USD107540S - Design for a milk pail - Google Patents
Design for a milk pail Download PDFInfo
- Publication number
- USD107540S USD107540S US D107540 S USD107540 S US D107540S
- Authority
- US
- United States
- Prior art keywords
- design
- milk pail
- milk
- pail
- mchale
- Prior art date
Links
- 210000004080 Milk Anatomy 0.000 title description 12
- 239000008267 milk Substances 0.000 title description 12
- 235000013336 milk Nutrition 0.000 title description 12
- AGPKZVBTJJNPAG-CRCLSJGQSA-N D-allo-isoleucine Chemical compound CC[C@H](C)[C@@H](N)C(O)=O AGPKZVBTJJNPAG-CRCLSJGQSA-N 0.000 description 2
- 230000003340 mental Effects 0.000 description 2
Images
Description
Des. 107,540
Dec. 21, 1937.
T. D. M HALE MILK PAIL Filed Sept. '7, 1957 flew/w: a M' HILE IN VENTOR.
Patented Dec. 21, 1937 [De UNITED STATES EXTENT OFFIQE DESIGN FOR A MILK PAIL Thomas D. McHale, Los Angeles, Calif.
Application September '7, 1937, Serial No. 71,494
Term of patent 14 years To all whom it may concern: the accompanying drawing, forming part thereof. Be it known that I, Thomas D. McHale, a citi- The figure is a perspective view of a milk pail, zen of the United States, residing at Los Angeles, showing my new design. in the county of Los Angeles and State of Cali- I claim: fornia, have invented a new, original, and orna- The ornamental design for a milk pail, as mental Design for a Milk Pail, of which the folshown. lowing is a specification, reference being had to THOS. D. MCHALE.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD107540S (en) | Design for a milk pail | |
| USD113351S (en) | Design for a sewing case or similar | |
| USD111793S (en) | Design for a bottle | |
| USD123616S (en) | Design for an automobile | |
| USD130080S (en) | Design for a food teay | |
| USD116194S (en) | Design fob a basket | |
| USD119610S (en) | Design for a chair or the like | |
| USD109634S (en) | Design for a brush or the like | |
| USD112150S (en) | Design for a dispensing cover for a | |
| USD100925S (en) | Design for a skein holder | |
| USD118023S (en) | Design for a handle fob sauce pans | |
| USD110117S (en) | Design for a skillet | |
| USD87707S (en) | Design fob a gabment hanger | |
| USD116193S (en) | Design for a basket | |
| USD77711S (en) | Mattbice selig | |
| USD116380S (en) | Design for a coffee maker | |
| USD122967S (en) | Combined automobile grille guard and lamps | |
| USD87157S (en) | Design fob | |
| USD92788S (en) | Design for a floor lamp | |
| USD110870S (en) | Design fob a bottle | |
| USD111882S (en) | Design fob a lamp | |
| USD97909S (en) | Design for a creamer | |
| USD89954S (en) | Design for a mixing slab | |
| USD116108S (en) | Design for a pillowcase | |
| USD78617S (en) | Design fob a nursery chest |