides: beflubutamid, diflufenican, fluridone, flurochloridone, flurtamone, norflurazon, picolinafen, 4-(3-trifluoromethyhphenoxy)-2-(4- trifluoromethylphenyl)pyrimidine (180608-33-7); benzobicyclon, benzofenap,
bicyclopyrone, clomazone, fenquintrione, isoxaflutole, mesotrione, pyrasulfotole, pyrazolynate, pyrazoxyfen, sulcotrione, tefuryltrione, tembotrione, tolpyralate,
topramezone; aclonifen, amitrole, flumeturon;
N.6 EPSP synthase inhibitors: glyphosate, glyphosate-isopropylammonium, glyposate- potassium, glyphosate-trimesium (sulfosate);
N.7 Glutamine synthase inhibitors: bilanaphos (bialaphos), bilanaphos-sodium, glufosinate, glufosinate-P, glufosinate-ammonium;
N.8 DHP synthase inhibitors: asulam;
N.9 Mitosis inhibitors: benfluralin, butralin, dinitramine, ethalfluralin, fluchloralin, oryzalin, pendimethalin, prodiamine, trifluralin; amiprophos, amiprophos-methyl, butamiphos; chlorthal, chlorthal-dimethyl, dithiopyr, thiazopyr, propyzamide, tebutam; carbetamide, chlorpropham, flamprop, flamprop-isopropyl, flamprop-methyl, flamprop-M-isopropyl, flamprop-M-methyl, propham;
N.10 VLCFA inhibitors: acetochlor, alachlor, butachlor, dimethachlor, dimethenamid,
dimethenamid-P, metazachlor, metolachlor, metolachlor-S, pethoxamid, pretilachlor, propachlor, propisochlor, thenylchlor, flufenacet, mefenacet, diphenamid, naproanilide, napropamide, napropamide-M, fentrazamide, anilofos, cafenstrole, fenoxasulfone, ipfencarbazone, piperophos, pyroxasulfone, isoxazoline compounds of the formulae 11.1 ,
11.1
N.1 1 Cellulose biosynthesis inhibitors: chlorthiamid, dichlobenil, flupoxam, indaziflam,
isoxaben, triaziflam, 1 -cyclohexyl-5-pentafluorphenyloxy-14-[1 ,2,4,6]thiatriazin-3-ylamine (175899-01 -1 );
N.12 Decoupler herbicides: dinoseb, dinoterb, DNOC and its salts;
N.13 Auxinic herbicides: 2,4-D and its salts and esters, clacyfos, 2,4-DB and its salts and esters, aminocyclopyrachlor and its salts and esters, aminopyralid and its salts such as aminopyralid-dimethylammonium, aminopyralid-tris(2-hydroxypropyl)ammonium and its esters, benazolin, benazolin-ethyl, chloramben and its salts and esters, clomeprop, clopyralid and its salts and esters, dicamba and its salts and esters, dichlorprop and its salts and esters, dichlorprop-P and its salts and esters, fluroxypyr, fluroxypyr-butometyl, fluroxypyr-meptyl, halauxifen and its salts and esters (943832-60-8); MCPA and its salts and esters, MCPA-thioethyl, MCPB and its salts and esters, mecoprop and its salts and esters, mecoprop-P and its salts and esters, picloram and its salts and esters, quinclorac, quinmerac, TBA (2,3,6) and its salts and esters, triclopyr and its salts and esters, 4- amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylic acid, florpyrauxifen-benzyl, florpyrauxifen;
N.14 Auxin transport inhibitors: diflufenzopyr, diflufenzopyr-sodium, naptalam, naptalam- sodium;
N.15 Other herbicides: bromobutide, chlorflurenol, chlorflurenol-methyl, cinmethylin,
cumyluron, cyclopyrimorate (499223-49-3) and its salts and esters, dalapon, dazomet, difenzoquat, difenzoquat-metilsulfate, dimethipin, DSMA, dymron, endothal and its salts, etobenzanid, flurenol, flurenol-butyl, flurprimidol, fosamine, fosamine-ammonium, indanofan, maleic hydrazide, mefluidide, metam, methiozolin (403640-27-7), methyl azide, methyl bromide, methyl-dymron, methyl iodide, MSMA, oleic acid, oxaziclomefone, pelargonic acid, pyributicarb, quinoclamine, tridiphane;
O) Insecticides from classes 0.1 to 0.29
0.1 Acetylcholine esterase (AChE) inhibitors: aldicarb (0.1.1 ), alanycarb (0.1.2), bendiocarb (0.1.3), benfuracarb (0.1 .4), butocarboxim (0.1.5), butoxycarboxim (0.1.6), carbaryl (0.1.7), carbofuran (0.1.8), carbosulfan (0.1.9), ethiofencarb (0.1.10), fenobucarb (0.1.1 1 ), formetanate (0.1 .12), furathiocarb (0.1.13), isoprocarb (0.1.14), methiocarb (0.1.15), methomyl (0.1.16), metolcarb (0.1 .17), oxamyl (0.1.18), pirimicarb (0.1.19), propoxur (0.1 .20), thiodicarb (0.1 .21 ), thiofanox (0.1.22), trimethacarb (0.1.23), XMC (0.1.24), xylylcarb (0.1.25), triazamate (0.1.26), acephate (0.1.27), azamethiphos (0.1.28), azinphos-ethyl (0.1 .29), azinphosmethyl (0.1.30), cadusafos (0.1.31 ), chlorethoxyfos (0.1.32), chlorfenvinphos (0.1 .33), chlormephos (0.1.34), chlorpyrifos (0.1.35), chlorpyrifos-methyl (0.1 .36), coumaphos (0.1 .37), cyanophos (0.1.38), demeton-S-methyl (0.1 .39), diazinon (0.1 .40), dichlorvos/ DDVP (0.1 .41 ), dicrotophos (0.1.42), dimethoate (0.1.43), dimethylvinphos (0.1.44), disulfoton (0.1.45), EPN (0.1.46), ethion (0.1 .47), ethoprophos (0.1.48), famphur (0.1.49), fenamiphos (0.1.50), fenitrothion (0.1 .51 ), fenthion (0.1 .52), fosthiazate (0.1 .53), heptenophos (0.1 .54), imicyafos (0.1 .55), isofenphos (0.1 .56), isopropyl O-(methoxyaminothio-phosphoryl) salicylate (0.1 .57), isoxathion (0.1 .58), malathion (0.1 .59), mecarbam (0.1.60), methamidophos (0.1.61 ), methidathion (0.1.62), mevinphos (0.1.63), monocrotophos (0.1.64), naled (0.1.65), omethoate (0.1.66), oxydemeton-methyl (0.1.67), parathion (0.1.68), parathion-methyl (0.1 .69), phenthoate (0.1.70), phorate (0.1 .71 ), phosalone (0.1.72), phosmet (0.1.73), phosphamidon (0.1 .74), phoxim (0.1 .75), pirimiphos- methyl (0.1.76), profenofos (0.1.77), propetamphos (0.1 .78), prothiofos (0.1.79), pyraclofos (0.1.80), pyridaphenthion (0.1 .81 ), quinalphos (0.1 .82), sulfotep (0.1.83), tebupirimfos (0.1.84), temephos (0.1 .85), terbufos (0.1 .86), tetrachlorvinphos (0.1.87), thiometon (0.1.88), triazophos (0.1.89), trichlorfon (0.1.90), vamidothion (0.1.91 );
0.2 GABA-gated chloride channel antagonists: endosulfan (0.2.1 ), chlordane (0.2.2),
ethiprole (0.2.3), fipronil (0.2.4), flufiprole (0.2.5), pyrafluprole (0.2.6), pyriprole (0.2.7);
0.3 Sodium channel modulators: acrinathrin (0.3.1 ), allethrin (0.3.2), d-cis-trans allethrin (0.3.3), d-trans allethrin (0.3.4), bifenthrin (0.3.5), kappa-bifenthrin (0.3.6), bioallethrin (0.3.7), bioallethrin S-cylclopentenyl (0.3.8), bioresmethrin (0.3.9), cycloprothrin
(0.3.10), cyfluthrin (0.3.1 1 ), beta-cyfluthrin (0.3.12), cyhalothrin (0.3.13), lambda- cyhalothrin (0.3.14), gamma-cyhalothrin (0.3.15), cypermethrin (0.3.16), alpha- cypermethrin (0.3.17), beta-cypermethrin (0.3.18), theta-cypermethrin (0.3.19), zeta- cypermethrin (0.3.20), cyphenothrin (0.3.21 ), deltamethrin (0.3.22), empenthrin
(0.3.23), esfenvalerate (0.3.24), etofenprox (0.3.25), fenpropathrin (0.3.26), fenvalerate (0.3.27), flucythrinate (0.3.28), flumethrin (0.3.29), tau-fluvalinate (0.3.30), halfenprox (0.3.31 ), heptafluthrin (0.3.32), imiprothrin (0.3.33), meperfluthrin (0.3.34), metofluthrin (0.3.35), momfluorothrin (0.3.36), epsilon-momfluorothrin (0.3.37), permethrin (0.3.38), phenothrin (0.3.39), prallethrin (0.3.40), profluthrin (0.3.41 ), pyrethrin (pyrethrum) (0.3.42), resmethrin (0.3.43), silafluofen (0.3.44), tefluthrin (0.3.45), kappa-tefluthrin (0.3.46), tetramethylfluthrin (0.3.47), tetramethrin (0.3.48), tralomethrin (0.3.49), transfluthrin (0.3.50), DDT (0.3.51 ), methoxychlor (0.3.52);
0.4 Nicotinic acetylcholine receptor agonists (nAChR): acetamiprid (0.4.1 ), clothianidin
(0.4.2), cycloxaprid (0.4.3), dinotefuran (0.4.4), imidacloprid (0.4.5), nitenpyram (0.4.6), thiacloprid (0.4.7), thiamethoxam (0.4.8), 4,5-dihydro-/V-nitro-1 -(2-oxiranylmethyl)-1 H-
imidazol-2-amine (0.4.9), (2£)-1 -[(e-chloropyridin-S-y methyll-AAnitro^-pentylidene- hydrazinecarboximidamide (0.4.10), 1-[(6-chloropyridin-3-yl)methyl]-7-methyl-8-nitro-5- propoxy-1 ,2,3,5,6,7-hexahydroimidazo[1 ,2-a]pyridine (0.4.1 1), nicotine (0.4.12), sulfoxaflor (0.4.13), flupyradifurone (0.4.14), triflumezopyrim (0.4.15), ( 3R}-3-{2 - chlorothiazol-5-yl)-8-methyl-5-oxo-6-phenyl-2,3-dihydrothiazolo[3,2-a]pyrimidin-8-ium-7- olate (0.4.16), (3S)-3-(6-chloro-3-pyridyl)-8-methyl-5-oxo-6-phenyl-2,3-di- hydrothiazolo[3,2-a]pyrimidin-8-ium-7-olate (0.4.17), (3S)-8-methyl-5-oxo-6-phenyl-3- pyrimidin-5-yl-2,3-dihydrothiazolo[3,2-a]pyrimidin-8-ium-7-olate (0.4.18), ( 3R}-3-{2 - chlorothiazol-5-yl)-8-methyl-5-oxo-6-[3-(trifluoromethyl)phenyl]-2,3-dihydrothiazolo[3,2- a]pyrimidin-8-ium-7-olate (0.4.19), (3/\ -3-(2-chlorothiazol-5-yl)-6-(3,5-dichlorophenyl)-8- methyl-5-oxo-2,3-dihydrothiazolo[3,2-a]pyrimidin-8-ium-7-olate (0.4.20), ( 3R)-3-{2 - chlorothiazol-5-yl)-8-ethyl-5-oxo-6-phenyl-2,3-dihydrothiazolo[3,2-a]pyrimidin-8-ium-7- olate (0.4.21 );
0.5 Nicotinic acetylcholine receptor allosteric activators: spinosad (0.5.1 ), spinetoram
(0.5.2);
0.6 Chloride channel activators: abamectin (0.6.1), emamectin benzoate (0.6.2), ivermectin (0.6.3), lepimectin (0.6.4), milbemectin (0.6.5);
0.7 Juvenile hormone mimics: hydroprene (0.7.1), kinoprene (0.7.2), methoprene (0.7.3), fenoxycarb (0.7.4), pyriproxyfen (0.7.5);
0.8 miscellaneous non-specific (multi-site) inhibitors: methyl bromide (0.8.1 ) and other alkyl halides, chloropicrin (0.8.2), sulfuryl fluoride (0.8.3), borax (0.8.4), tartar emetic (0.8.5);
0.9 Chordotonal organ TRPV channel modulators: pymetrozine (0.9.1 ), pyrifluquinazon (0.9.2), flonicamid (0.9.3);
0.10 Mite growth inhibitors: clofentezine (0.10.1), hexythiazox (0.10.2), diflovidazin
(0.10.3), etoxazole (0.10.4);
0.1 1 Microbial disruptors of insect midgut membranes: Bacillus thuringiensis, Bacillus
sphaericus and the insecticdal proteins they produce: Bacillus thuringiensis subsp.
Israe/ensis (0.1 1.1), Bacillus sphaericus (0.1 1.2), Bacillus thuringiensis subsp. aizawai (0.1 1.3), Bacillus thuringiensis subsp. kurstaki (0L 1.4), Bacillus thuringiensis subsp. tenebrionis (0.11.5), the Bt crop proteins: Cry1 Ab (0.1 1.6), Cry1 Ac (0.11.7), Cry1 Fa (0.11.8), Cry2Ab (0.1 1.9), mCry3A (0.11.10), Cry3Ab (0.11.11 ), Cry3Bb (0.1 1.12), Cry34/35Ab1 (0.11.13);
0.12 Inhibitors of mitochondrial ATP synthase: diafenthiuron (0.12.1 ), azocyclotin (0.12.2), cyhexatin (0.12.3), fenbutatin oxide (0.12.4), propargite (0.12.5), tetradifon (0.12.6);
0.13 Uncouplers of oxidative phosphorylation via disruption of the proton gradient:
chlorfenapyr (0.13.1), DNOC (0.13.2), sulfluramid (0.13.3);
0.14 Nicotinic acetylcholine receptor (nAChR) channel blockers: bensultap (0.14.1 ), cartap hydrochloride (0.14.2), thiocyclam (0.14.3), thiosultap sodium (0.14.4);
0.15 Inhibitors of the chitin biosynthesis type 0: bistrifluron (0.15.1 ), chlorfluazuron (0.15.2), diflubenzuron (0.15.3), flucycloxuron (0.15.4), flufenoxuron (0.15.5), hexaflumuron (0.15.6), lufenuron (0.15.7), novaluron (0.15.8), noviflumuron (0.15.9), teflubenzuron (0.15.10), triflumuron (0.15.11 );
0.16 Inhibitors of the chitin biosynthesis type 1 : buprofezin (0.16.1);
0.17 Moulting disruptors: cyromazine (0.17.1 );
8 Ecdyson receptor agonists: methoxyfenozide (0.18.1), tebufenozide (0.18.2), halofenozide (0.18.3), fufenozide (0.18.4), chromafenozide (0.18.5);
9 Octopamin receptor agonists: amitraz (0.19.1 );
0 Mitochondrial complex III electron transport inhibitors: hydramethylnon (0.20.1), acequinocyl (0.20.2), fluacrypyrim (0.20.3), bifenazate (0.20.4);
1 Mitochondrial complex I electron transport inhibitors: fenazaquin (0.21.1),
fenpyroximate (0.21.2), pyrimidifen (0.21.3), pyridaben (0.21.4), tebufenpyrad (0.21.5), tolfenpyrad (0.21.6), rotenone (0.21.7);
2 Voltage-dependent sodium channel blockers: indoxacarb (0.22.1), metaflumizonev (0.22.2), 2-[2-(4-cyanophenyl)-1-[3-(trifluoromethyl)phenyl]ethylidene]-/V-[4- (difluoromethoxy)phenyl]-hydrazinecarboxamide (0.22.3), /V-(3-chloro-2-methylphenyl)- 2-[(4-chlorophenyl)-[4-[methyl(methylsulfonyl)amino]phenyl]methylene]- hydrazinecarboxamide (0.22.4);
3 Inhibitors of the of acetyl CoA carboxylase: spirodiclofen (0.23.1), spiromesifen (0.23.2), spirotetramat (0.23.3), spiropidion (0.23.4);
4 Mitochondrial complex IV electron transport inhibitors: aluminium phosphide (0.24.1 ), calcium phosphide (0.24.2), phosphine (0.24.3), zinc phosphide (0.24.4), cyanide (0.24.5);
5 Mitochondrial complex II electron transport inhibitors: cyenopyrafen (0.25.1), cyflumetofen (0.25.2);
6 Ryanodine receptor-modulators: flubendiamide (0.26.1), chlorantraniliprole (0.26.2), cyantraniliprole (0.26.3), cyclaniliprole (0.26.4), tetraniliprole (0.26.5), (/Tl-S-chloro-A/1- {2-methyl-4-[1 ,2,2,2 -tetrafluoro-1 -(trifluoromethyl)ethyl]phenyl}-Ae-(1 -methyl-2 - methylsulfonylethyl)phthalamide (0.26.6), (S)-3-chloro-/V-{2-methyl-4-[1 ,2,2,2-te- trafluoro-1-(trifluoromethyl)ethyl]phenyl}-Ae-(1-methyl-2-methylsulfonylethyl)phthalamide (0.26.7), methyl-2-[3,5-dibromo-2-({[3-bromo-1 -(3-chloropyridin-2-yl)-177-pyrazol-5-yl]- carbonyl}amino)benzoyl]-1 ,2-dimethylhydrazinecarboxylate (0.26.8), /V-[4,6-dichloro-2- [(diethyl-lambda-4-sulfanylidene)carbamoyl]-phenyl]-2-(3-chloro-2-pyridyl)-5- (trifluoromethyl)pyrazole-3-carboxamide (0.26.9), /V-[4-chloro-2-[(diethyl-lambda-4- sulfanylidene)carbamoyl]-6-methyl-phenyl]-2-(3-chloro-2-pyridyl)-5- (trifluoromethyl)pyrazole-3-carboxamide (0.26.10), /V-[4-chloro-2-[(di-2-propyl-lambda-4- sulfanylidene)carbamoyl]-6-methyl-phenyl]-2-(3-chloro-2-pyridyl)-5-(trifluorometh- yl)pyrazole-3-carboxamide (0.26.11 ), /V-[4,6-dichloro-2-[(di-2-propyl-lambda-4- sulfanylidene)carbamoyl]-phenyl]-2-(3-chloro-2-pyridyl)-5-(trifluoromethyl)pyrazole-3- carboxamide (0.26.12), /V-[4,6-dibromo-2-[(diethyl-lambda-4-sulfanylidene)carbamoyl]- phenyl]-2-(3-chloro-2-pyridyl)-5-(trifluoromethyl)pyrazole-3-carboxamide (0.26.13), N-[2- (5-amino-1 ,3,4-thiadiazol-2-yl)-4-chloro-6-methylphenyl]-3-bromo-1-(3-chloro-2-pyridinyl)- 1 TT-pyrazole-S-carboxamide (0.26.14), 3-chloro-1-(3-chloro-2-pyridinyl)-/V-[2,4-dichloro- 6-[[(1 -cyano-1 -methylethyl)amino]carbonyl]phenyl]-1 /7-pyrazole-5-carboxamide
(0.26.15), tetrachlorantraniliprole (0.26.16), /V-[4-chloro-2-[[(1 ,1- dimethylethyl)amino]carbonyl]-6-methylphenyl]-1-(3-chloro-2-pyridinyl)-3- (fluoromethoxy)-l TT-pyrazole-S-carboxamide (0.26.17), cyhalodiamide (0.26.18);
7: Chordotonal organ Modulators - undefined target site: flonicamid (0.27.1 );
8. insecticidal active compounds of unknown or uncertain mode of action: afidopyropen
(0.28.1 ), afoxolaner (0.28.2), azadirachtin (0.28.3), amidoflumet (0.28.4), benzoximate (0.28.5), broflanilide (0.28.6), bromopropylate (0.28.7), chinomethionat (0.28.8), cryolite (0.28.9), dicloromezotiaz (0.28.10), dicofol (0.28.11 ), flufenerim (0.28.12), flometoquin (0.28.13), fluensulfone (0.28.14), fluhexafon (0.28.15), fluopyram (0.28.16), fluralaner (0.28.17), metoxadiazone (0.28.18), piperonyl butoxide (0.28.19), pyflubumide
(0.28.20), pyridalyl (0.28.21 ), tioxazafen (0.28.22), 11-(4-chloro-2,6-dimethylphenyl)-12- hydroxy-1 ,4-dioxa-9-azadispiro[4.2.4.2]-tetradec-11 -en-10-one, 3-(4’-fluoro-2,4- dimethylbiphenyl-3-yl)-4-hydroxy-8-oxa-1 -azaspiro[4.5]dec-3-en-2-one, 1 -[2-fluoro-4- methyl-5-[(2,2,2-trifluoroethyl)sulfinyl]phenyl]-3-(trifluoromethyl)-1 H- 1 ,2,4-triazole-5-amine (0.28.23), Bacillus firmus \- \ 582 (0.28.24), flupyrimin (0.28.25), fluazaindolizine
(0.28.26), 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4ATLisoxazol-3-yl]-2-methyl-/V-(1- oxothietan-3-yl)benzamide (0.28.27), fluxametamide (0.28.28), 5-[3-[2,6-dichloro-4-(3,3- dichloroallyloxy)phenoxy]propoxy]-1 TT-pyrazole (0.28.1), 4-cyano-/V-[2-cyano-5-[[2,6- dibromo-4-[1 ,2,2,3,3,3-hexafluoro-1-(trifluoromethyl)propyl]phenyl]carbamoyl]phenyl]-2- methyl-benzamide (0.28.29), 4-cyano-3-[(4-cyano-2-methyl-benzoyl)amino]-/V-[2,6-di- chloro-4-[1 ,2,2,3,3,3-hexafluoro-1-(trifluoromethyl)propyl]phenyl]-2-fluoro-benzamide (0.28.30), /V-[5-[[2-chloro-6-cyano-4-[1 ,2,2,3,3,3-hexafluoro-1 -(trifluoromethyl)propyl]- phenyl]carbamoyl]-2-cyano-phenyl]-4-cyano-2-methyl-benzamide (0.28.31 ), LA[5-[[2- bromo-6-chloro-4-[2, 2, 2-trifluoro-1 -hydroxy-1 -(trifluoromethyl)ethyl]phenyl]carbamoyl]-2- cyano-phenyl]-4-cyano-2-methyl-benzamide (0.28.32), /V-[5-[[2-bromo-6-chloro-4- [1 ,2,2,3,3,3-hexafluoro-1-(trifluoromethyl)propyl]phenyl]carbamoyl]-2-cyano-phenyl]- 4-cyano-2-methyl-benzamide (0.28.33), 4-cyano-/V-[2-cyano-5-[[2,6-dichloro-4- [1 ,2,2,3,3,3-hexafluoro-1-(trifluoromethyl)propyl]phenyl]carbamoyl]phenyl]-2-methyl- benzamide (0.28.34), 4-cyano-/V-[2-cyano-5-[[2,6-dichloro-4-[1 ,2,2,2-tetrafluoro-
1-(trifluoromethyl)ethyl]phenyl]carbamoyl]phenyl]-2-methyl-benzamide (0.28.35), /V-[5-[[2-bromo-6-chloro-4-[1 ,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]phenyl]carbamoyl]-
2-cyano-phenyl]-4-cyano-2-methyl-benzamide (0.28.36); 2-(1 ,3-dioxan-2-yl)-6-[2-(3- pyridinyl)-5-thiazolyl]-pyridine (0.28.37), 2-[6-[2-(5-fluoro-3-pyridinyl)-5-thiazolyl]-2- pyridinyl]-pyrimidine (0.28.38), 2-[6-[2-(3-pyridinyl)-5-thiazolyl]-2-pyridinyl]-pyrimidine (0.28.39), AAmethylsulfonyl-6-[2-(3-pyridyl)thiazol-5-yl]pyridine-2-carboxamide (0.28.40), /V-methylsulfonyl-6-[2-(3-pyridyl)thiazol-5-yl]pyridine-2-carboxamide (0.28.41), 1-[(6-chlo- ro-3-pyridinyl)methyl]-1 ,2,3,5,6,7-hexahydro-5-methoxy-7-methyl-8-nitro-imidazo[1 ,2- a]pyridine (0.28.42), 1-[(6-chloropyridin-3-yl)methyl]-7-methyl-8-nitro-1 ,2,3,5,6,7- hexahydroimidazo[1 ,2-a]pyridin-5-ol (0.28.43), 1-isopropyl-/V,5-dimethyl-/V-pyridazin-4-yl- pyrazole-4-carboxamide (0.28.44), 1-(1 ,2-dimethylpropyl)-/V-ethyl-5-methyl-/V-pyridazin-
4-yl-pyrazole-4-carboxamide (0.28.45), /V,5-dimethyl-/V-pyridazin-4-yl-1 -(2,2,2-trifluoro-1 - methyl-ethyl)pyrazole-4-carboxamide (0.28.46), 1-[1-(1-cyanocyclopropyl)ethyl]-/V-ethyl-
5-methyl-/V-pyridazin-4-yl-pyrazole-4-carboxamide (0.28.47), /V-ethyl-1 -(2-fluoro-1 - methyl-propyl)-5-meth-yl-/V-pyridazin-4-yl-pyrazole-4-carboxamide (0.28.48), 1-(1 ,2- dimethylpropyl)-/V,5-dimethyl-/V-pyridazin-4-yl-pyrazole-4-carboxamide (0.28.49),
1 -[1 -(1 -cyanocyclopropyl)ethyl]-/V,5-dimethyl-/V-pyridazin-4-yl-pyrazole-4-carboxamide (0.28.50), /V-methyl-1 -(2-fluoro-1 -methyl-propyl]-5-methyl-/V-pyridazin-4-yl-pyrazole-4- carboxamide (0.28.51), 1-(4,4-difluorocyclohexyl)-/V-ethyl-5-methyl-/V-pyridazin-4-yl-pyr- azole-4-carboxamide (0.28.52), 1-(4,4-difluorocyclohexyl)-/V,5-dimethyl-/V-pyridazin-4-yl-
pyrazole-4-carboxamide (0.28.53), LA( 1 -methylethyl)-2-(3-pyridinyl)-2 TT-indazole-
4-carboxamide (0.28.54), /V-cyclopropyl-2-(3-pyndinyl)-2 TLindazole-4-carboxamide (0.28.55), /V-cyclohexyl-2-(3-pyridinyl)-2/7-indazole-4-carboxamide (0.28.56), 2-(3- pyridinyl)-/V-(2,2,2-trifluoroethyl)-2A7Lindazole-4-carboxamide (0.28.57), 2-(3-pyridinyl)- /V-[(tetrahydro-2-furanyl)methyl]-2/7-indazole-5-carboxamide (0.28.58), methyl 2-[[2-(3- pyridinyl)-2/7-indazol-5-yl]carbonyl]hydrazinecarboxylate (0.28.59), LA[( 2,2-di- fluorocyclopropyl)methyl]-2-(3-pyridinyl)-2/7-indazole-5-carboxamide (0.28.60), LA( 2,2- difluoropropyl)-2-(3-pyndinyl)-2/7-indazole-5-carboxamide (0.28.61), 2-(3-pyridinyl )-N-( 2- pyrimidinylmethyl )-2/TLindazole-5-carboxamide (0.28.62), /V-[(5-methyl-2-pyrazinyl)- methyl]-2-(3-pyridinyl)-2/TLindazole-5-carboxamide (0.28.63), tyclopyrazoflor (0.28.64), sarolaner (0.28.65), lotilaner (0.28.66), /V-[4-chloro-3-[[(phenylmethyl)amino]car- bonyl]phenyl]-1-methyl-3-(1 ,1 ,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-1 /7-pyrazole-5- carboxamide (0.28.67), M. UN.22a 2-(3-ethylsulfonyl-2-pyridyl)-3-methyl-6- (trifluoromethyl)imidazo[4,5-b]pyridine (0.28.68), 2-[3-ethylsulfonyl-5-(trifluoromethyl)-2- pyridyl]-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine (0.28.69),
iscocycloseram(O.28.70), /V-[4-chloro-3-(cyclopropylcarbamoyl)phenyl]-2-methyl-
5-(1 ,1 ,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-3-carboxamide (0.28.72), LA[ 4- chloro-3-[(1-cyanocyclopropyl)carbamoyl]phenyl]-2-methyl-5-(1 ,1 ,2,2,2-pentafluoroethyl)-
4-(trifluoromethyl)pyrazole-3-carboxamide (0.28.73), acynonapyr (0.28.74),
benzpyrimoxan (0.28.75), chloro-/V-(1 -cyanocyclopropyl)-5-[1 -[2-methyl-
5-(1 ,1 ,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-3-yl]pyrazol-4-yl]benzamide (0.28.76), oxazosulfyl (0.28.77), [(25,3/?,4/?,55,6S)-3,5-dimethoxy-6-methyl-4-propoxy- tetrahydropyran-2-yl]-/V-[4-[1-[4-(trifluoromethoxy)phenyl]-1 ,2,4-triazol-3- yl]phenyl]carbamate (0.28.78), [(25,3/?,4/?,55,6S)-3,4,5-trimethoxy-6-methyl-tetrahydro- pyran-2-yl] N-[4-[1 -[4-(trifluoromethoxy)phenyl]-1 ,2,4-triazol-3-yl]phenyl]carbamate (0.28.79), [(25,3/?,4/?,55,6S)-3,5-dimethoxy-6-methyl-4-propoxy-tetrahydropyran-2-yl]- LA[4-[1-[4-(1 ,1 ,2,2,2-pentafluoroethoxy)phenyl]-1 ,2,4-triazol-3-yl]phenyl]carbamate (0.28.80), [(25,3/?,4/?,55,6S)-3,4,5-trimethoxy-6-methyl-tetrahydropyran-2-yl]-/V-[4-[1-[4- (1 ,1 ,2,2,2-pentafluoroethoxy)phenyl]-1 ,2,4-triazol-3-yl]phenyl]carbamate (0.28.81), (22)- 3-(2-isopropylphenyl)-2-[(£)-[4-[1-[4-(1 ,1 ,2,2,2-pentafluoroethoxy)phenyl]-1 ,2,4-triazol-3- yl]phenyl]methylenehydrazono]thiazolidin-4-one (0.28.82), 2-(6-chloro-3-ethylsulfonyl- imidazo[1 ,2-a]pyridin-2-yl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine (0.28.83), 2- (6-bromo-3-ethylsulfonyl-imidazo[1 ,2-a]pyridin-2-yl)-3-methyl-6-(trifluoro- methyl)imidazo[4,5-b]pyridine (0.28.84), 2-(3-ethylsulfonyl-6-iodo-imidazo[1 ,2-a]pyridin-2- yl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine (0.28.85), 2-[3-ethylsulfonyl-6- (trifluoromethyl)imidazo[1 ,2-a]pyridin-2-yl]-3-methyl-6-(trifluoromethyl)imidazo[4,5- b]pyridine (0.28.86), 2-(7-chloro-3-ethylsulfonyl-imidazo[1 ,2-a]pyridin-2-yl)-3-methyl-6- (trifluoromethyl)imidazo[4,5-b]pyridine (0.28.87), 2-(3-ethylsulfonyl-7-iodo-imidazo[1 ,2- a]pyridin-2-yl)-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine (0.28.88), 3- ethylsulfonyl-6-iodo-2-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]imidazo[1 ,2- a]pyridine-8-carbonitrile (0.28.89), 2-[3-ethylsulfonyl-8-fluoro-6-(trifluoromethyl)imi- dazo[1 ,2-a]pyridin-2-yl]-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine (0.28.90), 2-[3- ethylsulfonyl-7-(trifluoromethyl)imidazo[1 ,2-a]pyridin-2-yl]-3-methyl-6- (trifluoromethylsulfinyl)imidazo[4,5-b]pyridine (0.28.91), 2-[3-ethylsulfonyl-7-
(trifluoromethyl)imidazo[1 ,2-a]pyridin-2-yl]-3-methyl-6-(trifluoromethyl)imidazo[4,5- c]pyridine (0.28.92), 2-(6-bromo-3-ethylsulfonyl-imidazo[1 ,2-a]pyridin-2-yl)-6-(tri- fluoromethyl)pyrazolo[4,3-c]pyridine (0.28.93).
2. The mixture according to claim 1 , comprising a compound I and a compound II in a
synergistically effective amount.
3. The mixture according to claim 1 , comprising a compound I and a compound II in a weight ratio of from 100:1 to 1 :100.
4. A fungicidal mixture comprising as active components
1 ) at least one active compound I as defined in claim 1 , or an N-oxide, or an agriculturally useful salt thereof;
and as component
2) at least one active compound II selected from groups A) to O) as defined for component 2) in claim 1 , or an N-oxide, or an agriculturally useful salt thereof;
and as component
3) at least one active compound III selected from groups A) to O) as defined for component 2) in claim 1 , or an N-oxide, or an agriculturally useful salt thereof;
wherein the at least one active compound III of component 3) is not identical with the at least one active compound II of component 2).
5. The mixture according to claim 4, comprising a compound I and a compound II and a further active compound III in a synergistically effective amount.
6. The mixture according to claim 4, comprising a compound I and a compound II in a weight ratio of from 100:1 to 1 :100, and a compound I and compound III in a weight ratio of from 100:1 to 1 :100.
7. An agrochemical composition, comprising a solvent or solid carrier and a composition
according to any of claims 1 to 6.
8. The agrochemical composition according to claim 7 further comprising seed in an amount of from 1 g to 1000 g active components per 100 kg of seed.
9. Use of the mixture as defined in any of the claims 1 to 6 or of the agrochemical composition as defined in claim 7 for controlling phytopathogenic harmful fungi.
10. A method for controlling phytopathogenic harmful fungi, comprising treating the fungi, their habitat or the seed, the soil or the plants to be protected against fungal attack with an effective amount of the compound I and the compound II and the compound III as defined in any one of claims 1 to 6 or of the composition as defined in claim 7.
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
EP18175961.4 | 2018-06-05 | ||
EP18175961 | 2018-06-05 |
Publications (1)
Publication Number | Publication Date |
---|---|
WO2019233826A1 true WO2019233826A1 (en) | 2019-12-12 |
Family
ID=62567317
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
PCT/EP2019/063813 WO2019233826A1 (en) | 2018-06-05 | 2019-05-28 | Fungicidal mixtures comprising substituted 3-phenyl-5-(trifluoromethyl)-1,2,4-oxadiazoles |
Country Status (2)
Country | Link |
---|---|
AR (1) | AR114915A1 (en) |
WO (1) | WO2019233826A1 (en) |
Cited By (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2022017836A1 (en) * | 2020-07-20 | 2022-01-27 | BASF Agro B.V. | Fungicidal compositions comprising (r)-2-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-1- (1,2,4-triazol-1-yl)propan-2-ol |
WO2022024146A1 (en) * | 2020-07-30 | 2022-02-03 | Rajdhani Petrochemicals Private Limited | Synergistic formulation for plant protective composition comprising prothioconazole |
EP4094579A1 (en) * | 2021-05-28 | 2022-11-30 | Basf Se | Pesticidal mixtures comprising metyltetraprole |
CN116283829A (en) * | 2023-05-11 | 2023-06-23 | 广东工业大学 | Co-crystal with thiadiazole and imidazole structure, and preparation method and application thereof |
Citations (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2015185485A1 (en) * | 2014-06-06 | 2015-12-10 | Basf Se | Use of substituted oxadiazoles for combating phytopathogenic fungi |
WO2017076742A1 (en) * | 2015-11-05 | 2017-05-11 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2017093019A1 (en) * | 2015-12-03 | 2017-06-08 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2018234139A1 (en) * | 2017-06-19 | 2018-12-27 | Basf Se | 2-[[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]aryloxy](thio)acetamides for combating phytopathogenic fungi |
-
2019
- 2019-05-28 WO PCT/EP2019/063813 patent/WO2019233826A1/en active Application Filing
- 2019-06-04 AR ARP190101517A patent/AR114915A1/en unknown
Patent Citations (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2015185485A1 (en) * | 2014-06-06 | 2015-12-10 | Basf Se | Use of substituted oxadiazoles for combating phytopathogenic fungi |
WO2017076742A1 (en) * | 2015-11-05 | 2017-05-11 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2017093019A1 (en) * | 2015-12-03 | 2017-06-08 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2018234139A1 (en) * | 2017-06-19 | 2018-12-27 | Basf Se | 2-[[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]aryloxy](thio)acetamides for combating phytopathogenic fungi |
Non-Patent Citations (1)
Title |
---|
ANON.: "FRAC Code List 2017: Fungicides sorted by mode of action", 1 January 2017 (2017-01-01), pages 1 - 12, XP055486188, Retrieved from the Internet <URL:https://cpb-us-w2.wpmucdn.com/u.osu.edu/dist/b/28945/files/2017/04/frac-code-list-2017-final-1juq211.pdf> [retrieved on 20180620] * |
Cited By (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2022017836A1 (en) * | 2020-07-20 | 2022-01-27 | BASF Agro B.V. | Fungicidal compositions comprising (r)-2-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-1- (1,2,4-triazol-1-yl)propan-2-ol |
WO2022024146A1 (en) * | 2020-07-30 | 2022-02-03 | Rajdhani Petrochemicals Private Limited | Synergistic formulation for plant protective composition comprising prothioconazole |
EP4094579A1 (en) * | 2021-05-28 | 2022-11-30 | Basf Se | Pesticidal mixtures comprising metyltetraprole |
CN116283829A (en) * | 2023-05-11 | 2023-06-23 | 广东工业大学 | Co-crystal with thiadiazole and imidazole structure, and preparation method and application thereof |
CN116283829B (en) * | 2023-05-11 | 2023-08-08 | 广东工业大学 | Co-crystal with thiadiazole and imidazole structure, and preparation method and application thereof |
Also Published As
Publication number | Publication date |
---|---|
AR114915A1 (en) | 2020-10-28 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US20210084902A1 (en) | Fungicidal mixture comprising substituted 3-phenyl-5-(trifluoromethyl)-1,2,4-oxadiazoles | |
AU2020201830B2 (en) | Pesticidal mixture comprising a pyrazole compound and an insecticide | |
US10499644B2 (en) | Substituted oxadiazoles for combating phytopathogenic fungi | |
US10986839B2 (en) | Substituted oxadiazoles for combating phytopathogenic fungi | |
US10674727B2 (en) | Substituted oxadiazoles for combating phytopathogenic fungi | |
US11425910B2 (en) | Substituted oxadiazoles for combating phytopathogenic fungi | |
CA2978037A1 (en) | Quinoline compounds | |
WO2019115511A1 (en) | Fungicidal mixture comprising substituted 3-phenyl-5-(trifluoromethyl)-1,2,4-oxadiazoles | |
WO2019233826A1 (en) | Fungicidal mixtures comprising substituted 3-phenyl-5-(trifluoromethyl)-1,2,4-oxadiazoles | |
US20210084900A1 (en) | Substituted 5-(haloalkyl)-5-hydroxy-isoxazoles for Combating Phytopathogenic Fungi | |
US20190322631A1 (en) | Substituted oxadiazoles for combating phytopathogenic fungi | |
US20190359589A1 (en) | Fungicidal pyridine compounds | |
WO2018219797A1 (en) | Substituted oxadiazoles for combating phytopathogenic fungi | |
WO2018054723A1 (en) | Pyridine compounds for controlling phytopathogenic harmful fungi | |
US11737463B2 (en) | Pyridine and pyrazine compounds | |
WO2019214979A1 (en) | Substituted trifluoromethyloxadiazoles for combating phytopathogenic fungi | |
US20200187500A1 (en) | Pyridine compounds | |
BR122023006472B1 (en) | FUNGICIDAL MIXTURE, AGROCHEMICAL COMPOSITION, USE OF THE FUNGICIDAL MIXTURE AND AGROCHEMICAL COMPOSITION AND METHOD FOR CONTROLING HARMFUL PHYTOPATHOGENIC FUNGI | |
BR122023006481B1 (en) | FUNGICIDAL MIXTURE, AGROCHEMICAL COMPOSITION, USE OF THE FUNGICIDAL MIXTURE AND AGROCHEMICAL COMPOSITION AND METHOD FOR CONTROLING HARMFUL PHYTOPATHOGENIC FUNGI | |
BR122023006485B1 (en) | FUNGICIDAL MIXTURE, AGROCHEMICAL COMPOSITION, USE OF THE FUNGICIDAL MIXTURE AND AGROCHEMICAL COMPOSITION AND METHOD FOR CONTROLING HARMFUL PHYTOPATHOGENIC FUNGI | |
BR122023006505B1 (en) | FUNGICIDAL MIXTURE, AGROCHEMICAL COMPOSITION, USE OF THE FUNGICIDAL MIXTURE AND AGROCHEMICAL COMPOSITION AND METHOD FOR CONTROLING HARMFUL PHYTOPATHOGENIC FUNGI | |
BR122023006460B1 (en) | FUNGICIDAL MIXTURE, AGROCHEMICAL COMPOSITION, USE OF THE FUNGICIDAL MIXTURE AND AGROCHEMICAL COMPOSITION AND METHOD FOR CONTROLING HARMFUL PHYTOPATHOGENIC FUNGI | |
JP2019048865A (en) | Plant disease control composition containing pyridazine compound |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
121 | Ep: the epo has been informed by wipo that ep was designated in this application |
Ref document number: 19730695 Country of ref document: EP Kind code of ref document: A1 |
|
NENP | Non-entry into the national phase |
Ref country code: DE |
|
122 | Ep: pct application non-entry in european phase |
Ref document number: 19730695 Country of ref document: EP Kind code of ref document: A1 |