US20180153863A1 - Methods of treating solid tumors using nanoparticle mtor inhibitor combination therapy - Google Patents
Methods of treating solid tumors using nanoparticle mtor inhibitor combination therapy Download PDFInfo
- Publication number
- US20180153863A1 US20180153863A1 US15/737,943 US201615737943A US2018153863A1 US 20180153863 A1 US20180153863 A1 US 20180153863A1 US 201615737943 A US201615737943 A US 201615737943A US 2018153863 A1 US2018153863 A1 US 2018153863A1
- Authority
- US
- United States
- Prior art keywords
- sirolimus
- inhibitor
- nanoparticles
- individual
- effective amount
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000002105 nanoparticle Substances 0.000 title claims abstract description 489
- 239000003628 mammalian target of rapamycin inhibitor Substances 0.000 title claims abstract description 275
- 229940124302 mTOR inhibitor Drugs 0.000 title claims abstract description 273
- 238000000034 method Methods 0.000 title claims abstract description 249
- 206010028980 Neoplasm Diseases 0.000 title claims abstract description 115
- 238000002648 combination therapy Methods 0.000 title description 37
- 229960002930 sirolimus Drugs 0.000 claims abstract description 376
- 239000000203 mixture Substances 0.000 claims abstract description 331
- QFJCIRLUMZQUOT-HPLJOQBZSA-N sirolimus Chemical compound C1C[C@@H](O)[C@H](OC)C[C@@H]1C[C@@H](C)[C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@](O)(O2)[C@H](C)CC[C@H]2C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(C)=C/[C@@H](C)C(=O)C1 QFJCIRLUMZQUOT-HPLJOQBZSA-N 0.000 claims abstract description 320
- ZAHRKKWIAAJSAO-UHFFFAOYSA-N rapamycin Natural products COCC(O)C(=C/C(C)C(=O)CC(OC(=O)C1CCCCN1C(=O)C(=O)C2(O)OC(CC(OC)C(=CC=CC=CC(C)CC(C)C(=O)C)C)CCC2C)C(C)CC3CCC(O)C(C3)OC)C ZAHRKKWIAAJSAO-UHFFFAOYSA-N 0.000 claims abstract description 318
- 239000003814 drug Substances 0.000 claims abstract description 302
- 102000009027 Albumins Human genes 0.000 claims abstract description 295
- 108010088751 Albumins Proteins 0.000 claims abstract description 295
- 229940124597 therapeutic agent Drugs 0.000 claims abstract description 156
- 229940079593 drug Drugs 0.000 claims abstract description 144
- 238000011282 treatment Methods 0.000 claims abstract description 52
- 239000002955 immunomodulating agent Substances 0.000 claims description 157
- 229940121354 immunomodulator Drugs 0.000 claims description 157
- 230000002584 immunomodulator Effects 0.000 claims description 157
- 206010005003 Bladder cancer Diseases 0.000 claims description 142
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 claims description 128
- 201000005112 urinary bladder cancer Diseases 0.000 claims description 128
- 239000003276 histone deacetylase inhibitor Substances 0.000 claims description 119
- 229940121372 histone deacetylase inhibitor Drugs 0.000 claims description 118
- 229940043355 kinase inhibitor Drugs 0.000 claims description 118
- 239000003757 phosphotransferase inhibitor Substances 0.000 claims description 118
- 208000006265 Renal cell carcinoma Diseases 0.000 claims description 102
- 201000001441 melanoma Diseases 0.000 claims description 61
- 229960000688 pomalidomide Drugs 0.000 claims description 58
- UVSMNLNDYGZFPF-UHFFFAOYSA-N pomalidomide Chemical compound O=C1C=2C(N)=CC=CC=2C(=O)N1C1CCC(=O)NC1=O UVSMNLNDYGZFPF-UHFFFAOYSA-N 0.000 claims description 58
- 229940076838 Immune checkpoint inhibitor Drugs 0.000 claims description 53
- 102000037984 Inhibitory immune checkpoint proteins Human genes 0.000 claims description 53
- 108091008026 Inhibitory immune checkpoint proteins Proteins 0.000 claims description 53
- 239000012274 immune-checkpoint protein inhibitor Substances 0.000 claims description 53
- 229960004942 lenalidomide Drugs 0.000 claims description 43
- GOTYRUGSSMKFNF-UHFFFAOYSA-N lenalidomide Chemical compound C1C=2C(N)=CC=CC=2C(=O)N1C1CCC(=O)NC1=O GOTYRUGSSMKFNF-UHFFFAOYSA-N 0.000 claims description 43
- 238000011301 standard therapy Methods 0.000 claims description 38
- 239000000090 biomarker Substances 0.000 claims description 10
- 230000004044 response Effects 0.000 claims description 8
- 230000002349 favourable effect Effects 0.000 claims description 5
- 230000004075 alteration Effects 0.000 claims description 4
- 230000003442 weekly effect Effects 0.000 claims description 3
- 239000002245 particle Substances 0.000 description 83
- MLDQJTXFUGDVEO-UHFFFAOYSA-N BAY-43-9006 Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=CC(NC(=O)NC=3C=C(C(Cl)=CC=3)C(F)(F)F)=CC=2)=C1 MLDQJTXFUGDVEO-UHFFFAOYSA-N 0.000 description 57
- 239000005511 L01XE05 - Sorafenib Substances 0.000 description 57
- 229960003787 sorafenib Drugs 0.000 description 57
- 229940022399 cancer vaccine Drugs 0.000 description 56
- 238000009566 cancer vaccine Methods 0.000 description 56
- 229960003452 romidepsin Drugs 0.000 description 53
- OHRURASPPZQGQM-GCCNXGTGSA-N romidepsin Chemical group O1C(=O)[C@H](C(C)C)NC(=O)C(=C/C)/NC(=O)[C@H]2CSSCC\C=C\[C@@H]1CC(=O)N[C@H](C(C)C)C(=O)N2 OHRURASPPZQGQM-GCCNXGTGSA-N 0.000 description 53
- OHRURASPPZQGQM-UHFFFAOYSA-N romidepsin Natural products O1C(=O)C(C(C)C)NC(=O)C(=CC)NC(=O)C2CSSCCC=CC1CC(=O)NC(C(C)C)C(=O)N2 OHRURASPPZQGQM-UHFFFAOYSA-N 0.000 description 53
- 108010091666 romidepsin Proteins 0.000 description 53
- 239000005536 L01XE08 - Nilotinib Substances 0.000 description 49
- 229960001346 nilotinib Drugs 0.000 description 49
- HHZIURLSWUIHRB-UHFFFAOYSA-N nilotinib Chemical group C1=NC(C)=CN1C1=CC(NC(=O)C=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)=CC(C(F)(F)F)=C1 HHZIURLSWUIHRB-UHFFFAOYSA-N 0.000 description 49
- 229940121358 tyrosine kinase inhibitor Drugs 0.000 description 47
- 239000005483 tyrosine kinase inhibitor Substances 0.000 description 47
- 150000004917 tyrosine kinase inhibitor derivatives Chemical class 0.000 description 47
- -1 interferon-lambda Proteins 0.000 description 46
- 102000003964 Histone deacetylase Human genes 0.000 description 44
- 108090000353 Histone deacetylase Proteins 0.000 description 44
- HKVAMNSJSFKALM-GKUWKFKPSA-N Everolimus Chemical compound C1C[C@@H](OCCO)[C@H](OC)C[C@@H]1C[C@@H](C)[C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@](O)(O2)[C@H](C)CC[C@H]2C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(C)=C/[C@@H](C)C(=O)C1 HKVAMNSJSFKALM-GKUWKFKPSA-N 0.000 description 42
- 238000002560 therapeutic procedure Methods 0.000 description 33
- NWIBSHFKIJFRCO-WUDYKRTCSA-N Mytomycin Chemical compound C1N2C(C(C(C)=C(N)C3=O)=O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 NWIBSHFKIJFRCO-WUDYKRTCSA-N 0.000 description 32
- 201000011510 cancer Diseases 0.000 description 32
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 32
- 239000003112 inhibitor Substances 0.000 description 32
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 32
- 201000010099 disease Diseases 0.000 description 29
- MQHIQUBXFFAOMK-UHFFFAOYSA-N pazopanib hydrochloride Chemical compound Cl.C1=CC2=C(C)N(C)N=C2C=C1N(C)C(N=1)=CC=NC=1NC1=CC=C(C)C(S(N)(=O)=O)=C1 MQHIQUBXFFAOMK-UHFFFAOYSA-N 0.000 description 28
- 230000000306 recurrent effect Effects 0.000 description 28
- 229960005486 vaccine Drugs 0.000 description 28
- CBPNZQVSJQDFBE-FUXHJELOSA-N Temsirolimus Chemical compound C1C[C@@H](OC(=O)C(C)(CO)CO)[C@H](OC)C[C@@H]1C[C@@H](C)[C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@](O)(O2)[C@H](C)CC[C@H]2C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(C)=C/[C@@H](C)C(=O)C1 CBPNZQVSJQDFBE-FUXHJELOSA-N 0.000 description 27
- 150000001875 compounds Chemical class 0.000 description 27
- 239000003795 chemical substances by application Substances 0.000 description 26
- 150000003384 small molecules Chemical class 0.000 description 26
- 239000002147 L01XE04 - Sunitinib Substances 0.000 description 25
- 229960001796 sunitinib Drugs 0.000 description 25
- WINHZLLDWRZWRT-ATVHPVEESA-N sunitinib Chemical compound CCN(CC)CCNC(=O)C1=C(C)NC(\C=C/2C3=CC(F)=CC=C3NC\2=O)=C1C WINHZLLDWRZWRT-ATVHPVEESA-N 0.000 description 25
- 229960000235 temsirolimus Drugs 0.000 description 25
- 210000004881 tumor cell Anatomy 0.000 description 25
- 102000013530 TOR Serine-Threonine Kinases Human genes 0.000 description 21
- 108010065917 TOR Serine-Threonine Kinases Proteins 0.000 description 21
- 229960005167 everolimus Drugs 0.000 description 21
- 108090000623 proteins and genes Proteins 0.000 description 21
- QFJCIRLUMZQUOT-UHFFFAOYSA-N temsirolimus Natural products C1CC(O)C(OC)CC1CC(C)C1OC(=O)C2CCCCN2C(=O)C(=O)C(O)(O2)C(C)CCC2CC(OC)C(C)=CC=CC=CC(C)CC(C)C(=O)C(OC)C(O)C(C)=CC(C)C(=O)C1 QFJCIRLUMZQUOT-UHFFFAOYSA-N 0.000 description 20
- 229960005310 aldesleukin Drugs 0.000 description 19
- 108700025316 aldesleukin Proteins 0.000 description 19
- 102000014150 Interferons Human genes 0.000 description 16
- 108010050904 Interferons Proteins 0.000 description 16
- 229940042992 afinitor Drugs 0.000 description 16
- 239000000427 antigen Substances 0.000 description 16
- NCNRHFGMJRPRSK-MDZDMXLPSA-N belinostat Chemical compound ONC(=O)\C=C\C1=CC=CC(S(=O)(=O)NC=2C=CC=CC=2)=C1 NCNRHFGMJRPRSK-MDZDMXLPSA-N 0.000 description 16
- 229940079322 interferon Drugs 0.000 description 16
- 229960004857 mitomycin Drugs 0.000 description 16
- 229910052697 platinum Inorganic materials 0.000 description 16
- 230000003042 antagnostic effect Effects 0.000 description 15
- 108091007433 antigens Proteins 0.000 description 15
- 102000036639 antigens Human genes 0.000 description 15
- 229940127079 antineoplastic immunimodulatory agent Drugs 0.000 description 15
- 229960003094 belinostat Drugs 0.000 description 15
- 239000003798 L01XE11 - Pazopanib Substances 0.000 description 14
- QGZYDVAGYRLSKP-UHFFFAOYSA-N N-[7-(hydroxyamino)-7-oxoheptyl]-2-(N-phenylanilino)-5-pyrimidinecarboxamide Chemical compound N1=CC(C(=O)NCCCCCCC(=O)NO)=CN=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 QGZYDVAGYRLSKP-UHFFFAOYSA-N 0.000 description 14
- 210000001744 T-lymphocyte Anatomy 0.000 description 14
- 230000003213 activating effect Effects 0.000 description 14
- 230000001270 agonistic effect Effects 0.000 description 14
- 229940120638 avastin Drugs 0.000 description 14
- 229960003005 axitinib Drugs 0.000 description 14
- RITAVMQDGBJQJZ-FMIVXFBMSA-N axitinib Chemical compound CNC(=O)C1=CC=CC=C1SC1=CC=C(C(\C=C\C=2N=CC=CC=2)=NN2)C2=C1 RITAVMQDGBJQJZ-FMIVXFBMSA-N 0.000 description 14
- 229960000397 bevacizumab Drugs 0.000 description 14
- 230000000694 effects Effects 0.000 description 14
- 210000002865 immune cell Anatomy 0.000 description 14
- 210000000987 immune system Anatomy 0.000 description 14
- 230000035772 mutation Effects 0.000 description 14
- FPOHNWQLNRZRFC-ZHACJKMWSA-N panobinostat Chemical compound CC=1NC2=CC=CC=C2C=1CCNCC1=CC=C(\C=C\C(=O)NO)C=C1 FPOHNWQLNRZRFC-ZHACJKMWSA-N 0.000 description 14
- 229960005492 pazopanib hydrochloride Drugs 0.000 description 14
- 102000005962 receptors Human genes 0.000 description 14
- 108020003175 receptors Proteins 0.000 description 14
- 229940069559 votrient Drugs 0.000 description 14
- BUROJSBIWGDYCN-GAUTUEMISA-N AP 23573 Chemical compound C1C[C@@H](OP(C)(C)=O)[C@H](OC)C[C@@H]1C[C@@H](C)[C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@](O)(O2)[C@H](C)CC[C@H]2C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(C)=C/[C@@H](C)C(=O)C1 BUROJSBIWGDYCN-GAUTUEMISA-N 0.000 description 13
- 102000037982 Immune checkpoint proteins Human genes 0.000 description 13
- 108091008036 Immune checkpoint proteins Proteins 0.000 description 13
- 210000004027 cell Anatomy 0.000 description 13
- 108020004201 indoleamine 2,3-dioxygenase Proteins 0.000 description 13
- 102000006639 indoleamine 2,3-dioxygenase Human genes 0.000 description 13
- 229960005184 panobinostat Drugs 0.000 description 13
- 101001059454 Homo sapiens Serine/threonine-protein kinase MARK2 Proteins 0.000 description 12
- 102100028904 Serine/threonine-protein kinase MARK2 Human genes 0.000 description 12
- 210000003205 muscle Anatomy 0.000 description 12
- 229950006743 ricolinostat Drugs 0.000 description 12
- 239000005517 L01XE01 - Imatinib Substances 0.000 description 11
- 239000005551 L01XE03 - Erlotinib Substances 0.000 description 11
- 239000002136 L01XE07 - Lapatinib Substances 0.000 description 11
- 108010011536 PTEN Phosphohydrolase Proteins 0.000 description 11
- 102000014160 PTEN Phosphohydrolase Human genes 0.000 description 11
- 108091000080 Phosphotransferase Proteins 0.000 description 11
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 description 11
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 description 11
- 229940123690 Raf kinase inhibitor Drugs 0.000 description 11
- 229940121742 Serine/threonine kinase inhibitor Drugs 0.000 description 11
- 229960001433 erlotinib Drugs 0.000 description 11
- AAKJLRGGTJKAMG-UHFFFAOYSA-N erlotinib Chemical compound C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 AAKJLRGGTJKAMG-UHFFFAOYSA-N 0.000 description 11
- 229960002411 imatinib Drugs 0.000 description 11
- KTUFNOKKBVMGRW-UHFFFAOYSA-N imatinib Chemical compound C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 KTUFNOKKBVMGRW-UHFFFAOYSA-N 0.000 description 11
- 229960004891 lapatinib Drugs 0.000 description 11
- BCFGMOOMADDAQU-UHFFFAOYSA-N lapatinib Chemical compound O1C(CNCCS(=O)(=O)C)=CC=C1C1=CC=C(N=CN=C2NC=3C=C(Cl)C(OCC=4C=C(F)C=CC=4)=CC=3)C2=C1 BCFGMOOMADDAQU-UHFFFAOYSA-N 0.000 description 11
- 102000051624 phosphatidylethanolamine binding protein Human genes 0.000 description 11
- 108700021017 phosphatidylethanolamine binding protein Proteins 0.000 description 11
- 102000020233 phosphotransferase Human genes 0.000 description 11
- 108010077182 raf Kinases Proteins 0.000 description 11
- 102000009929 raf Kinases Human genes 0.000 description 11
- 208000024891 symptom Diseases 0.000 description 10
- 238000011161 development Methods 0.000 description 9
- 230000018109 developmental process Effects 0.000 description 9
- 102100039620 Granulocyte-macrophage colony-stimulating factor Human genes 0.000 description 8
- 108091008611 Protein Kinase B Proteins 0.000 description 8
- 230000037361 pathway Effects 0.000 description 8
- 206010044412 transitional cell carcinoma Diseases 0.000 description 8
- 102100033810 RAC-alpha serine/threonine-protein kinase Human genes 0.000 description 7
- 229960005386 ipilimumab Drugs 0.000 description 7
- 229960003301 nivolumab Drugs 0.000 description 7
- 229960002621 pembrolizumab Drugs 0.000 description 7
- 229960001302 ridaforolimus Drugs 0.000 description 7
- 230000004083 survival effect Effects 0.000 description 7
- 208000023747 urothelial carcinoma Diseases 0.000 description 7
- 229960003862 vemurafenib Drugs 0.000 description 7
- GPXBXXGIAQBQNI-UHFFFAOYSA-N vemurafenib Chemical compound CCCS(=O)(=O)NC1=CC=C(F)C(C(=O)C=2C3=CC(=CN=C3NC=2)C=2C=CC(Cl)=CC=2)=C1F GPXBXXGIAQBQNI-UHFFFAOYSA-N 0.000 description 7
- 102100024458 Cyclin-dependent kinase inhibitor 2A Human genes 0.000 description 6
- 102100039996 Histone deacetylase 1 Human genes 0.000 description 6
- 101001035024 Homo sapiens Histone deacetylase 1 Proteins 0.000 description 6
- 102000004083 Lymphotoxin-alpha Human genes 0.000 description 6
- 108090000542 Lymphotoxin-alpha Proteins 0.000 description 6
- 206010027476 Metastases Diseases 0.000 description 6
- 108091007960 PI3Ks Proteins 0.000 description 6
- 108090000430 Phosphatidylinositol 3-kinases Proteins 0.000 description 6
- 102000003993 Phosphatidylinositol 3-kinases Human genes 0.000 description 6
- 230000000735 allogeneic effect Effects 0.000 description 6
- 230000009401 metastasis Effects 0.000 description 6
- VAZAPHZUAVEOMC-UHFFFAOYSA-N tacedinaline Chemical compound C1=CC(NC(=O)C)=CC=C1C(=O)NC1=CC=CC=C1N VAZAPHZUAVEOMC-UHFFFAOYSA-N 0.000 description 6
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 5
- 102100030708 GTPase KRas Human genes 0.000 description 5
- 102100039788 GTPase NRas Human genes 0.000 description 5
- 101000584612 Homo sapiens GTPase KRas Proteins 0.000 description 5
- 108010078049 Interferon alpha-2 Proteins 0.000 description 5
- WWGBHDIHIVGYLZ-UHFFFAOYSA-N N-[4-[3-[[[7-(hydroxyamino)-7-oxoheptyl]amino]-oxomethyl]-5-isoxazolyl]phenyl]carbamic acid tert-butyl ester Chemical compound C1=CC(NC(=O)OC(C)(C)C)=CC=C1C1=CC(C(=O)NCCCCCCC(=O)NO)=NO1 WWGBHDIHIVGYLZ-UHFFFAOYSA-N 0.000 description 5
- 229960002465 dabrafenib Drugs 0.000 description 5
- BFSMGDJOXZAERB-UHFFFAOYSA-N dabrafenib Chemical compound S1C(C(C)(C)C)=NC(C=2C(=C(NS(=O)(=O)C=3C(=CC=CC=3F)F)C=CC=2)F)=C1C1=CC=NC(N)=N1 BFSMGDJOXZAERB-UHFFFAOYSA-N 0.000 description 5
- 229960003901 dacarbazine Drugs 0.000 description 5
- 230000003247 decreasing effect Effects 0.000 description 5
- 230000014509 gene expression Effects 0.000 description 5
- 229960003507 interferon alfa-2b Drugs 0.000 description 5
- MIXCUJKCXRNYFM-UHFFFAOYSA-M sodium;diiodomethanesulfonate;n-propyl-n-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide Chemical compound [Na+].[O-]S(=O)(=O)C(I)I.C1=CN=CN1C(=O)N(CCC)CCOC1=C(Cl)C=C(Cl)C=C1Cl MIXCUJKCXRNYFM-UHFFFAOYSA-M 0.000 description 5
- 229960004066 trametinib Drugs 0.000 description 5
- LIRYPHYGHXZJBZ-UHFFFAOYSA-N trametinib Chemical compound CC(=O)NC1=CC=CC(N2C(N(C3CC3)C(=O)C3=C(NC=4C(=CC(I)=CC=4)F)N(C)C(=O)C(C)=C32)=O)=C1 LIRYPHYGHXZJBZ-UHFFFAOYSA-N 0.000 description 5
- 230000004614 tumor growth Effects 0.000 description 5
- BWDQBBCUWLSASG-MDZDMXLPSA-N (e)-n-hydroxy-3-[4-[[2-hydroxyethyl-[2-(1h-indol-3-yl)ethyl]amino]methyl]phenyl]prop-2-enamide Chemical compound C=1NC2=CC=CC=C2C=1CCN(CCO)CC1=CC=C(\C=C\C(=O)NO)C=C1 BWDQBBCUWLSASG-MDZDMXLPSA-N 0.000 description 4
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical group NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- 102100032528 C-type lectin domain family 11 member A Human genes 0.000 description 4
- 101710167766 C-type lectin domain family 11 member A Proteins 0.000 description 4
- 201000009030 Carcinoma Diseases 0.000 description 4
- 108010071942 Colony-Stimulating Factors Proteins 0.000 description 4
- 108010079345 Follicle Stimulating Hormone Proteins 0.000 description 4
- 102000012673 Follicle Stimulating Hormone Human genes 0.000 description 4
- 108010017080 Granulocyte Colony-Stimulating Factor Proteins 0.000 description 4
- 102100039619 Granulocyte colony-stimulating factor Human genes 0.000 description 4
- 108010017213 Granulocyte-Macrophage Colony-Stimulating Factor Proteins 0.000 description 4
- 102100031561 Hamartin Human genes 0.000 description 4
- 101000744505 Homo sapiens GTPase NRas Proteins 0.000 description 4
- 101000795643 Homo sapiens Hamartin Proteins 0.000 description 4
- 108010000521 Human Growth Hormone Proteins 0.000 description 4
- 102000002265 Human Growth Hormone Human genes 0.000 description 4
- 239000000854 Human Growth Hormone Substances 0.000 description 4
- 108091006905 Human Serum Albumin Proteins 0.000 description 4
- 102000008100 Human Serum Albumin Human genes 0.000 description 4
- 108090000723 Insulin-Like Growth Factor I Proteins 0.000 description 4
- 102000004218 Insulin-Like Growth Factor I Human genes 0.000 description 4
- 102000009151 Luteinizing Hormone Human genes 0.000 description 4
- 108010073521 Luteinizing Hormone Proteins 0.000 description 4
- YALNUENQHAQXEA-UHFFFAOYSA-N N-[4-[(hydroxyamino)-oxomethyl]phenyl]carbamic acid [6-(diethylaminomethyl)-2-naphthalenyl]methyl ester Chemical compound C1=CC2=CC(CN(CC)CC)=CC=C2C=C1COC(=O)NC1=CC=C(C(=O)NO)C=C1 YALNUENQHAQXEA-UHFFFAOYSA-N 0.000 description 4
- 102000011923 Thyrotropin Human genes 0.000 description 4
- 108010061174 Thyrotropin Proteins 0.000 description 4
- 101800004564 Transforming growth factor alpha Proteins 0.000 description 4
- 102400001320 Transforming growth factor alpha Human genes 0.000 description 4
- 108060008682 Tumor Necrosis Factor Proteins 0.000 description 4
- 102000000852 Tumor Necrosis Factor-alpha Human genes 0.000 description 4
- 208000009956 adenocarcinoma Diseases 0.000 description 4
- 239000002671 adjuvant Substances 0.000 description 4
- 108091008034 costimulatory receptors Proteins 0.000 description 4
- INVTYAOGFAGBOE-UHFFFAOYSA-N entinostat Chemical compound NC1=CC=CC=C1NC(=O)C(C=C1)=CC=C1CNC(=O)OCC1=CC=CN=C1 INVTYAOGFAGBOE-UHFFFAOYSA-N 0.000 description 4
- 229940028334 follicle stimulating hormone Drugs 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 230000002068 genetic effect Effects 0.000 description 4
- 239000003102 growth factor Substances 0.000 description 4
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 4
- 229940040129 luteinizing hormone Drugs 0.000 description 4
- 108020004999 messenger RNA Proteins 0.000 description 4
- OYKBQNOPCSXWBL-SNAWJCMRSA-N n-hydroxy-3-[(e)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide Chemical compound ONC(=O)\C=C\C1=CC=CC(C(=O)NO)=C1 OYKBQNOPCSXWBL-SNAWJCMRSA-N 0.000 description 4
- 102000004169 proteins and genes Human genes 0.000 description 4
- 238000011277 treatment modality Methods 0.000 description 4
- GMYLVKUGJMYTFB-UHFFFAOYSA-N 5-ethyl-3-[2-methyl-6-(1h-1,2,4-triazol-5-yl)pyridin-3-yl]-7,8-dihydropyrazino[2,3-b]pyrazin-6-one Chemical compound N1=C2N(CC)C(=O)CNC2=NC=C1C(C(=N1)C)=CC=C1C1=NN=CN1 GMYLVKUGJMYTFB-UHFFFAOYSA-N 0.000 description 3
- 206010003571 Astrocytoma Diseases 0.000 description 3
- RFLHBLWLFUFFDZ-UHFFFAOYSA-N BML-210 Chemical compound NC1=CC=CC=C1NC(=O)CCCCCCC(=O)NC1=CC=CC=C1 RFLHBLWLFUFFDZ-UHFFFAOYSA-N 0.000 description 3
- UFKLYTOEMRFKAD-SHTZXODSSA-N C1C[C@@H](OC)CC[C@@H]1N1C2=NC(C=3C=NC(=CC=3)C(C)(C)O)=CN=C2NCC1=O Chemical compound C1C[C@@H](OC)CC[C@@H]1N1C2=NC(C=3C=NC(=CC=3)C(C)(C)O)=CN=C2NCC1=O UFKLYTOEMRFKAD-SHTZXODSSA-N 0.000 description 3
- 102100024462 Cyclin-dependent kinase 4 inhibitor B Human genes 0.000 description 3
- 102100022537 Histone deacetylase 6 Human genes 0.000 description 3
- 101000899330 Homo sapiens Histone deacetylase 6 Proteins 0.000 description 3
- 101000795659 Homo sapiens Tuberin Proteins 0.000 description 3
- 108700019961 Neoplasm Genes Proteins 0.000 description 3
- 102100020718 Receptor-type tyrosine-protein kinase FLT3 Human genes 0.000 description 3
- QJJXYPPXXYFBGM-LFZNUXCKSA-N Tacrolimus Chemical compound C1C[C@@H](O)[C@H](OC)C[C@@H]1\C=C(/C)[C@@H]1[C@H](C)[C@@H](O)CC(=O)[C@H](CC=C)/C=C(C)/C[C@H](C)C[C@H](OC)[C@H]([C@H](C[C@H]2C)OC)O[C@@]2(O)C(=O)C(=O)N2CCCC[C@H]2C(=O)O1 QJJXYPPXXYFBGM-LFZNUXCKSA-N 0.000 description 3
- RTKIYFITIVXBLE-UHFFFAOYSA-N Trichostatin A Natural products ONC(=O)C=CC(C)=CC(C)C(=O)C1=CC=C(N(C)C)C=C1 RTKIYFITIVXBLE-UHFFFAOYSA-N 0.000 description 3
- 102100031638 Tuberin Human genes 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 230000009286 beneficial effect Effects 0.000 description 3
- 230000004663 cell proliferation Effects 0.000 description 3
- 208000035475 disorder Diseases 0.000 description 3
- 230000036267 drug metabolism Effects 0.000 description 3
- 239000003596 drug target Substances 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 230000000977 initiatory effect Effects 0.000 description 3
- 230000001394 metastastic effect Effects 0.000 description 3
- 206010061289 metastatic neoplasm Diseases 0.000 description 3
- 210000000056 organ Anatomy 0.000 description 3
- KASDHRXLYQOAKZ-ZPSXYTITSA-N pimecrolimus Chemical compound C/C([C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@]2(O)O[C@@H]([C@H](C[C@H]2C)OC)[C@@H](OC)C[C@@H](C)C/C(C)=C/[C@H](C(C[C@H](O)[C@H]1C)=O)CC)=C\[C@@H]1CC[C@@H](Cl)[C@H](OC)C1 KASDHRXLYQOAKZ-ZPSXYTITSA-N 0.000 description 3
- 229960005330 pimecrolimus Drugs 0.000 description 3
- 206010041823 squamous cell carcinoma Diseases 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000001356 surgical procedure Methods 0.000 description 3
- RTKIYFITIVXBLE-QEQCGCAPSA-N trichostatin A Chemical compound ONC(=O)/C=C/C(/C)=C/[C@@H](C)C(=O)C1=CC=C(N(C)C)C=C1 RTKIYFITIVXBLE-QEQCGCAPSA-N 0.000 description 3
- WAEXFXRVDQXREF-UHFFFAOYSA-N vorinostat Chemical group ONC(=O)CCCCCCC(=O)NC1=CC=CC=C1 WAEXFXRVDQXREF-UHFFFAOYSA-N 0.000 description 3
- CGTADGCBEXYWNE-GTTQIJKGSA-N zotarolimus Chemical compound N1([C@H]2CC[C@@H](C[C@@H](C)[C@H]3OC(=O)[C@@H]4CCCCN4C(=O)C(=O)[C@@]4(O)[C@H](C)CC[C@H](O4)C[C@@H](\C(C)=C\C=C\C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(C)=C/[C@@H](C)C(=O)C3)OC)C[C@H]2OC)C=NN=N1 CGTADGCBEXYWNE-GTTQIJKGSA-N 0.000 description 3
- YOVVNQKCSKSHKT-HNNXBMFYSA-N (2s)-1-[4-[[2-(2-aminopyrimidin-5-yl)-7-methyl-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]methyl]piperazin-1-yl]-2-hydroxypropan-1-one Chemical compound C1CN(C(=O)[C@@H](O)C)CCN1CC1=C(C)C2=NC(C=3C=NC(N)=NC=3)=NC(N3CCOCC3)=C2S1 YOVVNQKCSKSHKT-HNNXBMFYSA-N 0.000 description 2
- QDITZBLZQQZVEE-YBEGLDIGSA-N (5z)-5-[(4-pyridin-4-ylquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione Chemical compound S1C(=O)NC(=O)\C1=C\C1=CC=C(N=CC=C2C=3C=CN=CC=3)C2=C1 QDITZBLZQQZVEE-YBEGLDIGSA-N 0.000 description 2
- QLHHRYZMBGPBJG-UHFFFAOYSA-N 1-[4-[1-(1,4-dioxaspiro[4.5]decan-8-yl)-4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-6-pyrazolo[3,4-d]pyrimidinyl]phenyl]-3-methylurea Chemical compound C1=CC(NC(=O)NC)=CC=C1C1=NC(N2CC3CCC(O3)C2)=C(C=NN2C3CCC4(CC3)OCCO4)C2=N1 QLHHRYZMBGPBJG-UHFFFAOYSA-N 0.000 description 2
- DWZAEMINVBZMHQ-UHFFFAOYSA-N 1-[4-[4-(dimethylamino)piperidine-1-carbonyl]phenyl]-3-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)phenyl]urea Chemical compound C1CC(N(C)C)CCN1C(=O)C(C=C1)=CC=C1NC(=O)NC1=CC=C(C=2N=C(N=C(N=2)N2CCOCC2)N2CCOCC2)C=C1 DWZAEMINVBZMHQ-UHFFFAOYSA-N 0.000 description 2
- UEJJHQNACJXSKW-UHFFFAOYSA-N 2-(2,6-dioxopiperidin-3-yl)-1H-isoindole-1,3(2H)-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1C1CCC(=O)NC1=O UEJJHQNACJXSKW-UHFFFAOYSA-N 0.000 description 2
- FSPQCTGGIANIJZ-UHFFFAOYSA-N 2-[[(3,4-dimethoxyphenyl)-oxomethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)NC1=C(C(N)=O)C(CCCC2)=C2S1 FSPQCTGGIANIJZ-UHFFFAOYSA-N 0.000 description 2
- RGHYDLZMTYDBDT-UHFFFAOYSA-N 2-amino-8-ethyl-4-methyl-6-(1H-pyrazol-5-yl)-7-pyrido[2,3-d]pyrimidinone Chemical compound O=C1N(CC)C2=NC(N)=NC(C)=C2C=C1C=1C=CNN=1 RGHYDLZMTYDBDT-UHFFFAOYSA-N 0.000 description 2
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical group C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 2
- JUSFANSTBFGBAF-IRXDYDNUSA-N 3-[2,4-bis[(3s)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC(C=2N=C3N=C(N=C(C3=CC=2)N2[C@H](COCC2)C)N2[C@H](COCC2)C)=C1 JUSFANSTBFGBAF-IRXDYDNUSA-N 0.000 description 2
- FPEIJQLXFHKLJV-UHFFFAOYSA-N 4-[6-(1h-indol-5-yl)-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]pyrazolo[3,4-d]pyrimidin-4-yl]morpholine Chemical compound C=1C=CN=CC=1CN(CC1)CCC1N(C1=NC(=N2)C=3C=C4C=CNC4=CC=3)N=CC1=C2N1CCOCC1 FPEIJQLXFHKLJV-UHFFFAOYSA-N 0.000 description 2
- IMXHGCRIEAKIBU-UHFFFAOYSA-N 4-[6-[4-(methoxycarbonylamino)phenyl]-4-(4-morpholinyl)-1-pyrazolo[3,4-d]pyrimidinyl]-1-piperidinecarboxylic acid methyl ester Chemical compound C1=CC(NC(=O)OC)=CC=C1C1=NC(N2CCOCC2)=C(C=NN2C3CCN(CC3)C(=O)OC)C2=N1 IMXHGCRIEAKIBU-UHFFFAOYSA-N 0.000 description 2
- GYLDXIAOMVERTK-UHFFFAOYSA-N 5-(4-amino-1-propan-2-yl-3-pyrazolo[3,4-d]pyrimidinyl)-1,3-benzoxazol-2-amine Chemical compound C12=C(N)N=CN=C2N(C(C)C)N=C1C1=CC=C(OC(N)=N2)C2=C1 GYLDXIAOMVERTK-UHFFFAOYSA-N 0.000 description 2
- JEGHXKRHKHPBJD-UHFFFAOYSA-N 5-(7-methylsulfonyl-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl)pyrimidin-2-amine Chemical compound CS(=O)(=O)N1CCC2=C1N=C(N1CCOCC1)N=C2C1=CN=C(N)N=C1 JEGHXKRHKHPBJD-UHFFFAOYSA-N 0.000 description 2
- YEAHTLOYHVWAKW-UHFFFAOYSA-N 8-(1-hydroxyethyl)-2-methoxy-3-[(4-methoxyphenyl)methoxy]benzo[c]chromen-6-one Chemical compound C1=CC(OC)=CC=C1COC(C(=C1)OC)=CC2=C1C1=CC=C(C(C)O)C=C1C(=O)O2 YEAHTLOYHVWAKW-UHFFFAOYSA-N 0.000 description 2
- KVLFRAWTRWDEDF-IRXDYDNUSA-N AZD-8055 Chemical compound C1=C(CO)C(OC)=CC=C1C1=CC=C(C(=NC(=N2)N3[C@H](COCC3)C)N3[C@H](COCC3)C)C2=N1 KVLFRAWTRWDEDF-IRXDYDNUSA-N 0.000 description 2
- 108010059616 Activins Proteins 0.000 description 2
- 102000005606 Activins Human genes 0.000 description 2
- 102400000068 Angiostatin Human genes 0.000 description 2
- 108010079709 Angiostatins Proteins 0.000 description 2
- 108010005853 Anti-Mullerian Hormone Proteins 0.000 description 2
- 206010065869 Astrocytoma, low grade Diseases 0.000 description 2
- YUXMAKUNSXIEKN-BTJKTKAUSA-N BGT226 Chemical compound OC(=O)\C=C/C(O)=O.C1=NC(OC)=CC=C1C1=CC=C(N=CC2=C3N(C=4C=C(C(N5CCNCC5)=CC=4)C(F)(F)F)C(=O)N2C)C3=C1 YUXMAKUNSXIEKN-BTJKTKAUSA-N 0.000 description 2
- 229940125565 BMS-986016 Drugs 0.000 description 2
- 208000033929 Birt-Hogg-Dubé syndrome Diseases 0.000 description 2
- 206010006187 Breast cancer Diseases 0.000 description 2
- 239000005461 Canertinib Substances 0.000 description 2
- 102100025064 Cellular tumor antigen p53 Human genes 0.000 description 2
- 108010012236 Chemokines Proteins 0.000 description 2
- 102000019034 Chemokines Human genes 0.000 description 2
- 102100021809 Chorionic somatomammotropin hormone 1 Human genes 0.000 description 2
- 102100031162 Collagen alpha-1(XVIII) chain Human genes 0.000 description 2
- 102100039193 Cullin-2 Human genes 0.000 description 2
- 108010009356 Cyclin-Dependent Kinase Inhibitor p15 Proteins 0.000 description 2
- 108010009392 Cyclin-Dependent Kinase Inhibitor p16 Proteins 0.000 description 2
- 102000004127 Cytokines Human genes 0.000 description 2
- 108090000695 Cytokines Proteins 0.000 description 2
- XUIIKFGFIJCVMT-GFCCVEGCSA-N D-thyroxine Chemical compound IC1=CC(C[C@@H](N)C(O)=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-GFCCVEGCSA-N 0.000 description 2
- 102100034157 DNA mismatch repair protein Msh2 Human genes 0.000 description 2
- ZBNZXTGUTAYRHI-UHFFFAOYSA-N Dasatinib Chemical compound C=1C(N2CCN(CCO)CC2)=NC(C)=NC=1NC(S1)=NC=C1C(=O)NC1=C(C)C=CC=C1Cl ZBNZXTGUTAYRHI-UHFFFAOYSA-N 0.000 description 2
- 108010079505 Endostatins Proteins 0.000 description 2
- 108090000394 Erythropoietin Proteins 0.000 description 2
- 102000003951 Erythropoietin Human genes 0.000 description 2
- 102000018233 Fibroblast Growth Factor Human genes 0.000 description 2
- 108050007372 Fibroblast Growth Factor Proteins 0.000 description 2
- 102000006771 Gonadotropins Human genes 0.000 description 2
- 108010086677 Gonadotropins Proteins 0.000 description 2
- 206010067943 Hereditary papillary renal carcinoma Diseases 0.000 description 2
- 208000027927 Hereditary papillary renal cell carcinoma Diseases 0.000 description 2
- 102100021455 Histone deacetylase 3 Human genes 0.000 description 2
- 101000746072 Homo sapiens Cullin-2 Proteins 0.000 description 2
- 101001134036 Homo sapiens DNA mismatch repair protein Msh2 Proteins 0.000 description 2
- 101000584633 Homo sapiens GTPase HRas Proteins 0.000 description 2
- 101000899282 Homo sapiens Histone deacetylase 3 Proteins 0.000 description 2
- 101000853002 Homo sapiens Interleukin-25 Proteins 0.000 description 2
- 101001128431 Homo sapiens Myeloid-derived growth factor Proteins 0.000 description 2
- 101000733249 Homo sapiens Tumor suppressor ARF Proteins 0.000 description 2
- 102000002746 Inhibins Human genes 0.000 description 2
- 108010004250 Inhibins Proteins 0.000 description 2
- 102000004877 Insulin Human genes 0.000 description 2
- 108090001061 Insulin Proteins 0.000 description 2
- 108090001117 Insulin-Like Growth Factor II Proteins 0.000 description 2
- 102100025947 Insulin-like growth factor II Human genes 0.000 description 2
- 108010047761 Interferon-alpha Proteins 0.000 description 2
- 102000006992 Interferon-alpha Human genes 0.000 description 2
- 108090000467 Interferon-beta Proteins 0.000 description 2
- 102000003996 Interferon-beta Human genes 0.000 description 2
- 108010074328 Interferon-gamma Proteins 0.000 description 2
- 102000008070 Interferon-gamma Human genes 0.000 description 2
- 108010002352 Interleukin-1 Proteins 0.000 description 2
- 102000000589 Interleukin-1 Human genes 0.000 description 2
- 108090000174 Interleukin-10 Proteins 0.000 description 2
- 108090000177 Interleukin-11 Proteins 0.000 description 2
- 102000003815 Interleukin-11 Human genes 0.000 description 2
- 108010065805 Interleukin-12 Proteins 0.000 description 2
- 108090000176 Interleukin-13 Proteins 0.000 description 2
- 102000003812 Interleukin-15 Human genes 0.000 description 2
- 108090000172 Interleukin-15 Proteins 0.000 description 2
- 102000049772 Interleukin-16 Human genes 0.000 description 2
- 101800003050 Interleukin-16 Proteins 0.000 description 2
- 108050003558 Interleukin-17 Proteins 0.000 description 2
- 102000013691 Interleukin-17 Human genes 0.000 description 2
- 102000003810 Interleukin-18 Human genes 0.000 description 2
- 108090000171 Interleukin-18 Proteins 0.000 description 2
- 108010002350 Interleukin-2 Proteins 0.000 description 2
- 102100030703 Interleukin-22 Human genes 0.000 description 2
- 108010002386 Interleukin-3 Proteins 0.000 description 2
- 108090000978 Interleukin-4 Proteins 0.000 description 2
- 108010002616 Interleukin-5 Proteins 0.000 description 2
- 108090001005 Interleukin-6 Proteins 0.000 description 2
- 108010002586 Interleukin-7 Proteins 0.000 description 2
- 108090001007 Interleukin-8 Proteins 0.000 description 2
- 108010002335 Interleukin-9 Proteins 0.000 description 2
- RFSMUFRPPYDYRD-CALCHBBNSA-N Ku-0063794 Chemical compound C1=C(CO)C(OC)=CC=C1C1=CC=C(C(=NC(=N2)N3C[C@@H](C)O[C@@H](C)C3)N3CCOCC3)C2=N1 RFSMUFRPPYDYRD-CALCHBBNSA-N 0.000 description 2
- 239000002067 L01XE06 - Dasatinib Substances 0.000 description 2
- 239000002146 L01XE16 - Crizotinib Substances 0.000 description 2
- 239000002176 L01XE26 - Cabozantinib Substances 0.000 description 2
- 239000002177 L01XE27 - Ibrutinib Substances 0.000 description 2
- 102000016267 Leptin Human genes 0.000 description 2
- 108010092277 Leptin Proteins 0.000 description 2
- 102100040275 Leucine zipper putative tumor suppressor 1 Human genes 0.000 description 2
- 102100032352 Leukemia inhibitory factor Human genes 0.000 description 2
- 108090000581 Leukemia inhibitory factor Proteins 0.000 description 2
- 229910015837 MSH2 Inorganic materials 0.000 description 2
- 239000005462 Mubritinib Substances 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- 102000013609 MutL Protein Homolog 1 Human genes 0.000 description 2
- 108010026664 MutL Protein Homolog 1 Proteins 0.000 description 2
- 102100031789 Myeloid-derived growth factor Human genes 0.000 description 2
- IDQPVOFTURLJPT-UHFFFAOYSA-N N,N'-dihydroxyoctanediamide Chemical compound ONC(=O)CCCCCCC(=O)NO IDQPVOFTURLJPT-UHFFFAOYSA-N 0.000 description 2
- HRNLUBSXIHFDHP-UHFFFAOYSA-N N-(2-aminophenyl)-4-[[[4-(3-pyridinyl)-2-pyrimidinyl]amino]methyl]benzamide Chemical compound NC1=CC=CC=C1NC(=O)C(C=C1)=CC=C1CNC1=NC=CC(C=2C=NC=CC=2)=N1 HRNLUBSXIHFDHP-UHFFFAOYSA-N 0.000 description 2
- BHUZLJOUHMBZQY-YXQOSMAKSA-N N-[4-[(2R,4R,6S)-4-[[(4,5-diphenyl-2-oxazolyl)thio]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyoctanediamide Chemical compound C1=CC(CO)=CC=C1[C@H]1O[C@@H](C=2C=CC(NC(=O)CCCCCCC(=O)NO)=CC=2)O[C@@H](CSC=2OC(=C(N=2)C=2C=CC=CC=2)C=2C=CC=CC=2)C1 BHUZLJOUHMBZQY-YXQOSMAKSA-N 0.000 description 2
- CXQHYVUVSFXTMY-UHFFFAOYSA-N N1'-[3-fluoro-4-[[6-methoxy-7-[3-(4-morpholinyl)propoxy]-4-quinolinyl]oxy]phenyl]-N1-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide Chemical compound C1=CN=C2C=C(OCCCN3CCOCC3)C(OC)=CC2=C1OC(C(=C1)F)=CC=C1NC(=O)C1(C(=O)NC=2C=CC(F)=CC=2)CC1 CXQHYVUVSFXTMY-UHFFFAOYSA-N 0.000 description 2
- 206010061309 Neoplasm progression Diseases 0.000 description 2
- 102000007530 Neurofibromin 1 Human genes 0.000 description 2
- 108010085793 Neurofibromin 1 Proteins 0.000 description 2
- TUVCWJQQGGETHL-UHFFFAOYSA-N PI-103 Chemical compound OC1=CC=CC(C=2N=C3C4=CC=CN=C4OC3=C(N3CCOCC3)N=2)=C1 TUVCWJQQGGETHL-UHFFFAOYSA-N 0.000 description 2
- NVRXTLZYXZNATH-UHFFFAOYSA-N PP121 Chemical compound N1=C(C=2C=C3C=CNC3=NC=2)C=2C(N)=NC=NC=2N1C1CCCC1 NVRXTLZYXZNATH-UHFFFAOYSA-N 0.000 description 2
- 102000003982 Parathyroid hormone Human genes 0.000 description 2
- 108090000445 Parathyroid hormone Proteins 0.000 description 2
- 108010003044 Placental Lactogen Proteins 0.000 description 2
- 239000000381 Placental Lactogen Substances 0.000 description 2
- 108010076181 Proinsulin Proteins 0.000 description 2
- 108010057464 Prolactin Proteins 0.000 description 2
- 102000003946 Prolactin Human genes 0.000 description 2
- 239000005464 Radotinib Substances 0.000 description 2
- 101710151245 Receptor-type tyrosine-protein kinase FLT3 Proteins 0.000 description 2
- 108090000103 Relaxin Proteins 0.000 description 2
- 102000003743 Relaxin Human genes 0.000 description 2
- 206010038389 Renal cancer Diseases 0.000 description 2
- 201000000582 Retinoblastoma Diseases 0.000 description 2
- 206010039491 Sarcoma Diseases 0.000 description 2
- 102000036693 Thrombopoietin Human genes 0.000 description 2
- 108010041111 Thrombopoietin Proteins 0.000 description 2
- 102000002938 Thrombospondin Human genes 0.000 description 2
- 108060008245 Thrombospondin Proteins 0.000 description 2
- LUKBXSAWLPMMSZ-OWOJBTEDSA-N Trans-resveratrol Chemical compound C1=CC(O)=CC=C1\C=C\C1=CC(O)=CC(O)=C1 LUKBXSAWLPMMSZ-OWOJBTEDSA-N 0.000 description 2
- 102000004887 Transforming Growth Factor beta Human genes 0.000 description 2
- 108090001012 Transforming Growth Factor beta Proteins 0.000 description 2
- 102000046299 Transforming Growth Factor beta1 Human genes 0.000 description 2
- 101800002279 Transforming growth factor beta-1 Proteins 0.000 description 2
- 101710102803 Tumor suppressor ARF Proteins 0.000 description 2
- 108010073929 Vascular Endothelial Growth Factor A Proteins 0.000 description 2
- 102000005789 Vascular Endothelial Growth Factors Human genes 0.000 description 2
- 108010019530 Vascular Endothelial Growth Factors Proteins 0.000 description 2
- 229940028652 abraxane Drugs 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000000488 activin Substances 0.000 description 2
- 239000000556 agonist Substances 0.000 description 2
- 229960000548 alemtuzumab Drugs 0.000 description 2
- 238000010171 animal model Methods 0.000 description 2
- 239000000868 anti-mullerian hormone Substances 0.000 description 2
- 229960003982 apatinib Drugs 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- FZCSTZYAHCUGEM-UHFFFAOYSA-N aspergillomarasmine B Natural products OC(=O)CNC(C(O)=O)CNC(C(O)=O)CC(O)=O FZCSTZYAHCUGEM-UHFFFAOYSA-N 0.000 description 2
- 229950002916 avelumab Drugs 0.000 description 2
- 108010006025 bovine growth hormone Proteins 0.000 description 2
- GYKLFBYWXZYSOW-UHFFFAOYSA-N butanoyloxymethyl 2,2-dimethylpropanoate Chemical compound CCCC(=O)OCOC(=O)C(C)(C)C GYKLFBYWXZYSOW-UHFFFAOYSA-N 0.000 description 2
- 229960001292 cabozantinib Drugs 0.000 description 2
- ONIQOQHATWINJY-UHFFFAOYSA-N cabozantinib Chemical compound C=12C=C(OC)C(OC)=CC2=NC=CC=1OC(C=C1)=CC=C1NC(=O)C1(C(=O)NC=2C=CC(F)=CC=2)CC1 ONIQOQHATWINJY-UHFFFAOYSA-N 0.000 description 2
- 229950002826 canertinib Drugs 0.000 description 2
- OMZCMEYTWSXEPZ-UHFFFAOYSA-N canertinib Chemical compound C1=C(Cl)C(F)=CC=C1NC1=NC=NC2=CC(OCCCN3CCOCC3)=C(NC(=O)C=C)C=C12 OMZCMEYTWSXEPZ-UHFFFAOYSA-N 0.000 description 2
- XDLYKKIQACFMJG-WKILWMFISA-N chembl1234354 Chemical compound C1=NC(OC)=CC=C1C(C1=O)=CC2=C(C)N=C(N)N=C2N1[C@@H]1CC[C@@H](OCCO)CC1 XDLYKKIQACFMJG-WKILWMFISA-N 0.000 description 2
- JROFGZPOBKIAEW-HAQNSBGRSA-N chembl3120215 Chemical compound N1C=2C(OC)=CC=CC=2C=C1C(=C1C(N)=NC=NN11)N=C1[C@H]1CC[C@H](C(O)=O)CC1 JROFGZPOBKIAEW-HAQNSBGRSA-N 0.000 description 2
- 230000000875 corresponding effect Effects 0.000 description 2
- 229950009240 crenolanib Drugs 0.000 description 2
- DYNHJHQFHQTFTP-UHFFFAOYSA-N crenolanib Chemical compound C=1C=C2N(C=3N=C4C(N5CCC(N)CC5)=CC=CC4=CC=3)C=NC2=CC=1OCC1(C)COC1 DYNHJHQFHQTFTP-UHFFFAOYSA-N 0.000 description 2
- 229960005061 crizotinib Drugs 0.000 description 2
- KTEIFNKAUNYNJU-GFCCVEGCSA-N crizotinib Chemical compound O([C@H](C)C=1C(=C(F)C=CC=1Cl)Cl)C(C(=NC=1)N)=CC=1C(=C1)C=NN1C1CCNCC1 KTEIFNKAUNYNJU-GFCCVEGCSA-N 0.000 description 2
- JOGKUKXHTYWRGZ-UHFFFAOYSA-N dactolisib Chemical compound O=C1N(C)C2=CN=C3C=CC(C=4C=C5C=CC=CC5=NC=4)=CC3=C2N1C1=CC=C(C(C)(C)C#N)C=C1 JOGKUKXHTYWRGZ-UHFFFAOYSA-N 0.000 description 2
- 229960002448 dasatinib Drugs 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 229950009791 durvalumab Drugs 0.000 description 2
- 230000008482 dysregulation Effects 0.000 description 2
- 229940105423 erythropoietin Drugs 0.000 description 2
- 201000004753 familial renal oncocytoma Diseases 0.000 description 2
- 201000005306 familial renal papillary carcinoma Diseases 0.000 description 2
- 229940126864 fibroblast growth factor Drugs 0.000 description 2
- 229950008692 foretinib Drugs 0.000 description 2
- 229950005309 fostamatinib Drugs 0.000 description 2
- GKDRMWXFWHEQQT-UHFFFAOYSA-N fostamatinib Chemical compound COC1=C(OC)C(OC)=CC(NC=2N=C(NC=3N=C4N(COP(O)(O)=O)C(=O)C(C)(C)OC4=CC=3)C(F)=CN=2)=C1 GKDRMWXFWHEQQT-UHFFFAOYSA-N 0.000 description 2
- 239000002622 gonadotropin Substances 0.000 description 2
- 230000003394 haemopoietic effect Effects 0.000 description 2
- 230000002440 hepatic effect Effects 0.000 description 2
- 208000024635 hereditary kidney oncocytoma Diseases 0.000 description 2
- 229960001507 ibrutinib Drugs 0.000 description 2
- XYFPWWZEPKGCCK-GOSISDBHSA-N ibrutinib Chemical compound C1=2C(N)=NC=NC=2N([C@H]2CN(CCC2)C(=O)C=C)N=C1C(C=C1)=CC=C1OC1=CC=CC=C1 XYFPWWZEPKGCCK-GOSISDBHSA-N 0.000 description 2
- 229960003445 idelalisib Drugs 0.000 description 2
- YKLIKGKUANLGSB-HNNXBMFYSA-N idelalisib Chemical compound C1([C@@H](NC=2[C]3N=CN=C3N=CN=2)CC)=NC2=CC=CC(F)=C2C(=O)N1C1=CC=CC=C1 YKLIKGKUANLGSB-HNNXBMFYSA-N 0.000 description 2
- 230000001965 increasing effect Effects 0.000 description 2
- 239000000893 inhibin Substances 0.000 description 2
- ZPNFWUPYTFPOJU-LPYSRVMUSA-N iniprol Chemical compound C([C@H]1C(=O)NCC(=O)NCC(=O)N[C@H]2CSSC[C@H]3C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H](C(N[C@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC=4C=CC=CC=4)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC=4C=CC=CC=4)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC2=O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC=2C=CC=CC=2)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]2N(CCC2)C(=O)[C@@H](N)CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N2[C@@H](CCC2)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N3)C(=O)NCC(=O)NCC(=O)N[C@@H](C)C(O)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@H](C(=O)N1)C(C)C)[C@@H](C)O)[C@@H](C)CC)=O)[C@@H](C)CC)C1=CC=C(O)C=C1 ZPNFWUPYTFPOJU-LPYSRVMUSA-N 0.000 description 2
- 229940125396 insulin Drugs 0.000 description 2
- 102000006495 integrins Human genes 0.000 description 2
- 108010044426 integrins Proteins 0.000 description 2
- 229960003130 interferon gamma Drugs 0.000 description 2
- 229960001388 interferon-beta Drugs 0.000 description 2
- 108010074108 interleukin-21 Proteins 0.000 description 2
- 229940126401 izorlisib Drugs 0.000 description 2
- 229950002216 linifanib Drugs 0.000 description 2
- MPVGZUGXCQEXTM-UHFFFAOYSA-N linifanib Chemical compound CC1=CC=C(F)C(NC(=O)NC=2C=CC(=CC=2)C=2C=3C(N)=NNC=3C=CC=2)=C1 MPVGZUGXCQEXTM-UHFFFAOYSA-N 0.000 description 2
- 229950011263 lirilumab Drugs 0.000 description 2
- 229940123729 mTOR kinase inhibitor Drugs 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- VDOCQQKGPJENHJ-UHFFFAOYSA-N methyl n-[4-[4-morpholin-4-yl-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]pyrazolo[3,4-d]pyrimidin-6-yl]phenyl]carbamate Chemical compound C1=CC(NC(=O)OC)=CC=C1C1=NC(N2CCOCC2)=C(C=NN2C3CCN(CC=4C=NC=CC=4)CC3)C2=N1 VDOCQQKGPJENHJ-UHFFFAOYSA-N 0.000 description 2
- 229950003968 motesanib Drugs 0.000 description 2
- RAHBGWKEPAQNFF-UHFFFAOYSA-N motesanib Chemical compound C=1C=C2C(C)(C)CNC2=CC=1NC(=O)C1=CC=CN=C1NCC1=CC=NC=C1 RAHBGWKEPAQNFF-UHFFFAOYSA-N 0.000 description 2
- 229950002212 mubritinib Drugs 0.000 description 2
- ZTFBIUXIQYRUNT-MDWZMJQESA-N mubritinib Chemical compound C1=CC(C(F)(F)F)=CC=C1\C=C\C1=NC(COC=2C=CC(CCCCN3N=NC=C3)=CC=2)=CO1 ZTFBIUXIQYRUNT-MDWZMJQESA-N 0.000 description 2
- WPEWQEMJFLWMLV-UHFFFAOYSA-N n-[4-(1-cyanocyclopentyl)phenyl]-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide Chemical group C=1C=CN=C(NCC=2C=CN=CC=2)C=1C(=O)NC(C=C1)=CC=C1C1(C#N)CCCC1 WPEWQEMJFLWMLV-UHFFFAOYSA-N 0.000 description 2
- CCBCHURBDSNSTJ-UHFFFAOYSA-N n-hydroxybutanamide Chemical compound CCCC(=O)NO CCBCHURBDSNSTJ-UHFFFAOYSA-N 0.000 description 2
- 229960004378 nintedanib Drugs 0.000 description 2
- XZXHXSATPCNXJR-ZIADKAODSA-N nintedanib Chemical compound O=C1NC2=CC(C(=O)OC)=CC=C2\C1=C(C=1C=CC=CC=1)\NC(C=C1)=CC=C1N(C)C(=O)CN1CCN(C)CC1 XZXHXSATPCNXJR-ZIADKAODSA-N 0.000 description 2
- CGBJSGAELGCMKE-UHFFFAOYSA-N omipalisib Chemical compound COC1=NC=C(C=2C=C3C(C=4C=NN=CC=4)=CC=NC3=CC=2)C=C1NS(=O)(=O)C1=CC=C(F)C=C1F CGBJSGAELGCMKE-UHFFFAOYSA-N 0.000 description 2
- 229960001319 parathyroid hormone Drugs 0.000 description 2
- 239000000199 parathyroid hormone Substances 0.000 description 2
- 230000001575 pathological effect Effects 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- 229950010773 pidilizumab Drugs 0.000 description 2
- OXCMYAYHXIHQOA-UHFFFAOYSA-N potassium;[2-butyl-5-chloro-3-[[4-[2-(1,2,4-triaza-3-azanidacyclopenta-1,4-dien-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol Chemical compound [K+].CCCCC1=NC(Cl)=C(CO)N1CC1=CC=C(C=2C(=CC=CC=2)C2=N[N-]N=N2)C=C1 OXCMYAYHXIHQOA-UHFFFAOYSA-N 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 229940097325 prolactin Drugs 0.000 description 2
- 108010087851 prorelaxin Proteins 0.000 description 2
- 150000003180 prostaglandins Chemical class 0.000 description 2
- 229950004043 radotinib Drugs 0.000 description 2
- DUPWHXBITIZIKZ-UHFFFAOYSA-N radotinib Chemical compound C1=NC(C)=CN1C1=CC(NC(=O)C=2C=C(NC=3N=C(C=CN=3)C=3N=CC=NC=3)C(C)=CC=2)=CC(C(F)(F)F)=C1 DUPWHXBITIZIKZ-UHFFFAOYSA-N 0.000 description 2
- 229940099538 rapamune Drugs 0.000 description 2
- 102000016914 ras Proteins Human genes 0.000 description 2
- 108010014186 ras Proteins Proteins 0.000 description 2
- 238000002271 resection Methods 0.000 description 2
- 229950009216 sapanisertib Drugs 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 230000011664 signaling Effects 0.000 description 2
- 201000004059 subependymal giant cell astrocytoma Diseases 0.000 description 2
- 230000002194 synthesizing effect Effects 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- ZRKFYGHZFMAOKI-QMGMOQQFSA-N tgfbeta Chemical compound C([C@H](NC(=O)[C@H](C(C)C)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CCSC)C(C)C)[C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(O)=O)C1=CC=C(O)C=C1 ZRKFYGHZFMAOKI-QMGMOQQFSA-N 0.000 description 2
- 229960003433 thalidomide Drugs 0.000 description 2
- 229940034208 thyroxine Drugs 0.000 description 2
- XUIIKFGFIJCVMT-UHFFFAOYSA-N thyroxine-binding globulin Natural products IC1=CC(CC([NH3+])C([O-])=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-UHFFFAOYSA-N 0.000 description 2
- AKCRNFFTGXBONI-UHFFFAOYSA-N torin 1 Chemical compound C1CN(C(=O)CC)CCN1C1=CC=C(N2C(C=CC3=C2C2=CC(=CC=C2N=C3)C=2C=C3C=CC=CC3=NC=2)=O)C=C1C(F)(F)F AKCRNFFTGXBONI-UHFFFAOYSA-N 0.000 description 2
- 229940100411 torisel Drugs 0.000 description 2
- MFAQYJIYDMLAIM-UHFFFAOYSA-N torkinib Chemical compound C12=C(N)N=CN=C2N(C(C)C)N=C1C1=CC2=CC(O)=CC=C2N1 MFAQYJIYDMLAIM-UHFFFAOYSA-N 0.000 description 2
- 238000002054 transplantation Methods 0.000 description 2
- 229950007217 tremelimumab Drugs 0.000 description 2
- 239000000107 tumor biomarker Substances 0.000 description 2
- 230000005751 tumor progression Effects 0.000 description 2
- 229950005972 urelumab Drugs 0.000 description 2
- 229950001067 varlilumab Drugs 0.000 description 2
- 229950000578 vatalanib Drugs 0.000 description 2
- YCOYDOIWSSHVCK-UHFFFAOYSA-N vatalanib Chemical compound C1=CC(Cl)=CC=C1NC(C1=CC=CC=C11)=NN=C1CC1=CC=NC=C1 YCOYDOIWSSHVCK-UHFFFAOYSA-N 0.000 description 2
- 229940121351 vopratelimab Drugs 0.000 description 2
- 229960000237 vorinostat Drugs 0.000 description 2
- 229940043785 zortress Drugs 0.000 description 2
- JWOGUUIOCYMBPV-GMFLJSBRSA-N (3S,6S,9S,12R)-3-[(2S)-Butan-2-yl]-6-[(1-methoxyindol-3-yl)methyl]-9-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone Chemical compound N1C(=O)[C@H](CCCCCC(=O)CC)NC(=O)[C@H]2CCCCN2C(=O)[C@H]([C@@H](C)CC)NC(=O)[C@@H]1CC1=CN(OC)C2=CC=CC=C12 JWOGUUIOCYMBPV-GMFLJSBRSA-N 0.000 description 1
- QRPSQQUYPMFERG-LFYBBSHMSA-N (e)-5-[3-(benzenesulfonamido)phenyl]-n-hydroxypent-2-en-4-ynamide Chemical compound ONC(=O)\C=C\C#CC1=CC=CC(NS(=O)(=O)C=2C=CC=CC=2)=C1 QRPSQQUYPMFERG-LFYBBSHMSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- PXBFMLJZNCDSMP-UHFFFAOYSA-N 2-Aminobenzamide Chemical compound NC(=O)C1=CC=CC=C1N PXBFMLJZNCDSMP-UHFFFAOYSA-N 0.000 description 1
- MAUCONCHVWBMHK-UHFFFAOYSA-N 3-[(dimethylamino)methyl]-N-[2-[4-[(hydroxyamino)-oxomethyl]phenoxy]ethyl]-2-benzofurancarboxamide Chemical compound O1C2=CC=CC=C2C(CN(C)C)=C1C(=O)NCCOC1=CC=C(C(=O)NO)C=C1 MAUCONCHVWBMHK-UHFFFAOYSA-N 0.000 description 1
- RGWSSTALGUXZMU-UHFFFAOYSA-N 4-(dimethylamino)-n-[6-(hydroxyamino)-6-oxohexyl]benzamide Chemical compound CN(C)C1=CC=C(C(=O)NCCCCCC(=O)NO)C=C1 RGWSSTALGUXZMU-UHFFFAOYSA-N 0.000 description 1
- ABZSPJVXTTUFAA-UHFFFAOYSA-N 4-acetamido-N-(2-amino-5-thiophen-2-ylphenyl)benzamide Chemical compound C1=CC(NC(=O)C)=CC=C1C(=O)NC1=CC(C=2SC=CC=2)=CC=C1N ABZSPJVXTTUFAA-UHFFFAOYSA-N 0.000 description 1
- PLIVFNIUGLLCEK-UHFFFAOYSA-N 7-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxy-n-hydroxyheptanamide Chemical compound C=12C=C(OCCCCCCC(=O)NO)C(OC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 PLIVFNIUGLLCEK-UHFFFAOYSA-N 0.000 description 1
- VUWMSJQZENJPHO-UHFFFAOYSA-N 7-oxo-7-(n-phenylanilino)heptanoic acid Chemical compound C=1C=CC=CC=1N(C(=O)CCCCCC(=O)O)C1=CC=CC=C1 VUWMSJQZENJPHO-UHFFFAOYSA-N 0.000 description 1
- 201000003076 Angiosarcoma Diseases 0.000 description 1
- 241001550224 Apha Species 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- 102100025982 BMP/retinoic acid-inducible neural-specific protein 1 Human genes 0.000 description 1
- 206010004146 Basal cell carcinoma Diseases 0.000 description 1
- 101000653197 Beet necrotic yellow vein virus (isolate Japan/S) Movement protein TGB3 Proteins 0.000 description 1
- 206010004593 Bile duct cancer Diseases 0.000 description 1
- 206010055113 Breast cancer metastatic Diseases 0.000 description 1
- 208000026310 Breast neoplasm Diseases 0.000 description 1
- 102000014914 Carrier Proteins Human genes 0.000 description 1
- 101150015280 Cel gene Proteins 0.000 description 1
- 206010008342 Cervix carcinoma Diseases 0.000 description 1
- 208000005243 Chondrosarcoma Diseases 0.000 description 1
- 201000009047 Chordoma Diseases 0.000 description 1
- 208000006332 Choriocarcinoma Diseases 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- 208000030808 Clear cell renal carcinoma Diseases 0.000 description 1
- 206010053567 Coagulopathies Diseases 0.000 description 1
- 206010009944 Colon cancer Diseases 0.000 description 1
- 201000000054 Coronary Restenosis Diseases 0.000 description 1
- 206010056489 Coronary artery restenosis Diseases 0.000 description 1
- 208000009798 Craniopharyngioma Diseases 0.000 description 1
- 206010072449 Desmoplastic melanoma Diseases 0.000 description 1
- 201000009051 Embryonal Carcinoma Diseases 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 206010014967 Ependymoma Diseases 0.000 description 1
- 208000006168 Ewing Sarcoma Diseases 0.000 description 1
- 102100023600 Fibroblast growth factor receptor 2 Human genes 0.000 description 1
- 101710182389 Fibroblast growth factor receptor 2 Proteins 0.000 description 1
- 102100027842 Fibroblast growth factor receptor 3 Human genes 0.000 description 1
- 101710182396 Fibroblast growth factor receptor 3 Proteins 0.000 description 1
- 201000008808 Fibrosarcoma Diseases 0.000 description 1
- 102100027541 GTP-binding protein Rheb Human genes 0.000 description 1
- 102100029974 GTPase HRas Human genes 0.000 description 1
- 208000032612 Glial tumor Diseases 0.000 description 1
- 206010018338 Glioma Diseases 0.000 description 1
- 208000001258 Hemangiosarcoma Diseases 0.000 description 1
- 208000002250 Hematologic Neoplasms Diseases 0.000 description 1
- 101000933342 Homo sapiens BMP/retinoic acid-inducible neural-specific protein 1 Proteins 0.000 description 1
- 101000980919 Homo sapiens Cyclin-dependent kinase 4 inhibitor B Proteins 0.000 description 1
- 101001038440 Homo sapiens Leucine zipper putative tumor suppressor 1 Proteins 0.000 description 1
- 101000954986 Homo sapiens Merlin Proteins 0.000 description 1
- 101000721712 Homo sapiens NTF2-related export protein 1 Proteins 0.000 description 1
- 101000945496 Homo sapiens Proliferation marker protein Ki-67 Proteins 0.000 description 1
- 101000712974 Homo sapiens Ras association domain-containing protein 7 Proteins 0.000 description 1
- 101001012157 Homo sapiens Receptor tyrosine-protein kinase erbB-2 Proteins 0.000 description 1
- 101000742859 Homo sapiens Retinoblastoma-associated protein Proteins 0.000 description 1
- 101000628562 Homo sapiens Serine/threonine-protein kinase STK11 Proteins 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 208000007766 Kaposi sarcoma Diseases 0.000 description 1
- 208000008839 Kidney Neoplasms Diseases 0.000 description 1
- 208000018142 Leiomyosarcoma Diseases 0.000 description 1
- 206010024218 Lentigo maligna Diseases 0.000 description 1
- 101710142669 Leucine zipper putative tumor suppressor 1 Proteins 0.000 description 1
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 1
- 208000007054 Medullary Carcinoma Diseases 0.000 description 1
- 208000000172 Medulloblastoma Diseases 0.000 description 1
- 102100037106 Merlin Human genes 0.000 description 1
- 206010027406 Mesothelioma Diseases 0.000 description 1
- 101001062862 Mus musculus Fatty acid-binding protein, adipocyte Proteins 0.000 description 1
- WTKBRPXPNAKVEQ-UHFFFAOYSA-N N'-(2-aminophenyl)-N-(4-methylphenyl)heptanediamide Chemical compound C1=CC(C)=CC=C1NC(=O)CCCCCC(=O)NC1=CC=CC=C1N WTKBRPXPNAKVEQ-UHFFFAOYSA-N 0.000 description 1
- HQSSEGBEYORUBY-UHFFFAOYSA-N N-[3-[(2-hydroxynaphthalen-1-yl)methylideneamino]phenyl]-2-phenylpropanamide Chemical compound C=1C=CC(N=CC=2C3=CC=CC=C3C=CC=2O)=CC=1NC(=O)C(C)C1=CC=CC=C1 HQSSEGBEYORUBY-UHFFFAOYSA-N 0.000 description 1
- PAWIYAYFNXQGAP-UHFFFAOYSA-N N-hydroxy-2-[4-[[(1-methyl-3-indolyl)methylamino]methyl]-1-piperidinyl]-5-pyrimidinecarboxamide Chemical compound C12=CC=CC=C2N(C)C=C1CNCC(CC1)CCN1C1=NC=C(C(=O)NO)C=N1 PAWIYAYFNXQGAP-UHFFFAOYSA-N 0.000 description 1
- 206010029260 Neuroblastoma Diseases 0.000 description 1
- 206010029488 Nodular melanoma Diseases 0.000 description 1
- JWOGUUIOCYMBPV-UHFFFAOYSA-N OT-Key 11219 Natural products N1C(=O)C(CCCCCC(=O)CC)NC(=O)C2CCCCN2C(=O)C(C(C)CC)NC(=O)C1CC1=CN(OC)C2=CC=CC=C12 JWOGUUIOCYMBPV-UHFFFAOYSA-N 0.000 description 1
- 201000010133 Oligodendroglioma Diseases 0.000 description 1
- 206010033128 Ovarian cancer Diseases 0.000 description 1
- 206010061535 Ovarian neoplasm Diseases 0.000 description 1
- 229930012538 Paclitaxel Natural products 0.000 description 1
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 1
- 101000621505 Peanut clump virus (isolate 87/TGTA2) Suppressor of RNA silencing Proteins 0.000 description 1
- 208000007641 Pinealoma Diseases 0.000 description 1
- 102100034836 Proliferation marker protein Ki-67 Human genes 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 1
- 102000001253 Protein Kinase Human genes 0.000 description 1
- 101710113459 RAC-alpha serine/threonine-protein kinase Proteins 0.000 description 1
- 101150020518 RHEB gene Proteins 0.000 description 1
- 102100030086 Receptor tyrosine-protein kinase erbB-2 Human genes 0.000 description 1
- QNVSXXGDAPORNA-UHFFFAOYSA-N Resveratrol Natural products OC1=CC=CC(C=CC=2C=C(O)C(O)=CC=2)=C1 QNVSXXGDAPORNA-UHFFFAOYSA-N 0.000 description 1
- 102100038042 Retinoblastoma-associated protein Human genes 0.000 description 1
- 201000010208 Seminoma Diseases 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- 102100026715 Serine/threonine-protein kinase STK11 Human genes 0.000 description 1
- 206010042553 Superficial spreading melanoma stage unspecified Diseases 0.000 description 1
- BPEGJWRSRHCHSN-UHFFFAOYSA-N Temozolomide Chemical compound O=C1N(C)N=NC2=C(C(N)=O)N=CN21 BPEGJWRSRHCHSN-UHFFFAOYSA-N 0.000 description 1
- 208000024313 Testicular Neoplasms Diseases 0.000 description 1
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 1
- 239000004473 Threonine Substances 0.000 description 1
- 208000026911 Tuberous sclerosis complex Diseases 0.000 description 1
- 208000006105 Uterine Cervical Neoplasms Diseases 0.000 description 1
- 208000014070 Vestibular schwannoma Diseases 0.000 description 1
- 208000008383 Wilms tumor Diseases 0.000 description 1
- 208000004064 acoustic neuroma Diseases 0.000 description 1
- 206010000583 acral lentiginous melanoma Diseases 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 208000006431 amelanotic melanoma Diseases 0.000 description 1
- 238000002583 angiography Methods 0.000 description 1
- 108010082820 apicidin Proteins 0.000 description 1
- 229930186608 apicidin Natural products 0.000 description 1
- 201000007180 bile duct carcinoma Diseases 0.000 description 1
- 108091008324 binding proteins Proteins 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 238000001574 biopsy Methods 0.000 description 1
- 201000001531 bladder carcinoma Diseases 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 208000003362 bronchogenic carcinoma Diseases 0.000 description 1
- 230000030833 cell death Effects 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 230000010001 cellular homeostasis Effects 0.000 description 1
- 201000010881 cervical cancer Diseases 0.000 description 1
- HQSSEGBEYORUBY-WPWMEQJKSA-N chembl597845 Chemical compound C=1C=CC(\N=C\C=2C3=CC=CC=C3C=CC=2O)=CC=1NC(=O)C(C)C1=CC=CC=C1 HQSSEGBEYORUBY-WPWMEQJKSA-N 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 201000010240 chromophobe renal cell carcinoma Diseases 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 206010073251 clear cell renal cell carcinoma Diseases 0.000 description 1
- 230000035602 clotting Effects 0.000 description 1
- 201000010276 collecting duct carcinoma Diseases 0.000 description 1
- 238000002591 computed tomography Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 208000002445 cystadenocarcinoma Diseases 0.000 description 1
- 238000002574 cystoscopy Methods 0.000 description 1
- 230000001086 cytosolic effect Effects 0.000 description 1
- 229950005259 dacinostat Drugs 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000009110 definitive therapy Methods 0.000 description 1
- 230000001934 delay Effects 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- NIJJYAXOARWZEE-UHFFFAOYSA-N di-n-propyl-acetic acid Natural products CCCC(C(O)=O)CCC NIJJYAXOARWZEE-UHFFFAOYSA-N 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 230000003467 diminishing effect Effects 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000012377 drug delivery Methods 0.000 description 1
- 229950005837 entinostat Drugs 0.000 description 1
- 208000037828 epithelial carcinoma Diseases 0.000 description 1
- 238000013401 experimental design Methods 0.000 description 1
- 238000009093 first-line therapy Methods 0.000 description 1
- 108010003374 fms-Like Tyrosine Kinase 3 Proteins 0.000 description 1
- 229950010415 givinostat Drugs 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 201000002222 hemangioblastoma Diseases 0.000 description 1
- 206010073071 hepatocellular carcinoma Diseases 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 239000003018 immunosuppressive agent Substances 0.000 description 1
- 239000005414 inactive ingredient Substances 0.000 description 1
- 230000008595 infiltration Effects 0.000 description 1
- 238000001764 infiltration Methods 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- 229960004768 irinotecan Drugs 0.000 description 1
- UWKQSNNFCGGAFS-XIFFEERXSA-N irinotecan Chemical compound C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 UWKQSNNFCGGAFS-XIFFEERXSA-N 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 201000007785 kidney angiomyolipoma Diseases 0.000 description 1
- 201000010982 kidney cancer Diseases 0.000 description 1
- 210000000244 kidney pelvis Anatomy 0.000 description 1
- 208000011080 lentigo maligna melanoma Diseases 0.000 description 1
- 206010024627 liposarcoma Diseases 0.000 description 1
- 201000005296 lung carcinoma Diseases 0.000 description 1
- 208000037829 lymphangioendotheliosarcoma Diseases 0.000 description 1
- 208000012804 lymphangiosarcoma Diseases 0.000 description 1
- 238000002595 magnetic resonance imaging Methods 0.000 description 1
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 238000002483 medication Methods 0.000 description 1
- 208000023356 medullary thyroid gland carcinoma Diseases 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 229950007812 mocetinostat Drugs 0.000 description 1
- 201000003731 mucosal melanoma Diseases 0.000 description 1
- 208000001611 myxosarcoma Diseases 0.000 description 1
- BYVHZKAHBXINPL-UHFFFAOYSA-N n'-hydroxy-n-(4-iodophenyl)octanediamide Chemical compound ONC(=O)CCCCCCC(=O)NC1=CC=C(I)C=C1 BYVHZKAHBXINPL-UHFFFAOYSA-N 0.000 description 1
- KXWWYFKVBFUVIZ-SGWCAAJKSA-N n'-hydroxy-n-[(e)-[4-(n-phenylanilino)phenyl]methylideneamino]octanediamide Chemical compound C1=CC(/C=N/NC(=O)CCCCCCC(=O)NO)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 KXWWYFKVBFUVIZ-SGWCAAJKSA-N 0.000 description 1
- JRZGPWOEHDOVMC-UHFFFAOYSA-N n-hydroxynaphthalene-1-carboxamide Chemical compound C1=CC=C2C(C(=O)NO)=CC=CC2=C1 JRZGPWOEHDOVMC-UHFFFAOYSA-N 0.000 description 1
- 208000025189 neoplasm of testis Diseases 0.000 description 1
- 201000000032 nodular malignant melanoma Diseases 0.000 description 1
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 1
- 230000000683 nonmetastatic effect Effects 0.000 description 1
- 201000011330 nonpapillary renal cell carcinoma Diseases 0.000 description 1
- 201000008968 osteosarcoma Diseases 0.000 description 1
- 229960001592 paclitaxel Drugs 0.000 description 1
- 201000002528 pancreatic cancer Diseases 0.000 description 1
- 208000008443 pancreatic carcinoma Diseases 0.000 description 1
- 208000021010 pancreatic neuroendocrine tumor Diseases 0.000 description 1
- 208000004019 papillary adenocarcinoma Diseases 0.000 description 1
- 201000010198 papillary carcinoma Diseases 0.000 description 1
- 201000010279 papillary renal cell carcinoma Diseases 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 208000024724 pineal body neoplasm Diseases 0.000 description 1
- 201000004123 pineal gland cancer Diseases 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000002250 progressing effect Effects 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 108060006633 protein kinase Proteins 0.000 description 1
- 238000001959 radiotherapy Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 201000010174 renal carcinoma Diseases 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 208000037803 restenosis Diseases 0.000 description 1
- 235000021283 resveratrol Nutrition 0.000 description 1
- 229940016667 resveratrol Drugs 0.000 description 1
- 201000009410 rhabdomyosarcoma Diseases 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 201000008407 sebaceous adenocarcinoma Diseases 0.000 description 1
- 238000011519 second-line treatment Methods 0.000 description 1
- 125000003607 serino group Chemical group [H]N([H])[C@]([H])(C(=O)[*])C(O[H])([H])[H] 0.000 description 1
- 230000019491 signal transduction Effects 0.000 description 1
- 208000000649 small cell carcinoma Diseases 0.000 description 1
- 208000000587 small cell lung carcinoma Diseases 0.000 description 1
- 210000004872 soft tissue Anatomy 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 230000035882 stress Effects 0.000 description 1
- 208000030457 superficial spreading melanoma Diseases 0.000 description 1
- 201000010965 sweat gland carcinoma Diseases 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 229950011110 tacedinaline Drugs 0.000 description 1
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 1
- 229960004964 temozolomide Drugs 0.000 description 1
- 201000003120 testicular cancer Diseases 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000003325 tomography Methods 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- 208000009999 tuberous sclerosis Diseases 0.000 description 1
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 description 1
- 238000002604 ultrasonography Methods 0.000 description 1
- 210000000626 ureter Anatomy 0.000 description 1
- 210000003708 urethra Anatomy 0.000 description 1
- 208000010570 urinary bladder carcinoma Diseases 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- MSRILKIQRXUYCT-UHFFFAOYSA-M valproate semisodium Chemical compound [Na+].CCCC(C(O)=O)CCC.CCCC(C([O-])=O)CCC MSRILKIQRXUYCT-UHFFFAOYSA-M 0.000 description 1
- 229960000604 valproic acid Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Images
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K38/00—Medicinal preparations containing peptides
- A61K38/04—Peptides having up to 20 amino acids in a fully defined sequence; Derivatives thereof
- A61K38/15—Depsipeptides; Derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/16—Amides, e.g. hydroxamic acids
- A61K31/18—Sulfonamides
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/335—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin
- A61K31/337—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin having four-membered rings, e.g. taxol
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/40—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with one nitrogen as the only ring hetero atom, e.g. sulpiride, succinimide, tolmetin, buflomedil
- A61K31/403—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with one nitrogen as the only ring hetero atom, e.g. sulpiride, succinimide, tolmetin, buflomedil condensed with carbocyclic rings, e.g. carbazole
- A61K31/404—Indoles, e.g. pindolol
- A61K31/4045—Indole-alkylamines; Amides thereof, e.g. serotonin, melatonin
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/40—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with one nitrogen as the only ring hetero atom, e.g. sulpiride, succinimide, tolmetin, buflomedil
- A61K31/407—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with one nitrogen as the only ring hetero atom, e.g. sulpiride, succinimide, tolmetin, buflomedil condensed with other heterocyclic ring systems, e.g. ketorolac, physostigmine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/4353—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom ortho- or peri-condensed with heterocyclic ring systems
- A61K31/436—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom ortho- or peri-condensed with heterocyclic ring systems the heterocyclic ring system containing a six-membered ring having oxygen as a ring hetero atom, e.g. rapamycin
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
- A61K31/4523—Non condensed piperidines, e.g. piperocaine containing further heterocyclic ring systems
- A61K31/454—Non condensed piperidines, e.g. piperocaine containing further heterocyclic ring systems containing a five-membered ring with nitrogen as a ring hetero atom, e.g. pimozide, domperidone
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/506—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim not condensed and containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/70—Carbohydrates; Sugars; Derivatives thereof
- A61K31/7042—Compounds having saccharide radicals and heterocyclic rings
- A61K31/7052—Compounds having saccharide radicals and heterocyclic rings having nitrogen as a ring hetero atom, e.g. nucleosides, nucleotides
- A61K31/706—Compounds having saccharide radicals and heterocyclic rings having nitrogen as a ring hetero atom, e.g. nucleosides, nucleotides containing six-membered rings with nitrogen as a ring hetero atom
- A61K31/7064—Compounds having saccharide radicals and heterocyclic rings having nitrogen as a ring hetero atom, e.g. nucleosides, nucleotides containing six-membered rings with nitrogen as a ring hetero atom containing condensed or non-condensed pyrimidines
- A61K31/7068—Compounds having saccharide radicals and heterocyclic rings having nitrogen as a ring hetero atom, e.g. nucleosides, nucleotides containing six-membered rings with nitrogen as a ring hetero atom containing condensed or non-condensed pyrimidines having oxo groups directly attached to the pyrimidine ring, e.g. cytidine, cytidylic acid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K33/00—Medicinal preparations containing inorganic active ingredients
- A61K33/24—Heavy metals; Compounds thereof
- A61K33/243—Platinum; Compounds thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K45/00—Medicinal preparations containing active ingredients not provided for in groups A61K31/00 - A61K41/00
- A61K45/06—Mixtures of active ingredients without chemical characterisation, e.g. antiphlogistics and cardiaca
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K47/00—Medicinal preparations characterised by the non-active ingredients used, e.g. carriers or inert additives; Targeting or modifying agents chemically bound to the active ingredient
- A61K47/30—Macromolecular organic or inorganic compounds, e.g. inorganic polyphosphates
- A61K47/42—Proteins; Polypeptides; Degradation products thereof; Derivatives thereof, e.g. albumin, gelatin or zein
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/0012—Galenical forms characterised by the site of application
- A61K9/0019—Injectable compositions; Intramuscular, intravenous, arterial, subcutaneous administration; Compositions to be administered through the skin in an invasive manner
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/48—Preparations in capsules, e.g. of gelatin, of chocolate
- A61K9/50—Microcapsules having a gas, liquid or semi-solid filling; Solid microparticles or pellets surrounded by a distinct coating layer, e.g. coated microspheres, coated drug crystals
- A61K9/51—Nanocapsules; Nanoparticles
- A61K9/5107—Excipients; Inactive ingredients
- A61K9/513—Organic macromolecular compounds; Dendrimers
- A61K9/5169—Proteins, e.g. albumin, gelatin
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K39/00—Medicinal preparations containing antigens or antibodies
- A61K2039/555—Medicinal preparations containing antigens or antibodies characterised by a specific combination antigen/adjuvant
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2300/00—Mixtures or combinations of active ingredients, wherein at least one active ingredient is fully defined in groups A61K31/00 - A61K41/00
Definitions
- compositions for the treatment of a solid tumor by administering compositions comprising nanoparticles that comprise an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin in combination with a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin in combination with a second therapeutic agent.
- the mammalian target of rapamycin is a conserved serine/threonine kinase that serves as a central hub of signaling in the cell to integrate intracellular and extracellular signals and to regulate cellular growth and homeostasis.
- Activation of the mTOR pathway is associated with cell proliferation and survival, while inhibition of mTOR signaling leads to inflammation and cell death.
- Dysregulation of the mTOR signaling pathway has been implicated in an increasing number of human diseases, including cancer and autoimmune disorders. Consequently, mTOR inhibitors have found wide applications in treating diverse pathological conditions such as solid tumors, hematological malignancies, organ transplantation, restenosis, and rheumatoid arthritis.
- Sirolimus (INN/USAN), also known as rapamycin, is an immunosuppressant drug used to prevent rejection in organ transplantation; it is especially useful in kidney transplants.
- Sirolimus-eluting stents were approved in the United States to treat coronary restenosis. Additionally, sirolimus has been demonstrated as an effective inhibitor of tumor growth in various cell lines and animal models.
- Other limus drugs, such as analogs of sirolimus have been designed to improve the pharmacokinetic and pharmacodynamic properties of sirolimus. For example, Temsirolimus was approved in the United States and Europe for the treatment of renal cell carcinoma. Everolimus was approved in the U.S.
- sirolimus for treatment of advanced breast cancer, pancreatic neuroendocrine tumors, advanced renal cell carcinoma, and subependymal giant cell astrocytoma (SEGA) associated with Tuberous Sclerosis.
- the mode of action of sirolimus is to bind the cytosolic protein FK-binding protein 12 (FKBP12), and the sirolimus-FKBP12 complex in turn inhibits the mTOR pathway by directly binding to the mTOR Complex 1 (mTORC1).
- FKBP12 cytosolic protein FK-binding protein 12
- mTORC1 mTOR Complex 1
- Albumin-based nanoparticle compositions have been developed as a drug delivery system for delivering substantially water insoluble drugs. See, for example, U.S. Pat. Nos. 5,916,596; 6,506,405; 6,749,868, and 6,537,579, 7,820,788, and 7,923,536.
- Abraxane® an albumin stabilized nanoparticle formulation of paclitaxel
- Albumin derived from human blood has been used for the manufacture of Abraxane® as well as various other albumin-based nanoparticle compositions.
- the present invention provides methods of treating a solid tumor (such as bladder cancer, renal cell carcinoma, or melanoma) in an individual, comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- the mTOR inhibitor nanoparticle composition such as sirolimus/albumin nanoparticle composition
- the second therapeutic agent act synergistically to inhibit cell proliferation.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor is sirolimus.
- the albumin is human albumin (such as human serum albumin).
- the nanoparticles comprise sirolimus or a derivative thereof associated (e.g., coated) with albumin.
- the nanoparticles comprise sirolimus or a derivative thereof coated with albumin.
- the average particle size of the nanoparticles in the mTOR inhibitor nanoparticle composition (such as sirolimus/albumin nanoparticle composition) is no greater than about 150 nm (such as no greater than about 120 nm).
- the average particle size of the nanoparticles in the mTOR inhibitor nanoparticle composition is no more than about 120 nm.
- the nanoparticles in the mTOR inhibitor nanoparticle composition are sterile filterable.
- the mTOR inhibitor nanoparticle composition comprises the albumin stabilized nanoparticle formulation of sirolimus (nab-sirolimus, a formulation of sirolimus stabilized by human albumin USP, where the weight ratio of human albumin and sirolimus is about 8:1 to about 9:1).
- the mTOR inhibitor nanoparticle composition is nab-sirolimus. In some embodiments, the mTOR inhibitor nanoparticle composition is administered intravenously, intraarterially, intraperitoneally, intravesicularly, subcutaneously, intrathecally, intrapulmonarily, intramuscularly, intratracheally, intraocularly, transdermally, orally, or by inhalation. In some embodiments, the mTOR inhibitor nanoparticle composition is administered intravenously. In some embodiments, the mTOR inhibitor nanoparticle composition is administered subcutaneously. In some embodiments, the individual is a human.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the second therapeutic agent is an immunomodulator that stimulates the immune system (hereinafter also referred to as an “immunostimulator”).
- the immunomodulator is an agonistic antibody that targets an activating receptor (including co-stimulatory receptors) on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the second therapeutic agent is an immunomodulator selected from the group consisting of pomalidomide and lenalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat.
- the second therapeutic agent is a kinase inhibitor.
- the kinase inhibitor is selected from the group consisting of nilotinib and sorafenib.
- the second therapeutic agent is a cancer vaccine.
- the cancer vaccine is a vaccine prepared from a tumor cell or a vaccine prepared from at least one tumor-associated antigen.
- the solid tumor is selected from the group consisting of bladder cancer, renal cell carcinoma, and melanoma. In some embodiments, the solid tumor is a relapsed solid tumor. In some embodiments, the solid tumor is refractory to a standard therapy for the solid tumor.
- the solid tumor is bladder cancer
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine.
- the solid tumor is renal cell carcinoma
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine.
- the solid tumor is melanoma
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine.
- the mTOR inhibitor nanoparticle composition (such as sirolimus/albumin nanoparticle composition) and the second therapeutic agent are administered simultaneously.
- the mTOR inhibitor nanoparticle composition (such as sirolimus/albumin nanoparticle composition) and the second therapeutic agent are not administered simultaneously.
- the mTOR inhibitor nanoparticle composition (such as sirolimus/albumin nanoparticle composition) and the second therapeutic agent are administered sequentially.
- the mTOR inhibitor nanoparticle composition (such as sirolimus/albumin nanoparticle composition) and the second therapeutic agent are present in amounts that produce a synergistic effect in the treatment of a solid tumor (such as bladder cancer, renal cell carcinoma, or melanoma) in an individual in need thereof.
- a solid tumor such as bladder cancer, renal cell carcinoma, or melanoma
- the method is carried out in a neoadjuvant setting. In some embodiments, the method is carried out in an adjuvant setting.
- the solid tumor is refractory to a standard therapy or recurrent after the standard therapy.
- the treatment is first line treatment. In some embodiments, the treatment is second line treatment.
- the individual has progressed from an earlier therapy for a solid tumor. In some embodiments, the individual is refractory to an earlier therapy for a solid tumor. In some embodiments, the individual has recurrent solid tumor.
- the amount of the nanoparticles in the mTOR inhibitor nanoparticle composition is about 10 mg/m 2 to about 200 mg/m 2 (such as about any of 10, 20, 30, 45, 75, 100, 150, or 200 mg/m 2 , including any range between these values). In some embodiments, the amount of the nanoparticles in the mTOR inhibitor nanoparticle composition (such as sirolimus/albumin nanoparticle composition) is about 45 mg/m 2 . In some embodiments, the amount of the nanoparticles in the mTOR inhibitor nanoparticle composition (such as sirolimus/albumin nanoparticle composition) is about 75 mg/m 2 .
- the amount of the nanoparticles in the mTOR inhibitor nanoparticle composition is about 100 mg/m 2 .
- the mTOR inhibitor nanoparticle composition (such as sirolimus/albumin nanoparticle composition) is administered weekly (such as 3 out of 4 weeks).
- the mTOR inhibitor nanoparticle composition (such as sirolimus/albumin nanoparticle composition) is administered at least twice (such as at least 2, 3, or 4 times) in a 28-day cycle for at least one (such at least 2, 3, 4, 5, 6, 7, 8, 9, 10, or more) cycle.
- the mTOR inhibitor nanoparticle composition (such as sirolimus/albumin nanoparticle composition) is administered at least twice (such as at least 2, 3, or 4 times) at weekly intervals in a 28-day cycle (such as on days 1, 8, and 15 of the 28-day cycle) for at least one (such at least 2, 3, 4, 5, 6, 7, 8, 9, 10, or more) cycle.
- the mTOR inhibitor nanoparticle composition (such as sirolimus/albumin nanoparticle composition) is administered three times in a 28-day cycle (such as on days 1, 8, and 15 of the 28-day cycle) for at least one (such at least 2, 3, 4, 5, 6, 7, 8, 9, 10, or more) cycle.
- the method further comprises selecting the individual for treatment based on the presence of at least one mTOR-activating aberration.
- the mTOR-activating aberration comprises a mutation in an mTOR-associated gene.
- the mTOR-activating aberration is in at least one mTOR-associated gene selected from the group consisting of protein kinase B (PKB/Akt), fms-like tyrosine kinase 3 internal tandem duplication (FLT-3ITD), mechanistic target of rapamycin (mTOR), phosphoinositide 3-kinase (PI3K), TSC1, TSC2, RHEB, STK11, NF1, NF2, Kirsten rat sarcoma viral oncogene homolog (KRAS), neuroblastoma RAS viral (v-ras) oncogene homolog (NRAS) and PTEN.
- the treatment is based on the presence of at least one genetic variant in a gene selected from the group consisting of drug metabolism genes, cancer genes, and drug target genes.
- the method further comprises selecting the individual for treatment based on the presence of at least one biomarker indicative of favorable response to treatment with an immunomodulator.
- the at least one biomarker comprises a mutation in an immunomodulator-associated gene.
- the method further comprises selecting the individual for treatment based on the presence of at least one biomarker indicative of favorable response to treatment with a histone deacetylase inhibitor (HDACi).
- HDACi histone deacetylase inhibitor
- the at least one biomarker comprises a mutation in an HDACi-associated gene.
- the method further comprises selecting the individual for treatment based on the presence of at least one biomarker indicative of favorable response to treatment with a kinase inhibitor.
- the at least one biomarker comprises a mutation in a kinase inhibitor-associated gene.
- the method further comprises selecting the individual for treatment based on the presence of at least one biomarker indicative of favorable response to treatment with a cancer vaccine.
- the at least one biomarker comprises a tumor-associated antigen (TAA) expressed in tumor cells in the individual, such as an aberrantly expressed protein or a neo-antigen.
- TAA tumor-associated antigen
- the methods described herein can be used for any one or more of the following purposes: alleviating one or more symptoms of a solid tumor, delaying progressing of a solid tumor, shrinking tumor size in a solid tumor patient, inhibiting solid tumor growth, prolonging overall survival, prolonging disease-free survival, prolonging time to tumor progression, preventing or delaying metastasis, reducing (such as eradicating) preexisting metastasis, reducing incidence or burden of preexisting metastasis, and preventing recurrence of solid tumor.
- FIG. 1 shows the experimental design schema for a Phase I clinical study in pediatric patients of ABI-009 as a single agent and in combination with temozolomide and irinotecan.
- the present invention provides methods and compositions for treating a solid tumor (such as bladder cancer, renal cell carcinoma, or melanoma) in an individual by administering to the individual a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin (hereinafter also referred to as an “mTOR inhibitor nanoparticle composition”) in conjunction with a second therapeutic agent.
- mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin hereinafter also referred to as an “mTOR inhibitor nanoparticle composition”
- the second therapeutic agent may be an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), or a cancer vaccine (such as a vaccine prepared from a tumor cell or a vaccine prepared from at least one tumor-associated antigen).
- an immunomodulator such as an immunostimulator or an immune checkpoint inhibitor
- a histone deacetylase inhibitor such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor
- a cancer vaccine such as a vaccine prepared from a tumor cell or a vaccine prepared from at least one tumor-associated antigen.
- compositions such as pharmaceutical compositions
- kits and unit dosages useful for the methods described herein.
- nab stands for nanoparticle albumin-bound
- nab-sirolimus is an albumin stabilized nanoparticle formulation of sirolimus.
- nab-sirolimus is also known as nab-rapamycin, which has been previously described. See, for example, WO2008109163A1, WO2014151853, WO2008137148A2, and WO2012149451A1, each of which is incorporated herein by reference in their entirety.
- beneficial or desired clinical results include, but are not limited to, one or more of the following: alleviating one or more symptoms resulting from the disease, diminishing the extent of the disease, stabilizing the disease (e.g., preventing or delaying the worsening of the disease), preventing or delaying the spread (e.g., metastasis) of the disease, preventing or delaying the recurrence of the disease, reducing recurrence rate of the disease, delay or slowing the progression of the disease, ameliorating the disease state, providing a remission (partial or total) of the disease, decreasing the dose of one or more other medications required to treat the disease, delaying the progression of the disease, increasing the quality of life, and/or prolonging survival.
- the treatment reduces the severity of one or more symptoms associated with cancer by at least about any of 10%, 20%, 30%, 40%, 50%, 60%, 70%, 80%, 90%, 95% or 100% compared to the corresponding symptom in the same subject prior to treatment or compared to the corresponding symptom in other subjects not receiving the treatment.
- treatment is a reduction of pathological consequence of cancer. The methods of the invention contemplate any one or more of these aspects of treatment.
- recurrence refers to the return of a cancer or disease after clinical assessment of the disappearance of disease. A diagnosis of distant metastasis or local recurrence can be considered a relapse.
- refractory or “resistant” refers to a cancer or disease that has not responded to treatment.
- an “at risk” individual is an individual who is at risk of developing cancer.
- An individual “at risk” may or may not have detectable disease, and may or may not have displayed detectable disease prior to the treatment methods described herein.
- At risk denotes that an individual has one or more so-called risk factors, which are measurable parameters that correlate with development of cancer, which are described herein. An individual having one or more of these risk factors has a higher probability of developing cancer than an individual without these risk factor(s).
- “Adjuvant setting” refers to a clinical setting in which an individual has had a history of cancer, and generally (but not necessarily) been responsive to therapy, which includes, but is not limited to, surgery (e.g., surgery resection), radiotherapy, and chemotherapy. However, because of their history of cancer, these individuals are considered at risk of development of the disease. Treatment or administration in the “adjuvant setting” refers to a subsequent mode of treatment. The degree of risk (e.g., when an individual in the adjuvant setting is considered as “high risk” or “low risk”) depends upon several factors, most usually the extent of disease when first treated.
- “Neoadjuvant setting” refers to a clinical setting in which the method is carried out before the primary/definitive therapy.
- “delaying” the development of cancer means to defer, hinder, slow, retard, stabilize, and/or postpone development of the disease. This delay can be of varying lengths of time, depending on the history of the disease and/or individual being treated. As is evident to one skilled in the art, a sufficient or significant delay can, in effect, encompass prevention, in that the individual does not develop the disease.
- a method that “delays” development of cancer is a method that reduces probability of disease development in a given time frame and/or reduces the extent of the disease in a given time frame, when compared to not using the method. Such comparisons are typically based on clinical studies, using a statistically significant number of subjects.
- Cancer development can be detectable using standard methods, including, but not limited to, computerized axial tomography (CAT scan), Magnetic Resonance Imaging (MRI), ultrasound, clotting tests, arteriography, biopsy, urine cytology, and cystoscopy. Development may also refer to cancer progression that may be initially undetectable and includes occurrence, recurrence, and onset.
- CAT scan computerized axial tomography
- MRI Magnetic Resonance Imaging
- ultrasound ultrasound
- clotting tests arteriography
- biopsy biopsy
- urine cytology urine cytology
- cystoscopy cystoscopy
- an effective amount refers to an amount of a compound or composition sufficient to treat a specified disorder, condition or disease such as ameliorate, palliate, lessen, and/or delay one or more of its symptoms.
- an effective amount comprises an amount sufficient to cause a tumor to shrink and/or to decrease the growth rate of the tumor (such as to suppress tumor growth) or to prevent or delay other unwanted cell proliferation in cancer.
- an effective amount is an amount sufficient to delay development of cancer.
- an effective amount is an amount sufficient to prevent or delay recurrence.
- an effective amount is an amount sufficient to reduce recurrence rate in the individual.
- An effective amount can be administered in one or more administrations.
- the effective amount of the drug or composition may: (i) reduce the number of cancer cells; (ii) reduce tumor size; (iii) inhibit, retard, slow to some extent and preferably stop cancer cell infiltration into peripheral organs; (iv) inhibit (i.e., slow to some extent and preferably stop) tumor metastasis; (v) inhibit tumor growth; (vi) prevent or delay occurrence and/or recurrence of tumor; (vii) reduce recurrence rate of tumor, and/or (viii) relieve to some extent one or more of the symptoms associated with the cancer.
- an “effective amount” may be in one or more doses, i.e., a single dose or multiple doses may be required to achieve the desired treatment endpoint.
- An effective amount may be considered in the context of administering one or more therapeutic agents, and a nanoparticle composition (e.g., a composition including sirolimus and an albumin) may be considered to be given in an effective amount if, in conjunction with one or more other agents, a desirable or beneficial result may be or is achieved.
- the components (e.g., the first and second therapies) in a combination therapy of the invention may be administered sequentially, simultaneously, or concurrently using the same or different routes of administration for each component.
- an effective amount of a combination therapy includes an amount of the first therapy and an amount of the second therapy that when administered sequentially, simultaneously, or concurrently produces a desired outcome.
- “In conjunction with” or “in combination with” refers to administration of one treatment modality in addition to another treatment modality, such as administration of a nanoparticle composition described herein in addition to administration of the other agent to the same individual under the same treatment plan.
- “in conjunction with” or “in combination with” refers to administration of one treatment modality before, during or after delivery of the other treatment modality to the individual.
- first therapy and second therapy in a combination therapy are administered with a time separation of no more than about 15 minutes, such as no more than about any of 10, 5, or 1 minutes.
- first and second therapies may be contained in the same composition (e.g., a composition comprising both a first and second therapy) or in separate compositions (e.g., a first therapy is contained in one composition and a second therapy is contained in another composition).
- the term “sequential administration” means that the first therapy and second therapy in a combination therapy are administered with a time separation of more than about 15 minutes, such as more than about any of 20, 30, 40, 50, 60, or more minutes. Either the first therapy or the second therapy may be administered first.
- the first and second therapies are contained in separate compositions, which may be contained in the same or different packages or kits.
- the term “concurrent administration” means that the administration of the first therapy and that of a second therapy in a combination therapy overlap with each other.
- telomere binding e.g., a protein and an enzyme
- a particular target e.g., a protein and an enzyme
- the compound has a higher affinity, a higher avidity, a higher binding coefficient, or a lower dissociation coefficient for a particular target.
- the specificity or selectivity of a compound for a particular target can be measured, determined, or assessed by using various methods well known in the art. For example, the specificity or selectivity can be measured, determined, or assessed by measuring the IC 50 of a compound for a target.
- a compound is specific or selective for a target when the IC 50 of the compound for the target is 2-fold, 4-fold, 6-fold, 8-fold, 10-fold, 20-fold, 50-fold, 100-fold, 500-fold, 1000-fold, or more lower than the IC 50 of the same compound for a non-target.
- the IC 50 of a histone deacetylase inhibitor of the present invention for HDACs is 2-fold, 4-fold, 6-fold, 8-fold, 10-fold, 20-fold, 50-fold, 100-fold, 500-fold, 1000-fold, or more lower than the IC 50 of the same histone deacetylase inhibitor for non-HDACs.
- the IC 50 of a histone deacetylase inhibitor of the present invention for class-I HDACs is 2-fold, 4-fold, 6-fold, 8-fold, 10-fold, 20-fold, 50-fold, 100-fold, 500-fold, 1000-fold, or more lower than the IC 50 of the same histone deacetylase inhibitor for other HDACs (e.g., class-II HDACs).
- the IC 50 of a histone deacetylase inhibitor of the present invention for HDAC3 is 2-fold, 4-fold, 6-fold, 8-fold, 10-fold, 20-fold, 50-fold, 100-fold, 500-fold, 1000-fold, or more lower than the IC 50 of the same histone deacetylase inhibitor for other HDACs (e.g., HDAC1, 2, or 6).
- IC 50 can be determined by commonly known methods in the art.
- pharmaceutically acceptable or “pharmacologically compatible” is meant a material that is not biologically or otherwise undesirable, e.g., the material may be incorporated into a pharmaceutical composition administered to a patient without causing any significant undesirable biological effects or interacting in a deleterious manner with any of the other components of the composition in which it is contained.
- Pharmaceutically acceptable carriers or excipients have preferably met the required standards of toxicological and manufacturing testing and/or are included on the Inactive Ingredient Guide prepared by the U.S. Food and Drug administration.
- references to “about” a value or parameter herein includes (and describes) variations that are directed to that value or parameter per se. For example, description referring to “about X” includes description of “X”.
- reference to “not” a value or parameter generally means and describes “other than” a value or parameter.
- the method is not used to treat cancer of type X means the method is used to treat cancer of types other than X.
- the present invention provides methods of treating a solid tumor (such as bladder cancer, renal cell carcinoma, or melanoma) in an individual (such as a human) comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- a solid tumor such as bladder cancer, renal cell carcinoma, or melanoma
- an individual such as a human
- an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the solid tumor includes, but is not limited to, sarcomas and carcinomas such as fibrosarcoma, myxosarcoma, liposarcoma, chondrosarcoma, osteogenic sarcoma, chordoma, angiosarcoma, endotheliosarcoma, lymphangiosarcoma, lymphangioendotheliosarcoma, Kaposi's sarcoma, soft tissue sarcoma, uterine sacronomasynovioma, mesothelioma, Ewing's tumor, leiomyosarcoma, rhabdomyosarcoma, colon carcinoma, pancreatic cancer, breast cancer, ovarian cancer, prostate cancer, squamous cell carcinoma, basal cell carcinoma, adenocarcinoma, sweat gland carcinoma, sebaceous gland carcinoma, papillary carcinoma, papillary adenocarcinomas, cystadenocarcinoma, me
- a method of treating a solid tumor such as bladder cancer, renal cell carcinoma, or melanoma in an individual (such as a human) comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, and wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin
- the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), and wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus. In some embodiments, the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor).
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor.
- the histone deacetylase inhibitor is specific to only one HDAC.
- the histone deacetylase inhibitor is specific to only one class of HDAC.
- the histone deacetylase inhibitor is specific to two or more HDACs or two or more classes of HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class I and II HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class III HDACs. In some embodiments, the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor. In some embodiments, the kinase inhibitor is a Raf kinase inhibitor. In some embodiments, the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase). In some embodiments, the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen.
- the second therapeutic agent and the nanoparticle composition are administered sequentially.
- the second therapeutic agent and the nanoparticle composition are administered simultaneously.
- the second therapeutic agent and the nanoparticle composition are administered concurrently.
- the solid tumor is selected from the group consisting of bladder cancer, renal cell carcinoma, and melanoma.
- the solid tumor is a relapsed or refractory solid tumor.
- a method of treating a solid tumor such as bladder cancer, renal cell carcinoma, or melanoma in an individual (such as a human) comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent, wherein the nanoparticle composition and the second therapeutic agent are administered concurrently.
- the administrations of the nanoparticle composition and the second therapeutic agent are initiated at about the same time (for example, within any one of 1, 2, 3, 4, 5, 6, or 7 days).
- the administrations of the nanoparticle composition and the second therapeutic agent are terminated at about the same time (for example, within any one of 1, 2, 3, 4, 5, 6, or 7 days).
- the administration of the second therapeutic agent continues (for example for about any one of 0.5, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, or 12 months) after the termination of the administration of the nanoparticle composition.
- the administration of the second therapeutic agent is initiated after (for example after about any one of 0.5, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, or 12 months) the initiation of the administration of the nanoparticle composition.
- the administrations of the nanoparticle composition and the second therapeutic agent are initiated and terminated at about the same time.
- the administrations of the nanoparticle composition and the second therapeutic agent are initiated at about the same time and the administration of the second therapeutic agent continues (for example for about any one of 0.5, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, or 12 months) after the termination of the administration of the nanoparticle composition.
- the administration of the nanoparticle composition and the second therapeutic agent stop at about the same time and the administration of the second therapeutic agent is initiated after (for example after about any one of 0.5, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, or 12 months) the initiation of the administration of the nanoparticle composition.
- the administration of the nanoparticle composition and the second therapeutic agent stop at about the same time and the administration of the nanoparticle composition is initiated after (for example after about any one of 0.5, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, or 12 months) the initiation of the administration of the second therapeutic agent.
- mTOR inhibitor used herein refers to inhibitors of mTOR.
- mTOR is a serine/threonine-specific protein kinase downstream of the phosphatidylinositol 3-kinase (PI3K)/Akt (protein kinase B) pathway, and a key regulator of cell survival, proliferation, stress, and metabolism.
- PI3K phosphatidylinositol 3-kinase
- Akt protein kinase B pathway
- mTOR pathway dysregulation has been found in many human carcinomas, and mTOR inhibition produced substantial inhibitory effects on tumor progression.
- the mTOR inhibitor is an mTOR kinase inhibitor.
- mTOR inhibitors described herein include, but are not limited to, BEZ235 (NVP-BEZ235), everolimus (also known as RAD001, Zortress, Certican, and Afinitor), rapamycin (also known as sirolimus or Rapamune), AZD8055, temsirolimus (also known as CCI-779 and Torisel), CC-115, CC-223, PI-103, Ku-0063794, INK 128, AZD2014, NVP-BGT226, PF-04691502, CH5132799, GDC-0980 (RG7422), Torin 1, WAY-600, WYE-125132, WYE-687, GSK2126458, PF-05212384 (PKI-587), PP-121, OSI-027, Palomid 529, PP242, XL765, GSK1059615, WYE-354, and ridaforolimus (also known as deforolimus).
- BEZ235 NVP-B
- the mTOR inhibitor is a limus drug, which includes sirolimus and its analogs.
- limus drugs include, but are not limited to, temsirolimus (CCI-779), everolimus (RAD001), ridaforolimus (AP-23573), deforolimus (MK-8669), zotarolimus (ABT-578), pimecrolimus, and tacrolimus (FK-506).
- the limus drug is selected from the group consisting of temsirolimus (CCI-779), everolimus (RAD001), ridaforolimus (AP-23573), deforolimus (MK-8669), zotarolimus (ABT-578), pimecrolimus, and tacrolimus (FK-506).
- the mTOR inhibitor is an mTOR kinase inhibitor, such as CC-115 or CC-223.
- a method of treating a solid tumor comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor is selected from the group consisting of BEZ235 (NVP-BEZ235), everolimus (also known as RAD001, Zortress, Certican, and Afinitor), rapamycin (also known as sirolimus or Rapamune), AZD8055, temsirolimus (also known as CCI-779 and Torisel), CC-115, CC-223, PI-103, Ku-0063794, INK 128, AZD2014, NVP-BGT226, PF-04691502, CH5132799, GDC-09
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin wherein the
- a method of treating a solid tumor comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor is a limus drug selected from the group consisting of temsirolimus (CCI-779), everolimus (RAD001), ridaforolimus (AP-23573), deforolimus (MK-8669), zotarolimus (ABT-578), pimecrolimus, and tacrolimus (FK-506); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin wherein the mTOR inhibitor is a limus drug selected from the group consisting of temsirolimus (CCI-779), everolimus (RAD001), rid
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator.
- the immunostimulator directly stimulates the immune system of an individual.
- the immunomodulator is an IMiDs® compound (Celgene).
- IMiDs® compounds are proprietary small molecule, orally available compounds that modulate the immune system and other biological targets through multiple mechanisms of action; IMiDs® compounds include lenalidomide and pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the immunomodulator is selected from the group consisting of a cytokine, a chemokine, a stem cell growth factor, a lymphotoxin, an hematopoietic factor, a colony stimulating factor (CSF), erythropoietin, thrombopoietin, tumor necrosis factor-alpha (TNF), TNF-beta, granulocyte-colony stimulating factor (G-CSF), granulocyte macrophage-colony stimulating factor (GM-CSF), interferon-alpha, interferon-beta, interferon-gamma, interferon-lambda, stem cell growth factor designated “S1 factor”, human growth hormone, N-methionyl human growth hormone, bovine growth hormone, parathyroid hormone, thyroxine, insulin, proinsulin, relaxin, prorelaxin, follicle stimulating hormone (FSH), thyroid stimulating hormone (TSH), luteinizing hormone (LH),
- FSH
- the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is an agonistic antibody that targets an activating receptor (including co-stimulatory receptors) on an immune cell (such as a T cell).
- the immunomodulator is an agonistic antibody selected from the group consisting of anti-CD28, anti-OX40 (such as MEDI6469), anti-GITR (such as TRX518), anti-4-1BB (such as BMS-663513 and PF-05082566), anti-ICOS (such as JTX-2011, Jounce Therapeutics), anti-CD27 (such as Varlilumab and hCD27.15), anti-CD40 (such as CP870,893), and anti-HVEM.
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an antagonistic antibody selected from the group consisting of anti-CTLA4 (such as Ipilimumab and Tremelimumab), anti-PD-1 (such as Nivolumab, Pidilizumab, and Pembrolizumab), anti-PD-L1 (such as MPDL3280A, BMS-936559, MEDI4736, and Avelumab), anti-PD-L2, anti-LAG3 (such as BMS-986016 or C9B7W), anti-B7-1, anti-B7-H3 (such as MGA271), anti-B7-H4, anti-TIM3, anti-BTLA, anti-VISTA, anti-MR (such as Lirilumab and IPH2101), anti-A2aR, anti-CD52 (such as alemtuzumab), anti-IL-10, anti-FasL (such as disclosed in U.S. Pat. No. 9,255,150), anti-IL-35, and anti-TGF
- a method of treating a solid tumor such as bladder cancer, renal cell carcinoma, or melanoma in an individual (such as a human) comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of an immunomodulator.
- a solid tumor such as bladder cancer, renal cell carcinoma, or melanoma
- an individual such as a human
- an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- a method of treating a solid tumor such as bladder cancer, renal cell carcinoma, or melanoma in an individual (such as a human) comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of an immunostimulator.
- a solid tumor such as bladder cancer, renal cell carcinoma, or melanoma
- an individual such as a human
- an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- a method of treating a solid tumor such as bladder cancer, renal cell carcinoma, or melanoma in an individual (such as a human) comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of an immunostimulator that directly stimulates the immune system of an individual.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- a method of treating a solid tumor comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as an albumin
- an IMiDs® compound small molecule immunomodulator, such as lenalidomide or pomalidomide
- a method of treating a solid tumor comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a small molecule or antibody-based IDO inhibitor.
- a solid tumor such as bladder cancer, renal cell carcinoma, or melanoma
- an individual such as a human
- an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a small molecule or antibody-based IDO inhibitor.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- a method of treating a solid tumor comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator) selected from the group consisting of a cytokine, a chemokine, a stem cell growth factor, a lymphotoxin, an hematopoietic factor, a colony stimulating factor (CSF), erythropoietin, thrombopoietin, tumor necrosis factor-alpha (TNF), TNF-beta, granulocyte-colony stimulating factor (G-CSF), granulocyte macrophage-colony stimulating factor (GM-CSF
- a method of treating a solid tumor such as bladder cancer, renal cell carcinoma, or melanoma in an individual (such as a human) comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of an agonist of an activating receptor (including co-stimulatory receptors) on an immune cell (such as a T cell).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the agonist of an activating receptor (including co-stimulatory receptors) on an immune cell is an agonistic antibody selected from the group consisting of anti-CD28, anti-OX40 (such as MEDI6469), anti-ICOS (such as JTX-2011, Jounce Therapeutics), anti-GITR (such as TRX518), anti-4-1BB (such as BMS-663513 and PF-05082566), anti-CD27 (such as Varlilumab and hCD27.15), anti-CD40 (such as CP870,893), and anti-HVEM.
- anti-CD28 such as MEDI6469
- anti-ICOS such as JTX-2011, Jounce Therapeutics
- anti-GITR such as TRX5178
- anti-4-1BB such as BMS-663513 and PF-05082566
- anti-CD27 such as Varlilumab and hCD27.15
- anti-CD40 such as CP870,893
- a method of treating a solid tumor such as bladder cancer, renal cell carcinoma, or melanoma in an individual (such as a human) comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immune checkpoint inhibitor is an antagonistic antibody selected from the group consisting of anti-CTLA4 (such as Ipilimumab and Tremelimumab), anti-PD-1 (such as Nivolumab, Pidilizumab, and Pembrolizumab), anti-PD-L1 (such as MPDL3280A, BMS-936559, MEDI4736, and Avelumab), anti-PD-L2, anti-LAG3 (such as BMS-986016 or C9B7W), anti-B7-1, anti-B7-H3 (such as MGA271), anti-B7-H4, anti-TIM3, anti-BTLA, anti-VISTA, anti-KIR (such as Lirilumab and IPH2101), anti-A2aR, anti-CD52 (such as alemtuzumab), anti-IL-10, anti-FasL, anti-IL-35, and anti-TGF- ⁇ (such as Fresolumimab).
- anti-CTLA4
- the second therapeutic agent is a histone deacetylase inhibitor.
- the histone deacetylase inhibitor is specific to only one HDAC.
- the histone deacetylase inhibitor is specific to only one class of HDAC.
- the histone deacetylase inhibitor is specific to two or more HDACs or two or more classes of HDACs.
- the histone deacetylase inhibitor is specific to class I and II HDACs.
- the histone deacetylase inhibitor is specific to class III HDACs.
- the histone deacetylase inhibitor is selected from the group consisting of vorinostat (SAHA), panobinostat (LBH589), belinostat (PXD101, CAS 414864-00-9), tacedinaline (N-acetyldinaline, CI-994), givinostat (gavinostat, ITF2357), FRM-0334 (EVP-0334), resveratrol (SRT501), CUDC-101, quisinostat (JNJ-26481585), abexinostat (PCI-24781), dacinostat (LAQ824, NVP-LAQ824), valproic acid, 4-(dimethylamino) N-[6-(hydroxyamino)-6-oxohexyl]-benzamide (HDAC1 inhibitor), 4-Iodo suberoylanilide hydroxamic acid (HDAC1 and HDAC6 inhibitor), romidepsin (a cyclic cyclic a
- a method of treating a solid tumor such as bladder cancer, renal cell carcinoma, or melanoma in an individual (such as a human) comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a histone deacetylase inhibitor.
- the histone deacetylase inhibitor is specific to only one HDAC.
- the histone deacetylase inhibitor is specific to only one class of HDAC.
- the histone deacetylase inhibitor is specific to two or more HDACs or two or more classes of HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class I and II HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class III HDACs.
- the histone deacetylase inhibitor is a hydroxamic acid, including, but not limited to, vorinostat (suberoylanilide hydroxamic acid or “SAHA”), trichostatin A (“TSA”), LBH589 (panobinostat), PXD101 (belinostat), oxamflatin, tubacin, seriptaid, NVP-LAQ824, cinnamic acid hydroxamic acid (CBHA), CBHA derivatives, and ITF2357.
- SAHA suberoylanilide hydroxamic acid
- TSA trichostatin A
- LBH589 panobinostat
- PXD101 belinostat
- oxamflatin oxamflatin
- tubacin tubacin
- seriptaid seriptaid
- NVP-LAQ824 cinnamic acid hydroxamic acid
- CBHA cinnamic acid hydroxamic acid
- CBHA derivatives
- the histone deacetylase inhibitor is a benzamide, including, but not limited to, mocetinostat (MGCD0103), benzamide M344, BML-210, entinostat (SNDX-275 or MS-275), pimelic diphenylamide 4b, pimelic diphenylamide 106, MS-994, CI-994 (acetyldinaline, PD 123654, and 4-acetylamino-N-(Uaminophenyl)-benzamide).
- the histone deacetylase inhibitor is romidepsin.
- the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of apatinib, cabozantinib, canertinib, crenolanib, crizotinib, dasatinib, erlotinib, foretinib, fostamatinib, ibrutinib, idelalisib, imatinib, lapatinib, linifanib, motesanib, mubritinib, nilotinib, nintedanib, radotinib, sorafenib, sunitinib, vatalanib, and vemurafenib.
- the second therapeutic agent is the kinase inhibitor nilotinib.
- the second therapeutic agent is the kinase inhibitor sorafenib.
- a method of treating a solid tumor such as bladder cancer, renal cell carcinoma, or melanoma in an individual (such as a human) comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a kinase inhibitor.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor. In some embodiments, the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- a class of kinase e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase.
- the kinase inhibitor is selected from the group consisting of apatinib, cabozantinib, canertinib, crenolanib, crizotinib, dasatinib, erlotinib, foretinib, fostamatinib, ibrutinib, idelalisib, imatinib, lapatinib, linifanib, motesanib, mubritinib, nilotinib, nintedanib, radotinib, sorafenib, sunitinib, vatalanib, and vemurafenib.
- the kinase inhibitor is nilotinib. In some embodiments, the kinase inhibitor is sorafenib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the cancer vaccine is a vaccine prepared using at least one tumor-associated antigen (TAA).
- TAA tumor-associated antigen
- a method of treating a solid tumor comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a cancer vaccine.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the cancer vaccine is a vaccine prepared using at least one tumor-associated antigen (TAA).
- TAA tumor-associated antigen
- references to a second therapeutic agent herein applies to the second therapeutic agent or its derivatives and accordingly the invention contemplates and includes either of these embodiments (second therapeutic agent; second therapeutic agent or derivative(s) thereof).
- “Derivatives” or “analogs” of an agent or other chemical moiety include, but are not limited to, compounds that are structurally similar to the agent or moiety or are in the same general chemical class as the agent or moiety.
- the derivative or analog of the second therapeutic agent or moiety retains similar chemical and/or physical property (including, for example, functionality) of the second therapeutic agent or moiety.
- the method further comprises administering to the individual one or more additional therapeutic agents used in a standard combination therapy with the second therapeutic agent.
- a method of treating a solid tumor such as bladder cancer, renal cell carcinoma, or melanoma
- an individual such as a human
- administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; b) an effective amount of a second therapeutic agent; and c) an effective amount of at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the methods provided herein can be used to treat an individual (e.g., human) who has been diagnosed with or is suspected of having a solid tumor.
- the individual is a human.
- the individual is a clinical patient, a clinical trial volunteer, an experimental animal, etc.
- the individual is younger than about 60 years old (including for example younger than about any of 50, 40, 30, 25, 20, 15, or 10 years old).
- the individual is older than about 60 years old (including for example older than about any of 70, 80, 90, or 100 years old).
- the individual is diagnosed with or genetically prone to one or more of the diseases or disorders described herein (such as bladder cancer, renal cell carcinoma, or melanoma).
- the individual has one or more risk factors associated with one or more diseases or disorders described herein.
- Cancer treatments can be evaluated, for example, by tumor regression, tumor weight or size shrinkage, time to progression, duration of survival, progression free survival, overall response rate, duration of response, quality of life, protein expression and/or activity.
- Approaches to determining efficacy of the therapy can be employed, including for example, measurement of response through radiological imaging.
- the efficacy of treatment is measured as the percentage tumor growth inhibition (% TGI), calculated using the equation 100-(T/C ⁇ 100), where T is the mean relative tumor volume of the treated tumor, and C is the mean relative tumor volume of a non-treated tumor.
- % TGI is about 10%, about 20%, about 30%, about 40%, about 50%, about 60%, about 70%, about 80%, about 90%, about 91%, about 92%, about 93%, about 94%, about 95%, or more than 95%.
- a method of treating bladder cancer such as non-muscle invasive bladder cancer, e.g., BCG-refractory NMIBC
- an individual such as a human
- administering comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus. In some embodiments, the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor. In some embodiments, the histone deacetylase inhibitor is specific to only one HDAC. In some embodiments, the histone deacetylase inhibitor is specific to only one class of HDAC.
- the histone deacetylase inhibitor is specific to two or more HDACs or two or more classes of HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class I and II HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class III HDACs. In some embodiments, the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin. In some embodiments, the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor. In some embodiments, the kinase inhibitor is a Raf kinase inhibitor. In some embodiments, the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase). In some embodiments, the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is sorafenib. In some embodiments, the kinase inhibitor is nilotinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered sequentially. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered simultaneously. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered concurrently.
- the bladder cancer is a low grade bladder cancer. In some embodiments, the bladder cancer is a high grade bladder cancer. In some embodiments, the bladder cancer is invasive. In some embodiments, the bladder cancer is non-invasive. In some embodiments, the bladder cancer is non-muscle invasive.
- the bladder cancer is transitional cell carcinoma or urothelial carcinoma (such as metastatic urothelial carcinoma), including, but not limited to, papillary tumors and flat carcinomas.
- the bladder cancer is metastatic urothelial carcinoma.
- the bladder cancer is urothelial carcinoma of the bladder.
- the bladder cancer is urothelial carcinoma of the ureter.
- the bladder cancer is urothelial carcinoma of the urethra.
- the bladder cancer is urothelial carcinoma of the renal pelvis.
- the bladder cancer is squamous cell carcinoma. In some embodiments, the bladder cancer is non-squamous cell carcinoma. In some embodiments, the bladder cancer is adenocarcinoma. In some embodiments, the bladder cancer is small cell carcinoma.
- the bladder cancer is early stage bladder cancer, non-metastatic bladder cancer, non-invasive bladder cancer, non-muscle-invasive bladder cancer, primary bladder cancer, advanced bladder cancer, locally advanced bladder cancer (such as unrespectable locally advanced bladder cancer), metastatic bladder cancer, or bladder cancer in remission.
- the bladder cancer is localized respectable, localized unrespectable, or unrespectable.
- the bladder cancer is a high grade, non-muscle-invasive cancer that has been refractory to standard intra-bladder infusion (intravesicular) therapy.
- the methods provided herein can be used to treat an individual (e.g., human) who has been diagnosed with or is suspected of having bladder cancer.
- the individual has undergone a tumor resection.
- the individual has refused surgery.
- the individual is medically inoperable.
- the individual is at a clinical stage of Ta, Tis, T1, T2, T3a, T3b, or T4 bladder cancer.
- the individual is at a clinical stage of Tis, CIS, Ta, or T1.
- the individual is a human who exhibits one or more symptoms associated with bladder cancer. In some embodiments, the individual is at an early stage of bladder cancer. In some embodiments, the individual is at an advanced stage of bladder cancer. In some of embodiments, the individual is genetically or otherwise predisposed (e.g., having a risk factor) to developing bladder cancer. Individuals at risk for bladder cancer include, e.g., those having relatives who have experienced bladder cancer, and those whose risk is determined by analysis of genetic or biochemical markers. In some embodiments, the individual is positive for SPARC expression (for example based on IHC standard). In some embodiments, the individual is negative for SPARC expression. In some embodiments, the individual has a mutation in FGFR2.
- the individual has a mutation in p53. In some embodiments, the individual has a mutation in MIB-1. In some embodiments, the individual has a mutation in one or more of FEZ1/LZTS1, PTEN, CDKN2A/MTS1/P6, CDKN2B/INK4B/P15, TSC1, DBCCR1, HRAS1, ERBB2, or NF1. In some embodiments, the individual has mutation in both p53 and PTEN.
- the individual has been previously treated for bladder cancer (also referred to as the “prior therapy”). In some embodiments, individual has been previously treated with a standard therapy for bladder cancer. In some embodiments, the prior standard therapy is treatment with BCG. In some embodiments, the prior standard therapy is treatment with mitomycin C. In some embodiments, the prior standard therapy is treatment with interferon (such as interferon-a). In some embodiments, the individual has bladder cancer in remission, progressive bladder cancer, or recurrent bladder cancer. In some embodiments, the individual is resistant to treatment of bladder cancer with other agents (such as platinum-based agents, BCG, mitomycin C, and/or interferon). In some embodiments, the individual is initially responsive to treatment of bladder cancer with other agents (such as platinum-based agents, or BCG) but has progressed after treatment.
- the prior standard therapy is treatment with BCG.
- the prior standard therapy is treatment with mitomycin C.
- interferon such as interferon-a
- the individual has bladder cancer in remission, progressive bladder cancer,
- the individual has recurrent bladder cancer (such as a bladder cancer at the clinical stage of Ta, Tis, T1, T2, T3a, T3b, or T4) after a prior therapy (such as prior standard therapy, for example treatment with BCG).
- a prior therapy such as prior standard therapy, for example treatment with BCG.
- the individual may be initially responsive to the treatment with the prior therapy, but develops bladder cancer after about any of about 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 24, 36, 48, or 60 months upon the cessation of the prior therapy.
- the individual is refractory to a prior therapy (such as prior standard therapy, for example treatment with BCG).
- a prior therapy such as prior standard therapy, for example treatment with BCG.
- the individual has progressed on the prior therapy (such as prior standard therapy, for example treatment with BCG) at the time of treatment.
- the prior therapy such as prior standard therapy, for example treatment with BCG
- the individual has progressed within any of about 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, or 12 months upon treatment with the prior therapy.
- the individual is resistant to the prior therapy (such as prior standard therapy, for example treatment with BCG).
- prior therapy such as prior standard therapy, for example treatment with BCG.
- the individual is unsuitable to continue with the prior therapy (such as prior standard therapy, for example treatment with BCG), for example due to failure to respond and/or due to toxicity.
- prior therapy such as prior standard therapy, for example treatment with BCG
- the individual is non-responsive to the prior therapy (such as prior standard therapy, for example treatment with BCG).
- prior therapy such as prior standard therapy, for example treatment with BCG.
- the individual is partially responsive to the prior therapy (such as prior standard therapy, for example treatment with BCG), or exhibits a less desirable degree of responsiveness.
- a method of treating bladder cancer such as non-muscle invasive bladder cancer, e.g., BCG-refractory NMIBC
- an individual such as a human
- administering comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug,
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is lenalidomide.
- the immunomodulator is pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the bladder cancer is recurrent bladder cancer. In some embodiments, the bladder cancer is refractory to one or more drugs used in a standard therapy for bladder cancer, such as, but not limited to, platinum-based agents, BCG, mitomycin C, and/or interferon.
- a method of treating bladder cancer such as non-muscle invasive bladder cancer, e.g., BCG-refractory NMIBC
- an individual such as a human
- administering comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the bladder cancer is recurrent bladder cancer. In some embodiments, the bladder cancer is refractory to one or more drugs used in a standard therapy for bladder cancer, such as, but not limited to, platinum-based agents, BCG, mitomycin C, and/or interferon.
- a method of treating bladder cancer such as non-muscle invasive bladder cancer, e.g., BCG-refractory NMIBC
- an individual such as a human
- administering comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a histone deacetylase inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a histone deacetylase inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 n
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., si
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat.
- the histone deacetylase inhibitor is romidepsin.
- the bladder cancer is recurrent bladder cancer.
- the bladder cancer is refractory to one or more drugs used in a standard therapy for bladder cancer, such as, but not limited to, platinum-based agents, BCG, mitomycin C, and/or interferon.
- a method of treating bladder cancer such as non-muscle invasive bladder cancer, e.g., BCG-refractory NMIBC
- an individual such as a human
- a method of treating bladder cancer comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin.
- the bladder cancer is recurrent bladder cancer. In some embodiments, the bladder cancer is refractory to one or more drugs used in a standard therapy for bladder cancer, such as, but not limited to, platinum-based agents, BCG, mitomycin C, and/or interferon.
- drugs used in a standard therapy for bladder cancer such as, but not limited to, platinum-based agents, BCG, mitomycin C, and/or interferon.
- a method of treating bladder cancer such as non-muscle invasive bladder cancer, e.g., BCG-refractory NMIBC
- an individual such as a human
- administering comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafeni
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., siroli
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the bladder cancer is recurrent bladder cancer. In some embodiments, the bladder cancer is refractory to one or more drugs used in a standard therapy for bladder cancer, such as, but not limited to, platinum-based agents, BCG, mitomycin C, and/or interferon.
- drugs used in a standard therapy for bladder cancer such as, but not limited to, platinum-based agents, BCG, mitomycin C, and/or interferon.
- a method of treating bladder cancer such as non-muscle invasive bladder cancer, e.g., BCG-refractory NMIBC
- an individual such as a human
- a method of treating bladder cancer comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or so
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the bladder cancer is recurrent bladder cancer.
- the bladder cancer is refractory to one or more drugs used in a standard therapy for bladder cancer, such as, but not limited to, platinum-based agents, BCG, mitomycin C, and/or interferon.
- a method of treating bladder cancer such as non-muscle invasive bladder cancer, e.g., BCG-refractory NMIBC
- an individual such as a human
- administering comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the bladder cancer is recurrent bladder cancer.
- the bladder cancer is refractory to one or more drugs used in a standard therapy for bladder cancer, such as, but not limited to, platinum-based agents, BCG, mitomycin C, and/or interferon.
- a method of treating bladder cancer such as non-muscle invasive bladder cancer, e.g., BCG-refractory NMIBC
- an individual such as a human
- administering comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the bladder cancer is recurrent bladder cancer.
- the bladder cancer is refractory to one or more drugs used in a standard therapy for bladder cancer, such as, but not limited to, platinum-based agents, BCG, mitomycin C, and/or interferon.
- a method of treating bladder cancer such as non-muscle invasive bladder cancer, e.g., BCG-refractory NMIBC
- an individual such as a human
- administering comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a second therapeutic agent selected from the group consisting of platinum-based agents, BCG, mitomycin C, and interferon.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent selected from the group consisting of platinum-based agents, BCG, mitomycin C, and interferon.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of platinum-based agents, BCG, mitomycin C, and interferon.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of platinum-based agents, BCG, mitomycin C, and interferon.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent selected from the group consisting of platinum-based agents, BCG, mitomycin C, and interferon.
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the bladder cancer is recurrent bladder cancer.
- the bladder cancer is refractory to one or more drugs used in a standard therapy for bladder cancer, such as, but not limited to, platinum-based agents, BCG, mitomycin C, and/or interferon.
- the individual is a human who exhibits one or more symptoms associated with bladder cancer.
- the individual is at an early stage of bladder cancer.
- the individual is at an advanced stage of bladder cancer.
- the individual is genetically or otherwise predisposed (e.g., having a risk factor) to developing bladder cancer.
- Individuals at risk for bladder cancer include, e.g., those having relatives who have experienced bladder cancer, and those whose risk is determined by analysis of genetic or biochemical markers.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with bladder cancer (e.g., HRAS, KRAS2, RB1, or FGFR3) or has one or more extra copies of a gene associated with bladder cancer.
- the individual has a ras or PTEN mutation.
- the cancer cells are dependent on an mTOR pathway to translate one or more mRNAs.
- the cancer cells are not capable of synthesizing mRNAs by an mTOR-independent pathway.
- the cancer cells have decreased or no PTEN activity or have decreased or no expression of PTEN compared to non-cancerous cells.
- the individual has at least one tumor biomarker selected from the group consisting of elevated PI3K activity, elevated mTOR activity, presence of FLT-3ITD, elevated AKT activity, elevated KRAS activity, and elevated NRAS activity.
- the individual has a variation in at least one gene selected from the group consisting of drug metabolism genes, cancer genes, and drug target genes.
- a method of treating renal cell carcinoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus. In some embodiments, the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor. In some embodiments, the histone deacetylase inhibitor is specific to only one HDAC. In some embodiments, the histone deacetylase inhibitor is specific to only one class of HDAC.
- the histone deacetylase inhibitor is specific to two or more HDACs or two or more classes of HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class I and II HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class III HDACs. In some embodiments, the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin. In some embodiments, the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor. In some embodiments, the kinase inhibitor is a Raf kinase inhibitor. In some embodiments, the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase). In some embodiments, the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is sorafenib. In some embodiments, the kinase inhibitor is nilotinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered sequentially. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered simultaneously. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered concurrently.
- the renal cell carcinoma (also called kidney cancer, renal adenocarcinoma, or hypernephroma) is an adenocarcinoma.
- the renal cell carcinoma is a clear cell renal cell carcinoma, papillary renal cell carcinoma (also called chromophilic renal cell carcinoma), chromophobe renal cell carcinoma, collecting duct renal cell carcinoma, granular renal cell carcinoma, mixed granular renal cell carcinoma, renal angiomyolipomas, or spindle renal cell carcinoma.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with renal cell carcinoma (e.g., VHL, TSC1, TSC2, CUL2, MSH2, MLH1, INK4a/ARF, MET, TGF- ⁇ , TGF- ⁇ 1, IGF-I, IGF-IR, AKT, and/or PTEN) or has one or more extra copies of a gene associated with renal cell carcinoma.
- a gene, genetic mutation, or polymorphism associated with renal cell carcinoma e.g., VHL, TSC1, TSC2, CUL2, MSH2, MLH1, INK4a/ARF, MET, TGF- ⁇ , TGF- ⁇ 1, IGF-I, IGF-IR, AKT, and/or PTEN
- the renal cell carcinoma is associated with (1) von Hippel-Lindau (VHL) syndrome, (2) hereditary papillary renal carcinoma (HPRC), (3) familial renal oncocytoma (FRO) associated with Birt-Hogg-Dube syndrome (BHDS), or (4) hereditary renal carcinoma (HRC).
- VHL von Hippel-Lindau
- HPRC hereditary papillary renal carcinoma
- FRO familial renal oncocytoma
- BHDS Birt-Hogg-Dube syndrome
- HRC hereditary renal carcinoma
- AJCC American Joint Committee on Cancer
- the renal cell carcinoma is stage IV renal cell carcinoma.
- a method of treating renal cell carcinoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug,
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is lenalidomide.
- the immunomodulator is pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the renal cell carcinoma is recurrent renal cell carcinoma.
- the renal cell carcinoma is refractory to one or more drugs used in a standard therapy for renal cell carcinoma, such as, but not limited to, Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and/or Votrient (pazopanib hydrochloride).
- a standard therapy for renal cell carcinoma such as, but not limited to, Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and/or Votrient (pazopanib hydrochloride).
- a method of treating renal cell carcinoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the renal cell carcinoma is recurrent renal cell carcinoma.
- the renal cell carcinoma is refractory to one or more drugs used in a standard therapy for renal cell carcinoma, such as, but not limited to, Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and/or Votrient (pazopanib hydrochloride).
- a standard therapy for renal cell carcinoma such as, but not limited to, Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and/or Votrient (pazopanib hydrochloride).
- a method of treating renal cell carcinoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a histone deacetylase inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a histone deacetylase inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 n
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., si
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat.
- the histone deacetylase inhibitor is romidepsin.
- the renal cell carcinoma is recurrent renal cell carcinoma.
- the renal cell carcinoma is refractory to one or more drugs used in a standard therapy for renal cell carcinoma, such as, but not limited to, Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and/or Votrient (pazopanib hydrochloride).
- a method of treating renal cell carcinoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin.
- the renal cell carcinoma is recurrent renal cell carcinoma.
- the renal cell carcinoma is refractory to one or more drugs used in a standard therapy for renal cell carcinoma, such as, but not limited to, Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and/or Votrient (pazopanib hydrochloride).
- a method of treating renal cell carcinoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., siroli
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the renal cell carcinoma is recurrent renal cell carcinoma.
- the renal cell carcinoma is refractory to one or more drugs used in a standard therapy for renal cell carcinoma, such as, but not limited to, Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and/or Votrient (pazopanib hydrochloride).
- a method of treating renal cell carcinoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or so
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the renal cell carcinoma is recurrent renal cell carcinoma.
- the renal cell carcinoma is refractory to one or more drugs used in a standard therapy for renal cell carcinoma, such as, but not limited to, Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and/or Votrient (pazopanib hydrochloride).
- a standard therapy for renal cell carcinoma such as, but not limited to, Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and/or Votrient (pazopanib hydrochloride).
- a method of treating renal cell carcinoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the renal cell carcinoma is recurrent renal cell carcinoma.
- the renal cell carcinoma is refractory to one or more drugs used in a standard therapy for renal cell carcinoma, such as, but not limited to, Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and/or Votrient (pazopanib hydrochloride).
- a standard therapy for renal cell carcinoma such as, but not limited to, Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and/or Votrient (pazopanib hydrochloride).
- a method of treating renal cell carcinoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the renal cell carcinoma is recurrent renal cell carcinoma.
- the renal cell carcinoma is refractory to one or more drugs used in a standard therapy for renal cell carcinoma, such as, but not limited to, Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and/or Votrient (pazopanib hydrochloride).
- a standard therapy for renal cell carcinoma such as, but not limited to, Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and/or Votrient (pazopanib hydrochloride).
- a method of treating renal cell carcinoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a second therapeutic agent selected from the group consisting of Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and Votrient (pazopanib hydrochloride).
- Afinitor everolimus
- temsirolimus aldesleukin
- Avastin bevacizumab
- axitinib sorafenib
- sunitinib sunitinib
- Votrient pazopanib hydrochloride
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent selected from the group consisting of Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and Votrient (pazopanib hydrochloride).
- a second therapeutic agent selected from the group consisting of Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and Votrient (pazopanib hydrochloride).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and Votrient (pazopanib hydrochloride).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of Afinitor (everolimus), tems
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and Votrient (pazopanib hydrochloride).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticle
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent selected from the group consisting of Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and Votrient (pazopanib hydrochloride).
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the renal cell carcinoma is recurrent renal cell carcinoma.
- the renal cell carcinoma is refractory to one or more drugs used in a standard therapy for renal cell carcinoma, such as, but not limited to, Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and/or Votrient (pazopanib hydrochloride).
- a standard therapy for renal cell carcinoma such as, but not limited to, Afinitor (everolimus), temsirolimus, aldesleukin, Avastin (bevacizumab), axitinib, sorafenib, sunitinib, and/or Votrient (pazopanib hydrochloride).
- the individual is a human who exhibits one or more symptoms associated with renal cell carcinoma.
- the individual is at an early stage of renal cell carcinoma.
- the individual is at an advanced stage of renal cell carcinoma.
- the individual is genetically or otherwise predisposed (e.g., having a risk factor) to developing renal cell carcinoma.
- Individuals at risk for renal cell carcinoma include, e.g., those having relatives who have experienced renal cell carcinoma, and those whose risk is determined by analysis of genetic or biochemical markers.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with renal cell carcinoma (e.g., VHL, TSC1, TSC2, CUL2, MSH2, MLH1, INK4a/ARF, MET, TGF- ⁇ , TGF- ⁇ 1, IGF-I, IGF-IR, AKT, and/or PTEN) or has one or more extra copies of a gene associated with renal cell carcinoma.
- the individual has a ras or PTEN mutation.
- the cancer cells are dependent on an mTOR pathway to translate one or more mRNAs. In some embodiments, the cancer cells are not capable of synthesizing mRNAs by an mTOR-independent pathway.
- the cancer cells have decreased or no PTEN activity or have decreased or no expression of PTEN compared to non-cancerous cells.
- the individual has at least one tumor biomarker selected from the group consisting of elevated PI3K activity, elevated mTOR activity, presence of FLT-3ITD, elevated AKT activity, elevated KRAS activity, and elevated NRAS activity.
- the individual has a variation in at least one gene selected from the group consisting of drug metabolism genes, cancer genes, and drug target genes.
- a method of treating melanoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus. In some embodiments, the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor. In some embodiments, the histone deacetylase inhibitor is specific to only one HDAC. In some embodiments, the histone deacetylase inhibitor is specific to only one class of HDAC.
- the histone deacetylase inhibitor is specific to two or more HDACs or two or more classes of HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class I and II HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class III HDACs. In some embodiments, the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin. In some embodiments, the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor. In some embodiments, the kinase inhibitor is a Raf kinase inhibitor. In some embodiments, the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase). In some embodiments, the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is sorafenib. In some embodiments, the kinase inhibitor is nilotinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered sequentially. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered simultaneously. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered concurrently.
- the melanoma is superficial spreading melanoma, lentigo maligna melanoma, nodular melanoma, mucosal melanoma, polypoid melanoma, desmoplastic melanoma, amelanotic melanoma, soft-tissue melanoma, or acral lentiginous melanoma.
- melanoma is superficial spreading melanoma, lentigo maligna melanoma, nodular melanoma, mucosal melanoma, polypoid melanoma, desmoplastic melanoma, amelanotic melanoma, soft-tissue melanoma, or acral lentiginous melanoma.
- AJCC American Joint Committee on Cancer
- the melanoma is recurrent.
- a method of treating melanoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug,
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is lenalidomide.
- the immunomodulator is pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the melanoma is recurrent melanoma.
- the melanoma is refractory to one or more drugs used in a standard therapy for melanoma, such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- drugs used in a standard therapy for melanoma such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- a method of treating melanoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor. In some embodiments, the melanoma is recurrent melanoma.
- the melanoma is refractory to one or more drugs used in a standard therapy for melanoma, such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- drugs used in a standard therapy for melanoma such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- a method of treating melanoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a histone deacetylase inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a histone deacetylase inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 n
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., si
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat.
- the histone deacetylase inhibitor is romidepsin.
- the melanoma is recurrent melanoma.
- the melanoma is refractory to one or more drugs used in a standard therapy for melanoma, such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- a method of treating melanoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin.
- the melanoma is recurrent melanoma. In some embodiments, the melanoma is refractory to one or more drugs used in a standard therapy for melanoma, such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- drugs used in a standard therapy for melanoma such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- a method of treating melanoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., siroli
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the melanoma is recurrent melanoma. In some embodiments, the melanoma is refractory to one or more drugs used in a standard therapy for melanoma, such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- drugs used in a standard therapy for melanoma such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- a method of treating melanoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or so
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the melanoma is recurrent melanoma.
- the melanoma is refractory to one or more drugs used in a standard therapy for melanoma, such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- drugs used in a standard therapy for melanoma such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- a method of treating melanoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the melanoma is recurrent melanoma.
- the melanoma is refractory to one or more drugs used in a standard therapy for melanoma, such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- drugs used in a standard therapy for melanoma such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- a method of treating melanoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the melanoma is recurrent melanoma.
- the melanoma is refractory to one or more drugs used in a standard therapy for melanoma, such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- drugs used in a standard therapy for melanoma such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- a method of treating melanoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a second therapeutic agent selected from the group consisting of aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and vemurafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent selected from the group consisting of aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and vemurafenib.
- a second therapeutic agent selected from the group consisting of aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and vemurafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and vemurafenib.
- a second therapeutic agent selected from the group consisting of aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and vemurafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and vemurafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent selected from the group consisting of aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and vemurafenib.
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the melanoma is recurrent melanoma.
- the melanoma is refractory to one or more drugs used in a standard therapy for melanoma, such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- drugs used in a standard therapy for melanoma such as, but not limited to, aldesleukin, dabrafenib, dacarbazine, interferon alfa-2b, ipilimumab, pembrolizumab, trametinib, nivolumab, and/or vemurafenib.
- the individual is a human who exhibits one or more symptoms associated with melanoma.
- the individual is at an early stage of melanoma.
- the individual is at an advanced stage of melanoma.
- the individual is genetically or otherwise predisposed (e.g., having a risk factor) to developing melanoma.
- Individuals at risk for melanoma include, e.g., those having relatives who have experienced melanoma, and those whose risk is determined by analysis of genetic or biochemical markers.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with melanoma (e.g., CDKN2A, CDK4, BRCA2, BRAF, NRAS, KIT, MC1R, or MDM2) or has one or more extra copies of a gene associated with melanoma.
- the individual has a ras or PTEN mutation.
- the cancer cells are dependent on an mTOR pathway to translate one or more mRNAs. In some embodiments, the cancer cells are not capable of synthesizing mRNAs by an mTOR-independent pathway.
- the cancer cells have decreased or no PTEN activity or have decreased or no expression of PTEN compared to non-cancerous cells.
- the individual has at least one tumor biomarker selected from the group consisting of elevated PI3K activity, elevated mTOR activity, presence of FLT-3ITD, elevated AKT activity, elevated KRAS activity, and elevated NRAS activity.
- the individual has a variation in at least one gene selected from the group consisting of drug metabolism genes, cancer genes, and drug target genes.
- a method of treating breast cancer such as hormone receptor positive (HR+) breast cancer in an individual (such as a human) comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus. In some embodiments, the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor. In some embodiments, the histone deacetylase inhibitor is specific to only one HDAC. In some embodiments, the histone deacetylase inhibitor is specific to only one class of HDAC.
- the histone deacetylase inhibitor is specific to two or more HDACs or two or more classes of HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class I and II HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class III HDACs. In some embodiments, the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin. In some embodiments, the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor. In some embodiments, the kinase inhibitor is a Raf kinase inhibitor. In some embodiments, the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase). In some embodiments, the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is sorafenib. In some embodiments, the kinase inhibitor is nilotinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered sequentially. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered simultaneously. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered concurrently.
- the breast cancer is early stage breast cancer, non-metastatic breast cancer, advanced breast cancer, stage IV breast cancer, locally advanced breast cancer, metastatic breast cancer, breast cancer in remission, breast cancer in an adjuvant setting, or breast cancer in a neoadjuvant setting.
- the breast cancer is in a neoadjuvant setting.
- the breast cancer is at an advanced stage.
- the breast cancer (which may be HER2 positive or HER2 negative) includes, for example, advanced breast cancer, stage IV breast cancer, locally advanced breast cancer, and metastatic breast cancer.
- a method of treating breast cancer comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug,
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is lenalidomide.
- the immunomodulator is pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the breast cancer (such as HR+ breast cancer) is recurrent breast cancer (such as HR+ breast cancer).
- the breast cancer (such as HR+ breast cancer) is refractory to one or more drugs used in a standard therapy for breast cancer (such as HR+ breast cancer), such as, but not limited to, docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab-paclitaxel, and/or eribulin.
- drugs used in a standard therapy for breast cancer such as HR+ breast cancer
- drugs used in a standard therapy for breast cancer such as HR+ breast cancer
- a method of treating breast cancer comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the breast cancer (such as HR+ breast cancer) is recurrent breast cancer (such as HR+ breast cancer).
- the breast cancer (such as HR+ breast cancer) is refractory to one or more drugs used in a standard therapy for breast cancer (such as HR+ breast cancer), such as, but not limited to, docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab-paclitaxel, and/or eribulin.
- drugs used in a standard therapy for breast cancer such as HR+ breast cancer
- drugs used in a standard therapy for breast cancer such as HR+ breast cancer
- a method of treating breast cancer comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a histone deacetylase inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a histone deacetylase inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 n
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., si
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat.
- the histone deacetylase inhibitor is romidepsin.
- the breast cancer (such as HR+ breast cancer) is recurrent breast cancer (such as HR+ breast cancer).
- the breast cancer (such as HR+ breast cancer) is refractory to one or more drugs used in a standard therapy for breast cancer (such as HR+ breast cancer), such as, but not limited to, docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab-paclitaxel, and/or eribulin.
- drugs used in a standard therapy for breast cancer such as HR+ breast cancer
- a method of treating breast cancer comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin.
- the breast cancer (such as HR+ breast cancer) is recurrent breast cancer (such as HR+ breast cancer).
- the breast cancer (such as HR+ breast cancer) is refractory to one or more drugs used in a standard therapy for breast cancer (such as HR+ breast cancer), such as, but not limited to, docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab-paclitaxel, and/or eribulin.
- drugs used in a standard therapy for breast cancer such as HR+ breast cancer
- a method of treating breast cancer comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., siroli
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the breast cancer (such as HR+ breast cancer) is recurrent breast cancer (such as HR+ breast cancer).
- the breast cancer (such as HR+ breast cancer) is refractory to one or more drugs used in a standard therapy for breast cancer (such as HR+ breast cancer), such as, but not limited to, docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab-paclitaxel, and/or eribulin.
- drugs used in a standard therapy for breast cancer such as HR+ breast cancer
- a method of treating breast cancer comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or so
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the breast cancer (such as HR+ breast cancer) is recurrent breast cancer (such as HR+ breast cancer).
- the breast cancer (such as HR+ breast cancer) is refractory to one or more drugs used in a standard therapy for breast cancer (such as HR+ breast cancer), such as, but not limited to, docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab-paclitaxel, and/or eribulin.
- drugs used in a standard therapy for breast cancer such as HR+ breast cancer
- drugs used in a standard therapy for breast cancer such as HR+ breast cancer
- a method of treating breast cancer comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a cancer vaccine.
- a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the breast cancer (such as HR+ breast cancer) is recurrent breast cancer (such as HR+ breast cancer).
- the breast cancer (such as HR+ breast cancer) is refractory to one or more drugs used in a standard therapy for breast cancer (such as HR+ breast cancer), such as, but not limited to, docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab-paclitaxel, and/or eribulin.
- drugs used in a standard therapy for breast cancer such as HR+ breast cancer
- a method of treating breast cancer comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the breast cancer (such as HR+ breast cancer) is recurrent breast cancer (such as HR+ breast cancer).
- the breast cancer (such as HR+ breast cancer) is refractory to one or more drugs used in a standard therapy for breast cancer (such as HR+ breast cancer), such as, but not limited to, docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab-paclitaxel, and/or eribulin.
- drugs used in a standard therapy for breast cancer such as HR+ breast cancer
- drugs used in a standard therapy for breast cancer such as HR+ breast cancer
- a method of treating breast cancer comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a second therapeutic agent selected from the group consisting of docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab-paclitaxel, and eribulin.
- a second therapeutic agent selected from the group consisting of docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab-paclitaxel, and eribulin.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent selected from the group consisting of docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab-paclitaxel, and eribulin.
- a second therapeutic agent selected from the group consisting of docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab-pac
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab-paclitaxel, and eribulin.
- a second therapeutic agent selected from the group consisting of docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab-paclitaxel, and eribulin.
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent selected from the group consisting of docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab-paclitaxel
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the breast cancer (such as HR+ breast cancer) is recurrent breast cancer (such as HR+ breast cancer).
- the breast cancer (such as HR+ breast cancer) is refractory to one or more drugs used in a standard therapy for breast cancer (such as HR+ breast cancer), such as, but not limited to, docetaxel, paclitaxel, cisplatin, carboplatin, vinorelbine, capecitabine, liposomal doxorubicin, gemcitabine, mitoxantrone, ixabepilone, nab-paclitaxel, and/or eribulin.
- drugs used in a standard therapy for breast cancer such as HR+ breast cancer
- drugs used in a standard therapy for breast cancer such as HR+ breast cancer
- the individual is a human who exhibits one or more symptoms associated with breast cancer (such as HR+ breast cancer).
- the individual is at an early stage of breast cancer (such as HR+ breast cancer).
- the individual is at an advanced stage of breast cancer (such as HR+ breast cancer).
- the individual is genetically or otherwise predisposed (e.g., having a risk factor) to developing breast cancer (such as HR+ breast cancer).
- Individuals at risk for breast cancer include, e.g., those having relatives who have experienced breast cancer (such as HR+ breast cancer), and those whose risk is determined by analysis of genetic or biochemical markers.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with breast cancer (such as HR+ breast cancer) (e.g., BRCA1, BRCA2, ATM, CHEK2, RAD51, AR, DIRAS3, ERBB2, TP53, AKT, PTEN, and/or PDK) or has one or more extra copies of a gene associated with breast cancer (such as HR+ breast cancer).
- the individual has a ras or PTEN mutation.
- the method further comprises identifying a patient population (i.e. breast cancer (such as HR+ breast cancer) population) based on a hormone receptor status of patients having tumor tissue not expressing both ER and PgR.
- the cancer cells are dependent on an mTOR pathway to translate one or more mRNAs.
- the cancer cells are not capable of synthesizing mRNAs by an mTOR-independent pathway.
- the cancer cells have decreased or no PTEN activity or have decreased or no expression of PTEN compared to non-cancerous cells.
- the individual has at least one tumor biomarker selected from the group consisting of elevated PI3K activity, elevated mTOR activity, presence of FLT-3ITD, elevated AKT activity, elevated KRAS activity, and elevated NRAS activity.
- the individual has a variation in at least one gene selected from the group consisting of drug metabolism genes, cancer genes, and drug target genes.
- a method of treating endometrial cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus. In some embodiments, the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor. In some embodiments, the histone deacetylase inhibitor is specific to only one HDAC. In some embodiments, the histone deacetylase inhibitor is specific to only one class of HDAC.
- the histone deacetylase inhibitor is specific to two or more HDACs or two or more classes of HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class I and II HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class III HDACs. In some embodiments, the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin. In some embodiments, the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor. In some embodiments, the kinase inhibitor is a Raf kinase inhibitor. In some embodiments, the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase). In some embodiments, the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is sorafenib. In some embodiments, the kinase inhibitor is nilotinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered sequentially. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered simultaneously. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered concurrently.
- the endometrial cancer is adenocarcinoma, carcinosarcoma, squamous cell carcinoma, undifferentiated carcinoma, small cell carcinoma, or transitional carcinoma.
- the endometrial cancer is endometroid cancer, adenocarcinoma with squamous differentiation, adenoacanthoma, adenosquamous carcinoma, secretory carcinoma, ciliated carcinoma, or villoglandular adenocarcinoma.
- the endometrial cancer is clear-cell carcinoma, mucinous adenocarcinoma, or papillary serous adenocarcinoma.
- the endometrial cancer is grade 1, grade 2, or grade 3. In some embodiments, the endometrial cancer is type 1 endometrial cancer. In some embodiments, the endometrial cancer is type 2 endometrial cancer. In some embodiments, the endometrial cancer is uterine carcinosarcoma.
- a method of treating endometrial cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug,
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is lenalidomide.
- the immunomodulator is pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the endometrial cancer is recurrent endometrial cancer.
- the endometrial cancer is refractory to one or more drugs used in a standard therapy for endometrial cancer, such as, but not limited to, paclitaxel, carboplatin, doxorubicin, and/or cisplatin.
- drugs used in a standard therapy for endometrial cancer such as, but not limited to, paclitaxel, carboplatin, doxorubicin, and/or cisplatin.
- a method of treating endometrial cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor. In some embodiments, the endometrial cancer is recurrent endometrial cancer.
- the endometrial cancer is refractory to one or more drugs used in a standard therapy for endometrial cancer, such as, but not limited to, paclitaxel, carboplatin, doxorubicin, and/or cisplatin.
- drugs used in a standard therapy for endometrial cancer such as, but not limited to, paclitaxel, carboplatin, doxorubicin, and/or cisplatin.
- a method of treating endometrial cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a histone deacetylase inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a histone deacetylase inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 n
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., si
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat.
- the histone deacetylase inhibitor is romidepsin.
- the endometrial cancer is recurrent endometrial cancer.
- the endometrial cancer is refractory to one or more drugs used in a standard therapy for endometrial cancer, such as, but not limited to, paclitaxel, carboplatin, doxorubicin, and/or cisplatin.
- a method of treating endometrial cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin.
- the endometrial cancer is recurrent endometrial cancer.
- the endometrial cancer is refractory to one or more drugs used in a standard therapy for endometrial cancer, such as, but not limited to, paclitaxel, carboplatin, doxorubicin, and/or cisplatin.
- a method of treating endometrial cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., siroli
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the endometrial cancer is recurrent endometrial cancer.
- the endometrial cancer is refractory to one or more drugs used in a standard therapy for endometrial cancer, such as, but not limited to, paclitaxel, carboplatin, doxorubicin, and/or cisplatin.
- a method of treating endometrial cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or so
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the endometrial cancer is recurrent endometrial cancer.
- the endometrial cancer is refractory to one or more drugs used in a standard therapy for endometrial cancer, such as, but not limited to, paclitaxel, carboplatin, doxorubicin, and/or cisplatin.
- drugs used in a standard therapy for endometrial cancer such as, but not limited to, paclitaxel, carboplatin, doxorubicin, and/or cisplatin.
- a method of treating endometrial cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the endometrial cancer is recurrent endometrial cancer.
- the endometrial cancer is refractory to one or more drugs used in a standard therapy for endometrial cancer, such as, but not limited to, paclitaxel, carboplatin, doxorubicin, and/or cisplatin.
- drugs used in a standard therapy for endometrial cancer such as, but not limited to, paclitaxel, carboplatin, doxorubicin, and/or cisplatin.
- a method of treating endometrial cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the endometrial cancer is recurrent endometrial cancer.
- the endometrial cancer is refractory to one or more drugs used in a standard therapy for endometrial cancer, such as, but not limited to, paclitaxel, carboplatin, doxorubicin, and/or cisplatin.
- drugs used in a standard therapy for endometrial cancer such as, but not limited to, paclitaxel, carboplatin, doxorubicin, and/or cisplatin.
- a method of treating endometrial cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a second therapeutic agent selected from the group consisting of paclitaxel, carboplatin, doxorubicin, and cisplatin.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent selected from the group consisting of paclitaxel, carboplatin, doxorubicin, and cisplatin.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of paclitaxel, carboplatin, doxorubicin, and cisplatin.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of paclitaxel, carboplatin, doxorubicin, and cisplatin.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent selected from the group consisting of paclitaxel, carboplatin, doxorubicin, and cisplatin.
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the endometrial cancer is recurrent endometrial cancer.
- the endometrial cancer is refractory to one or more drugs used in a standard therapy for endometrial cancer, such as, but not limited to, paclitaxel, carboplatin, doxorubicin, and/or cisplatin.
- drugs used in a standard therapy for endometrial cancer such as, but not limited to, paclitaxel, carboplatin, doxorubicin, and/or cisplatin.
- the individual is a human who exhibits one or more symptoms associated with endometrial cancer.
- the individual is at an early stage of endometrial cancer.
- the individual is at an advanced stage of endometrial cancer.
- the individual is genetically or otherwise predisposed (e.g., having a risk factor) to developing endometrial cancer.
- Individuals at risk for endometrial cancer include, e.g., those having relatives who have experienced endometrial cancer, and those whose risk is determined by analysis of genetic or biochemical markers.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with endometrial cancer (e.g., MLH1, MLH2, MSH2, MLH3, MSH6, TGBR2, PMS1, and/or PMS2) or has one or more extra copies of a gene associated with endometrial cancer.
- the individual has a ras or PTEN mutation.
- the cancer cells are dependent on an mTOR pathway to translate one or more mRNAs. In some embodiments, the cancer cells are not capable of synthesizing mRNAs by an mTOR-independent pathway.
- the cancer cells have decreased or no PTEN activity or have decreased or no expression of PTEN compared to non-cancerous cells.
- the individual has at least one tumor biomarker selected from the group consisting of elevated PI3K activity, elevated mTOR activity, presence of FLT-3ITD, elevated AKT activity, elevated KRAS activity, and elevated NRAS activity.
- the individual has a variation in at least one gene selected from the group consisting of drug metabolism genes, cancer genes, and drug target genes.
- a method of treating pancreatic neuroendocrine cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus. In some embodiments, the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor. In some embodiments, the histone deacetylase inhibitor is specific to only one HDAC. In some embodiments, the histone deacetylase inhibitor is specific to only one class of HDAC.
- the histone deacetylase inhibitor is specific to two or more HDACs or two or more classes of HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class I and II HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class III HDACs. In some embodiments, the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin. In some embodiments, the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor. In some embodiments, the kinase inhibitor is a Raf kinase inhibitor. In some embodiments, the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase). In some embodiments, the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is sorafenib. In some embodiments, the kinase inhibitor is nilotinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered sequentially. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered simultaneously. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered concurrently.
- the pancreatic neuroendocrine cancer is a well-differentiated neuroendocrine tumor, a well-differentiated (low grade) neuroendocrine carcinoma, or a poorly differentiated (high grade) neuroendocrine carcinoma.
- the pancreatic neuroendocrine cancer is a functional or a nonfunctional pancreatic neuroendocrine tumor.
- the pancreatic neuroendocrine cancer is insulinoma, glucagonoma, somatostatinoma, gastrinoma, VlPoma, GRFoma, or ACTHoma.
- a method of treating pancreatic neuroendocrine cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug,
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is lenalidomide.
- the immunomodulator is pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the pancreatic neuroendocrine cancer is recurrent pancreatic neuroendocrine cancer.
- the pancreatic neuroendocrine cancer is refractory to one or more drugs used in a standard therapy for pancreatic neuroendocrine cancer, such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and/or everolimus.
- drugs used in a standard therapy for pancreatic neuroendocrine cancer such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and/or ever
- a method of treating pancreatic neuroendocrine cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor. In some embodiments, the pancreatic neuroendocrine cancer is recurrent pancreatic neuroendocrine cancer.
- the pancreatic neuroendocrine cancer is refractory to one or more drugs used in a standard therapy for pancreatic neuroendocrine cancer, such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and/or everolimus.
- drugs used in a standard therapy for pancreatic neuroendocrine cancer such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and/or ever
- a method of treating pancreatic neuroendocrine cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a histone deacetylase inhibitor
- a histone deacetylase inhibitor such as romidepsin
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a histone deacetylase inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 n
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., si
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat.
- the histone deacetylase inhibitor is romidepsin.
- the pancreatic neuroendocrine cancer is recurrent pancreatic neuroendocrine cancer.
- the pancreatic neuroendocrine cancer is refractory to one or more drugs used in a standard therapy for pancreatic neuroendocrine cancer, such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and/or everolimus.
- drugs used in a standard therapy for pancreatic neuroendocrine cancer such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunit
- a method of treating pancreatic neuroendocrine cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin.
- the pancreatic neuroendocrine cancer is recurrent pancreatic neuroendocrine cancer.
- the pancreatic neuroendocrine cancer is refractory to one or more drugs used in a standard therapy for pancreatic neuroendocrine cancer, such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and/or everolimus.
- drugs used in a standard therapy for pancreatic neuroendocrine cancer such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., o
- a method of treating pancreatic neuroendocrine cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., siroli
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the pancreatic neuroendocrine cancer is recurrent pancreatic neuroendocrine cancer.
- the pancreatic neuroendocrine cancer is refractory to one or more drugs used in a standard therapy for pancreatic neuroendocrine cancer, such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and/or everolimus.
- drugs used in a standard therapy for pancreatic neuroendocrine cancer such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., o
- a method of treating pancreatic neuroendocrine cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or so
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the pancreatic neuroendocrine cancer is recurrent pancreatic neuroendocrine cancer.
- the pancreatic neuroendocrine cancer is refractory to one or more drugs used in a standard therapy for pancreatic neuroendocrine cancer, such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and/or everolimus.
- drugs used in a standard therapy for pancreatic neuroendocrine cancer such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and/or ever
- a method of treating pancreatic neuroendocrine cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the pancreatic neuroendocrine cancer is recurrent pancreatic neuroendocrine cancer.
- the pancreatic neuroendocrine cancer is refractory to one or more drugs used in a standard therapy for pancreatic neuroendocrine cancer, such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and/or everolimus.
- drugs used in a standard therapy for pancreatic neuroendocrine cancer such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and/or ever
- a method of treating pancreatic neuroendocrine cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the pancreatic neuroendocrine cancer is recurrent pancreatic neuroendocrine cancer.
- the pancreatic neuroendocrine cancer is refractory to one or more drugs used in a standard therapy for pancreatic neuroendocrine cancer, such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and/or everolimus.
- drugs used in a standard therapy for pancreatic neuroendocrine cancer such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and/or ever
- a method of treating pancreatic neuroendocrine cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a second therapeutic agent selected from the group consisting of doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and everolimus.
- doxorubicin streptozocin
- fluorouracil fluorouracil
- dacarbazine dacarbazine
- temozolomide temozolomide
- thalidomide thalidomide
- capecitabine sunitinib
- sunitinib somatostatin analog
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent selected from the group consisting of doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and everolimus.
- doxorubicin streptozocin
- fluorouracil 5-FU
- dacarbazine dacarbazine
- temozolomide temozolomide
- thalidomide thalidomide
- capecitabine sunitini
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and everolimus.
- doxorubicin streptozocin
- fluorouracil 5-FU
- dacarbazine dacarbazine
- temozolomide temozolomide
- thalidomide thalidomide
- capecitabine sunit
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and everolimus.
- doxorubicin streptozocin
- fluorouracil 5-FU
- dacarbazine dacarbazine
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent selected from the group consisting of doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the pancreatic neuroendocrine cancer is recurrent pancreatic neuroendocrine cancer.
- the pancreatic neuroendocrine cancer is refractory to one or more drugs used in a standard therapy for pancreatic neuroendocrine cancer, such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and/or everolimus.
- drugs used in a standard therapy for pancreatic neuroendocrine cancer such as, but not limited to, doxorubicin, streptozocin, fluorouracil (5-FU), dacarbazine, temozolomide, thalidomide, capecitabine, sunitinib, somatostatin analogs (e.g., octreotide, lanreotide, or pasireotide), and/or ever
- the individual is a human who exhibits one or more symptoms associated with pancreatic neuroendocrine cancer.
- the individual is at an early stage of pancreatic neuroendocrine cancer.
- the individual is at an advanced stage of pancreatic neuroendocrine cancer.
- the individual is genetically or otherwise predisposed (e.g., having a risk factor) to developing pancreatic neuroendocrine cancer.
- Individuals at risk for pancreatic neuroendocrine cancer include, e.g., those having relatives who have experienced pancreatic neuroendocrine cancer, and those whose risk is determined by analysis of genetic or biochemical markers.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with pancreatic neuroendocrine cancer (e.g., NF1 and/or MEN1) or has one or more extra copies of a gene associated with pancreatic neuroendocrine cancer.
- the individual has a ras or PTEN mutation.
- the cancer cells are dependent on an mTOR pathway to translate one or more mRNAs.
- the cancer cells are not capable of synthesizing mRNAs by an mTOR-independent pathway.
- the cancer cells have decreased or no PTEN activity or have decreased or no expression of PTEN compared to non-cancerous cells.
- the individual has at least one tumor biomarker selected from the group consisting of elevated PI3K activity, elevated mTOR activity, presence of FLT-3ITD, elevated AKT activity, elevated KRAS activity, and elevated NRAS activity.
- the individual has a variation in at least one gene selected from the group consisting of drug metabolism genes, cancer genes, and drug target genes.
- a method of treating ovarian cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus. In some embodiments, the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor. In some embodiments, the histone deacetylase inhibitor is specific to only one HDAC. In some embodiments, the histone deacetylase inhibitor is specific to only one class of HDAC.
- the histone deacetylase inhibitor is specific to two or more HDACs or two or more classes of HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class I and II HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class III HDACs. In some embodiments, the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin. In some embodiments, the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor. In some embodiments, the kinase inhibitor is a Raf kinase inhibitor. In some embodiments, the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase). In some embodiments, the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is sorafenib. In some embodiments, the kinase inhibitor is nilotinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered sequentially. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered simultaneously. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered concurrently.
- the ovarian cancer is ovarian epithelial cancer.
- ovarian epithelial cancer histological classifications include: serous cystomas (e.g., serous benign cystadenomas, serous cystadenomas with proliferating activity of the epithelial cells and nuclear abnormalities but with no infiltrative destructive growth, or serous cystadenocarcinomas), mucinous cystomas (e.g., mucinous benign cystadenomas, mucinous cystadenomas with proliferating activity of the epithelial cells and nuclear abnormalities but with no infiltrative destructive growth, or mucinous cystadenocarcinomas), endometrioid tumors (e.g., endometrioid benign cysts, endometrioid tumors with proliferating activity of the epithelial cells and nuclear abnormalities but with no infiltrative destructive growth, or endometrioid adenocarcinomas), clear cell (mesonephro), a pre
- the ovarian epithelial cancer is stage I (e.g., stage IA, IB, or IC), stage II (e.g., stage HA, HB, or IIC), stage III (e.g., stage IIIA, HIB, or HIC), or stage IV.
- stage I e.g., stage IA, IB, or IC
- stage II e.g., stage HA, HB, or IIC
- stage III e.g., stage IIIA, HIB, or HIC
- stage IV e.g., stage IV.
- the ovarian cancer is an ovarian germ cell tumor.
- Exemplary histologic subtypes include dysgerminomas or other germ cell tumors (e.g., endodermal sinus tumors such as hepatoid or intestinal tumors, embryonal carcinomas, olyembryomas, choriocarcinomas, teratomas, or mixed form tumors).
- Exemplary teratomas are immature teratomas, mature teratomas, solid teratomas, and cystic teratomas (e.g., dermoid cysts such as mature cystic teratomas, and dermoid cysts with malignant transformation).
- the ovarian germ cell tumor is stage I (e.g., stage IA, IB, or IC), stage II (e.g., stage HA, HB, or IIC), stage III (e.g., stage IIIA, HIB, or IIIC), or stage IV.
- stage I e.g., stage IA, IB, or IC
- stage II e.g., stage HA, HB, or IIC
- stage III e.g., stage IIIA, HIB, or IIIC
- stage IV e.g., stage IV.
- a method of treating ovarian cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug,
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is lenalidomide.
- the immunomodulator is pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the ovarian cancer is recurrent ovarian cancer.
- the ovarian cancer is refractory to one or more drugs used in a standard therapy for ovarian cancer, such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed, topotecan, and/or vinorelbine.
- drugs used in a standard therapy for ovarian cancer such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed,
- a method of treating ovarian cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor. In some embodiments, the ovarian cancer is recurrent ovarian cancer.
- the ovarian cancer is refractory to one or more drugs used in a standard therapy for ovarian cancer, such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed, topotecan, and/or vinorelbine.
- drugs used in a standard therapy for ovarian cancer such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed,
- a method of treating ovarian cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a histone deacetylase inhibitor
- a histone deacetylase inhibitor such as romidepsin
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a histone deacetylase inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 n
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., si
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat.
- the histone deacetylase inhibitor is romidepsin.
- the ovarian cancer is recurrent ovarian cancer.
- the ovarian cancer is refractory to one or more drugs used in a standard therapy for ovarian cancer, such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed, topotecan, and/or vinorelbine.
- drugs used in a standard therapy for ovarian cancer such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, if
- a method of treating ovarian cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin.
- the ovarian cancer is recurrent ovarian cancer.
- the ovarian cancer is refractory to one or more drugs used in a standard therapy for ovarian cancer, such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed, topotecan, and/or vinorelbine.
- drugs used in a standard therapy for ovarian cancer such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxor
- a method of treating ovarian cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., siroli
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the ovarian cancer is recurrent ovarian cancer.
- the ovarian cancer is refractory to one or more drugs used in a standard therapy for ovarian cancer, such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed, topotecan, and/or vinorelbine.
- drugs used in a standard therapy for ovarian cancer such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxor
- a method of treating ovarian cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or so
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the ovarian cancer is recurrent ovarian cancer.
- the ovarian cancer is refractory to one or more drugs used in a standard therapy for ovarian cancer, such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed, topotecan, and/or vinorelbine.
- drugs used in a standard therapy for ovarian cancer such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed,
- a method of treating ovarian cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the ovarian cancer is recurrent ovarian cancer.
- the ovarian cancer is refractory to one or more drugs used in a standard therapy for ovarian cancer, such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed, topotecan, and/or vinorelbine.
- drugs used in a standard therapy for ovarian cancer such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed,
- a method of treating ovarian cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the ovarian cancer is recurrent ovarian cancer.
- the ovarian cancer is refractory to one or more drugs used in a standard therapy for ovarian cancer, such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed, topotecan, and/or vinorelbine.
- drugs used in a standard therapy for ovarian cancer such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed,
- a method of treating ovarian cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a second therapeutic agent selected from the group consisting of nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed, topotecan, and vinorelbine.
- a second therapeutic agent selected from the group consisting of nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, iri
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent selected from the group consisting of nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed, topotecan, and vinorelbine.
- a second therapeutic agent selected from the group consisting of nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide,
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed, topotecan, and vinorelbine.
- a second therapeutic agent selected from the group consisting of nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed, topotecan, and vinorelbine.
- a second therapeutic agent selected from the group consisting of nab-paclitaxel, paclitaxel
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent selected from the group consisting of nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposom
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the ovarian cancer is recurrent ovarian cancer.
- the ovarian cancer is refractory to one or more drugs used in a standard therapy for ovarian cancer, such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed, topotecan, and/or vinorelbine.
- drugs used in a standard therapy for ovarian cancer such as, but not limited to, nab-paclitaxel, paclitaxel, cisplatin, vinblastine, altretamine, capecitabine, cyclophosphamide, etoposide, gemcitabine, ifosfamide, irinotecan, liposomal doxorubicin, melphalan, pemetrexed,
- the individual is a human who exhibits one or more symptoms associated with ovarian cancer.
- the individual is at an early stage of ovarian cancer.
- the individual is at an advanced stage of ovarian cancer.
- the individual is genetically or otherwise predisposed (e.g., having a risk factor) to developing ovarian cancer.
- Individuals at risk for ovarian cancer include, e.g., those having relatives who have experienced ovarian cancer, and those whose risk is determined by analysis of genetic or biochemical markers.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with ovarian cancer (e.g., MLH1, MLH3, MSH2, MSH6, TGFBR2, PMS1, PMS2, BRCA1 and/or BRCA2) or has one or more extra copies of a gene associated with ovarian cancer.
- the individual has a ras or PTEN mutation.
- the cancer cells are dependent on an mTOR pathway to translate one or more mRNAs. In some embodiments, the cancer cells are not capable of synthesizing mRNAs by an mTOR-independent pathway.
- the cancer cells have decreased or no PTEN activity or have decreased or no expression of PTEN compared to non-cancerous cells.
- the individual has at least one tumor biomarker selected from the group consisting of elevated PI3K activity, elevated mTOR activity, presence of FLT-3ITD, elevated AKT activity, elevated KRAS activity, and elevated NRAS activity.
- the individual has a variation in at least one gene selected from the group consisting of drug metabolism genes, cancer genes, and drug target genes.
- LAM Lymphangioleiomyomatosis
- a method of treating lymphangioleiomyomatosis in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus. In some embodiments, the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor. In some embodiments, the histone deacetylase inhibitor is specific to only one HDAC. In some embodiments, the histone deacetylase inhibitor is specific to only one class of HDAC.
- the histone deacetylase inhibitor is specific to two or more HDACs or two or more classes of HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class I and II HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class III HDACs. In some embodiments, the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin. In some embodiments, the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor. In some embodiments, the kinase inhibitor is a Raf kinase inhibitor. In some embodiments, the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase). In some embodiments, the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is sorafenib. In some embodiments, the kinase inhibitor is nilotinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered sequentially. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered simultaneously. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered concurrently.
- a method of treating lymphangioleiomyomatosis in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug,
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is lenalidomide.
- the immunomodulator is pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the lymphangioleiomyomatosis is recurrent lymphangioleiomyomatosis.
- the lymphangioleiomyomatosis is refractory to one or more drugs used in a standard therapy for lymphangioleiomyomatosis, such as, but not limited to, sirolimus and/or doxycycline.
- a method of treating lymphangioleiomyomatosis in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the lymphangioleiomyomatosis is recurrent lymphangioleiomyomatosis. In some embodiments, the lymphangioleiomyomatosis is refractory to one or more drugs used in a standard therapy for lymphangioleiomyomatosis, such as, but not limited to, sirolimus and/or doxycycline.
- a method of treating lymphangioleiomyomatosis in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a histone deacetylase inhibitor
- a histone deacetylase inhibitor such as romidepsin
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a histone deacetylase inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 n
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., si
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat.
- the histone deacetylase inhibitor is romidepsin.
- the lymphangioleiomyomatosis is recurrent lymphangioleiomyomatosis.
- the lymphangioleiomyomatosis is refractory to one or more drugs used in a standard therapy for lymphangioleiomyomatosis, such as, but not limited to, sirolimus and/or doxycycline.
- a method of treating lymphangioleiomyomatosis in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin.
- the lymphangioleiomyomatosis is recurrent lymphangioleiomyomatosis. In some embodiments, the lymphangioleiomyomatosis is refractory to one or more drugs used in a standard therapy for lymphangioleiomyomatosis, such as, but not limited to, sirolimus and/or doxycycline.
- a method of treating lymphangioleiomyomatosis in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., siroli
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the lymphangioleiomyomatosis is recurrent lymphangioleiomyomatosis. In some embodiments, the lymphangioleiomyomatosis is refractory to one or more drugs used in a standard therapy for lymphangioleiomyomatosis, such as, but not limited to, sirolimus and/or doxycycline.
- a method of treating lymphangioleiomyomatosis in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or so
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the lymphangioleiomyomatosis is recurrent lymphangioleiomyomatosis.
- the lymphangioleiomyomatosis is refractory to one or more drugs used in a standard therapy for lymphangioleiomyomatosis, such as, but not limited to, sirolimus and/or doxycycline.
- a method of treating lymphangioleiomyomatosis in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the lymphangioleiomyomatosis is recurrent lymphangioleiomyomatosis.
- the lymphangioleiomyomatosis is refractory to one or more drugs used in a standard therapy for lymphangioleiomyomatosis, such as, but not limited to, sirolimus and/or doxycycline.
- a method of treating lymphangioleiomyomatosis in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the lymphangioleiomyomatosis is recurrent lymphangioleiomyomatosis.
- the lymphangioleiomyomatosis is refractory to one or more drugs used in a standard therapy for lymphangioleiomyomatosis, such as, but not limited to, sirolimus and/or doxycycline.
- a method of treating lymphangioleiomyomatosis in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of doxycycline.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of doxycycline.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of doxycycline.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of doxycycline.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of doxycycline.
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with doxycycline.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the lymphangioleiomyomatosis is recurrent lymphangioleiomyomatosis.
- the lymphangioleiomyomatosis is refractory to one or more drugs used in a standard therapy for lymphangioleiomyomatosis, such as, but not limited to, sirolimus and/or doxycycline.
- the individual is a human who exhibits one or more symptoms associated with lymphangioleiomyomatosis. In some embodiments, the individual is at an early stage of lymphangioleiomyomatosis. In some embodiments, the individual is at an advanced stage of lymphangioleiomyomatosis. In some of embodiments, the individual is genetically or otherwise predisposed (e.g., having a risk factor) to developing lymphangioleiomyomatosis.
- lymphangioleiomyomatosis include, e.g., those having relatives who have experienced lymphangioleiomyomatosis, and those whose risk is determined by analysis of genetic or biochemical markers.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with lymphangioleiomyomatosis (e.g., TSC1 and/or TSC2) or has one or more extra copies of a gene associated with lymphangioleiomyomatosis.
- the individual has a ras or PTEN mutation.
- the cancer cells are dependent on an mTOR pathway to translate one or more mRNAs.
- the cancer cells are not capable of synthesizing mRNAs by an mTOR-independent pathway. In some embodiments, the cancer cells have decreased or no PTEN activity or have decreased or no expression of PTEN compared to non-cancerous cells. In some embodiments, the individual has at least one tumor biomarker selected from the group consisting of elevated PI3K activity, elevated mTOR activity, presence of FLT-3ITD, elevated AKT activity, elevated KRAS activity, and elevated NRAS activity. In some embodiments, the individual has a variation in at least one gene selected from the group consisting of drug metabolism genes, cancer genes, and drug target genes.
- a method of treating prostate cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus. In some embodiments, the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor. In some embodiments, the histone deacetylase inhibitor is specific to only one HDAC. In some embodiments, the histone deacetylase inhibitor is specific to only one class of HDAC.
- the histone deacetylase inhibitor is specific to two or more HDACs or two or more classes of HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class I and II HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class III HDACs. In some embodiments, the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin. In some embodiments, the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor. In some embodiments, the kinase inhibitor is a Raf kinase inhibitor. In some embodiments, the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase). In some embodiments, the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is sorafenib. In some embodiments, the kinase inhibitor is nilotinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered sequentially. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered simultaneously. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered concurrently.
- the prostate cancer is an adenocarcinoma. In some embodiments, the prostate cancer is a sarcoma, neuroendocrine tumor, small cell cancer, ductal cancer, or a lymphoma. In some embodiments, the prostate cancer is at any of the four stages, A, B, C, or D, according to the Jewett staging system. In some embodiments, the prostate cancer is stage A prostate cancer (e.g., the cancer cannot be felt during a rectal exam). In some embodiments, the prostate cancer is stage B prostate cancer (e.g., the tumor involves more tissue within the prostate, and can be felt during a rectal exam, or is found with a biopsy that is done because of a high PSA level).
- stage A prostate cancer e.g., the cancer cannot be felt during a rectal exam
- the prostate cancer is stage B prostate cancer (e.g., the tumor involves more tissue within the prostate, and can be felt during a rectal exam, or is found with a biopsy that is done because of a high PSA level).
- the prostate cancer is stage C prostate cancer (e.g., the cancer has spread outside the prostate to nearby tissues). In some embodiments, the prostate cancer is stage D prostate cancer. In some embodiments, the prostate cancer is androgen independent prostate cancer (AIPC). In some embodiments, the prostate cancer is androgen dependent prostate cancer. In some embodiments, the prostate cancer is refractory to hormone therapy.
- stage C prostate cancer e.g., the cancer has spread outside the prostate to nearby tissues.
- the prostate cancer is stage D prostate cancer.
- the prostate cancer is androgen independent prostate cancer (AIPC). In some embodiments, the prostate cancer is androgen dependent prostate cancer. In some embodiments, the prostate cancer is refractory to hormone therapy.
- AIPC androgen independent prostate cancer
- the prostate cancer is androgen dependent prostate cancer. In some embodiments, the prostate cancer is refractory to hormone therapy.
- a method of treating prostate cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as an albumin
- an immunomodulator such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as lenalidomide, pomalidomide, or an immune checkpoint inhibitor).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug,
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is lenalidomide.
- the immunomodulator is pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the prostate cancer is recurrent prostate cancer.
- the prostate cancer is refractory to one or more drugs used in a standard therapy for prostate cancer, such as, but not limited to, docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and/or vinorelbine.
- drugs used in a standard therapy for prostate cancer such as, but not limited to, docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and/or vinorelbine.
- a method of treating prostate cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of an immunomodulator (such as an immunostimulator, e.g., pomalidomide).
- an immunomodulator such as an immunostimulator, e.g., pomalidomide
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the immunomodulator.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor. In some embodiments, the prostate cancer is recurrent prostate cancer.
- the prostate cancer is refractory to one or more drugs used in a standard therapy for prostate cancer, such as, but not limited to, docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and/or vinorelbine.
- drugs used in a standard therapy for prostate cancer such as, but not limited to, docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and/or vinorelbine.
- a method of treating prostate cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a histone deacetylase inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a histone deacetylase inhibitor
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 n
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., si
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat.
- the histone deacetylase inhibitor is romidepsin.
- the prostate cancer is recurrent prostate cancer.
- the prostate cancer is refractory to one or more drugs used in a standard therapy for prostate cancer, such as, but not limited to, docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and/or vinorelbine.
- a method of treating prostate cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and sirolimus or a derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a histone deacetylase inhibitor (such as romidepsin).
- a histone deacetylase inhibitor such as romidepsin
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the histone deacetylase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin.
- the prostate cancer is recurrent prostate cancer.
- the prostate cancer is refractory to one or more drugs used in a standard therapy for prostate cancer, such as, but not limited to, docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and/or vinorelbine.
- a method of treating prostate cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin e.g., an albumin
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a kinase inhibitor
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- an mTOR inhibitor such as a limus drug, e.g., siroli
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the prostate cancer is recurrent prostate cancer.
- the prostate cancer is refractory to one or more drugs used in a standard therapy for prostate cancer, such as, but not limited to, docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and/or vinorelbine.
- a method of treating prostate cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a kinase inhibitor (such as a tyrosine kinase inhibitor, e.g., nilotinib or sorafenib).
- a kinase inhibitor such as a tyrosine kinase inhibitor, e.g., nilotinib or so
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the kinase inhibitor.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the kinase inhibitor is a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is a Raf kinase inhibitor.
- the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase).
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is nilotinib.
- the prostate cancer is recurrent prostate cancer.
- the prostate cancer is refractory to one or more drugs used in a standard therapy for prostate cancer, such as, but not limited to, docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and/or vinorelbine.
- drugs used in a standard therapy for prostate cancer such as, but not limited to, docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and/or vinorelbine.
- a method of treating prostate cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the prostate cancer is recurrent prostate cancer.
- the prostate cancer is refractory to one or more drugs used in a standard therapy for prostate cancer, such as, but not limited to, docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and/or vinorelbine.
- drugs used in a standard therapy for prostate cancer such as, but not limited to, docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and/or vinorelbine.
- a method of treating prostate cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a cancer vaccine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a cancer vaccine.
- a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the cancer vaccine.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the cancer vaccine is a vaccine prepared using autologous tumor cells.
- the cancer vaccine is a vaccine prepared using allogeneic tumor cells.
- the prostate cancer is recurrent prostate cancer.
- the prostate cancer is refractory to one or more drugs used in a standard therapy for prostate cancer, such as, but not limited to, docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and/or vinorelbine.
- drugs used in a standard therapy for prostate cancer such as, but not limited to, docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and/or vinorelbine.
- a method of treating prostate cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin; and b) an effective amount of a second therapeutic agent selected from the group consisting of docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and vinorelbine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the sirolimus or derivative thereof in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent selected from the group consisting of docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and vinorelbine.
- a second therapeutic agent selected from the group consisting of docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and vinorelbine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and vinorelbine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent selected from the group consisting of docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and vinorelbine.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising sirolimus or a derivative thereof and an albumin, wherein the nanoparticles comprise the sirolimus or derivative thereof associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the sirolimus or derivative thereof in the sirolimus nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent selected from the group consisting of docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and vinorelbine.
- a second therapeutic agent selected from the group consisting of docet
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the sirolimus or derivative thereof is sirolimus.
- the sirolimus nanoparticle composition comprises nab-sirolimus.
- the sirolimus nanoparticle composition is nab-sirolimus.
- the prostate cancer is recurrent prostate cancer.
- the prostate cancer is refractory to one or more drugs used in a standard therapy for prostate cancer, such as, but not limited to, docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and/or vinorelbine.
- drugs used in a standard therapy for prostate cancer such as, but not limited to, docetaxel, cabazitaxel, mitoxantrone, estramustine, doxorubicin, etoposide, vinblastine, paclitaxel, carboplatin, and/or vinorelbine.
- the individual is a human who exhibits one or more symptoms associated with prostate cancer.
- the individual is at an early stage of prostate cancer.
- the individual is at an advanced stage of prostate cancer.
- the individual is genetically or otherwise predisposed (e.g., having a risk factor) to developing prostate cancer.
- Individuals at risk for prostate cancer include, e.g., those having relatives who have experienced prostate cancer, and those whose risk is determined by analysis of genetic or biochemical markers.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with prostate cancer (e.g., RNASEL/HPC1, ELAC2/HPC2, SR-A/MSR1, CHEK2, BRCA2, PONl, OGG1, MIC-I, TLR4, and/or PTEN) or has one or more extra copies of a gene associated with prostate cancer.
- the individual has a ras or PTEN mutation.
- the cancer cells are dependent on an mTOR pathway to translate one or more mRNAs. In some embodiments, the cancer cells are not capable of synthesizing mRNAs by an mTOR-independent pathway.
- the cancer cells have decreased or no PTEN activity or have decreased or no expression of PTEN compared to non-cancerous cells.
- the individual has at least one tumor biomarker selected from the group consisting of elevated PI3K activity, elevated mTOR activity, presence of FLT-3ITD, elevated AKT activity, elevated KRAS activity, and elevated NRAS activity.
- the individual has a variation in at least one gene selected from the group consisting of drug metabolism genes, cancer genes, and drug target genes.
- a method of treating a vascular tumor in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus. In some embodiments, the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor. In some embodiments, the histone deacetylase inhibitor is specific to only one HDAC. In some embodiments, the histone deacetylase inhibitor is specific to only one class of HDAC.
- the histone deacetylase inhibitor is specific to two or more HDACs or two or more classes of HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class I and II HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class III HDACs. In some embodiments, the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin. In some embodiments, the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor. In some embodiments, the kinase inhibitor is a Raf kinase inhibitor. In some embodiments, the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase). In some embodiments, the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is sorafenib. In some embodiments, the kinase inhibitor is nilotinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen. In some embodiments, the second therapeutic agent is vincristine. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered sequentially. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered simultaneously. In some embodiments, the second therapeutic agent and the nanoparticle composition are administered concurrently.
- the vascular tumor is Kaposi sarcoma, angiosarcoma, tufted angioma, or kaposiform hemangioendothelioma (KHE). In some embodiments, the vascular tumor is refractory to a prior therapy.
- a method of treating a vascular tumor comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of vincristine.
- a vascular tumor such as Kaposi sarcoma, angiosarcoma, tufted angioma, or kaposiform hemangioendothelioma
- an individual such as a human
- an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of vincristine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of vincristine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of vincristine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of vincristine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of vincristine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with vincristine.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus. In some embodiments, the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the mTOR inhibitor nanoparticle is in the dosage range of about 10 mg/m 2 to about 200 mg/m 2 (including for example about any of 10 mg/m 2 to about 40 mg/m 2 , about 40 mg/m 2 to about 75 mg/m 2 , about 75 mg/m 2 to about 100 mg/m 2 , about 100 mg/m 2 to about 200 mg/m 2 , about 20 mg/m 2 to about 55 mg/m 2 , and any ranges between these values). In some embodiments, the mTOR inhibitor nanoparticle is in the dosage range of about 20 mg/m 2 to about 55 mg/m 2 (such as about any of 20 mg/m 2 , 35 mg/m 2 , 45 mg/m 2 , or 55 mg/m 2 ).
- the vincristine is in the dosage range of about 0.5 mg/m 2 to about 5 mg/m 2 (including for example about any of 0.5 mg/m 2 to about 1 mg/m 2 , about 1 mg/m 2 to about 1.5 mg/m 2 , about 1.5 mg/m 2 to about 2 mg/m 2 , about 2 mg/m 2 to about 2.5 mg/m 2 , about 2.5 mg/m 2 to about 3 mg/m 2 , about 3 mg/m 2 to about 4 mg/m 2 , about 4 mg/m 2 to about 5 mg/m 2 , about 1.5 mg/m 2 , and any ranges between these values). In some embodiments, the vincristine is in a dosage of about 1.5 mg/m 2 .
- the vascular tumor is a recurrent vascular tumor. In some embodiments, the vascular tumor is refractory to one or more drugs used in a standard therapy for the vascular tumor. In some embodiments, the vascular tumor is Kaposi sarcoma. In some embodiments, the vascular tumor is angiosarcoma. In some embodiments, the vascular tumor is tufted angioma. or In some embodiments, the vascular tumor is kaposiform hemangioendothelioma.
- the present application in one aspect provides a method of treating solid tumor in a human individual comprising administering to the individual an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as sirolimus) and albumin and an effective amount of a second therapeutic agent (such as vincristine), wherein the individual is no more than about 21 years old (such as no more than about 18 years old).
- the solid tumor includes, for example, neuroblastoma, osteosarcoma, Ewing sarcoma, rhabdomyosarcoma, medulloblastoma, glioma, hepatic tumor, renal tumor, tufted angioma, and kaposiform hemangioendothelioma (KHE).
- the individual is resistant or refractory to a prior treatment.
- the individual has progressed on the prior treatment.
- the individual has a recurrent solid tumor.
- a method of treating a solid tumor in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent, wherein the individual is no more than about 21 years old (such as no more than about 18 years old).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of a second therapeutic agent.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with the second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus. In some embodiments, the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide). In some embodiments, the immunomodulator is lenalidomide. In some embodiments, the immunomodulator is pomalidomide. In some embodiments, the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor. In some embodiments, the histone deacetylase inhibitor is specific to only one HDAC. In some embodiments, the histone deacetylase inhibitor is specific to only one class of HDAC.
- the histone deacetylase inhibitor is specific to two or more HDACs or two or more classes of HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class I and II HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class III HDACs. In some embodiments, the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin. In some embodiments, the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor. In some embodiments, the kinase inhibitor is a Raf kinase inhibitor. In some embodiments, the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase). In some embodiments, the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the kinase inhibitor is sorafenib. In some embodiments, the kinase inhibitor is nilotinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen. In some embodiments, the second therapeutic agent is temozolomide, irinotecan, vincristine, or a combination thereof.
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of i) temozolomide and irinotecan; or ii) vincristine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- an effective amount of i) temozolomide and irinotecan or ii) vincristine.
- the second therapeutic agent and the nanoparticle composition are administered sequentially.
- the second therapeutic agent and the nanoparticle composition are administered simultaneously.
- the second therapeutic agent and the nanoparticle composition are administered concurrently.
- the solid tumor is neuroblastoma, osteosarcoma, Ewing sarcoma, rhabdomyosarcoma, medulloblastoma, glioma, hepatic tumor, renal tumor, tufted angioma, or kaposiform hemangioendothelioma.
- the solid tumor is refractory to a prior therapy.
- the individual is no more than about any of 17, 16, 15, 14, 13, 12, 11, 10, 9, 8, 7, 6, 5, 4, 3, 2, or 1 year old.
- the individual is about 9 to about 15 years old.
- the individual is about 5 to about 9 years old.
- the individual is about 1 to about 5 years old.
- the individual is no more than about 1 year old, such as about 6 months old to about 1 year old, less than about 6 months old, or less than about 3 months old.
- a method of treating a solid tumor comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of temozolomide and irinotecan, wherein the individual is no more than about 21 years old (such as no more than about 18 years old).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of temozolomide and irinotecan.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of temozolomide and irinotecan.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of temozolomide and irinotecan.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of temozolomide and irinotecan.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with temozolomide and irinotecan.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus. In some embodiments, the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the mTOR inhibitor nanoparticle is in the dosage range of about 10 mg/m 2 to about 200 mg/m 2 (including for example about any of 10 mg/m 2 to about 40 mg/m 2 , about 40 mg/m 2 to about 75 mg/m 2 , about 75 mg/m 2 to about 100 mg/m 2 , about 100 mg/m 2 to about 200 mg/m 2 , about 20 mg/m 2 to about 55 mg/m 2 , and any ranges between these values). In some embodiments, the mTOR inhibitor nanoparticle is in the dosage range of about 20 mg/m 2 to about 55 mg/m 2 (such as about any of 20 mg/m 2 , 35 mg/m 2 , 45 mg/m 2 , or 55 mg/m 2 ).
- the temozolomide is in the dosage range of about 10 mg/m 2 to about 200 mg/m 2 (including for example about any of 10 mg/m 2 to about 40 mg/m 2 , about 40 mg/m 2 to about 75 mg/m 2 , about 75 mg/m 2 to about 100 mg/m 2 , about 100 mg/m 2 to about 200 mg/m 2 , about 125 mg/m 2 , and any ranges between these values). In some embodiments, the temozolomide is in a dosage of about 125 mg/m 2 .
- the irinotecan is in the dosage range of about 10 mg/m 2 to about 200 mg/m 2 (including for example about any of 10 mg/m 2 to about 40 mg/m 2 , about 40 mg/m 2 to about 75 mg/m 2 , about 75 mg/m 2 to about 100 mg/m 2 , about 100 mg/m 2 to about 200 mg/m 2 , about 90 mg/m 2 , and any ranges between these values).
- the irinotecan is in a dosage of about 90 mg/m 2 .
- the solid tumor is a recurrent solid tumor.
- the solid tumor is refractory to one or more drugs used in a standard therapy for the solid tumor.
- the solid tumor is neuroblastoma. In some embodiments, the solid tumor is osteosarcoma. In some embodiments, the solid tumor is Ewing sarcoma. In some embodiments, the solid tumor is rhabdomyosarcoma. In some embodiments, the solid tumor is medulloblastoma. In some embodiments, the solid tumor is glioma. In some embodiments, the solid tumor is hepatic tumor. In some embodiments, the solid tumor is renal tumor. In some embodiments, the individual is no more than about any of 17, 16, 15, 14, 13, 12, 11, 10, 9, 8, 7, 6, 5, 4, 3, 2, or 1 year old. In some embodiments, the individual is about 9 to about 15 years old.
- the individual is about 5 to about 9 years old. In some embodiments, the individual is about 1 to about 5 years old. In some embodiments, the individual is no more than about 1 year old, such as about 6 months old to about 1 year old, less than about 6 months old, or less than about 3 months old.
- a method of treating a solid tumor such as tufted angioma or kaposiform hemangioendothelioma
- an individual such as a human
- administering comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of vincristine, wherein the individual is no more than about 21 years old (such as no more than about 18 years old).
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the mTOR inhibitor in the nanoparticles is associated (e.g., coated) with the albumin; and b) an effective amount of vincristine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of vincristine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm); and b) an effective amount of vincristine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm)
- the method comprises administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin, wherein the nanoparticles comprise the mTOR inhibitor associated (e.g., coated) with the albumin, wherein the nanoparticles have an average particle size of no greater than about 150 nm (such as no greater than about 120 nm, for example about 100 nm), wherein the weight ratio of albumin and the mTOR inhibitor in the mTOR inhibitor nanoparticle composition is about 9:1 or less (such as about 9:1 or about 8:1); and b) an effective amount of vincristine.
- an mTOR inhibitor such as a limus drug, e.g., sirolimus or a derivative thereof
- an albumin such as a limus drug, e.g., sirolimus or a derivative thereof
- the nanoparticles
- the method further comprises administering to the individual at least one therapeutic agent used in a standard combination therapy with vincristine.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus. In some embodiments, the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the mTOR inhibitor nanoparticle is in the dosage range of about 10 mg/m 2 to about 200 mg/m 2 (including for example about any of 10 mg/m 2 to about 40 mg/m 2 , about 40 mg/m 2 to about 75 mg/m 2 , about 75 mg/m 2 to about 100 mg/m 2 , about 100 mg/m 2 to about 200 mg/m 2 , about 20 mg/m 2 to about 55 mg/m 2 , and any ranges between these values). In some embodiments, the mTOR inhibitor nanoparticle is in the dosage range of about 20 mg/m 2 to about 55 mg/m 2 (such as about any of 20 mg/m 2 , 35 mg/m 2 , 45 mg/m 2 , or 55 mg/m 2 ).
- the vincristine is in the dosage range of about 0.5 mg/m 2 to about 5 mg/m 2 (including for example about any of 0.5 mg/m 2 to about 1 mg/m 2 , about 1 mg/m 2 to about 1.5 mg/m 2 , about 1.5 mg/m 2 to about 2 mg/m 2 , about 2 mg/m 2 to about 2.5 mg/m 2 , about 2.5 mg/m 2 to about 3 mg/m 2 , about 3 mg/m 2 to about 4 mg/m 2 , about 4 mg/m 2 to about 5 mg/m 2 , about 1.5 mg/m 2 , and any ranges between these values). In some embodiments, the vincristine is in a dosage of about 1.5 mg/m 2 .
- the solid tumor is a recurrent solid tumor. In some embodiments, the solid tumor is refractory to one or more drugs used in a standard therapy for the solid tumor. In some embodiments, the solid tumor is tufted angioma. In some embodiments, the solid tumor is kaposiform hemangioendothelioma. In some embodiments, the individual is no more than about any of 17, 16, 15, 14, 13, 12, 11, 10, 9, 8, 7, 6, 5, 4, 3, 2, or 1 year old. In some embodiments, the individual is about 9 to about 15 years old. In some embodiments, the individual is about 5 to about 9 years old. In some embodiments, the individual is about 1 to about 5 years old. In some embodiments, the individual is no more than about 1 year old, such as about 6 months old to about 1 year old, less than about 6 months old, or less than about 3 months old.
- nanoparticle compositions such as mTOR inhibitor nanoparticle compositions
- second therapeutic agents described herein can be used in the preparation of a formulation, such as a pharmaceutical composition, by combining the nanoparticle composition(s) or second therapeutic agent(s) described above with a pharmaceutically acceptable carrier, an excipient, a stabilizing agent, and/or another agent known in the art for use in the methods of treatment, methods of administration, and dosage regimes described herein.
- negatively charged components include, but are not limited to, bile salts, bile acids, glycocholic acid, cholic acid, chenodeoxycholic acid, taurocholic acid, glycochenodeoxycholic acid, taurochenodeoxycholic acid, lithocholic acid, ursodeoxycholic acid, dehydrocholic acid, and others; and phospholipids including lecithin (egg yolk) based phospholipids, which includes the following phosphatidylcholines: palmitoyloleoylphosphatidylcholine, palmitoyllinoleoylphosphatidylcholine, stearoyllinoleoylphosphatidylcholine, stearoyloleoylphosphatidylcholine, stearoylarachidoylphosphatidylcholine, and dipalmitoyl
- phospholipids include L- ⁇ -dimyristoylphosphatidylcholine (DMPC), dioleoylphosphatidylcholine (DOPC), distearoylphosphatidylcholine (DSPC), hydrogenated soy phosphatidylcholine (HSPC), and other related compounds.
- Negatively charged surfactants or emulsifiers are also suitable as additives, e.g., sodium cholesteryl sulfate and the like.
- the pharmaceutical composition is suitable for administration to a human. In some embodiments, the pharmaceutical composition is suitable for administration to a mammal, such as, in the veterinary context, domestic pets and agricultural animals.
- a mammal such as, in the veterinary context, domestic pets and agricultural animals.
- suitable formulations of the inventive composition see, e.g., U.S. Pat. Nos. 5,916,596 and 6,096,331, which are hereby incorporated by reference in their entireties).
- the following formulations and methods are merely exemplary and are in no way limiting.
- Formulations suitable for oral administration can comprise (a) liquid solutions, such as an effective amount of the active ingredient (e.g., nanoparticle composition or second therapeutic agent) dissolved in diluents, such as water, saline, or orange juice, (b) capsules, sachets or tablets, each containing a predetermined amount of the active ingredient, as solids or granules, (c) suspensions in an appropriate liquid, (d) suitable emulsions, and (e) powders.
- liquid solutions such as an effective amount of the active ingredient (e.g., nanoparticle composition or second therapeutic agent) dissolved in diluents, such as water, saline, or orange juice
- diluents such as water, saline, or orange juice
- capsules, sachets or tablets each containing a predetermined amount of the active ingredient, as solids or granules
- suspensions in an appropriate liquid such as water, saline, or orange juice
- Tablet forms can include one or more of lactose, mannitol, corn starch, potato starch, microcrystalline cellulose, acacia, gelatin, colloidal silicon dioxide, croscarmellose sodium, talc, magnesium stearate, stearic acid, and other excipients, colorants, diluents, buffering agents, moistening agents, preservatives, flavoring agents, and pharmacologically compatible excipients.
- Lozenge forms can comprise the active ingredient in a flavor, usually sucrose and acacia or tragacanth, as well as pastilles comprising the active ingredient in an inert base, such as gelatin and glycerin, or sucrose and acacia, emulsions, gels, and the like containing, in addition to the active ingredient, such excipients as are known in the art.
- a flavor usually sucrose and acacia or tragacanth
- pastilles comprising the active ingredient in an inert base, such as gelatin and glycerin, or sucrose and acacia, emulsions, gels, and the like containing, in addition to the active ingredient, such excipients as are known in the art.
- Formulations suitable for parenteral administration include aqueous and non-aqueous, isotonic sterile injection solutions, which can contain anti-oxidants, buffers, bacteriostats, and solutes that render the formulation compatible with the blood of the intended recipient, and aqueous and non-aqueous sterile suspensions that can include suspending agents, solubilizers, thickening agents, stabilizing agents, and preservatives.
- the formulations can be presented in unit-dose or multi-dose sealed containers, such as ampules and vials, and can be stored in a freeze-dried (lyophilized) condition requiring only the addition of a sterile liquid excipient (e.g., water) for injection, immediately prior to use.
- Extemporaneous injection solutions and suspensions can be prepared from sterile powders, granules, and tablets of the kind previously described.
- Formulations suitable for aerosol administration are provided that comprise the inventive compositions described above.
- the formulation suitable for aerosol administration is an aqueous or non-aqueous isotonic sterile solutions, and can contain anti-oxidants, buffers, bacteriostats, and/or solutes.
- the formulation suitable for aerosol administration is an aqueous or non-aqueous sterile suspensions that can include suspending agents, solubilizers, thickening agents, stabilizing agents, and/or preservatives, alone or in combination with other suitable components.
- These aerosol formulations can be placed into pressurized acceptable propellants, such as dichlorodifluoromethane, propane, nitrogen, and the like. They can also be formulated as pharmaceuticals for non-pressured preparations, such as for use in a nebulizer or an atomizer.
- the pharmaceutical composition is formulated to have a pH in the range of about 4.5 to about 9.0, including for example pH ranges of any of about 5.0 to about 8.0, about 6.5 to about 7.5, and about 6.5 to about 7.0.
- the pH of the pharmaceutical composition is formulated to no less than about 6, including for example no less than about any of 6.5, 7, or 8 (e.g., about 8).
- the pharmaceutical composition can also be made to be isotonic with blood by the addition of a suitable tonicity modifier, such as glycerol.
- the nanoparticles of this invention can be enclosed in a hard or soft capsule, can be compressed into tablets, or can be incorporated with beverages or food or otherwise incorporated into the diet.
- Capsules can be formulated by mixing the nanoparticles with an inert pharmaceutical diluent and inserting the mixture into a hard gelatin capsule of the appropriate size. If soft capsules are desired, a slurry of the nanoparticles with an acceptable vegetable oil, light petroleum or other inert oil can be encapsulated by machine into a gelatin capsule.
- unit dosage forms comprising the compositions and formulations described herein. These unit dosage forms can be stored in a suitable packaging in single or multiple unit dosages and may also be further sterilized and sealed.
- the pharmaceutical composition e.g., a dosage or unit dosage form of a pharmaceutical composition
- the pharmaceutical composition e.g., a dosage or unit dosage form of a pharmaceutical composition includes a) nanoparticles comprising sirolimus or a derivative thereof and an albumin and b) at least one other therapeutic agent.
- the other therapeutic agent comprises any of the second therapeutic agents described herein).
- the pharmaceutical composition also includes one or more other compounds (or pharmaceutically acceptable salts thereof) that are useful for treating cancer.
- the amount of mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) in the composition is included in any of the following ranges: about 20 to about 50 mg, about 50 to about 100 mg, about 100 to about 125 mg, about 125 to about 150 mg, about 150 to about 175 mg, about 175 to about 200 mg, about 200 to about 225 mg, about 225 to about 250 mg, about 250 to about 300 mg, or about 300 to about 350 mg.
- the amount of mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) in the composition is in the range of about 54 mg to about 540 mg, such as about 180 mg to about 270 mg or about 216 mg, of the mTOR inhibitor.
- the carrier is suitable for parental administration (e.g., intravenous administration).
- a taxane is not contained in the composition.
- the mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) is the only pharmaceutically active agent for the treatment of solid tumors that is contained in the composition.
- a pharmaceutical composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and/or a second therapeutic agent for use in any of the methods of treating a solid tumor described herein.
- the pharmaceutical composition comprises nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and albumin (such as human albumin)
- the pharmaceutical composition comprises a second therapeutic agent.
- the pharmaceutical composition comprises a) nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and albumin (such as human albumin); and b) a second therapeutic agent.
- the second therapeutic agent is an immunomodulator.
- the second therapeutic agent is an immunostimulator.
- the second therapeutic agent is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® compound (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the second therapeutic agent is an immunomodulator selected from the group consisting of pomalidomide and lenalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor.
- the histone deacetylase inhibitor is specific to only one HDAC.
- the histone deacetylase inhibitor is specific to only one class of HDAC.
- the histone deacetylase inhibitor is specific to two or more HDACs or two or more classes of HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class I and II HDACs. In some embodiments, the histone deacetylase inhibitor is specific to class III HDACs. In some embodiments, the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor.
- the kinase inhibitor is a serine/threonine kinase inhibitor. In some embodiments, the kinase inhibitor is a Raf kinase inhibitor. In some embodiments, the kinase inhibitor inhibits more than one class of kinase (e.g., an inhibitor of more than one of a tyrosine kinase, a Raf kinase, and a serine/threonine kinase). In some embodiments, the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib. In some embodiments, the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen.
- a cancer vaccine such as a vaccine prepared using tumor cells or at least one tumor-associated antigen.
- the solid tumor is selected from the group consisting of pancreatic neuroendocrine cancer, endometrial cancer, ovarian cancer, breast cancer, renal cell carcinoma, lymphangioleiomyomatosis (LAM), prostate cancer, and bladder cancer.
- the methods are applicable to solid tumors of all stages, including stages, I, II, III, and IV, according to the American Joint Committee on Cancer (AJCC) staging groups.
- the solid tumor is an/a: early stage cancer, non-metastatic cancer, primary cancer, advanced cancer, locally advanced cancer, metastatic cancer, cancer in remission, cancer in an adjuvant setting, or cancer in a neoadjuvant setting.
- the solid tumor is localized respectable, localized unrespectable, or unrespectable. In some embodiments, the solid tumor is localized respectable or borderline respectable. In some embodiments, the cancer has been refractory to prior therapy. In some embodiments, the cancer is resistant to the treatment with a non-nanoparticle formulation of a chemotherapeutic agent (such as non-nanoparticle formulation of a limus drug).
- a chemotherapeutic agent such as non-nanoparticle formulation of a limus drug
- the solid tumor is breast cancer.
- the breast cancer is early stage breast cancer, non-metastatic breast cancer, advanced breast cancer, stage IV breast cancer, locally advanced breast cancer, metastatic breast cancer, breast cancer in remission, breast cancer in an adjuvant setting, or breast cancer in a neoadjuvant setting.
- the breast cancer is in a neoadjuvant setting.
- the breast cancer is at an advanced stage.
- the breast cancer (which may be HER2 positive or HER2 negative) includes, for example, advanced breast cancer, stage IV breast cancer, locally advanced breast cancer, and metastatic breast cancer.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with breast cancer (e.g., BRCA1, BRCA2, ATM, CHEK2, RAD51, AR, DIRAS3, ERBB2, TP53, AKT, PTEN, and/or PDK) or has one or more extra copies of a gene (e.g., one or more extra copies of the HER2 gene) associated with breast cancer.
- the method further comprises identifying a cancer patient population (i.e. breast cancer population) based on a hormone receptor status of patients having tumor tissue not expressing both ER and PgR.
- the cancer is renal cell carcinoma.
- the renal cell carcinoma is an adenocarcinoma.
- the renal cell carcinoma is a clear cell renal cell carcinoma, papillary renal cell carcinoma (also called chromophilic renal cell carcinoma), chromophobe renal cell carcinoma, collecting duct renal cell carcinoma, granular renal cell carcinoma, mixed granular renal cell carcinoma, renal angiomyolipomas, or spindle renal cell carcinoma.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with renal cell carcinoma (e.g., VHL, TSC1, TSC2, CUL2, MSH2, MLH1, INK4a/ARF, MET, TGF- ⁇ , TGF- ⁇ 1, IGF-I, IGF-IR, AKT, and/or PTEN) or has one or more extra copies of a gene associated with renal cell carcinoma.
- a gene, genetic mutation, or polymorphism associated with renal cell carcinoma e.g., VHL, TSC1, TSC2, CUL2, MSH2, MLH1, INK4a/ARF, MET, TGF- ⁇ , TGF- ⁇ 1, IGF-I, IGF-IR, AKT, and/or PTEN
- the renal cell carcinoma is associated with (1) von Hippel-Lindau (VHL) syndrome, (2) hereditary papillary renal carcinoma (HPRC), (3) familial renal oncocytoma (FRO) associated with Birt-Hogg-Dube syndrome (BHDS), or (4) hereditary renal carcinoma (HRC).
- VHL von Hippel-Lindau
- HPRC hereditary papillary renal carcinoma
- FRO familial renal oncocytoma
- BHDS Birt-Hogg-Dube syndrome
- HRC hereditary renal carcinoma
- the renal cell carcinoma is at any of stage I, II, III, or IV, according to the American Joint Committee on Cancer (AJCC) staging groups.
- the renal cell carcinoma is stage IV renal cell carcinoma.
- the solid tumor is prostate cancer.
- the prostate cancer is an adenocarcinoma.
- the prostate cancer is a sarcoma, neuroendocrine tumor, small cell cancer, ductal cancer, or a lymphoma.
- the prostate cancer is at any of the four stages, A, B, C, or D, according to the Jewett staging system.
- the prostate cancer is stage A prostate cancer (e.g., the cancer cannot be felt during a rectal exam).
- the prostate cancer is stage B prostate cancer (e.g., the tumor involves more tissue within the prostate, and can be felt during a rectal exam, or is found with a biopsy that is done because of a high PSA level).
- the prostate cancer is stage C prostate cancer (e.g., the cancer has spread outside the prostate to nearby tissues).
- the prostate cancer is stage D prostate cancer.
- the prostate cancer is androgen independent prostate cancer (AIPC).
- AIPC androgen dependent prostate cancer.
- the prostate cancer is refractory to hormone therapy.
- the prostate cancer is substantially refractory to hormone therapy.
- the individual is a human who has a gene, genetic mutation, or polymorphism associated with prostate cancer (e.g., RNASEL/HPC1, ELAC2/HPC2, SR-A/MSR1, CHEK2, BRCA2, PONl, OGG1, MIC-I, TLR4, and/or PTEN) or has one or more extra copies of a gene associated with prostate cancer.
- a gene, genetic mutation, or polymorphism associated with prostate cancer e.g., RNASEL/HPC1, ELAC2/HPC2, SR-A/MSR1, CHEK2, BRCA2, PONl, OGG1, MIC-I, TLR4, and/or PTEN
- the solid tumor is lung cancer.
- the lung cancer is a non-small cell lung cancer (NSCLC).
- NSCLC non-small cell lung cancer
- Examples of NSCLC include, but are not limited to, large-cell carcinoma (e.g., large-cell neuroendocrine carcinoma, combined large-cell neuroendocrine carcinoma, basaloid carcinoma, lymphoepithelioma-like carcinoma, clear cell carcinoma, and large-cell carcinoma with rhabdoid phenotype), adenocarcinoma (e.g., acinar, papillary (e.g., bronchioloalveolar carcinoma, nonmucinous, mucinous, mixed mucinous and nonmucinous and indeterminate cell type), solid adenocarcinoma with mucin, adenocarcinoma with mixed subtypes, well-differentiated fetal adenocarcinoma, mucinous (colloid) adenocarcinoma, mucinous cystadeno
- the NSCLC is, according to TNM classifications, a stage T tumor (primary tumor), a stage N tumor (regional lymph nodes), or a stage M tumor (distant metastasis).
- the lung cancer is a carcinoid (typical or atypical), adenosquamous carcinoma, cylindroma, or carcinoma of the salivary gland (e.g., adenoid cystic carcinoma or mucoepidermoid carcinoma).
- the lung cancer is a carcinoma with pleomorphic, sarcomatoid, or sarcomatous elements (e.g., carcinomas with spindle and/or giant cells, spindle cell carcinoma, giant cell carcinoma, carcinosarcoma, or pulmonary blastoma).
- the cancer is small cell lung cancer (SCLC; also called oat cell carcinoma).
- SCLC small cell lung cancer
- the small cell lung cancer may be limited-stage, extensive stage or recurrent small cell lung cancer.
- the individual may be a human who has a gene, genetic mutation, or polymorphism suspected or shown to be associated with lung cancer (e.g., SASH1, LATS1, IGF2R, PARK2, KRAS, PTEN, Kras2, Krag, Pas1, ERCC1, XPD, IL8RA, EGFR, Ot 1 -AD, EPHX, MMP1, MMP2, MMP3, MMP12, IL1 ⁇ , RAS, and/or AKT) or has one or more extra copies of a gene associated with lung cancer.
- a gene, genetic mutation, or polymorphism suspected or shown to be associated with lung cancer e.g., SASH1, LATS1, IGF2R, PARK2, KRAS, PTEN, Kras2, Krag, Pas1, ERCC1, XPD, IL8RA, EGFR, Ot 1 -AD, EPHX, MMP1, MMP2, MMP3, MMP12, IL1 ⁇ , RAS, and/or AKT
- a method of treating lung cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is lenalidomide.
- the immunomodulator is pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin.
- the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor. In some embodiments, the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen.
- the lung cancer is recurrent lung cancer. In some embodiments, the lung cancer is refractory to at least one drug used in a standard therapy for lung cancer.
- the solid tumor is brain cancer.
- the brain cancer is glioma, brain stem glioma, cerebellar or cerebral astrocytoma (e.g., pilocytic astrocytoma, diffuse astrocytoma, or anaplastic (malignant) astrocytoma), malignant glioma, ependymoma, oligodenglioma, meningioma, craniopharyngioma, haemangioblastomas, medulloblastoma, supratentorial primitive neuroectodermal tumors, visual pathway and hypothalamic glioma, or glioblastoma.
- astrocytoma e.g., pilocytic astrocytoma, diffuse astrocytoma, or anaplastic (malignant) astrocytoma
- malignant glioma ependymoma
- oligodenglioma oligodenglio
- the brain cancer is glioblastoma (also called glioblastoma multiforme or grade 4 astrocytoma).
- the glioblastoma is radiation-resistant.
- the glioblastoma is radiation-sensitive.
- the glioblastoma may be infratentorial.
- the glioblastoma is supratentorial.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with brain cancer (e.g., glioblastoma) (e.g., NRPB, MAGE-E1, MMACI-E1, PTEN, LOH, p53, MDM2, DCC, TP-73, RbI, EGFR, PDGFR- ⁇ , PMS2, MLH1, and/or DMBT1) or has one or more extra copies of a gene associated with brain cancer (e.g., glioblastoma) (e.g., MDM2, EGFR, and PDGR- ⁇ ).
- glioblastoma e.g., NRPB, MAGE-E1, MMACI-E1, PTEN, LOH, p53, MDM2, DCC, TP-73, RbI, EGFR, PDGFR- ⁇ , PMS2, MLH1, and/or DMBT1
- glioblastoma e.g., NR
- a method of treating brain cancer in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is lenalidomide.
- the immunomodulator is pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin.
- the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor. In some embodiments, the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen.
- the brain cancer is recurrent brain cancer. In some embodiments, the brain cancer is refractory to at least one drug used in a standard therapy for brain cancer.
- the solid tumor is melanoma.
- the melanoma is superficial spreading melanoma, lentigo maligna melanoma, nodular melanoma, mucosal melanoma, polypoid melanoma, desmoplastic melanoma, amelanotic melanoma, soft-tissue melanoma, or acral lentiginous melanoma.
- the melanoma is at any of stage I, II, III, or IV, according to the American Joint Committee on Cancer (AJCC) staging groups.
- the melanoma is recurrent.
- the solid tumor is ovarian cancer.
- the ovarian cancer is ovarian epithelial cancer.
- Exemplary ovarian epithelial cancer histological classifications include: serous cystomas (e.g., serous benign cystadenomas, serous cystadenomas with proliferating activity of the epithelial cells and nuclear abnormalities but with no infiltrative destructive growth, or serous cystadenocarcinomas), mucinous cystomas (e.g., mucinous benign cystadenomas, mucinous cystadenomas with proliferating activity of the epithelial cells and nuclear abnormalities but with no infiltrative destructive growth, or mucinous cystadenocarcinomas), endometrioid tumors (e.g., endometrioid benign cysts, endometrioid tumors with proliferating activity of the epithelial cells and nuclear abnormalities but with no infiltrative destructive growth, or mucinous cystadenocarcinomas
- the ovarian epithelial cancer is stage I (e.g., stage IA, IB, or IC), stage II (e.g., stage HA, HB, or IIC), stage III (e.g., stage IIIA, HIB, or HIC), or stage IV.
- the individual is a human who has a gene, genetic mutation, or polymorphism associated with ovarian cancer (e.g., MLH1, MLH3, MSH2, MSH6, TGFBR2, PMS1, PMS2, BRCA1 and/or BRCA2) or has one or more extra copies of a gene associated with ovarian cancer (e.g., one or more extra copies of the HER2 gene).
- the ovarian cancer is an ovarian germ cell tumor.
- Exemplary histologic subtypes include dysgerminomas or other germ cell tumors (e.g., endodermal sinus tumors such as hepatoid or intestinal tumors, embryonal carcinomas, olyembryomas, choriocarcinomas, teratomas, or mixed form tumors).
- Exemplary teratomas are immature teratomas, mature teratomas, solid teratomas, and cystic teratomas (e.g., dermoid cysts such as mature cystic teratomas, and dermoid cysts with malignant transformation).
- the ovarian germ cell tumor is stage I (e.g., stage IA, IB, or IC), stage II (e.g., stage HA, HB, or IIC), stage III (e.g., stage IIIA, HIB, or IIIC), or stage IV.
- stage I e.g., stage IA, IB, or IC
- stage II e.g., stage HA, HB, or IIC
- stage III e.g., stage IIIA, HIB, or IIIC
- stage IV e.g., stage IV.
- the solid tumor is pancreatic neuroendocrine cancer.
- the pancreatic neuroendocrine cancer is a well-differentiated neuroendocrine tumor, a well-differentiated (low grade) neuroendocrine carcinoma, or a poorly differentiated (high grade) neuroendocrine carcinoma.
- the pancreatic neuroendocrine cancer is a functional pancreatic neuroendocrine tumor.
- the pancreatic neuroendocrine tumor is a nonfunctional pancreatic neuroendocrine tumor.
- the pancreatic neuroendocrine cancer is insulinoma, glucagonoma, somatostatinoma, gastrinoma, VIPoma, GRFoma, or ACTHoma.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with pancreatic neuroendocrine cancer (e.g., NF1 and/or MEN1) or has one or more extra copies of a gene associated with pancreatic neuroendocrine cancer.
- the solid tumor is endometrial cancer.
- the endometrial cancer is adenocarcinoma, carcinosarcoma, squamous cell carcinoma, undifferentiated carcinoma, small cell carcinoma, or transitional carcinoma.
- the endometrial cancer is endometroid cancer, adenocarcinoma with squamous differentiation, adenoacanthoma, adenosquamous carcinoma, secretory carcinoma, ciliated carcinoma, or villoglandular adenocarcinoma.
- the endometrial cancer is clear-cell carcinoma, mucinous adenocarcinoma, or papillary serous adenocarcinoma. In some embodiments, the endometrial cancer is grade 1, grade 2, or grade 3. In some embodiments, the endometrial cancer is type 1 endometrial cancer. In some embodiments, the endometrial cancer is type 2 endometrial cancer. In some embodiments, the endometrial cancer is uterine carcinosarcoma.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with endometrial cancer (e.g., MLH1, MLH2, MSH2, MLH3, MSH6, TGBR2, PMS1, and/or PMS2) or has one or more extra copies of a gene associated with endometrial cancer.
- a gene, genetic mutation, or polymorphism associated with endometrial cancer e.g., MLH1, MLH2, MSH2, MLH3, MSH6, TGBR2, PMS1, and/or PMS2
- the solid tumor is lymphangioleiomyomatosis.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with lymphangioleiomyomatosis (e.g., TSC1 and/or TSC2) or has one or more extra copies of a gene associated with lymphangioleiomyomatosis.
- the solid tumor is colon cancer.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with colon cancer (e.g., RAS, AKT, PTEN, POK, and/or EGFR) or has one or more extra copies of a gene associated with colon cancer.
- a gene, genetic mutation, or polymorphism associated with colon cancer e.g., RAS, AKT, PTEN, POK, and/or EGFR
- the solid tumor is subependymal giant cell astrocytoma (SEGA) with tuberous sclerosis (TS).
- SEGA subependymal giant cell astrocytoma
- TS tuberous sclerosis
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with SEGA (e.g., TSC1 and/or TSC2) or has one or more extra copies of a gene associated with SEGA.
- a method of treating SEGA (such as SEGA with TS) in an individual (such as a human) comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is lenalidomide.
- the immunomodulator is pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin.
- the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor. In some embodiments, the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen.
- the SEGA is recurrent SEGA. In some embodiments, the SEGA is refractory to at least one drug used in a standard therapy for SEGA (e.g., everolimus and/or sirolimus).
- the solid tumor is angiomyolipoma with tuberous sclerosis (TS).
- the angiomyolipoma is PEComa.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with angiomyolipoma (e.g., TSC1 and/or TSC2) or has one or more extra copies of a gene associated with angiomyolipoma.
- angiomyolipoma such as angiomyolipoma with TS
- an individual such as a human
- administering comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is lenalidomide.
- the immunomodulator is pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin.
- the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor. In some embodiments, the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen.
- the angiomyolipoma is recurrent angiomyolipoma.
- the angiomyolipoma is refractory to at least one drug used in a standard therapy for angiomyolipoma (e.g., everolimus and/or sirolimus).
- the solid tumor is carcinoid.
- the carcinoid is a gastrointestinal carcinoid, a lung carcinoid, or a rectal carcinoid.
- the carcinoid is a functional carcinoid.
- the carcinoid is a nonfunctional carcinoid.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with carcinoid (e.g., MEN1) or has one or more extra copies of a gene associated with carcinoid.
- a method of treating carcinoid in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is lenalidomide.
- the immunomodulator is pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin.
- the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor. In some embodiments, the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen.
- the carcinoid is recurrent carcinoid.
- the carcinoid is refractory to at least one drug used in a standard therapy for carcinoid (e.g., somatostatin analogs, interferon, and/or everolimus).
- the solid tumor is hepatocellular carcinoma (HCC).
- HCC hepatocellular carcinoma
- the HCC is early stage HCC, non-metastatic HCC, primary HCC, advanced HCC, locally advanced HCC, metastatic HCC, HCC in remission, or recurrent HCC.
- the HCC is localized respectable (i.e., tumors that are confined to a portion of the liver that allows for complete surgical removal), localized unrespectable (i.e., the localized tumors may be unrespectable because crucial blood vessel structures are involved or because the liver is impaired), or unrespectable (i.e., the tumors involve all lobes of the liver and/or has spread to involve other organs (e.g., lung, lymph nodes, bone).
- organs e.g., lung, lymph nodes, bone
- the HCC is, according to TNM classifications, a stage I tumor (single tumor without vascular invasion), a stage II tumor (single tumor with vascular invasion, or multiple tumors, none greater than 5 cm), a stage III tumor (multiple tumors, any greater than 5 cm, or tumors involving major branch of portal or hepatic veins), a stage IV tumor (tumors with direct invasion of adjacent organs other than the gallbladder, or perforation of visceral peritoneum), N1 tumor (regional lymph node metastasis), or M1 tumor (distant metastasis).
- the HCC is, according to AJCC (American Joint Commission on Cancer) staging criteria, stage T1, T2, T3, or T4 HCC.
- the HCC is any one of liver cell carcinomas, fibrolamellar variants of HCC, and mixed hepatocellular cholangiocarcinomas.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with hepatocellular carcinoma (e.g., CCND2, RAD23B, GRP78, CEP164, MDM2, and/or ALDH2) or has one or more extra copies of a gene associated with hepatocellular carcinoma.
- a method of treating hepatocellular carcinoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is lenalidomide.
- the immunomodulator is pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin.
- the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor. In some embodiments, the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen.
- the hepatocellular carcinoma is recurrent hepatocellular carcinoma.
- the hepatocellular carcinoma is refractory to at least one drug used in a standard therapy for hepatocellular carcinoma (e.g., sorafenib, floxuridine, cisplatin, mitomycin C, doxorubicin, and/or everolimus).
- a standard therapy for hepatocellular carcinoma e.g., sorafenib, floxuridine, cisplatin, mitomycin C, doxorubicin, and/or everolimus.
- the solid tumor is rhabdomyosarcoma (RMS).
- RMS rhabdomyosarcoma
- the rhabdomyosarcoma is botryoid rhabdomyosarcoma, spindle cell rhabdomyosarcoma, embryonal rhabdomyosarcoma, alveolar rhabdomyosarcoma, or undifferentiated sarcoma.
- the rhabdomyosarcoma is pleomorphic rhabdomyosarcoma or sclerosing rhabdomyosarcoma.
- the individual may be a human who has a gene, genetic mutation, or polymorphism associated with rhabdomyosarcoma (e.g., PAX3, PAX7, FOXO1, and/or IGF2) or has one or more extra copies of a gene associated with rhabdomyosarcoma.
- rhabdomyosarcoma e.g., PAX3, PAX7, FOXO1, and/or IGF2
- a method of treating rhabdomyosarcoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of a second therapeutic agent.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the second therapeutic agent is selected from the group consisting of an immunomodulator (such as an immunostimulator or an immune checkpoint inhibitor), a histone deacetylase inhibitor, a kinase inhibitor (such as a tyrosine kinase inhibitor), and a cancer vaccine (such as a vaccine prepared using tumor cells or at least one tumor-associated antigen).
- the second therapeutic agent is an immunomodulator.
- the immunomodulator is an immunostimulator that directly stimulates the immune system of an individual.
- the immunomodulator is an agonistic antibody that targets an activating receptor on an immune cell (such as a T cell).
- the immunomodulator is an immune checkpoint inhibitor.
- the immune checkpoint inhibitor is an antagonistic antibody that targets an immune checkpoint protein.
- the immunomodulator is an IMiDs® (small molecule immunomodulator, such as lenalidomide or pomalidomide).
- the immunomodulator is lenalidomide.
- the immunomodulator is pomalidomide.
- the immunomodulator is small molecule or antibody-based IDO inhibitor.
- the second therapeutic agent is a histone deacetylase inhibitor.
- the histone deacetylase inhibitor is selected from the group consisting of romidepsin, panobinostat, ricolinostat, and belinostat. In some embodiments, the histone deacetylase inhibitor is romidepsin.
- the second therapeutic agent is a kinase inhibitor, such as a tyrosine kinase inhibitor. In some embodiments, the kinase inhibitor is a serine/threonine kinase inhibitor.
- the kinase inhibitor is selected from the group consisting of erlotinib, imatinib, lapatinib, nilotinib, sorafenib, and sunitinib.
- the second therapeutic agent is a cancer vaccine, such as a vaccine prepared using tumor cells or at least one tumor-associated antigen.
- the second therapeutic agent is a vinca alkaloid (such as vinblastine, vincristine, vindesine, or vinorelbine) or an alkylating agent (such as cyclophosphamide, melphalan, chlorambucil, ifosfamide, streptozocin, or busulfan).
- the rhabdomyosarcoma is recurrent rhabdomyosarcoma. In some embodiments, the rhabdomyosarcoma is refractory to at least one drug used in a standard therapy for rhabdomyosarcoma (e.g., vincristine, dactinomycin, cyclophosphamide, irinotecan, topotecan, ifosfamide, etoposide, and/or doxorubicin).
- a standard therapy for rhabdomyosarcoma e.g., vincristine, dactinomycin, cyclophosphamide, irinotecan, topotecan, ifosfamide, etoposide, and/or doxorubicin.
- a method of treating rhabdomyosarcoma in an individual comprising administering to the individual a) an effective amount of a composition comprising nanoparticles comprising an mTOR inhibitor (such as a limus drug, e.g., sirolimus or a derivative thereof) and an albumin; and b) an effective amount of vinorelbine and cyclophosphamide.
- the mTOR inhibitor is a limus drug.
- the mTOR inhibitor is sirolimus or a derivative thereof.
- the mTOR inhibitor nanoparticle composition comprises nab-sirolimus.
- the mTOR inhibitor nanoparticle composition is nab-sirolimus.
- the mTOR inhibitor nanoparticle is in the dosage range of about 10 mg/m 2 to about 200 mg/m 2 (including for example about any of 10 mg/m 2 to about 40 mg/m 2 , about 40 mg/m 2 to about 75 mg/m 2 , about 75 mg/m 2 to about 100 mg/m 2 , about 100 mg/m 2 to about 200 mg/m 2 , about 15 mg/m 2 to about 45 mg/m 2 , and any ranges between these values).
- the mTOR inhibitor nanoparticle is in the dosage range of about 15 mg/m 2 to about 45 mg/m 2 (such as about any of 15 mg/m 2 , 25 mg/m 2 , 35 mg/m 2 , or 45 mg/m 2 ).
- the vinorelbine is in the dosage range of about 10 mg/m 2 to about 80 mg/m 2 (including for example about any of 10 mg/m 2 to about 20 mg/m 2 , about 20 mg/m 2 to about 40 mg/m 2 , about 40 mg/m 2 to about 60 mg/m 2 , about 60 mg/m 2 to about 80 mg/m 2 , about 25 mg/m 2 , and any ranges between these values).
- the vinorelbine is in a dosage of about 25 mg/m 2 .
- the cyclophosphamide is in the dosage range of about 0.5 g/m 2 to about 5 g/m 2 (including for example about any of 0.5 g/m 2 to about 1 g/m 2 , about 1 g/m 2 to about 1.2 g/m 2 , about 1.2 g/m 2 to about 1.4 g/m 2 , about 1.4 g/m 2 to about 1.6 g/m 2 , about 1.6 g/m 2 to about 1.8 g/m 2 , about 1.8 g/m 2 to about 2.0 g/m 2 , about 2.0 g/m 2 to about 2.2 g/m 2 , about 2.2 g/m 2 to about 3 g/m 2 , about 3 g/m 2 to about 4 g/m 2 , about 4 g/m 2 to about 5 g/m 2 , about 1.2 g/m
- the cyclophosphamide is in a dosage of about 1.2 g/m 2 .
- the rhabdomyosarcoma is recurrent rhabdomyosarcoma.
- the rhabdomyosarcoma is refractory to at least one drug used in a standard therapy for rhabdomyosarcoma (e.g., vincristine, dactinomycin, cyclophosphamide, irinotecan, topotecan, ifosfamide, etoposide, and/or doxorubicin).
- a standard therapy for rhabdomyosarcoma e.g., vincristine, dactinomycin, cyclophosphamide, irinotecan, topotecan, ifosfamide, etoposide, and/or doxorubicin.
- the solid tumor is neuroblastoma.
- the neuroblastoma is neuroblastoma of the adrenal glands, neck, chest abdomen, or pelvis.
- the neuroblastoma is a stage 1, stage 2A, stage 2B, stage 3, stage 4, or stage 4S neuroblastoma.
- the neuroblastoma is a stage L1, stage L2, stage M, or stage M2 neuroblastoma.
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Epidemiology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Physics & Mathematics (AREA)
- General Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Biomedical Technology (AREA)
- Nanotechnology (AREA)
- Optics & Photonics (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Dermatology (AREA)
- Gastroenterology & Hepatology (AREA)
- Immunology (AREA)
- Molecular Biology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Medicinal Preparation (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Investigating Or Analysing Biological Materials (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US15/737,943 US20180153863A1 (en) | 2015-06-29 | 2016-06-29 | Methods of treating solid tumors using nanoparticle mtor inhibitor combination therapy |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201562186325P | 2015-06-29 | 2015-06-29 | |
| PCT/US2016/040202 WO2017004267A1 (en) | 2015-06-29 | 2016-06-29 | Methods of treating solid tumors using nanoparticle mtor inhibitor combination therapy |
| US15/737,943 US20180153863A1 (en) | 2015-06-29 | 2016-06-29 | Methods of treating solid tumors using nanoparticle mtor inhibitor combination therapy |
Related Parent Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PCT/US2016/040202 A-371-Of-International WO2017004267A1 (en) | 2015-06-29 | 2016-06-29 | Methods of treating solid tumors using nanoparticle mtor inhibitor combination therapy |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US17/850,806 Continuation US20230263779A1 (en) | 2015-06-29 | 2022-06-27 | Methods of treating solid tumors using nanoparticle mtor inhibitor combination therapy |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US20180153863A1 true US20180153863A1 (en) | 2018-06-07 |
Family
ID=57609103
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US15/737,943 Abandoned US20180153863A1 (en) | 2015-06-29 | 2016-06-29 | Methods of treating solid tumors using nanoparticle mtor inhibitor combination therapy |
| US17/850,806 Abandoned US20230263779A1 (en) | 2015-06-29 | 2022-06-27 | Methods of treating solid tumors using nanoparticle mtor inhibitor combination therapy |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US17/850,806 Abandoned US20230263779A1 (en) | 2015-06-29 | 2022-06-27 | Methods of treating solid tumors using nanoparticle mtor inhibitor combination therapy |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US20180153863A1 (https=) |
| EP (1) | EP3313382A4 (https=) |
| JP (1) | JP2018521058A (https=) |
| KR (2) | KR20240090657A (https=) |
| CN (1) | CN107921006A (https=) |
| AU (1) | AU2016287508B2 (https=) |
| CA (1) | CA2990726A1 (https=) |
| CL (1) | CL2017003457A1 (https=) |
| EA (1) | EA201890146A1 (https=) |
| HK (1) | HK1247093A1 (https=) |
| IL (1) | IL256333B2 (https=) |
| MX (1) | MX2017016492A (https=) |
| NZ (1) | NZ738929A (https=) |
| WO (1) | WO2017004267A1 (https=) |
Cited By (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20180278502A1 (en) * | 2017-03-27 | 2018-09-27 | International Business Machines Corporation | Using activity states to determine receptiveness |
| US20180311203A1 (en) * | 2015-01-12 | 2018-11-01 | Emcure Pharmaceuticals Limited | Liquid formulation of cabazitaxel |
| US10206887B2 (en) | 2009-04-15 | 2019-02-19 | Abraxis Bioscience, Llc | Prion free nanoparticle compositions and methods of making thereof |
| US10258565B2 (en) | 2011-04-28 | 2019-04-16 | Abraxis Bioscience, Llc | Intravascular delivery of nanoparticle compositions and uses thereof |
| US10328031B2 (en) | 2013-01-11 | 2019-06-25 | Abraxis Bioscience, Llc | Methods of treating pancreatic cancer |
| US10413531B2 (en) | 2013-03-14 | 2019-09-17 | Abraxis Bioscience, Llc | Methods of treating bladder cancer |
| US10527604B1 (en) | 2015-03-05 | 2020-01-07 | Abraxis Bioscience, Llc | Methods of assessing suitability of use of pharmaceutical compositions of albumin and paclitaxel |
| US10555912B2 (en) | 2011-12-14 | 2020-02-11 | Abraxis Bioscience, Llc | Use of polymeric excipients for lyophilization or freezing of particles |
| US10660965B2 (en) | 2010-03-29 | 2020-05-26 | Abraxis Bioscience, Llc | Methods of enhancing drug delivery and effectiveness of therapeutic agents |
| US10682420B2 (en) | 2006-12-14 | 2020-06-16 | Abraxis Bioscience, Llc | Breast cancer therapy based on hormone receptor status with nanoparticles comprising taxane |
| WO2020123481A1 (en) * | 2018-12-10 | 2020-06-18 | Celator Pharmaceuticals Inc. | Combination formulations of taxanes and mtor inhibitors |
| US10705070B1 (en) | 2015-03-05 | 2020-07-07 | Abraxis Bioscience, Llc | Methods of assessing suitability of use of pharmaceutical compositions of albumin and poorly water soluble drug |
| US10744110B2 (en) | 2013-03-12 | 2020-08-18 | Abraxis Bioscience, Llc | Methods of treating lung cancer |
| WO2020264181A1 (en) * | 2019-06-28 | 2020-12-30 | The Board Of Regents Of The University Of Oklahoma | Therapeutic annexin-drug conjugates and methods of use |
| US10973806B2 (en) | 2015-06-29 | 2021-04-13 | Abraxis Bioscience, Llc | Methods of treating epithelioid cell tumors comprising administering a composition comprising nanoparticles comprising an mTOR inhibitor and an albumin |
| US11497737B2 (en) | 2019-10-28 | 2022-11-15 | Abraxis Bioscience, Llc | Pharmaceutical compositions of albumin and rapamycin |
| US20230293449A1 (en) * | 2019-11-11 | 2023-09-21 | Abraxis Bioscience, Llc | Biomarkers for nanoparticle compositions |
| US11944708B2 (en) | 2018-03-20 | 2024-04-02 | Abraxis Bioscience, Llc | Methods of treating central nervous system disorders via administration of nanoparticles of an mTOR inhibitor and an albumin |
| WO2024228964A1 (en) * | 2023-04-30 | 2024-11-07 | Aadi Bioscience, Inc. | Treatments comprising an mtor inhibitor nanoparticle composition |
| CN119770670A (zh) * | 2024-12-27 | 2025-04-08 | 西安交通大学医学院第一附属医院 | 一种蛋白微球抑制剂及其制备方法和应用 |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20180177771A1 (en) * | 2015-06-29 | 2018-06-28 | Abraxis Bioscience, Llc | Biomarkers for nanoparticle compositions |
| TWI794171B (zh) | 2016-05-11 | 2023-03-01 | 美商滬亞生物國際有限公司 | Hdac抑制劑與pd-l1抑制劑之組合治療 |
| TWI808055B (zh) | 2016-05-11 | 2023-07-11 | 美商滬亞生物國際有限公司 | Hdac 抑制劑與 pd-1 抑制劑之組合治療 |
| EP3641772B1 (en) * | 2017-06-22 | 2023-08-02 | Celgene Corporation | Treatment of hepatocellular carcinoma characterized by hepatitis b virus infection |
| EA202091514A1 (ru) * | 2017-12-19 | 2020-09-15 | АБРАКСИС БАЙОСАЙЕНС, ЭлЭлСи | СПОСОБЫ ЛЕЧЕНИЯ РАКА ТОЛСТОЙ КИШКИ С ИСПОЛЬЗОВАНИЕМ КОМБИНИРОВАННОЙ ТЕРАПИИ НАНОЧАСТИЦАМИ С ИНГИБИТОРОМ mTOR |
| JP2021523930A (ja) * | 2018-03-23 | 2021-09-09 | アイエスアール イミューン システム レギュレイション ホールディング アクチエボラグ(パブル) | マクロライド化合物と免疫チェックポイント阻害剤との組み合わせ |
| CN112423737A (zh) * | 2018-05-22 | 2021-02-26 | 阿布拉科斯生物科学有限公司 | 用于治疗肺高压的方法和组合物 |
| US10350226B1 (en) * | 2018-06-27 | 2019-07-16 | Joshua O. Atiba | Therapy and prevention of prion protein complex infections |
| MX2021011230A (es) * | 2019-03-19 | 2022-03-11 | Abraxis Bioscience Llc | Administracion subcutanea de nanoparticulas que comprenden un inhibidor del objetivo de la rapamicina en mamiferos (mtor) y albumina para tratamiento de enfermedades. |
| CN110055331B (zh) * | 2019-05-10 | 2023-05-02 | 人和未来生物科技(长沙)有限公司 | 一种用于膀胱癌辅助诊断或筛查的试剂盒及其应用 |
| CN117045800A (zh) * | 2022-05-06 | 2023-11-14 | 上海科技大学 | mTOR抑制剂增强靶向蛋白降解药物功效的应用 |
| WO2024081674A1 (en) | 2022-10-11 | 2024-04-18 | Aadi Bioscience, Inc. | Combination therapies for the treatment of cancer |
| WO2025075314A1 (ko) | 2023-10-06 | 2025-04-10 | 오스템임플란트 주식회사 | 치과용 임플란트 및 이를 포함하는 치과용 임플란트 조립체 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2645633A1 (en) * | 2006-04-05 | 2007-11-01 | Novartis Ag | Combinations of therapeutic agents for treating cancer |
| CN101730526A (zh) * | 2007-03-07 | 2010-06-09 | 阿布拉科斯生物科学有限公司 | 作为抗癌剂的包含雷帕霉素和白蛋白的纳米颗粒 |
| AU2013204187B2 (en) * | 2007-03-07 | 2015-10-01 | Abraxis Bioscience, Llc | Nanoparticle comprising rapamycin and albumin as anticancer agent |
| WO2008109163A1 (en) * | 2007-03-07 | 2008-09-12 | Abraxis Bioscience, Llc. | Nanoparticle comprising rapamycin and albumin as anticancer agent |
| CN113967253A (zh) * | 2012-05-15 | 2022-01-25 | 百时美施贵宝公司 | 通过破坏pd-1/pd-l1信号传输的免疫治疗 |
| EP2968191B1 (en) * | 2013-03-14 | 2021-06-16 | Abraxis BioScience, LLC | Methods of treating bladder cancer |
| CN105358177B (zh) * | 2013-04-17 | 2018-11-23 | 西格诺药品有限公司 | 包含tor激酶抑制剂和imid化合物的联合疗法用于治疗癌症 |
-
2016
- 2016-06-29 HK HK18106582.1A patent/HK1247093A1/zh unknown
- 2016-06-29 NZ NZ738929A patent/NZ738929A/en unknown
- 2016-06-29 KR KR1020247016786A patent/KR20240090657A/ko not_active Ceased
- 2016-06-29 JP JP2017568137A patent/JP2018521058A/ja active Pending
- 2016-06-29 WO PCT/US2016/040202 patent/WO2017004267A1/en not_active Ceased
- 2016-06-29 EA EA201890146A patent/EA201890146A1/ru unknown
- 2016-06-29 MX MX2017016492A patent/MX2017016492A/es unknown
- 2016-06-29 EP EP16818728.4A patent/EP3313382A4/en not_active Withdrawn
- 2016-06-29 CN CN201680049598.0A patent/CN107921006A/zh active Pending
- 2016-06-29 CA CA2990726A patent/CA2990726A1/en not_active Abandoned
- 2016-06-29 AU AU2016287508A patent/AU2016287508B2/en active Active
- 2016-06-29 KR KR1020187002291A patent/KR20180019229A/ko not_active Ceased
- 2016-06-29 US US15/737,943 patent/US20180153863A1/en not_active Abandoned
-
2017
- 2017-12-14 IL IL256333A patent/IL256333B2/en unknown
- 2017-12-28 CL CL2017003457A patent/CL2017003457A1/es unknown
-
2022
- 2022-06-27 US US17/850,806 patent/US20230263779A1/en not_active Abandoned
Cited By (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US10682420B2 (en) | 2006-12-14 | 2020-06-16 | Abraxis Bioscience, Llc | Breast cancer therapy based on hormone receptor status with nanoparticles comprising taxane |
| US10206887B2 (en) | 2009-04-15 | 2019-02-19 | Abraxis Bioscience, Llc | Prion free nanoparticle compositions and methods of making thereof |
| US10660965B2 (en) | 2010-03-29 | 2020-05-26 | Abraxis Bioscience, Llc | Methods of enhancing drug delivery and effectiveness of therapeutic agents |
| US10258565B2 (en) | 2011-04-28 | 2019-04-16 | Abraxis Bioscience, Llc | Intravascular delivery of nanoparticle compositions and uses thereof |
| US10555912B2 (en) | 2011-12-14 | 2020-02-11 | Abraxis Bioscience, Llc | Use of polymeric excipients for lyophilization or freezing of particles |
| US10328031B2 (en) | 2013-01-11 | 2019-06-25 | Abraxis Bioscience, Llc | Methods of treating pancreatic cancer |
| US10744110B2 (en) | 2013-03-12 | 2020-08-18 | Abraxis Bioscience, Llc | Methods of treating lung cancer |
| US10413531B2 (en) | 2013-03-14 | 2019-09-17 | Abraxis Bioscience, Llc | Methods of treating bladder cancer |
| US20180311203A1 (en) * | 2015-01-12 | 2018-11-01 | Emcure Pharmaceuticals Limited | Liquid formulation of cabazitaxel |
| US10527604B1 (en) | 2015-03-05 | 2020-01-07 | Abraxis Bioscience, Llc | Methods of assessing suitability of use of pharmaceutical compositions of albumin and paclitaxel |
| US12061183B2 (en) | 2015-03-05 | 2024-08-13 | Abraxis Bioscience, Llc | Methods of assessing suitability of use of pharmaceutical compositions of albumin and poorly water soluble drug |
| US10705070B1 (en) | 2015-03-05 | 2020-07-07 | Abraxis Bioscience, Llc | Methods of assessing suitability of use of pharmaceutical compositions of albumin and poorly water soluble drug |
| US10900951B1 (en) | 2015-03-05 | 2021-01-26 | Abraxis Bioscience, Llc | Methods of assessing suitability of use of pharmaceutical compositions of albumin and paclitaxel |
| US11320416B1 (en) | 2015-03-05 | 2022-05-03 | Abraxis Bioscience, Llc | Methods of assessing suitability of use of pharmaceutical compositions of albumin and poorly water soluble drug |
| US10973806B2 (en) | 2015-06-29 | 2021-04-13 | Abraxis Bioscience, Llc | Methods of treating epithelioid cell tumors comprising administering a composition comprising nanoparticles comprising an mTOR inhibitor and an albumin |
| US12133844B2 (en) | 2015-06-29 | 2024-11-05 | Abraxis Bioscience, Llc | Methods of treating epithelioid cell tumors |
| US20180278502A1 (en) * | 2017-03-27 | 2018-09-27 | International Business Machines Corporation | Using activity states to determine receptiveness |
| US10841364B2 (en) * | 2017-03-27 | 2020-11-17 | International Business Machines Corporation | Using and comparing known and current activity states to determine receptiveness |
| US12324860B2 (en) | 2018-03-20 | 2025-06-10 | Abraxis Bioscience, Llc | Methods of treating central nervous system disorders via administration of nanoparticles of an mTOR inhibitor and an albumin |
| US11944708B2 (en) | 2018-03-20 | 2024-04-02 | Abraxis Bioscience, Llc | Methods of treating central nervous system disorders via administration of nanoparticles of an mTOR inhibitor and an albumin |
| WO2020123481A1 (en) * | 2018-12-10 | 2020-06-18 | Celator Pharmaceuticals Inc. | Combination formulations of taxanes and mtor inhibitors |
| WO2020264181A1 (en) * | 2019-06-28 | 2020-12-30 | The Board Of Regents Of The University Of Oklahoma | Therapeutic annexin-drug conjugates and methods of use |
| US11497737B2 (en) | 2019-10-28 | 2022-11-15 | Abraxis Bioscience, Llc | Pharmaceutical compositions of albumin and rapamycin |
| US20230293449A1 (en) * | 2019-11-11 | 2023-09-21 | Abraxis Bioscience, Llc | Biomarkers for nanoparticle compositions |
| WO2024228964A1 (en) * | 2023-04-30 | 2024-11-07 | Aadi Bioscience, Inc. | Treatments comprising an mtor inhibitor nanoparticle composition |
| CN119770670A (zh) * | 2024-12-27 | 2025-04-08 | 西安交通大学医学院第一附属医院 | 一种蛋白微球抑制剂及其制备方法和应用 |
Also Published As
| Publication number | Publication date |
|---|---|
| JP2018521058A (ja) | 2018-08-02 |
| US20230263779A1 (en) | 2023-08-24 |
| WO2017004267A1 (en) | 2017-01-05 |
| MX2017016492A (es) | 2018-08-16 |
| NZ738929A (en) | 2024-01-26 |
| CL2017003457A1 (es) | 2018-05-11 |
| EA201890146A1 (ru) | 2018-06-29 |
| EP3313382A1 (en) | 2018-05-02 |
| CA2990726A1 (en) | 2017-01-05 |
| IL256333B (en) | 2022-11-01 |
| IL256333B2 (en) | 2023-03-01 |
| CN107921006A (zh) | 2018-04-17 |
| AU2016287508A1 (en) | 2018-02-01 |
| HK1247093A1 (zh) | 2018-09-21 |
| EP3313382A4 (en) | 2019-03-06 |
| KR20240090657A (ko) | 2024-06-21 |
| AU2016287508B2 (en) | 2021-10-14 |
| KR20180019229A (ko) | 2018-02-23 |
| IL256333A (en) | 2018-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US20230263779A1 (en) | Methods of treating solid tumors using nanoparticle mtor inhibitor combination therapy | |
| US20240082224A1 (en) | Methods of treating hematological malignancy using nanoparticle mtor inhibitor combination therapy | |
| JP2018521058A5 (https=) | ||
| US20240009323A1 (en) | Methods of treating colon cancer using nanoparticle mtor inhibitor combination therapy | |
| KR102837015B1 (ko) | mTOR 억제제 및 알부민의 나노입자의 투여를 통한 중추 신경계 장애의 치료 방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: NON FINAL ACTION MAILED |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: RESPONSE TO NON-FINAL OFFICE ACTION ENTERED AND FORWARDED TO EXAMINER |
|
| AS | Assignment |
Owner name: ABRAXIS BIOSCIENCE, LLC, NEW JERSEY Free format text: ASSIGNMENT OF ASSIGNORS INTEREST;ASSIGNOR:DESAI, NEIL P.;REEL/FRAME:048941/0486 Effective date: 20180920 |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: NON FINAL ACTION MAILED |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: FINAL REJECTION MAILED |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: NON FINAL ACTION MAILED |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: RESPONSE TO NON-FINAL OFFICE ACTION ENTERED AND FORWARDED TO EXAMINER |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: NON FINAL ACTION MAILED |
|
| STPP | Information on status: patent application and granting procedure in general |
Free format text: NON FINAL ACTION MAILED |
|
| STCB | Information on status: application discontinuation |
Free format text: ABANDONED -- FAILURE TO RESPOND TO AN OFFICE ACTION |