USD95452S - Design for an apron - Google Patents
Design for an apron Download PDFInfo
- Publication number
- USD95452S USD95452S US D95452 S USD95452 S US D95452S
- Authority
- US
- United States
- Prior art keywords
- apron
- design
- quinn
- wearer
- ada
- Prior art date
Links
- 241000681094 Zingel asper Species 0.000 title description 7
- OYFJQPXVCSSHAI-QFPUQLAESA-N enalapril maleate Chemical compound OC(=O)\C=C/C(O)=O.C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)CC1=CC=CC=C1 OYFJQPXVCSSHAI-QFPUQLAESA-N 0.000 description 1
Images
Description
Des. 95,452
A. QUINN pril 30, 1935.
APRON Filed April 17, l934 GA/vbyyw INVENTOR Patented Apr. 30, 1935 UNITED STATES Des. 95,452
PATENT OFFICE DESIGN FOR AN APRON Ada, Quinn, Ogden, Utah Application April 17, 1934, Serial No. 51,437
Term of patent 7 years The strings fragmentarily shown at the waistline of the apron extend to the length essential to adapt the apron to the size of the wearer.
The panel, which forms the back of the apron when it is put on, extends to the length to fit the size of the wearer.
I claim:
The ornamental design for an apron, as shown and described.
ADA QUINN.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD95452S (en) | Design for an apron | |
| USD94564S (en) | Design for an apron | |
| USD94566S (en) | Design fob an apron | |
| USD94624S (en) | Design for an apron | |
| USD95454S (en) | Design for an apron | |
| USD94628S (en) | Design fob an apron | |
| USD94631S (en) | Design for an apron | |
| USD94625S (en) | Design for an apeon | |
| USD95453S (en) | Design for an apron | |
| GB438035A (en) | Improvements in aprons and bibs | |
| USD94562S (en) | Design fob an apron | |
| USD94563S (en) | Design fob an apron | |
| USD94627S (en) | Design for an apron | |
| USD94630S (en) | Design for an apron | |
| USD94626S (en) | Design for an apron | |
| USD97018S (en) | Design for an apron | |
| USD94565S (en) | Design for an apron | |
| USD100226S (en) | Design fob an apron | |
| USD97017S (en) | Design for an apron | |
| USD94633S (en) | Design fob an apron | |
| USD132924S (en) | Design foe an apron | |
| USD94632S (en) | Design fob an apron | |
| USD97016S (en) | Design for an apron | |
| USD100388S (en) | Design for a glove | |
| USD94623S (en) | Design for an apron |