US3661452A - Xerographic reproduction machine - Google Patents
Xerographic reproduction machine Download PDFInfo
- Publication number
- US3661452A US3661452A US731934A US3661452DA US3661452A US 3661452 A US3661452 A US 3661452A US 731934 A US731934 A US 731934A US 3661452D A US3661452D A US 3661452DA US 3661452 A US3661452 A US 3661452A
- Authority
- US
- United States
- Prior art keywords
- belt
- paper
- illumination device
- original
- latent image
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000005286 illumination Methods 0.000 claims abstract description 16
- 230000004913 activation Effects 0.000 claims 7
- 238000001994 activation Methods 0.000 claims 7
- 230000003213 activating effect Effects 0.000 claims 5
- 239000002245 particle Substances 0.000 claims 4
- 230000000694 effects Effects 0.000 claims 3
- 238000004519 manufacturing process Methods 0.000 claims 1
- 238000003384 imaging method Methods 0.000 abstract description 2
- 108091008695 photoreceptors Proteins 0.000 abstract description 2
- CMSGUKVDXXTJDQ-UHFFFAOYSA-N 4-(2-naphthalen-1-ylethylamino)-4-oxobutanoic acid Chemical compound C1=CC=C2C(CCNC(=O)CCC(=O)O)=CC=CC2=C1 CMSGUKVDXXTJDQ-UHFFFAOYSA-N 0.000 description 1
Images
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G15/00—Apparatus for electrographic processes using a charge pattern
- G03G15/22—Apparatus for electrographic processes using a charge pattern involving the combination of more than one step according to groups G03G13/02 - G03G13/20
- G03G15/26—Apparatus for electrographic processes using a charge pattern involving the combination of more than one step according to groups G03G13/02 - G03G13/20 in which the charge pattern is obtained by projection of the entire image, i.e. whole-frame projection
- G03G15/263—Apparatus for electrographic processes using a charge pattern involving the combination of more than one step according to groups G03G13/02 - G03G13/20 in which the charge pattern is obtained by projection of the entire image, i.e. whole-frame projection using a reusable recording medium in form of a band
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Combination Of More Than One Step In Electrophotography (AREA)
- Exposure Or Original Feeding In Electrophotography (AREA)
- Control Or Security For Electrophotography (AREA)
- Discharging, Photosensitive Material Shape In Electrophotography (AREA)
- Color Electrophotography (AREA)
- Electrostatic Charge, Transfer And Separation In Electrography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US73193468A | 1968-05-24 | 1968-05-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3661452A true US3661452A (en) | 1972-05-09 |
Family
ID=24941504
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US731934A Expired - Lifetime US3661452A (en) | 1968-05-24 | 1968-05-24 | Xerographic reproduction machine |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3661452A (cs) |
| BE (1) | BE733407A (cs) |
| CH (1) | CH491418A (cs) |
| DE (1) | DE1925398A1 (cs) |
| DK (1) | DK125257B (cs) |
| ES (1) | ES367613A1 (cs) |
| FR (1) | FR2009302A1 (cs) |
| GB (1) | GB1264406A (cs) |
| NL (2) | NL6907656A (cs) |
| PL (1) | PL80003B1 (cs) |
Cited By (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3791732A (en) * | 1971-11-17 | 1974-02-12 | Gestetner Copiers Ltd | Electrostatic copier |
| JPS49105539A (cs) * | 1973-01-15 | 1974-10-05 | ||
| US3851966A (en) * | 1972-12-11 | 1974-12-03 | Xerox Corp | Reproduction apparatus |
| US3869203A (en) * | 1973-09-18 | 1975-03-04 | Xerox Corp | Color electrophotographic printing machine |
| US3961849A (en) * | 1970-12-14 | 1976-06-08 | Xerox Corporation | Electrostatic printing machine |
| US3967893A (en) * | 1974-04-29 | 1976-07-06 | Xerox Corporation | Illuminating apparatus |
| US3976375A (en) * | 1972-12-30 | 1976-08-24 | Minolta Camera Kabushiki Kaisha | Electrostatic copying machine |
| US3981576A (en) * | 1973-04-24 | 1976-09-21 | Canon Kabushiki Kaisha | Multicolor electrophotographic copier with liquid developing |
| US3982832A (en) * | 1972-06-23 | 1976-09-28 | Rank Xerox Ltd. | Electrostatographic copying machines |
| JPS51119229A (en) * | 1975-04-11 | 1976-10-19 | Minolta Camera Co Ltd | Electrophotography |
| US4017170A (en) * | 1972-04-13 | 1977-04-12 | Canon Kabushiki Kaisha | Electrophotographic device |
| US4025180A (en) * | 1973-10-30 | 1977-05-24 | Minolta Camera Kabushiki Kaisha | Transfer type electrophotographic copying apparatus |
| FR2345748A1 (fr) * | 1976-03-25 | 1977-10-21 | Pitney Bowes Inc | Machine de reprographie |
| US4095890A (en) * | 1975-06-24 | 1978-06-20 | Oce-Van Der Grinten N.V. | Xerographic copying apparatus |
| JPS5415751A (en) * | 1978-07-12 | 1979-02-05 | Minolta Camera Co Ltd | Start position controller in transfer type electrophotographic copier |
| EP0029953A1 (en) * | 1979-12-03 | 1981-06-10 | International Business Machines Corporation | Electrophotographic copier including a belt photoconductor |
| US4346985A (en) * | 1979-06-25 | 1982-08-31 | Xerox Corporation | Automatic development control |
| US4396274A (en) * | 1979-12-03 | 1983-08-02 | International Business Machines Corporation | Electrophotographic copier configuration |
| US4470693A (en) * | 1982-01-11 | 1984-09-11 | Pitney Bowes Inc. | Self-cleaning xerographic apparatus |
| US4761671A (en) * | 1987-02-02 | 1988-08-02 | Eastman Kodak Company | Electrophotographic subprocess for apparatus using discharged area toning |
| US4809032A (en) * | 1986-12-10 | 1989-02-28 | Kabushiki Kaisha Toshiba | Printing apparatus |
| US4956676A (en) * | 1987-04-16 | 1990-09-11 | Kentek Information Systems, Inc. | Electrographic color printer/copier |
| US5237340A (en) * | 1989-12-21 | 1993-08-17 | Texas Instruments Incorporated | Replaceable elements for xerographic printing process and method of operation |
| US20020085245A1 (en) * | 2001-01-04 | 2002-07-04 | Mennie Douglas U. | Document feeding method and apparatus |
| US20080304111A1 (en) * | 2007-05-10 | 2008-12-11 | L-1 Identity Solutions, Inc | Identification reader |
| US11105366B2 (en) | 2018-06-12 | 2021-08-31 | Haydon Kerk Motion Solutions, Inc. | Long span lead screw assembly with anti-backlash nut and wear compensated load bearing element |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2551582A (en) * | 1943-08-27 | 1951-05-08 | Chester F Carlson | Method of printing and developing solvent images |
| US3146688A (en) * | 1961-05-01 | 1964-09-01 | Xerox Corp | Xerographic machine |
| US3168857A (en) * | 1961-05-01 | 1965-02-09 | Rca Corp | Electrostatic printing |
| US3339469A (en) * | 1962-08-06 | 1967-09-05 | Sun Chemical Corp | Electrostatic printing apparatus |
| US3427658A (en) * | 1966-05-06 | 1969-02-11 | Harris Intertype Corp | Electrophotographic apparatus and method |
-
1968
- 1968-05-24 US US731934A patent/US3661452A/en not_active Expired - Lifetime
-
1969
- 1969-05-19 DE DE19691925398 patent/DE1925398A1/de active Pending
- 1969-05-19 PL PL1969133694A patent/PL80003B1/pl unknown
- 1969-05-20 NL NL6907656A patent/NL6907656A/xx unknown
- 1969-05-21 GB GB1264406D patent/GB1264406A/en not_active Expired
- 1969-05-21 BE BE733407D patent/BE733407A/xx not_active IP Right Cessation
- 1969-05-22 DK DK279369AA patent/DK125257B/da unknown
- 1969-05-22 CH CH784569A patent/CH491418A/de not_active IP Right Cessation
- 1969-05-23 FR FR6917084A patent/FR2009302A1/fr active Pending
- 1969-05-23 ES ES367613A patent/ES367613A1/es not_active Expired
-
1981
- 1981-02-20 NL NL8100856A patent/NL8100856A/nl active Search and Examination
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2551582A (en) * | 1943-08-27 | 1951-05-08 | Chester F Carlson | Method of printing and developing solvent images |
| US3146688A (en) * | 1961-05-01 | 1964-09-01 | Xerox Corp | Xerographic machine |
| US3168857A (en) * | 1961-05-01 | 1965-02-09 | Rca Corp | Electrostatic printing |
| US3339469A (en) * | 1962-08-06 | 1967-09-05 | Sun Chemical Corp | Electrostatic printing apparatus |
| US3427658A (en) * | 1966-05-06 | 1969-02-11 | Harris Intertype Corp | Electrophotographic apparatus and method |
Cited By (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3961849A (en) * | 1970-12-14 | 1976-06-08 | Xerox Corporation | Electrostatic printing machine |
| US3791732A (en) * | 1971-11-17 | 1974-02-12 | Gestetner Copiers Ltd | Electrostatic copier |
| US4017170A (en) * | 1972-04-13 | 1977-04-12 | Canon Kabushiki Kaisha | Electrophotographic device |
| US3982832A (en) * | 1972-06-23 | 1976-09-28 | Rank Xerox Ltd. | Electrostatographic copying machines |
| US3851966A (en) * | 1972-12-11 | 1974-12-03 | Xerox Corp | Reproduction apparatus |
| US3976375A (en) * | 1972-12-30 | 1976-08-24 | Minolta Camera Kabushiki Kaisha | Electrostatic copying machine |
| US3860338A (en) * | 1973-01-15 | 1975-01-14 | Xerox Corp | Adjustable fadeout control |
| JPS49105539A (cs) * | 1973-01-15 | 1974-10-05 | ||
| US3981576A (en) * | 1973-04-24 | 1976-09-21 | Canon Kabushiki Kaisha | Multicolor electrophotographic copier with liquid developing |
| US3869203A (en) * | 1973-09-18 | 1975-03-04 | Xerox Corp | Color electrophotographic printing machine |
| US4025180A (en) * | 1973-10-30 | 1977-05-24 | Minolta Camera Kabushiki Kaisha | Transfer type electrophotographic copying apparatus |
| US3967893A (en) * | 1974-04-29 | 1976-07-06 | Xerox Corporation | Illuminating apparatus |
| JPS51119229A (en) * | 1975-04-11 | 1976-10-19 | Minolta Camera Co Ltd | Electrophotography |
| US4095890A (en) * | 1975-06-24 | 1978-06-20 | Oce-Van Der Grinten N.V. | Xerographic copying apparatus |
| US4084901A (en) * | 1976-03-25 | 1978-04-18 | Pitney-Bowes, Inc. | Copying machine |
| FR2345748A1 (fr) * | 1976-03-25 | 1977-10-21 | Pitney Bowes Inc | Machine de reprographie |
| JPS5415751A (en) * | 1978-07-12 | 1979-02-05 | Minolta Camera Co Ltd | Start position controller in transfer type electrophotographic copier |
| US4346985A (en) * | 1979-06-25 | 1982-08-31 | Xerox Corporation | Automatic development control |
| EP0029953A1 (en) * | 1979-12-03 | 1981-06-10 | International Business Machines Corporation | Electrophotographic copier including a belt photoconductor |
| US4396274A (en) * | 1979-12-03 | 1983-08-02 | International Business Machines Corporation | Electrophotographic copier configuration |
| US4470693A (en) * | 1982-01-11 | 1984-09-11 | Pitney Bowes Inc. | Self-cleaning xerographic apparatus |
| US4809032A (en) * | 1986-12-10 | 1989-02-28 | Kabushiki Kaisha Toshiba | Printing apparatus |
| US4761671A (en) * | 1987-02-02 | 1988-08-02 | Eastman Kodak Company | Electrophotographic subprocess for apparatus using discharged area toning |
| US4956676A (en) * | 1987-04-16 | 1990-09-11 | Kentek Information Systems, Inc. | Electrographic color printer/copier |
| US5237340A (en) * | 1989-12-21 | 1993-08-17 | Texas Instruments Incorporated | Replaceable elements for xerographic printing process and method of operation |
| US20020085245A1 (en) * | 2001-01-04 | 2002-07-04 | Mennie Douglas U. | Document feeding method and apparatus |
| US6798899B2 (en) * | 2001-01-04 | 2004-09-28 | Cummins-Allison Corp. | Document feeding method and apparatus |
| US20080304111A1 (en) * | 2007-05-10 | 2008-12-11 | L-1 Identity Solutions, Inc | Identification reader |
| US8493630B2 (en) * | 2007-05-10 | 2013-07-23 | L-I Indentity Solutions, Inc. | Identification reader |
| US9007664B2 (en) | 2007-05-10 | 2015-04-14 | Morphotrust Usa, Llc | Identification reader |
| US11105366B2 (en) | 2018-06-12 | 2021-08-31 | Haydon Kerk Motion Solutions, Inc. | Long span lead screw assembly with anti-backlash nut and wear compensated load bearing element |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2009302A1 (cs) | 1970-01-30 |
| BE733407A (cs) | 1969-11-21 |
| ES367613A1 (es) | 1971-04-16 |
| NL8100856A (nl) | 1981-07-01 |
| PL80003B1 (cs) | 1975-08-30 |
| DE1925398A1 (de) | 1969-12-18 |
| DK125257B (da) | 1973-01-22 |
| NL6907656A (cs) | 1969-11-26 |
| GB1264406A (cs) | 1972-02-23 |
| CH491418A (de) | 1970-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3661452A (en) | Xerographic reproduction machine | |
| US3672765A (en) | Apparatus for making two-sided copies from two images on an original | |
| US3914043A (en) | Color accenting copying machine | |
| US3865482A (en) | Electrostatographic copying machine | |
| US3580670A (en) | Apparatus for duplexing | |
| US3775102A (en) | Method of electrostatically copying information on both sides of an original onto both sides of a support material | |
| US3754822A (en) | Scanning system | |
| US3606532A (en) | Photoelectrostatic duplicator | |
| GB1168085A (en) | Improved Electrophotographic Apparatus | |
| US4251154A (en) | Electrophotographic color copier | |
| US3685896A (en) | Duplicating method and apparatus | |
| US3536398A (en) | Reproduction apparatus | |
| GB1103161A (en) | Electrophotographic apparatus | |
| GB1403218A (en) | Method and apparatus for electrostatic reproduction | |
| US3795442A (en) | Electroprinting device | |
| GB1454152A (en) | Electrographic apparatus | |
| US4027960A (en) | Transfer system for electrostatic reproduction machine | |
| US3649114A (en) | Multiple output electrostatic recording system | |
| US3848204A (en) | Pressure adjustable electrophotographic printing machine transfer apparatus | |
| CA1114003A (en) | Duplex reproduction machine | |
| US4537493A (en) | Copy sheet positioning apparatus | |
| US4884106A (en) | Multi-image reproduction apparatus | |
| US4111540A (en) | Field lens for an electrophotographic printing machine | |
| US3635554A (en) | Exposure system | |
| US3620618A (en) | Multiple input copying apparatus |