US6124485A - Process for producing 13-cis retinoic acid - Google Patents
Process for producing 13-cis retinoic acid Download PDFInfo
- Publication number
- US6124485A US6124485A US09/047,700 US4770098A US6124485A US 6124485 A US6124485 A US 6124485A US 4770098 A US4770098 A US 4770098A US 6124485 A US6124485 A US 6124485A
- Authority
- US
- United States
- Prior art keywords
- formula
- magnesium
- butenolide
- lewis acid
- weak base
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 title claims abstract description 39
- 229960005280 isotretinoin Drugs 0.000 title claims description 26
- SHGAZHPCJJPHSC-NUEINMDLSA-N Isotretinoin Chemical compound OC(=O)C=C(C)/C=C/C=C(C)C=CC1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-NUEINMDLSA-N 0.000 title claims 2
- 150000003839 salts Chemical class 0.000 claims abstract description 21
- 239000002841 Lewis acid Substances 0.000 claims abstract description 17
- 150000007517 lewis acids Chemical class 0.000 claims abstract description 17
- SQEBMLCQNJOCBG-HVHJFMEUSA-N (5s)-3-(hydroxymethyl)-5-methoxy-4-methyl-5-[(e)-2-phenylethenyl]furan-2-one Chemical compound C=1C=CC=CC=1/C=C/[C@]1(OC)OC(=O)C(CO)=C1C SQEBMLCQNJOCBG-HVHJFMEUSA-N 0.000 claims abstract description 15
- FBMORZZOJSDNRQ-UHFFFAOYSA-N Demethoxy,B,HCl-Adriamycin Natural products C1C2C(=C)CCCC2(C)CC2(O)C1=C(C)C(=O)O2 FBMORZZOJSDNRQ-UHFFFAOYSA-N 0.000 claims abstract description 15
- JUTMAMXOAOYKHT-UHFFFAOYSA-N karrikinolide Natural products C1=COC=C2OC(=O)C(C)=C21 JUTMAMXOAOYKHT-UHFFFAOYSA-N 0.000 claims abstract description 15
- 239000002904 solvent Substances 0.000 claims abstract description 8
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical group CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 12
- -1 loweralkyl Chemical group 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 11
- 125000000623 heterocyclic group Chemical group 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 9
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- 239000003880 polar aprotic solvent Substances 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 6
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 229910001629 magnesium chloride Inorganic materials 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 239000012454 non-polar solvent Substances 0.000 claims description 3
- 150000003512 tertiary amines Chemical class 0.000 claims description 3
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical group OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 claims description 2
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 claims description 2
- 229910001623 magnesium bromide Inorganic materials 0.000 claims description 2
- ORUIBWPALBXDOA-UHFFFAOYSA-L magnesium fluoride Chemical compound [F-].[F-].[Mg+2] ORUIBWPALBXDOA-UHFFFAOYSA-L 0.000 claims description 2
- 229910001635 magnesium fluoride Inorganic materials 0.000 claims description 2
- BLQJIBCZHWBKSL-UHFFFAOYSA-L magnesium iodide Chemical compound [Mg+2].[I-].[I-] BLQJIBCZHWBKSL-UHFFFAOYSA-L 0.000 claims description 2
- 229910001641 magnesium iodide Inorganic materials 0.000 claims description 2
- BZQRBEVTLZHKEA-UHFFFAOYSA-L magnesium;trifluoromethanesulfonate Chemical compound [Mg+2].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F BZQRBEVTLZHKEA-UHFFFAOYSA-L 0.000 claims description 2
- 101150108015 STR6 gene Proteins 0.000 claims 1
- 150000002431 hydrogen Chemical group 0.000 claims 1
- WNBKPRWWMIPBSH-UHFFFAOYSA-L magnesium;2,2,2-trifluoroacetate Chemical compound [Mg+2].[O-]C(=O)C(F)(F)F.[O-]C(=O)C(F)(F)F WNBKPRWWMIPBSH-UHFFFAOYSA-L 0.000 claims 1
- SHGAZHPCJJPHSC-XFYACQKRSA-N isotretinoin Chemical compound OC(=O)/C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-XFYACQKRSA-N 0.000 description 25
- 239000011541 reaction mixture Substances 0.000 description 14
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 238000007239 Wittig reaction Methods 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 229910001385 heavy metal Inorganic materials 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 125000003282 alkyl amino group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 125000001188 haloalkyl group Chemical group 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000003504 photosensitizing agent Substances 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- CMSYDJVRTHCWFP-UHFFFAOYSA-N triphenylphosphane;hydrobromide Chemical compound Br.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 CMSYDJVRTHCWFP-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 238000006317 isomerization reaction Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 229910052703 rhodium Inorganic materials 0.000 description 2
- 239000010948 rhodium Substances 0.000 description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229910052717 sulfur Chemical group 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- PZGYHDPZANRCSM-PKNBQFBNSA-N (1e)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-ol Chemical compound CC1=C(\C=C\C(C)(O)C=C)C(C)(C)CCC1 PZGYHDPZANRCSM-PKNBQFBNSA-N 0.000 description 1
- CYSGHNMQYZDMIA-UHFFFAOYSA-N 1,3-Dimethyl-2-imidazolidinon Chemical compound CN1CCN(C)C1=O CYSGHNMQYZDMIA-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- XRNPHZPFAWLRNJ-UHFFFAOYSA-N 2-hydroxy-3-methyl-2h-furan-5-one Chemical compound CC1=CC(=O)OC1O XRNPHZPFAWLRNJ-UHFFFAOYSA-N 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 208000002874 Acne Vulgaris Diseases 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 101100386054 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) CYS3 gene Proteins 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- UJUZVVSRNMBGRO-UHFFFAOYSA-N [3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]-triphenylphosphanium Chemical class CC=1CCCC(C)(C)C=1C=CC(C)=CC[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 UJUZVVSRNMBGRO-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 206010000496 acne Diseases 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003302 alkenyloxy group Chemical group 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000005277 alkyl imino group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 description 1
- SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 description 1
- 125000005121 aminocarbonylalkoxy group Chemical group 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 229910052789 astatine Inorganic materials 0.000 description 1
- RYXHOMYVWAEKHL-UHFFFAOYSA-N astatine atom Chemical compound [At] RYXHOMYVWAEKHL-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 150000003842 bromide salts Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 125000005111 carboxyalkoxy group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000012039 electrophile Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000003965 isoxazolidinyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000004043 oxo group Chemical group O=* 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- 238000007699 photoisomerization reaction Methods 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 229930002330 retinoic acid Natural products 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 238000000935 solvent evaporation Methods 0.000 description 1
- 101150035983 str1 gene Proteins 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000005309 thioalkoxy group Chemical group 0.000 description 1
- 229960001727 tretinoin Drugs 0.000 description 1
- AVCVDUDESCZFHJ-UHFFFAOYSA-N triphenylphosphane;hydrochloride Chemical compound [Cl-].C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1 AVCVDUDESCZFHJ-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C403/00—Derivatives of cyclohexane or of a cyclohexene or of cyclohexadiene, having a side-chain containing an acyclic unsaturated part of at least four carbon atoms, this part being directly attached to the cyclohexane or cyclohexene or cyclohexadiene rings, e.g. vitamin A, beta-carotene, beta-ionone
- C07C403/20—Derivatives of cyclohexane or of a cyclohexene or of cyclohexadiene, having a side-chain containing an acyclic unsaturated part of at least four carbon atoms, this part being directly attached to the cyclohexane or cyclohexene or cyclohexadiene rings, e.g. vitamin A, beta-carotene, beta-ionone having side-chains substituted by carboxyl groups or halides, anhydrides, or (thio)esters thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07B—GENERAL METHODS OF ORGANIC CHEMISTRY; APPARATUS THEREFOR
- C07B2200/00—Indexing scheme relating to specific properties of organic compounds
- C07B2200/09—Geometrical isomers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/16—Systems containing only non-condensed rings with a six-membered ring the ring being unsaturated
Definitions
- the present invention relates to a process for producing 13-cis retinoic acid.
- the first step of the reaction involves reacting a Wittig salt having the formula I with a butenolide having the formula II at a temperature of from about -10° to -50° C. in the presence of a strong base, such as a hydroxide or alkoxide, and an organic solvent.
- a strong base such as a hydroxide or alkoxide
- organic solvent such as a hydroxide or alkoxide
- the reaction of the Wittig salt having formula I and the butenolide of formula II produce compounds having the formula III and IV.
- the major product is the 11-cis isomer (formula III).
- the compound having formula III is isomerized to produce a compound having formula IV.
- the isomerization reaction is carried out by treating the compound having formula III with a catalyst in an inert solvent medium.
- the catalyst is typically a compound or complex of palladium or rhodium.
- the catalyst selectively isomerizes the 11-cis double bond in the compound having formula III to the corresponding trans double bond without affecting the 13-cis double bond in order to produce a compound having the formula IV.
- U.S. Pat. No. 5,424,465 describes the use of irradiation in an organic solvent in the presence of a suitable photosensitizer to influence the isomerization of the 11-cis isomer to the 11-trans isomer.
- Disadvantages of this process include, having to recycle mother liquors to affect complete photoisomerization, the use of special equipment, and the removal of residual photosensitizer from the final product.
- the present invention relates to a process for producing 13-cis retinoic acid, also known as isotretinoin.
- the process of the present invention involves reacting a Wittig salt in a solvent in the presence of a weak base and, optionally, a Lewis acid, with a butenolide via a Wittig reaction to produce 13-cis retinoic acid.
- the present invention involves a process for producing isotretinoin.
- the process of the present invention involves reacting a Wittig salt in a solvent, in the presence of a weak base and optionally, a Lewis acid, with a butenolide via a Wittig reaction, to produce isotretinoin.
- the isotretinoin prepared according to the process of the present invention is produced directly from the Wittig reaction.
- the process of the present invention is shown in Scheme I. ##STR2##
- the process of the present invention employs a Wittig salt of the formula I ##STR3## wherein R 1 , R 2 and R 3 are aryl or dialkylamino, and X is halogen or hydrogen sulfate.
- loweralkyl or “alkyl” as used herein refer to straight or branched chain alkyl radicals containing from 1 to 6 carbon atoms including, but not limited to, methyl, ethyl, n-propyl, iso-propyl, n-butyl, iso-butyl, sec-butyl, t-butyl, n-pentyl, 1-methylbutyl, 2,2-dimethylbutyl, 2-methylpentyl, 2,2-dimethylpropyl, n-hexyl and the like.
- dialkylamino refers to R 11 R 12 N-- wherein R 11 and R 12 are independently selected from loweralkyl, for example diethylamino, methyl propylamino, and the like.
- aryl refers to a mono- or bicyclic carbocyclic ring system having one or two aromatic rings including, but not limited to, phenyl, naphthyl, anthryl, phenanthryl, tetrahydronaphthyl, indanyl, indenyl and the like.
- Aryl groups can be unsubstituted or substituted with one, two or three substituents independently selected from loweralkyl, halogen, haloalkyl, hydroxy, hydroxyalkyl, alkenyl, alkenyloxy, alkoxy, alkoxyalkoxy, alkoxycarbonyl, amino, alkylamino, alkylsulfonyl, dialkylamino, aminocarbonyl, aminocarbonylalkoxy, aryl, arylalkyl, arylalkoxy, aryloxy, cyano, nitro, carboxy, cycloalkyl, cycloalkylalkyl, carboxyalkoxy, alkylsulfonylamino, and phenyl.
- substituted aryl examples include 3-chlorophenyl, 3-fluorophenyl, 4-chlorophenyl, 4-fluorophenyl, 3,4-dichlorophenyl, 3-chloro-4-fluoro-phenyl, 4-methylsulfonylphenyl, 4-isopropoxyphenyl, and the like.
- alkoxy refers to R 13 O-- wherein R 13 is a loweralkyl group, as defined above.
- alkoxy include, but are not limited to, ethoxy, tert-butoxy, and the like.
- cycloalkyl refers to an aliphatic ring system having 3 to 10 carbon atoms and 1 to 3 rings including, but not limited to, cyclopropyl, cyclopentyl, cyclohexyl, norbornyl, adamantyl, and the like. Cycloalkyl groups can be unsubstituted or substituted with one, two or three substituents independently selected from loweralkyl, haloalkyl, alkoxy, thioalkoxy, amino, alkylamino, dialkylamino, hydroxy, halo, mercapto, nitro, carboxaldehyde, carboxy, alkoxycarbonyl and carboxamide.
- halogen refers to one of the electronegative elements of group VIIA of the periodic table, such as fluorine, chlorine, bromine, iodine and astatine.
- heterocyclic ring or “heterocyclic” or “heterocycle” as used herein refers to any 3- or 4-membered ring containing a heteroatom selected from oxygen, nitrogen and sulfur; or a 5-, 6- or 7-membered ring containing one, two or three nitrogen atoms; one nitrogen and one sulfur atom; or one nitrogen and one oxygen atom.
- the 5-membered ring has 0-2 double bonds and the 6- and 7-membered ring have 0-3 double bonds.
- the nitrogen heteroatoms can be optionally quaternized.
- heterocyclic also includes bicyclic groups in which any of the above heterocyclic rings is fused to a benzene ring or a cyclohexane ring or another heterocyclic ring (for example, indolyl, quinolyl, isoquinolyl, tetrahydroquinolyl, benzofuryl or benzothienyl and the like).
- Heterocyclics include: azetidinyl, pyrrolyl, pyrrolinyl, pyrrolidinyl, pyrazolyl, pyrazolinyl, pyrazolidinyl, imidazolyl, imidazolinyl, imidazolidinyl, pyridyl, piperidinyl, homopiperidinyl, pyrazinyl, piperazinyl, pyrimidinyl, pyridazinyl, oxazolyl, oxazolidinyl, isoxazolyl, isoxazolidinyl, morpholinyl, thiazolyl, thiazolidinyl, isothiazolyl, isothiazolidinyl, indolyl, quinolinyl, isoquinolinyl, benzimidazolyl, benzothiazolyl, benzoxazolyl, furyl, thienyl and benzothien
- Heterocyclics can be unsubstituted or monosubstituted or disubstituted with substituents independently selected from hydroxy, halo, oxo ( ⁇ O), alkylimino (R*N ⁇ wherein R* is a loweralkyl group), amino, alkylamino, dialkylamino, alkoxy, alkoxyalkoxy, haloalkyl, cycloalkyl, aryl, arylalkyl, --COOH, --SO 3 H and loweralkyl.
- nitrogen containing heterocycles can be N-protected.
- the compound of formula I can be any conventional Wittig salt.
- the compound of formula I is a triphenyl phosphonium chloride or bromide salt.
- the Wittig salt having formula I can be prepared by any method known in the art.
- the Wittig salt can be prepared by reacting vinyl- ⁇ -ionol with triphenylphosphine hydrobromide to give a triphenyl phosphonium bromide salt having the formula I.
- This triphenyl phosphonium bromide salt can be used directly after solvent evaporation to prepare isotretinoin.
- An advantage of the process is that the Wittig salt does not have to be isolated for use. The remaining ingredients required for the synthesis of isotretinoin can be added directly to the reaction vessel used for the synthesis of the Wittig salt.
- the Wittig salt is dissolved in a solvent to form a reaction mixture.
- the solvent is a polar aprotic solvent. Any polar aprotic solvent or mixture of polar aprotic solvents can be used in the process of the present invention.
- polar aprotic solvents examples include, but are not intended to be limited to, methylene chloride, chloroform, acetonitrile, tetrahydrofuran, 1,4-dioxane, N,N'-dimethylformamide, 1-methyl-2-pyrrolidinone, 1,3-dimethyl-2-imidazolidinone, N,N'-dimethylacetamide, and mixtures thereof.
- the solvent can be a mixture of a polar aprotic solvent and a non-polar solvent.
- non-polar solvents examples include, but are not intended to be limited to, toluene and chlorobenzene.
- the Wittig salt of formula I is reacted in a solvent in the presence of a weak base and optionally, a Lewis acid, with a butenolide having the formula II: ##STR4## wherein R 4 and R 5 are independently hydrogen, loweralkyl, alkoxy, cycloalkyl, aryl, or heterocyclic.
- R 4 is methyl and R 5 is hydrogen: ##STR5##
- the order of addition of the weak base, Lewis acid and butenolide to the reaction mixture is not critical.
- an inert atmosphere such as nitrogen, to prevent oxidation of the end product.
- the molar ratio of butenolide to the Wittig salt in the reaction mixture is from about 1:1 to about 10:1, preferably from about 1:1 to about 2:1.
- weak base means a base that has a low percentage ionization in solution.
- weak bases include, but are not intended to be limited to, tertiary amines such as triethylamine, diisopropylethylamine, and N-ethylpiperidine, carbonates, bicarbonates, and acetates of sodium, potassium or cesium.
- the molar ratio of weak base to butenolide in the reaction mixture is from about 2:1 to about 10:1, preferably from about 3:1 to about 7:1.
- Lewis acid can be optionally employed in the process of the present invention.
- the term "Lewis acid” refers to any molecule or ion (called an electrophile) that can combine with another molecule or ion by forming a bond with two electrons to form a second molecule or ion.
- suitable Lewis acids include, but are not intended to be limited to, magnesium chloride, magnesium triflate, magnesium bromide, magnesium trifluroacetate, magnesium iodide, and magnesium fluoride. If a Lewis acid is used in the process of the present invention, it is preferred that prior to the addition of the Lewis acid that the reaction mixture be cooled to a temperature of from about -5° C. to about 15° C.
- the molar ratio of Lewis acid to Wittig salt having formula I in the reaction mixture is from about 1:1 to about 3:1, preferably from about 1.5:1 to about 2.5:1.
- the reaction mixture is stirred at ambient temperature under an inert atmosphere for a period of time of from about 10 hours to about 72 hours, preferably from about 15 hours to about 48 hours. After stirring, the isotretinoin is recovered from the reaction mixture using techniques well known in the art.
- the major product produced is the 11-cis isomer of isotretinoin.
- the stereoselectivity of a conventional Wittig reaction is reversed by reacting the Wittig salt with the butenolide in presence of a weak base to preferentially produce isotretinoin.
- the amount of isotretinoin recovered in the reaction may be increased if a Lewis acid is used in the reaction mixture with the weak base.
- butenolide and a weak base are added to the reaction mixture containing the Wittig salt dissolved in a polar aprotic solvent.
- the resulting suspension is cooled to 0° C., followed by the addition of a Lewis acid.
- the reaction mixture is stirred for about 15 hours at ambient temperature. Isotretinoin is then recovered from the reaction mixture. Because the process of the present invention does not employ any heavy metals or photosensitizer, the quality of the isotretinoin produced as a result of the process is improved.
- Example illustrates the preferred embodiment of the process of the present invention and is not limiting of the specification and claims in any way.
- N,N-dimethylacetamide 300 milliliters (mL)
- 5-hydroxy-4-methyl-2[5H]-furanone 26.81 grams (g)
- triethylamine 164 mL,1.2 moles, 6 equivalents
- 107.26 g 197 mmol
- [3-methyl-5-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4-pentadienyl] triphenyl phosphonium salt The resulting mixture was cooled to 15° C. prior to addition of magnesium chloride (30.03 g, 315 mmol, 1.6 equivalents).
- the reaction mixture was allowed to stir at room temperature for 17 hours.
- the reaction solution was washed with 200 mL of heptane.
- Toluene 100 mL was added and the solution was acidified with 280 mL of 20% by volume HCl .
- the aqueous layer was back-extracted three times, each time with 200 mL of a 9:1 heptane:toluene mixture.
- the combined organic layers were washed with aqueous methanol, water, and then concentrated to give an orange solid.
- Heptane 250 mL was added to the crude solid and the slurry was cooled to 0° C. and then filtered.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Abstract
Description
Claims (8)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US09/047,700 US6124485A (en) | 1998-03-25 | 1998-03-25 | Process for producing 13-cis retinoic acid |
| JP2000537849A JP4532734B2 (en) | 1998-03-25 | 1999-03-23 | Method for producing 13-cis retinoic acid |
| PT99914082T PT1066253E (en) | 1998-03-25 | 1999-03-23 | PROCESS FOR THE PRODUCTION OF 13-CIS-RETINOIC ACID |
| ES99914082T ES2229691T3 (en) | 1998-03-25 | 1999-03-23 | PROCEDURE TO PRODUCE 13-RETINOIC ACID. |
| AT99914082T ATE269847T1 (en) | 1998-03-25 | 1999-03-23 | METHOD FOR PRODUCING 13-CIS RETIN ACID |
| CA002325517A CA2325517A1 (en) | 1998-03-25 | 1999-03-23 | Process for producing 13-cis retinoic acid |
| EP99914082A EP1066253B1 (en) | 1998-03-25 | 1999-03-23 | Process for producing 13-cis retinoic acid |
| PCT/US1999/006385 WO1999048866A1 (en) | 1998-03-25 | 1999-03-23 | Process for producing 13-cis retinoic acid |
| DE69918277T DE69918277T2 (en) | 1998-03-25 | 1999-03-23 | METHOD FOR PRODUCING 13-CIS RETINES |
| US09/484,675 US20010018533A1 (en) | 1998-03-25 | 2000-01-18 | Process for producing 13-cis retinoic acid |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US09/047,700 US6124485A (en) | 1998-03-25 | 1998-03-25 | Process for producing 13-cis retinoic acid |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US09/484,675 Continuation US20010018533A1 (en) | 1998-03-25 | 2000-01-18 | Process for producing 13-cis retinoic acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US6124485A true US6124485A (en) | 2000-09-26 |
Family
ID=21950449
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US09/047,700 Expired - Lifetime US6124485A (en) | 1998-03-25 | 1998-03-25 | Process for producing 13-cis retinoic acid |
| US09/484,675 Abandoned US20010018533A1 (en) | 1998-03-25 | 2000-01-18 | Process for producing 13-cis retinoic acid |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US09/484,675 Abandoned US20010018533A1 (en) | 1998-03-25 | 2000-01-18 | Process for producing 13-cis retinoic acid |
Country Status (9)
| Country | Link |
|---|---|
| US (2) | US6124485A (en) |
| EP (1) | EP1066253B1 (en) |
| JP (1) | JP4532734B2 (en) |
| AT (1) | ATE269847T1 (en) |
| CA (1) | CA2325517A1 (en) |
| DE (1) | DE69918277T2 (en) |
| ES (1) | ES2229691T3 (en) |
| PT (1) | PT1066253E (en) |
| WO (1) | WO1999048866A1 (en) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN104447459A (en) * | 2014-11-28 | 2015-03-25 | 重庆华邦制药有限公司 | Novel crystal form of isotretinoin as well as preparation method and application thereof |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN102558007B (en) * | 2011-12-31 | 2014-02-26 | 湖南师范大学 | A kind of synthetic method of all-trans retinoic acid medicine |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0111325A2 (en) * | 1982-12-10 | 1984-06-20 | F. HOFFMANN-LA ROCHE & CO. Aktiengesellschaft | Process for the preparation of 13-cis-retinoic acid |
| US4556578A (en) * | 1983-06-30 | 1985-12-03 | Mallinckrodt, Inc. | NaCl-Free salt substitute containing potassium chloride, maltodextrin and potassium bitartrate and method of preparation |
| US4556518A (en) * | 1982-12-10 | 1985-12-03 | Hoffmann-La Roche Inc. | Preparation of 13-cis retinoic acid |
| US4916250A (en) * | 1988-10-31 | 1990-04-10 | Loyola University Of Chicago | Phosphonate reagent compositions |
| US5061819A (en) * | 1988-10-31 | 1991-10-29 | Loyola University Of Chicago | Methods for synthesizing phosphonate reagents and retinoids |
| US5191110A (en) * | 1987-05-21 | 1993-03-02 | L'oreal | Process for the synthesis of vitamin A and certain ones of derivatives |
| DE4313089A1 (en) * | 1993-04-22 | 1994-10-27 | Basf Ag | Process for the preparation of 13-(Z)-retinoic acid |
| EP0742204A1 (en) * | 1995-05-12 | 1996-11-13 | LABORATORI MAG S.p.A. | Photochemical method for the preparation of 13-cis-retinoic acid |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP3159413B2 (en) * | 1993-01-20 | 2001-04-23 | 株式会社クラレ | Method for producing 3-substituted-4-hydroxy-2-butenolide |
| JP3599403B2 (en) * | 1995-02-24 | 2004-12-08 | 山之内製薬株式会社 | A new method for producing benzazepine derivatives |
| JPH10298173A (en) * | 1997-04-30 | 1998-11-10 | Kuraray Co Ltd | Method for producing 4-hydroxy-2-butenolides |
-
1998
- 1998-03-25 US US09/047,700 patent/US6124485A/en not_active Expired - Lifetime
-
1999
- 1999-03-23 DE DE69918277T patent/DE69918277T2/en not_active Expired - Fee Related
- 1999-03-23 JP JP2000537849A patent/JP4532734B2/en not_active Expired - Fee Related
- 1999-03-23 AT AT99914082T patent/ATE269847T1/en not_active IP Right Cessation
- 1999-03-23 EP EP99914082A patent/EP1066253B1/en not_active Expired - Lifetime
- 1999-03-23 WO PCT/US1999/006385 patent/WO1999048866A1/en not_active Ceased
- 1999-03-23 CA CA002325517A patent/CA2325517A1/en not_active Abandoned
- 1999-03-23 PT PT99914082T patent/PT1066253E/en unknown
- 1999-03-23 ES ES99914082T patent/ES2229691T3/en not_active Expired - Lifetime
-
2000
- 2000-01-18 US US09/484,675 patent/US20010018533A1/en not_active Abandoned
Patent Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0111325A2 (en) * | 1982-12-10 | 1984-06-20 | F. HOFFMANN-LA ROCHE & CO. Aktiengesellschaft | Process for the preparation of 13-cis-retinoic acid |
| US4556518A (en) * | 1982-12-10 | 1985-12-03 | Hoffmann-La Roche Inc. | Preparation of 13-cis retinoic acid |
| US4556578A (en) * | 1983-06-30 | 1985-12-03 | Mallinckrodt, Inc. | NaCl-Free salt substitute containing potassium chloride, maltodextrin and potassium bitartrate and method of preparation |
| US5191110A (en) * | 1987-05-21 | 1993-03-02 | L'oreal | Process for the synthesis of vitamin A and certain ones of derivatives |
| US4916250A (en) * | 1988-10-31 | 1990-04-10 | Loyola University Of Chicago | Phosphonate reagent compositions |
| US5061819A (en) * | 1988-10-31 | 1991-10-29 | Loyola University Of Chicago | Methods for synthesizing phosphonate reagents and retinoids |
| US4916250B1 (en) * | 1988-10-31 | 1993-06-08 | Univ Loyola Chicago | |
| DE4313089A1 (en) * | 1993-04-22 | 1994-10-27 | Basf Ag | Process for the preparation of 13-(Z)-retinoic acid |
| US5424465A (en) * | 1993-04-22 | 1995-06-13 | Basf Aktiengesellschaft | Preparation of 13-(Z)-retinoic acid |
| EP0742204A1 (en) * | 1995-05-12 | 1996-11-13 | LABORATORI MAG S.p.A. | Photochemical method for the preparation of 13-cis-retinoic acid |
Non-Patent Citations (2)
| Title |
|---|
| Tetrahedron Letters, 29(2):209 212 (1988). * |
| Tetrahedron Letters, 29(2):209-212 (1988). |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN104447459A (en) * | 2014-11-28 | 2015-03-25 | 重庆华邦制药有限公司 | Novel crystal form of isotretinoin as well as preparation method and application thereof |
Also Published As
| Publication number | Publication date |
|---|---|
| DE69918277T2 (en) | 2005-07-14 |
| WO1999048866A1 (en) | 1999-09-30 |
| PT1066253E (en) | 2004-10-29 |
| CA2325517A1 (en) | 1999-09-30 |
| EP1066253B1 (en) | 2004-06-23 |
| DE69918277D1 (en) | 2004-07-29 |
| US20010018533A1 (en) | 2001-08-30 |
| JP2002507596A (en) | 2002-03-12 |
| JP4532734B2 (en) | 2010-08-25 |
| EP1066253A1 (en) | 2001-01-10 |
| ES2229691T3 (en) | 2005-04-16 |
| ATE269847T1 (en) | 2004-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0298404A2 (en) | Sulfon polyenes | |
| US4556518A (en) | Preparation of 13-cis retinoic acid | |
| EP2095875B1 (en) | Homogeneous asymmetric hydrogenation catalyst | |
| JP3585522B2 (en) | Method for producing 13- (Z) -retinoic acid | |
| KR100399512B1 (en) | Cyclic compounds and salts thereof, and methods for their preparation | |
| EP1066253B1 (en) | Process for producing 13-cis retinoic acid | |
| JPH0987258A (en) | Oxazolines, method for producing the same and method for producing asymmetric cyclopropanecarboxylic acid using the same | |
| EP0261911A2 (en) | Process for preparing retinoyl chlorides | |
| RU2448957C2 (en) | Fluorinated catharantine derivatives, their obtaining and application as precursors of dimeric vinca alkaloids | |
| EP0397042B1 (en) | Process for the preparation of isoquinoline derivatives | |
| KR100237525B1 (en) | Method for preparing chiral succinic acid derivative | |
| MXPA00009377A (en) | Process for producing 13-cis retinoic acid | |
| JPS6344544A (en) | Manufacture of dihydrocyclocitral and optically active stereoisomer thereof | |
| DK170945B1 (en) | Process for Preparation of 13-Cisretinoic Acid and Process for Preparing a Palladium Catalyst for Use in the Process | |
| JPH09504019A (en) | Method for producing oxirane, aziridine or cyclopropane | |
| DE60105729T2 (en) | Process for the preparation of retinol and intermediates for this process | |
| Imboden et al. | Preparation of optically active ortho-chloro-and ortho-bromophenyl sulfoxides | |
| JP3418725B2 (en) | Simple method for producing 1,1-bis (4-aminophenyl) ethane | |
| SU586168A1 (en) | Method of isolating a-amino-substituted isomer from mixture of a and b-amino-b(a)alkylthiocarboxylic acid derivatives | |
| JP4591778B2 (en) | Process for producing α, β, γ-substituted cyclopentanone derivatives | |
| JP2003192651A (en) | Method for producing 3-aminocarboxylic acid and its ester | |
| Lee et al. | Stereoselective Halolactonization of $\alpha-Phenylsulfonyl-\gamma,\delta $-Unsaturated Amides | |
| JP2000063351A (en) | Method for producing retinal, intermediate and method for producing the same | |
| JPS59164744A (en) | Preparation of aldehyde from methylthiomethyl aryl sulfone derivative | |
| JP2001139542A (en) | Method for producing β-cyclogeranyl aryl sulfone |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AS | Assignment |
Owner name: ABBOTT LABORATORIES, ILLINOIS Free format text: ASSIGNMENT OF ASSIGNORS INTEREST;ASSIGNORS:WANG, XIU C.;BHATIA, ASHOK V.;HOSSAIN, AZAD;AND OTHERS;REEL/FRAME:009159/0231 Effective date: 19980324 |
|
| STCF | Information on status: patent grant |
Free format text: PATENTED CASE |
|
| CC | Certificate of correction | ||
| FPAY | Fee payment |
Year of fee payment: 4 |
|
| FPAY | Fee payment |
Year of fee payment: 8 |
|
| FPAY | Fee payment |
Year of fee payment: 12 |
|
| AS | Assignment |
Owner name: ABBVIE INC., ILLINOIS Free format text: ASSIGNMENT OF ASSIGNORS INTEREST;ASSIGNOR:ABBOTT LABORATORIES;REEL/FRAME:030167/0103 Effective date: 20120801 |