USD126551S - Design for a door pull or the like - Google Patents
Design for a door pull or the like Download PDFInfo
- Publication number
- USD126551S USD126551S US D126551 S USD126551 S US D126551S
- Authority
- US
- United States
- Prior art keywords
- design
- door pull
- pull
- door
- borchers
- Prior art date
Links
- MXBCYQUALCBQIJ-RYVPXURESA-N (8S,9S,10R,13S,14S,17R)-13-ethyl-17-ethynyl-11-methylidene-1,2,3,6,7,8,9,10,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol;(8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1.C1CC[C@@H]2[C@H]3C(=C)C[C@](CC)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1 MXBCYQUALCBQIJ-RYVPXURESA-N 0.000 description 2
Images
Description
Apri 15, 1941. E BQRCHERS Des. 126,551
DOOR PULL OR THE LIKE Filed Jan. 31, 1941 Ewe/222 b? garifi orakers Patented Apr. 15, 1941 Des,
UNITED STATES PATENT OFFICE DESIGN FOR A DOOR PULL OR THE LIKE Earl Borchers, Rockford, Ill., assignor to American Cabinet Hardware Corporation, Rockford, Ill., a, corporation of Illinois Application January 31, 1941, Serial No. 98,605
Term of patent 7 years To all whom it may concern: Figure 1 is a perspective View of a door pull or Be it known that I, Earl Borchers, a citizen of the like showing my new design. the United States, residing at Rockford, in the Fig. 2 is a front View of the pull shown in Fig. 1. county of Winnebago and State of Illinois, have Fig. 3 is a side view of the pull shown in Fig. 1. invented a new, original, and ornamental De- I claim: sign for a Door Pull or the like, of which the fol- The ornamental design for a door pull or the lowing is a specification, reference being had to like, substantially as shown. the accompanying drawing, forming a part thereof. EARL BORCHERS.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD126551S (en) | Design for a door pull or the like | |
| USD121557S (en) | Design for a hinge or similar article | |
| USD121562S (en) | Design for a drawer pull or similar article | |
| USD130321S (en) | Drawer pull or similar article | |
| USD123853S (en) | Combined drawer pull and escutcheons | |
| USD121559S (en) | Design for a hinge or similar article | |
| USD123854S (en) | Combined cabinet pull and escutcheon | |
| USD118009S (en) | Design for a drawer pull or similar | |
| USD127782S (en) | Design for a drawer pull or the like | |
| USD121560S (en) | Design for a drawer pull or similar article | |
| USD121558S (en) | Design for a knob ob similar article | |
| USD109464S (en) | Design for a drawer pull or similar | |
| USD140766S (en) | Design foe, a catch operator | |
| USD109466S (en) | Design for a drawer pull or similar | |
| USD140760S (en) | Design for a cabinet pull | |
| USD109465S (en) | Design fob a drawer pull or similar | |
| USD140764S (en) | Design for a hinge | |
| USD121561S (en) | Design for a knob or similar article | |
| USD140759S (en) | Design fob a cabinet pull | |
| USD142942S (en) | Design for a drawer pull | |
| USD140761S (en) | Combined drawer pull and escutcheons | |
| USD142943S (en) | Design for a drawer pull | |
| USD140763S (en) | Design for a hinge | |
| USD103758S (en) | Design for a door handle | |
| USD126567S (en) | Design for a sash lift or the like |