US2114214A - Self-propelling projectile - Google Patents
Self-propelling projectile Download PDFInfo
- Publication number
- US2114214A US2114214A US67403A US6740336A US2114214A US 2114214 A US2114214 A US 2114214A US 67403 A US67403 A US 67403A US 6740336 A US6740336 A US 6740336A US 2114214 A US2114214 A US 2114214A
- Authority
- US
- United States
- Prior art keywords
- charge
- powder
- combustion
- elements
- envelope
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000843 powder Substances 0.000 description 21
- 238000002485 combustion reaction Methods 0.000 description 19
- 229910052751 metal Inorganic materials 0.000 description 11
- 230000008018 melting Effects 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- 229910000634 wood's metal Inorganic materials 0.000 description 5
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 3
- 229910052797 bismuth Inorganic materials 0.000 description 3
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 3
- 230000008030 elimination Effects 0.000 description 3
- 238000003379 elimination reaction Methods 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 235000015842 Hesperis Nutrition 0.000 description 2
- 235000012633 Iberis amara Nutrition 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 229910052793 cadmium Inorganic materials 0.000 description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 229910001234 light alloy Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910001092 metal group alloy Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 229910001261 rose's metal Inorganic materials 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- SYOKIDBDQMKNDQ-XWTIBIIYSA-N vildagliptin Chemical compound C1C(O)(C2)CC(C3)CC1CC32NCC(=O)N1CCC[C@H]1C#N SYOKIDBDQMKNDQ-XWTIBIIYSA-N 0.000 description 1
Images
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B15/00—Self-propelled projectiles or missiles, e.g. rockets; Guided missiles
Definitions
- the present invention relates to self-propelling projectiles,.that is to say projectiles which are l provided, in addition to their specic charge,
- the invention is more especially, al- 10 though not exclusively, concerned, among projectiles of this kind, with rockets.
- the object of the present invention is to provide a projectile of the kind above referred to which is better adapted to meet the requirements of practice, and in which, in particular, the combustion of the propelling charge contained in the projectile isutilized with an improved efficiency.
- the essential feature of the present invention consists in devising the envelope of a projectile of the type above referred to in such manner that the length of said envelope is gradually reduced as the propelling charge is being gradually burnt.
- Other features of the present invention will result from the following detailed description of 25 some specific embodiments thereof.
- Fig. 1 is anelevatlonal view, partly in section, of a rocket made according to an embodiment of the present invention
- Figs. 2 and 3 are views, similar to Fig. 1, relating to other embodiments.
- I further provide, in the direction of the axis of each chamber I, 2, 3, or 4, a nozzle 5, consisting of a cavity or recess, preferably of the shape of a frustum of a cone, the dimensions of which will be moreparticularly referred to in what follows, said nozzleubeing intended to facilitate the propagation of combustion in the charge.
- the 4respective chambers i, 2, 3 and 4 are separated from one another by means of annular elements 6, made for instance of cardboard, which prevent premature ignition of the successive charges of -said chambers.
- the charges may consist of any 4suitable matters, for instance powder.
- said envelope or cartridge is devised in such manner that its length is gradually reduced as the propelling charge that it contains is being burnt.
- the cartridge or envelope is constituted by the mere juxtaposition of annular elements 1, of copper for instance, said elements being kept in position owing to the cohesion of the charge of powder they surround.v
- the combustion of the charge of powder produces the successive elimination of annular elements 1.
- Rose's metal (1 part of tin, 1 of lead, 2 of bis- -muth) the melting point of which is 110;
- Woods metal (4 parts of tin, 8 of lead, 15' of bismuth and 4 of cadmium), the melting point of which is 70 C.;
- Lipowitz metal (4 parts of tin, 2 of lead, 16
- I may, fo
- annular parts separating the envelope into a plurality of elements said annular separating parts being made of one of these metals.
- the elements 8, 9, I0 and Il ofthe envelope are made of Woods metal.
- elements of the cartridge or envelope made of any metal consisting, as shown by Fig. 3, of four sleeves 8', 9', I0', Il' of copper, ⁇ or preferably of magnesium or of a light alloy oi.' this metal, said sleeves being connected with one another and with the nose of the rocket by annular elements made, at least partly, of Woods metal.
- Nozzle 5 must then be given a size .such that the particles of powder in contact with ring I4' given oiby the vvexhaust gases ensure a continuous or discontinuous elimination of these elements.
- the projectile above described may further includel any suitable stabilizing device, such for instance as ribs or ns which are carried either by the elements intended to be eliminated, or by the portion of said projectile that is intended to remainas long as said projectile is moving along its path oi.'I travel.
- any suitable stabilizing device such for instance as ribs or ns which are carried either by the elements intended to be eliminated, or by the portion of said projectile that is intended to remainas long as said projectile is moving along its path oi.'I travel.
- combustion chambers may include a number of combustion chambers as high as it is desired;
- a rocket according to the present invention may be combined with various devices, such, for example
- the projectile might include not l.
- a rocket having a charge of powder divided into a plurality of parts, each of such parts having a recess therein, a casing surrounding said parts and formed of a plurality of metallic elements associated with the respective charge 'parts I may also, according to another embodiment.
- a rocket having a. charge, of powder dividedr into a vplurality of parta-each of such parts having a recess therein, a casing surrounding said parts and formed of a plurality of metallic eleausgew o! the powder forming the charge. and iniusible rings joining said elements, said recesses being so located in each part-oi' the charge that between the recess and thewall of the fusible metallic element there is a layer of powder of suiicient thickness to prevent the melting of each fusible metallic element until the part of the charge ring there is a. layer of powder oi suicient thickness to prevent the melting of leach fusible ring until the part of the charge which is contained in the corresponding influsible section has been substantially completely burned.
Landscapes
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Aviation & Aerospace Engineering (AREA)
- Combustion & Propulsion (AREA)
- General Engineering & Computer Science (AREA)
- Aiming, Guidance, Guns With A Light Source, Armor, Camouflage, And Targets (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE2114214X | 1935-03-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US2114214A true US2114214A (en) | 1938-04-12 |
Family
ID=3895609
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US67403A Expired - Lifetime US2114214A (en) | 1935-03-09 | 1936-03-05 | Self-propelling projectile |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US2114214A (enFirst) |
| BE (1) | BE408330A (enFirst) |
| FR (1) | FR803021A (enFirst) |
Cited By (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2424934A (en) * | 1944-11-17 | 1947-07-29 | Melvin E Kasper | Projectile |
| US2454096A (en) * | 1943-05-11 | 1948-11-16 | Schermuly Pistol Rocket App | Means for discharging rockets |
| US2600678A (en) * | 1949-03-11 | 1952-06-17 | Olin Ind Inc | Rocket powder |
| US2749705A (en) * | 1951-01-03 | 1956-06-12 | Gen Electric | Fusible link jet motor control |
| US2920443A (en) * | 1955-05-25 | 1960-01-12 | Higginson John | Rocket propellant grain with helically grooved perforation |
| US2956401A (en) * | 1959-06-12 | 1960-10-18 | Ernest M Kane | Variable thrust rocket motor |
| US3000597A (en) * | 1951-08-15 | 1961-09-19 | Alfred J Bell | Rocket-propelled missile |
| US3017746A (en) * | 1958-06-16 | 1962-01-23 | Phillips Petroleum Co | Disposable elastic rocket case |
| US3032970A (en) * | 1957-01-25 | 1962-05-08 | Phillips Petroleum Co | Disposable rocket motor |
| US3043221A (en) * | 1958-06-02 | 1962-07-10 | Frank H Swanser | Rocket propulsion method and means |
| US3067575A (en) * | 1959-01-02 | 1962-12-11 | Thompson Ramo Wooldridge Inc | Disposable rocket motor |
| US3122884A (en) * | 1961-05-19 | 1964-03-03 | Atlantic Res Corp | Rocket motor |
| US3137126A (en) * | 1961-01-11 | 1964-06-16 | North American Aviation Inc | Method and means for forming a gaseous passage |
| US3142959A (en) * | 1959-09-11 | 1964-08-04 | Phillips Petroleum Co | Range control of self propelled missile |
| US3151559A (en) * | 1961-06-20 | 1964-10-06 | Schermuly Pistol Rocket App | Pyrotechnic propellant charge |
| US3172255A (en) * | 1961-09-26 | 1965-03-09 | United Aircraft Corp | Ignition device |
| US3175497A (en) * | 1962-02-20 | 1965-03-30 | United Aircraft Corp | Segmented rocket engine |
| US3199406A (en) * | 1961-06-21 | 1965-08-10 | Mb Assoc | In-line launching |
| US3250216A (en) * | 1960-01-26 | 1966-05-10 | Zissimos A Typaldos | Autophage rocket |
| US3292302A (en) * | 1964-09-14 | 1966-12-20 | Estes Ind | Multistage model rocket |
| US3319520A (en) * | 1965-06-23 | 1967-05-16 | Trw Inc | High speed low shock separation system |
| US3369365A (en) * | 1965-10-18 | 1968-02-20 | Henry A. Olson | Solid propellant rocket motor |
| US3397638A (en) * | 1961-03-08 | 1968-08-20 | Mb Assoc | Rocket launcher |
| US3517615A (en) * | 1961-07-14 | 1970-06-30 | Us Navy | Explosive wave shaper |
| US3554078A (en) * | 1969-02-10 | 1971-01-12 | Joseph S Horvath | Spherical missile and launching means therefor |
| US3611935A (en) * | 1969-10-31 | 1971-10-12 | Us Navy | Small caliber dual colored signal flare |
| US3811380A (en) * | 1958-01-30 | 1974-05-21 | Cava Ind | Rocket and propellant therefor |
| US4723736A (en) * | 1986-08-18 | 1988-02-09 | Todd Rider | Rocket staging system |
| US4930421A (en) * | 1988-07-11 | 1990-06-05 | The Boeing Company | Partitioned, fluid supported, high efficiency traveling charge for hyper-velocity guns |
| US5172875A (en) * | 1988-03-30 | 1992-12-22 | Israel Fried | Space launcher and method for launching objects into space |
| US6148610A (en) * | 1997-06-16 | 2000-11-21 | Aerospatiale Societe Nationale Industrielle | Solid propellant charge for a propulsion unit and propulsion unit equipped with such a charge |
| WO2001038711A1 (en) * | 1999-11-23 | 2001-05-31 | Technanogy, Llc | End-burning rocket motor |
| US7254936B1 (en) * | 2004-04-26 | 2007-08-14 | Knight Andrew F | Simple solid propellant rocket engine and super-staged rocket |
| WO2013001267A1 (en) * | 2011-06-28 | 2013-01-03 | Mbda Uk Limited | A bomb for deployment from an air vehicle |
| EP2602466A1 (en) * | 2011-12-07 | 2013-06-12 | MBDA UK Limited | A bomb for deployment from an air vehicle |
| RU2509909C1 (ru) * | 2012-07-10 | 2014-03-20 | Юрий Дмитриевич Сасов | Реактивный двигатель |
-
0
- BE BE408330D patent/BE408330A/xx unknown
-
1936
- 1936-03-05 US US67403A patent/US2114214A/en not_active Expired - Lifetime
- 1936-03-07 FR FR803021D patent/FR803021A/fr not_active Expired
Cited By (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2454096A (en) * | 1943-05-11 | 1948-11-16 | Schermuly Pistol Rocket App | Means for discharging rockets |
| US2424934A (en) * | 1944-11-17 | 1947-07-29 | Melvin E Kasper | Projectile |
| US2600678A (en) * | 1949-03-11 | 1952-06-17 | Olin Ind Inc | Rocket powder |
| US2749705A (en) * | 1951-01-03 | 1956-06-12 | Gen Electric | Fusible link jet motor control |
| US3000597A (en) * | 1951-08-15 | 1961-09-19 | Alfred J Bell | Rocket-propelled missile |
| US2920443A (en) * | 1955-05-25 | 1960-01-12 | Higginson John | Rocket propellant grain with helically grooved perforation |
| US3032970A (en) * | 1957-01-25 | 1962-05-08 | Phillips Petroleum Co | Disposable rocket motor |
| US3811380A (en) * | 1958-01-30 | 1974-05-21 | Cava Ind | Rocket and propellant therefor |
| US3043221A (en) * | 1958-06-02 | 1962-07-10 | Frank H Swanser | Rocket propulsion method and means |
| US3017746A (en) * | 1958-06-16 | 1962-01-23 | Phillips Petroleum Co | Disposable elastic rocket case |
| US3067575A (en) * | 1959-01-02 | 1962-12-11 | Thompson Ramo Wooldridge Inc | Disposable rocket motor |
| US2956401A (en) * | 1959-06-12 | 1960-10-18 | Ernest M Kane | Variable thrust rocket motor |
| US3142959A (en) * | 1959-09-11 | 1964-08-04 | Phillips Petroleum Co | Range control of self propelled missile |
| US3250216A (en) * | 1960-01-26 | 1966-05-10 | Zissimos A Typaldos | Autophage rocket |
| US3137126A (en) * | 1961-01-11 | 1964-06-16 | North American Aviation Inc | Method and means for forming a gaseous passage |
| US3397638A (en) * | 1961-03-08 | 1968-08-20 | Mb Assoc | Rocket launcher |
| US3122884A (en) * | 1961-05-19 | 1964-03-03 | Atlantic Res Corp | Rocket motor |
| US3151559A (en) * | 1961-06-20 | 1964-10-06 | Schermuly Pistol Rocket App | Pyrotechnic propellant charge |
| US3199406A (en) * | 1961-06-21 | 1965-08-10 | Mb Assoc | In-line launching |
| US3517615A (en) * | 1961-07-14 | 1970-06-30 | Us Navy | Explosive wave shaper |
| US3172255A (en) * | 1961-09-26 | 1965-03-09 | United Aircraft Corp | Ignition device |
| US3175497A (en) * | 1962-02-20 | 1965-03-30 | United Aircraft Corp | Segmented rocket engine |
| US3292302A (en) * | 1964-09-14 | 1966-12-20 | Estes Ind | Multistage model rocket |
| US3319520A (en) * | 1965-06-23 | 1967-05-16 | Trw Inc | High speed low shock separation system |
| US3369365A (en) * | 1965-10-18 | 1968-02-20 | Henry A. Olson | Solid propellant rocket motor |
| US3554078A (en) * | 1969-02-10 | 1971-01-12 | Joseph S Horvath | Spherical missile and launching means therefor |
| US3611935A (en) * | 1969-10-31 | 1971-10-12 | Us Navy | Small caliber dual colored signal flare |
| US4723736A (en) * | 1986-08-18 | 1988-02-09 | Todd Rider | Rocket staging system |
| US5172875A (en) * | 1988-03-30 | 1992-12-22 | Israel Fried | Space launcher and method for launching objects into space |
| US4930421A (en) * | 1988-07-11 | 1990-06-05 | The Boeing Company | Partitioned, fluid supported, high efficiency traveling charge for hyper-velocity guns |
| US6148610A (en) * | 1997-06-16 | 2000-11-21 | Aerospatiale Societe Nationale Industrielle | Solid propellant charge for a propulsion unit and propulsion unit equipped with such a charge |
| WO2001038711A1 (en) * | 1999-11-23 | 2001-05-31 | Technanogy, Llc | End-burning rocket motor |
| US7254936B1 (en) * | 2004-04-26 | 2007-08-14 | Knight Andrew F | Simple solid propellant rocket engine and super-staged rocket |
| WO2013001267A1 (en) * | 2011-06-28 | 2013-01-03 | Mbda Uk Limited | A bomb for deployment from an air vehicle |
| US8910576B2 (en) | 2011-06-28 | 2014-12-16 | Mbda Uk Limited | Bomb for deployment from an air vehicle |
| EP2602466A1 (en) * | 2011-12-07 | 2013-06-12 | MBDA UK Limited | A bomb for deployment from an air vehicle |
| RU2509909C1 (ru) * | 2012-07-10 | 2014-03-20 | Юрий Дмитриевич Сасов | Реактивный двигатель |
Also Published As
| Publication number | Publication date |
|---|---|
| BE408330A (enFirst) | |
| FR803021A (fr) | 1936-09-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2114214A (en) | Self-propelling projectile | |
| US2724237A (en) | Rocket projectile having discrete flight initiating and sustaining chambers | |
| US4106411A (en) | Incendiary fragmentation warhead | |
| US1376316A (en) | Projectile | |
| US2354451A (en) | Cartridge or shell for chain shot | |
| US2627160A (en) | Rocket igniter | |
| US2703960A (en) | Rocket | |
| JP4758421B2 (ja) | カートリッジ式弾薬、特に中口径カートリッジ式弾薬 | |
| US4353301A (en) | Smoke grenade | |
| US3049080A (en) | Rockets and rocket-borne distress signals | |
| US2972948A (en) | Shaped charge projectile | |
| US3439613A (en) | Self-propelled hollow charge having concave liner with propellant contained therein | |
| US2423837A (en) | Primer | |
| US1669969A (en) | Gun cartridge | |
| US3397638A (en) | Rocket launcher | |
| CH272168A (de) | Rakete. | |
| US4669383A (en) | Propellant charge igniter | |
| US3162127A (en) | Delay train for fuze | |
| US2115608A (en) | Projectile | |
| US2364643A (en) | Explosive projectile | |
| US1756079A (en) | Mortar shell | |
| US3494285A (en) | Tracer projectile for rifles | |
| US1897948A (en) | Hand grenade or aerial bomb | |
| US2759326A (en) | Powder reactor including a perforated conical grid | |
| US1899618A (en) | Cartridge |