US3216894A - Phosphonic acid esters and process for their production - Google Patents
Phosphonic acid esters and process for their production Download PDFInfo
- Publication number
- US3216894A US3216894A US17487A US1748760A US3216894A US 3216894 A US3216894 A US 3216894A US 17487 A US17487 A US 17487A US 1748760 A US1748760 A US 1748760A US 3216894 A US3216894 A US 3216894A
- Authority
- US
- United States
- Prior art keywords
- grams
- methyl
- mol
- compounds
- oil
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 title claims description 6
- 150000003008 phosphonic acid esters Chemical class 0.000 title description 6
- 238000004519 manufacturing process Methods 0.000 title description 2
- 241000238631 Hexapoda Species 0.000 claims description 5
- FUWGSUOSJRCEIV-UHFFFAOYSA-N phosphonothioic O,O-acid Chemical compound OP(O)=S FUWGSUOSJRCEIV-UHFFFAOYSA-N 0.000 claims description 3
- 231100000331 toxic Toxicity 0.000 claims description 2
- 230000002588 toxic effect Effects 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 description 25
- 239000000243 solution Substances 0.000 description 19
- 239000003921 oil Substances 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 150000002148 esters Chemical class 0.000 description 9
- 241000255925 Diptera Species 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 241001454295 Tetranychidae Species 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 230000009885 systemic effect Effects 0.000 description 5
- 241001124076 Aphididae Species 0.000 description 4
- WJXGTMBHOPEHGM-UHFFFAOYSA-N Cl.CCOP(C)(O)=S Chemical compound Cl.CCOP(C)(O)=S WJXGTMBHOPEHGM-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- -1 phosphonic acid halides Chemical class 0.000 description 4
- 150000003014 phosphoric acid esters Chemical class 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000000749 insecticidal effect Effects 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- UQFHLJKWYIJISA-UHFFFAOYSA-N 2,6-dimethyl-1h-pyrimidin-4-one Chemical compound CC1=CC(O)=NC(C)=N1 UQFHLJKWYIJISA-UHFFFAOYSA-N 0.000 description 2
- POSYYXPJEOGSCW-UHFFFAOYSA-N 2-ethyl-6-methyl-5-sulfanyl-1h-pyrimidin-4-one Chemical compound CCC1=NC(=O)C(S)=C(C)N1 POSYYXPJEOGSCW-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- WEQVLSZDHCLFPN-UHFFFAOYSA-N COP(C)(O)=S.Cl Chemical compound COP(C)(O)=S.Cl WEQVLSZDHCLFPN-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical class CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 230000003151 ovacidal effect Effects 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- FHTDDANQIMVWKZ-UHFFFAOYSA-N 1h-pyridine-4-thione Chemical compound SC1=CC=NC=C1 FHTDDANQIMVWKZ-UHFFFAOYSA-N 0.000 description 1
- SYOANZBNGDEJFH-UHFFFAOYSA-N 2,5-dihydro-1h-triazole Chemical compound C1NNN=C1 SYOANZBNGDEJFH-UHFFFAOYSA-N 0.000 description 1
- GYKVPGKWYHTMTM-UHFFFAOYSA-N 2,6-dimethyl-1h-pyrimidine-4-thione Chemical compound CC1=CC(S)=NC(C)=N1 GYKVPGKWYHTMTM-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- ZMEVDFFLOPFGCR-UHFFFAOYSA-N 4-methyl-3h-1,3-thiazol-2-one Chemical compound CC1=CSC(O)=N1 ZMEVDFFLOPFGCR-UHFFFAOYSA-N 0.000 description 1
- UXIWLHNMLDJWMF-UHFFFAOYSA-N 4-phenyl-3h-1,3-thiazol-2-one Chemical compound S1C(O)=NC(C=2C=CC=CC=2)=C1 UXIWLHNMLDJWMF-UHFFFAOYSA-N 0.000 description 1
- HCADPDLQEAZJJN-UHFFFAOYSA-N 6-methyl-1h-pyrimidine-4-thione Chemical compound CC1=CC(=S)N=CN1 HCADPDLQEAZJJN-UHFFFAOYSA-N 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 1
- 241001425390 Aphis fabae Species 0.000 description 1
- MHOWCHQNHPCPOE-UHFFFAOYSA-N CCP(O)(OC)=S.Cl Chemical compound CCP(O)(OC)=S.Cl MHOWCHQNHPCPOE-UHFFFAOYSA-N 0.000 description 1
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- 241000257159 Musca domestica Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical class OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- BADXJIPKFRBFOT-UHFFFAOYSA-N dimedone Chemical compound CC1(C)CC(=O)CC(=O)C1 BADXJIPKFRBFOT-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- LJFSZDRPNLUQMV-UHFFFAOYSA-N oxolane-2,3-dione Chemical class O=C1CCOC1=O LJFSZDRPNLUQMV-UHFFFAOYSA-N 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000009183 running Effects 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N57/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic phosphorus compounds
- A01N57/18—Biocides, pest repellants or attractants, or plant growth regulators containing organic phosphorus compounds having phosphorus-to-carbon bonds
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N57/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic phosphorus compounds
- A01N57/18—Biocides, pest repellants or attractants, or plant growth regulators containing organic phosphorus compounds having phosphorus-to-carbon bonds
- A01N57/24—Biocides, pest repellants or attractants, or plant growth regulators containing organic phosphorus compounds having phosphorus-to-carbon bonds containing heterocyclic radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/40—Esters thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/40—Esters thereof
- C07F9/4003—Esters thereof the acid moiety containing a substituent or a structure which is considered as characteristic
- C07F9/4018—Esters of cycloaliphatic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/40—Esters thereof
- C07F9/4071—Esters thereof the ester moiety containing a substituent or a structure which is considered as characteristic
- C07F9/4078—Esters with unsaturated acyclic alcohols
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/645—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having two nitrogen atoms as the only ring hetero atoms
- C07F9/6509—Six-membered rings
- C07F9/650905—Six-membered rings having the nitrogen atoms in the positions 1 and 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/645—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having two nitrogen atoms as the only ring hetero atoms
- C07F9/6509—Six-membered rings
- C07F9/6512—Six-membered rings having the nitrogen atoms in positions 1 and 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6515—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having three nitrogen atoms as the only ring hetero atoms
- C07F9/6518—Five-membered rings
Definitions
- the present invention relates to and has as its objects new and useful phosphonic acid esters and processes for their production.
- the new compound of this invention may be called phosphonic acid esters of the enolic ester type and thus they may be represented by the following formula
- R stands for aliphatic or aromatic radicals
- R stands for aliphatic radicals
- X and Y stand for oxygen or sulfur
- Z stands for further atoms necessary to complete a compound which is able to react in the ketoor enol-form, and which in the instant case as said above is present in the state of the enolic ester type.
- Phosphoric acid esters of the above mentioned type recently have become of importance of the insecticidal or generally pesticidal type.
- US. Patents No. 2,754,243 and No. 2,854,244 a number of compounds have been described which may .be considered as somewhat related to the above said formula with the exception that instead of phosphoric acid esters the compounds of the present invention are derivatives of the phosphonic acid ester type.
- the new and valuable class of insecticidal phosphonic acid esters can be obtained by reacting enolisable ketoor thioketo-compounds with O- alkyl-thionophosphonic acid halides or phosphonic acid halides.
- enolisable ketoor thioketo-compounds belong above all to the heterocyclic group and are for example (the designation means in the following either the enolor keto-form,'the notation which has become most familiar in organic chemistry): dioxotetra hydrofuran derivatives, and pyrazolones, such as e.g.,
- enolisable are likewise suitable for the process of the present invention.
- aceto-acetic acid esters and amides malonic esters, malonic ester seminitriles, halo-acetoacetic acid amides
- chloro-acetic esters chloro-malonic esters
- di-. hydroresorcinols such as, e.g., 5.5-dialkyl-dihydroresorcinol and similar compounds or their thio-analogues
- the reaction is preferably carried out with the alkali metal salts of enolates or with enolates in the presence of alkali metal hydroxides in inert organic solvents at room temperature or slightly elevated temperature.
- the new compounds are valuable insecticides, which for the most part possess the advantage over the corresponding phosphoric acid esters, that they are sometimes more readily crystallizable andtherefore simpler in handling and in formulation.
- the invention concerns compounds which are new insecticides which in part are effective against resistant forms of insect pests.
- the compounds obtained according to the invention are preferably applied in combination with the usual extending or diluent agents, as known for other phosphoric acid esters.
- the usual extending or diluent agents as known for other phosphoric acid esters.
- liquid combinations it is expedient to use commercial emulsifiers for improved distribution of the active compounds-especially in water.
- the compounds of the following formulae have been tested against aphids. and flies respectively.
- Aqueous solutions of the aforementioned compounds have been prepared by admixing them with the same amount of an auxiliary solvent (acetone).
- a commercial emulsifier (benzyl hydroxy diphenyl polgylcol ether) is added in an amount of 20% referred to active ingredient. This premixture then is diluted with water to the desired concentration.
- the tests have been carried out as follows: (a) against aphids (species Doralis fabae).
- Heavily infested bean plants (Vitia faba) have been sprayed drip wet with solution of Compound I prepared as indicated above in a concentration of 0.01%. The effect has been determined by evaluation after 24 hours by counting the dead pests either on the surface of the soil or still remaining on the plants, thereby complete killing has been obtained; (b) against flies (Musca domestica). About 50 flies are placed under covered petri dishes in which drop wet filter paper has been placed which is sprayed with an insecticidal solution of Compound II prepared as shown above in a concentration of 0.00001%. The living status of the flies has been determined after 24 hours, and complete killing has been obtained.
- the product is filtered ofi with suction, the filtrate poured into water and the oil taken up in benzene. After washing with water and drying over sodium sulfate and distilling oil the solvent 70 grams of a pale yellow oil are obtained, the oil being no longer distillable. Yield: 78.8% of the theoretical. The same ester is obtained if pyridine is used as solvent and acid-binding agent. The yield is then also 78-79% of the theoretical. Spider mites are killed completely With 0.01% solutions. Systemic action with 0.1% solutions: 100%. The compound shows an ovicidal action.
- a phosphonic acid ester of the following formula 5 R1 X I wherein R stands for a member selected from the group consisting of phenyl, chlorophenyl, cyclohexyl, lower alkenyl, lower-alkoxy-lower-alkenylene and lower alkyl having up to 8 carbon atoms, R stands for lower alkyl having up to 4 carbon atoms, X and Y stand for members selected from the group consisting of oxygen and sulfur, R stands for lower alkyl having up to 4 carbon atoms and R stands for a member selected from the group consisting of lower alkyl having up to 4 carbon atoms and lower alkylmercapto having up to 4 carbon atoms.
- the method of controlling insects which comprises contacting the insects with a toxic amount of a phosphonothioate of the structure IRVING MARCUS, MORRIS O. WOLK, WALTER A.
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Biochemistry (AREA)
- Molecular Biology (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Plant Pathology (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF28060A DE1140580B (de) | 1959-03-28 | 1959-03-28 | Verfahren zur Herstellung von Thionophosphonsaeureestern |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3216894A true US3216894A (en) | 1965-11-09 |
Family
ID=7092725
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US17487A Expired - Lifetime US3216894A (en) | 1959-03-28 | 1960-03-25 | Phosphonic acid esters and process for their production |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3216894A (pm) |
| BE (1) | BE589122A (pm) |
| CH (1) | CH387004A (pm) |
| DE (1) | DE1140580B (pm) |
| GB (1) | GB926234A (pm) |
| NL (2) | NL249896A (pm) |
Cited By (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3325492A (en) * | 1964-03-26 | 1967-06-13 | Bayer Ag | Thiophosphoric (-phosphonic, -phosphinic) or dithiophosphoric (-phosphonic, -phosphinic) acid esters |
| US3336314A (en) * | 1964-12-02 | 1967-08-15 | Mobil Oil Corp | O-quinolinyl s-alkyl-alkylphos-phonodithioates |
| US3384540A (en) * | 1965-07-14 | 1968-05-21 | Stauffer Chemical Co | Pesticidal compositions and methods containing phosphorous-containing esters of 2-thiomethyl mercapto pyrimidines |
| US3700686A (en) * | 1969-03-14 | 1972-10-24 | Bayer Ag | O-alkyl-o-pyrazolyl-phosphoric, phosphonic, thionophosphoric and thionophosphonic acid esters |
| US3700687A (en) * | 1969-04-05 | 1972-10-24 | Bayer Ag | (thiono) phosphoric (phosphonic)-acid esters |
| US3723456A (en) * | 1970-10-09 | 1973-03-27 | Bayer Ag | Pyrazolo-(thiono)phosphoric(phosphonic) acid esters |
| FR2162589A1 (pm) * | 1971-12-10 | 1973-07-20 | Ciba Geigy Ag | |
| US3759941A (en) * | 1965-08-20 | 1973-09-18 | Sankyo Co | Insecticidal isoxazole derivatives |
| US3775057A (en) * | 1969-02-24 | 1973-11-27 | Petrolite Corp | Use as corrosion inhibitors, nitrogen-heterocyclic phosphonates |
| US3862170A (en) * | 1970-10-22 | 1975-01-21 | Ciba Geigy Corp | Triazolylphosphoric acid esters |
| US3862124A (en) * | 1970-10-22 | 1975-01-21 | Ciba Geigy Corp | Triazolylthiophosphoric acid esters |
| US3880584A (en) * | 1971-08-19 | 1975-04-29 | Petrolite Corp | Use as corrosion inhibitors:acridine phosphoric compounds |
| US3880997A (en) * | 1965-05-26 | 1975-04-29 | Bayer Ag | Insecticidal and acaricidal phosphorous-containing esters of 2-hydroxyquinoxaline |
| US3888626A (en) * | 1971-08-19 | 1975-06-10 | Petrolite Corp | Use as corrosion inhibitors: phenanthridine phosphonic compounds |
| US3952098A (en) * | 1970-07-30 | 1976-04-20 | Bayer Aktiengesellschaft | Compositions and methods of combatting insects and acarids using pyrazolo-(thiono)-phosphoric(phosphonic) acid esters |
| US3980777A (en) * | 1974-07-02 | 1976-09-14 | Bayer Aktiengesellschaft | O-alkyl-O-[2-alkylthio-imidazol(4)yl](thiono)-phosphoric(phosphonic) acid esters and ester-amides |
| US4014996A (en) * | 1974-08-24 | 1977-03-29 | Bayer Aktiengesellschaft | O-Alkyl-O-pyrimidin (2)yl-thionophosphonic acid esters |
| US4035487A (en) * | 1973-09-10 | 1977-07-12 | Ciba-Geigy Corporation | Pesticidal 2-phenyl-1,2,3-triazolyl-(4) and-triazox-(1)-yl-(4) phosphate and thiosphosphate esters |
| US4059696A (en) * | 1975-05-27 | 1977-11-22 | Bayer Aktiengesellschaft | Pyrimidine (4,6)diyl-bis-(thiono)(thiol)-phosphoric(phosphonic)acid esters |
| US4104375A (en) * | 1977-02-24 | 1978-08-01 | Stauffer Chemical Company | Isoxazole phosphates and phosphonates |
| US4115542A (en) * | 1976-05-20 | 1978-09-19 | Bayer Aktiengesellschaft | O-Alkyl-O-(6-alkanesulphonyloxy-pyrimidin(4)yl)-(thiono) (thiol) phosphoric (phosphonic) acid esters and ester-amides and arthropodicidal compositions and methods of combating arthropods using them |
| US4155999A (en) * | 1976-09-02 | 1979-05-22 | Bayer Aktiengesellschaft | Pesticidally active O-alkyl-O-[6-tert.-butyl-pyrimidin(4)yl]-(thiono)(thiol)-phosphoric(phosphonic) acid esters |
| US4159323A (en) * | 1976-05-03 | 1979-06-26 | Bayer Aktiengesellschaft | O,O'-Dialkyl-4,6-diphosphorylated pyrimidines and compositions and methods for combating arthropods containing them |
| US4163052A (en) * | 1976-09-01 | 1979-07-31 | Bayer Aktiengesellschaft | Pesticidal O-[3-t-butylpyrazol-5-yl]phosphoric and thionophosphoric acid esters |
| US4168304A (en) * | 1977-01-27 | 1979-09-18 | Bayer Aktiengesellschaft | Combating pests with 4-substituted-pyrimidin-6-yl (thiono)-phosphoric (phosphonic) acid esters or ester amides |
| EP0007466A1 (de) * | 1978-07-15 | 1980-02-06 | Bayer Ag | 2-Cyclopropyl-pyrimidin(4)yl-thionophosphonsäureester, Verfahren zu ihrer Herstellung, ihre Verwendung als Insektizide und Akarizide, diese enthaltende Schädlingsbekämpfungsmittel und Verfahren zu deren Herstellung |
| US4940698A (en) * | 1987-09-02 | 1990-07-10 | Bayer Aktiengesellschaft | Insecticidal thionophosphonates |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2343931A1 (de) * | 1973-08-31 | 1975-04-03 | Bayer Ag | Pyrimidin(4)-yl-(thiono)-(thiol)-phosphor(phosphon)-saeureester bzw. -esteramide, verfahren zu ihrer herstellung sowie ihre verwendung als insetktizide und akarizide |
| AU511744B2 (en) * | 1976-09-25 | 1980-09-04 | Bayer Aktiengesellschaft | Pyrimidin(5)yl-(thiono) (thiol) phosporic-(phosphonic) acid esters and ester-amides |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE637016A (pm) * | 1951-04-20 | 1900-01-01 | ||
| US2867646A (en) * | 1956-04-09 | 1959-01-06 | Shell Dev | Complex arylphosphonates |
| BE568698A (pm) * | 1957-06-24 |
-
0
- NL NL126404D patent/NL126404C/xx active
- BE BE589122D patent/BE589122A/xx unknown
- NL NL249896D patent/NL249896A/xx unknown
-
1959
- 1959-03-28 DE DEF28060A patent/DE1140580B/de active Pending
-
1960
- 1960-03-24 CH CH332360A patent/CH387004A/de unknown
- 1960-03-25 US US17487A patent/US3216894A/en not_active Expired - Lifetime
- 1960-03-28 GB GB10946/60A patent/GB926234A/en not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3325492A (en) * | 1964-03-26 | 1967-06-13 | Bayer Ag | Thiophosphoric (-phosphonic, -phosphinic) or dithiophosphoric (-phosphonic, -phosphinic) acid esters |
| US3336314A (en) * | 1964-12-02 | 1967-08-15 | Mobil Oil Corp | O-quinolinyl s-alkyl-alkylphos-phonodithioates |
| US3880997A (en) * | 1965-05-26 | 1975-04-29 | Bayer Ag | Insecticidal and acaricidal phosphorous-containing esters of 2-hydroxyquinoxaline |
| US3384540A (en) * | 1965-07-14 | 1968-05-21 | Stauffer Chemical Co | Pesticidal compositions and methods containing phosphorous-containing esters of 2-thiomethyl mercapto pyrimidines |
| US3759941A (en) * | 1965-08-20 | 1973-09-18 | Sankyo Co | Insecticidal isoxazole derivatives |
| US3775057A (en) * | 1969-02-24 | 1973-11-27 | Petrolite Corp | Use as corrosion inhibitors, nitrogen-heterocyclic phosphonates |
| US3700686A (en) * | 1969-03-14 | 1972-10-24 | Bayer Ag | O-alkyl-o-pyrazolyl-phosphoric, phosphonic, thionophosphoric and thionophosphonic acid esters |
| US3700687A (en) * | 1969-04-05 | 1972-10-24 | Bayer Ag | (thiono) phosphoric (phosphonic)-acid esters |
| US3952098A (en) * | 1970-07-30 | 1976-04-20 | Bayer Aktiengesellschaft | Compositions and methods of combatting insects and acarids using pyrazolo-(thiono)-phosphoric(phosphonic) acid esters |
| US3723456A (en) * | 1970-10-09 | 1973-03-27 | Bayer Ag | Pyrazolo-(thiono)phosphoric(phosphonic) acid esters |
| US3862170A (en) * | 1970-10-22 | 1975-01-21 | Ciba Geigy Corp | Triazolylphosphoric acid esters |
| US3862124A (en) * | 1970-10-22 | 1975-01-21 | Ciba Geigy Corp | Triazolylthiophosphoric acid esters |
| US3880584A (en) * | 1971-08-19 | 1975-04-29 | Petrolite Corp | Use as corrosion inhibitors:acridine phosphoric compounds |
| US3888626A (en) * | 1971-08-19 | 1975-06-10 | Petrolite Corp | Use as corrosion inhibitors: phenanthridine phosphonic compounds |
| FR2162589A1 (pm) * | 1971-12-10 | 1973-07-20 | Ciba Geigy Ag | |
| US4035487A (en) * | 1973-09-10 | 1977-07-12 | Ciba-Geigy Corporation | Pesticidal 2-phenyl-1,2,3-triazolyl-(4) and-triazox-(1)-yl-(4) phosphate and thiosphosphate esters |
| US3980777A (en) * | 1974-07-02 | 1976-09-14 | Bayer Aktiengesellschaft | O-alkyl-O-[2-alkylthio-imidazol(4)yl](thiono)-phosphoric(phosphonic) acid esters and ester-amides |
| US4014996A (en) * | 1974-08-24 | 1977-03-29 | Bayer Aktiengesellschaft | O-Alkyl-O-pyrimidin (2)yl-thionophosphonic acid esters |
| US4059696A (en) * | 1975-05-27 | 1977-11-22 | Bayer Aktiengesellschaft | Pyrimidine (4,6)diyl-bis-(thiono)(thiol)-phosphoric(phosphonic)acid esters |
| US4159323A (en) * | 1976-05-03 | 1979-06-26 | Bayer Aktiengesellschaft | O,O'-Dialkyl-4,6-diphosphorylated pyrimidines and compositions and methods for combating arthropods containing them |
| US4115542A (en) * | 1976-05-20 | 1978-09-19 | Bayer Aktiengesellschaft | O-Alkyl-O-(6-alkanesulphonyloxy-pyrimidin(4)yl)-(thiono) (thiol) phosphoric (phosphonic) acid esters and ester-amides and arthropodicidal compositions and methods of combating arthropods using them |
| US4163052A (en) * | 1976-09-01 | 1979-07-31 | Bayer Aktiengesellschaft | Pesticidal O-[3-t-butylpyrazol-5-yl]phosphoric and thionophosphoric acid esters |
| US4155999A (en) * | 1976-09-02 | 1979-05-22 | Bayer Aktiengesellschaft | Pesticidally active O-alkyl-O-[6-tert.-butyl-pyrimidin(4)yl]-(thiono)(thiol)-phosphoric(phosphonic) acid esters |
| US4168304A (en) * | 1977-01-27 | 1979-09-18 | Bayer Aktiengesellschaft | Combating pests with 4-substituted-pyrimidin-6-yl (thiono)-phosphoric (phosphonic) acid esters or ester amides |
| US4104375A (en) * | 1977-02-24 | 1978-08-01 | Stauffer Chemical Company | Isoxazole phosphates and phosphonates |
| EP0007466A1 (de) * | 1978-07-15 | 1980-02-06 | Bayer Ag | 2-Cyclopropyl-pyrimidin(4)yl-thionophosphonsäureester, Verfahren zu ihrer Herstellung, ihre Verwendung als Insektizide und Akarizide, diese enthaltende Schädlingsbekämpfungsmittel und Verfahren zu deren Herstellung |
| US4254113A (en) * | 1978-07-15 | 1981-03-03 | Bayer Aktiengesellschaft | Combating arthropods with O-Alkyl-O-(2-cyclopropyl-6-methyl-pyrimidin-4-yl)-thionophosphonic acid esters |
| US4940698A (en) * | 1987-09-02 | 1990-07-10 | Bayer Aktiengesellschaft | Insecticidal thionophosphonates |
Also Published As
| Publication number | Publication date |
|---|---|
| BE589122A (pm) | 1900-01-01 |
| GB926234A (en) | 1963-05-15 |
| NL249896A (pm) | 1900-01-01 |
| CH387004A (de) | 1965-01-31 |
| NL126404C (pm) | 1900-01-01 |
| DE1140580B (de) | 1962-12-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3216894A (en) | Phosphonic acid esters and process for their production | |
| US3019250A (en) | Thiophosphoric acid esters and a process for their production | |
| US3205231A (en) | Phosphoric, phosphonic, thionophosphoric or thionophosphinic acid esters | |
| US3092649A (en) | Thiophosphoric acid esters and process for their production | |
| US4140774A (en) | Method of combating nematodes using S-(amidocarbonyl)-methyl-O-alkyl-mono(di)thiophosphoric acid ester amides | |
| US3205238A (en) | Thenyl phosphorothioates | |
| US3371095A (en) | Thio-or dithio-phosphoric (-phosphonic or-phosphinic) acid esters and processes for the production thereof | |
| US3202658A (en) | Thionophosphonic acid esters and a process for their production | |
| US3284455A (en) | Phosphonic and thionophosphonic quinolyl esters | |
| US3151146A (en) | Phosphonic and phosphinic acid esters of alpha- and beta-naphthols and processes for heir production | |
| US3018301A (en) | Dithiophosphonic acid amides and process for their production | |
| US3164623A (en) | O-cyanophenyl esters of alkylphosphonic, alkylthiophosphonic, dialkylphosphinic, anddialkylthiophosphinic acids | |
| US3320261A (en) | Pyridyl and quinolyl mercapto methyl phosphorus esters | |
| US4582825A (en) | 2-(substituted phenyl)-3-chloro-2-butene thio phosphates as insecticides | |
| US3094550A (en) | Thio- and dithio-phosphorus and alkyl esters and process for the production thereof | |
| US3060217A (en) | Thiophosphoric acid esters | |
| US3248459A (en) | Thiol-phosphoric, -phosphonic, -phosphinic or thionothiol-phosphoric, -phosphonic, -phosphinic acid esters and processes for the production thereof | |
| US3121662A (en) | (thiono)-thiolphosphonic and-thiolphosphinic acid esters and a process for their production | |
| US3171853A (en) | S-benzylthiomethyl neutral esters of thiophosphorus pentavalent acids | |
| US2983748A (en) | Thionophosphonic acid esters | |
| US4035490A (en) | Insecticide compositions | |
| US2680132A (en) | Process for making neutral esters of selenophosphoric acid | |
| US2931824A (en) | Thiophosphoric acid esters and their production | |
| US4612306A (en) | Oximinophosphoric acid derivatives and their use for controlling pests | |
| US3277216A (en) | Thiol- or thionothiolphosphoric (-phosphonic, -phosphinic) acid esters |