SU435613A1 - - Google Patents
Info
- Publication number
- SU435613A1 SU435613A1 SU1732456A SU1732456A SU435613A1 SU 435613 A1 SU435613 A1 SU 435613A1 SU 1732456 A SU1732456 A SU 1732456A SU 1732456 A SU1732456 A SU 1732456A SU 435613 A1 SU435613 A1 SU 435613A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- anhydrous
- ether
- solution
- added
- lithium
- Prior art date
Links
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 26
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 15
- 239000012153 distilled water Substances 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 11
- -1 piperidino, morpholino Chemical group 0.000 description 11
- 239000000284 extract Substances 0.000 description 9
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 8
- 125000000217 alkyl group Chemical group 0.000 description 8
- 229910052744 lithium Inorganic materials 0.000 description 8
- 238000000034 method Methods 0.000 description 8
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 7
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 7
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 6
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- 125000002947 alkylene group Chemical group 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 125000005842 heteroatom Chemical group 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 235000011121 sodium hydroxide Nutrition 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001340 alkali metals Chemical group 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- YDGSUPBDGKOGQT-UHFFFAOYSA-N lithium;dimethylazanide Chemical compound [Li+].C[N-]C YDGSUPBDGKOGQT-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 229940035422 diphenylamine Drugs 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 125000003884 phenylalkyl group Chemical group 0.000 description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- MSUCLKFPHDRRGG-UHFFFAOYSA-N 1-chloro-n,n-dimethylpropan-1-amine Chemical compound CCC(Cl)N(C)C MSUCLKFPHDRRGG-UHFFFAOYSA-N 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- UGXACBBAXFABGT-UHFFFAOYSA-N 3-chloro-n,n,2-trimethylpropan-1-amine Chemical compound ClCC(C)CN(C)C UGXACBBAXFABGT-UHFFFAOYSA-N 0.000 description 1
- KQZDYXLVZXJPQE-UHFFFAOYSA-N 6-amino-6-(2-methylphenyl)cyclohexa-2,4-diene-1-carboxylic acid Chemical compound C1(=C(C=CC=C1)C1(C(C(=O)O)C=CC=C1)N)C KQZDYXLVZXJPQE-UHFFFAOYSA-N 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 244000131522 Citrus pyriformis Species 0.000 description 1
- 206010062717 Increased upper airway secretion Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- UZVGSSNIUNSOFA-UHFFFAOYSA-N dibenzofuran-1-carboxylic acid Chemical compound O1C2=CC=CC=C2C2=C1C=CC=C2C(=O)O UZVGSSNIUNSOFA-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- NKDDWNXOKDWJAK-UHFFFAOYSA-N dimethoxymethane Chemical compound COCOC NKDDWNXOKDWJAK-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 1
- FWLXXNKURDSTBU-UHFFFAOYSA-N lithium piperidin-1-ylazanide Chemical compound N1(CCCCC1)[NH-].[Li+] FWLXXNKURDSTBU-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- BVSCXLNOACOCHU-UHFFFAOYSA-N n,n-dimethyl-n',n'-diphenylethane-1,2-diamine Chemical compound C=1C=CC=CC=1N(CCN(C)C)C1=CC=CC=C1 BVSCXLNOACOCHU-UHFFFAOYSA-N 0.000 description 1
- DYFFAVRFJWYYQO-UHFFFAOYSA-N n-methyl-n-phenylaniline Chemical compound C=1C=CC=CC=1N(C)C1=CC=CC=C1 DYFFAVRFJWYYQO-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 208000026435 phlegm Diseases 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7101647A FR2122305B1 (enExample) | 1971-01-19 | 1971-01-19 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SU435613A1 true SU435613A1 (enExample) | 1974-07-05 |
| SU435613A3 SU435613A3 (enExample) | 1974-07-05 |
Family
ID=9070505
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1732456A SU435613A3 (enExample) | 1971-01-19 | 1972-01-11 |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3821197A (enExample) |
| JP (1) | JPS4837037B2 (enExample) |
| AT (1) | AT313905B (enExample) |
| AU (1) | AU454492B2 (enExample) |
| BE (1) | BE778208A (enExample) |
| CA (1) | CA953722A (enExample) |
| CH (1) | CH546766A (enExample) |
| CS (1) | CS167963B2 (enExample) |
| DD (1) | DD98928A5 (enExample) |
| DE (1) | DE2202486C3 (enExample) |
| ES (1) | ES399022A1 (enExample) |
| FR (1) | FR2122305B1 (enExample) |
| GB (1) | GB1328602A (enExample) |
| HU (1) | HU163154B (enExample) |
| IE (1) | IE36061B1 (enExample) |
| IL (1) | IL38568A (enExample) |
| IT (1) | IT995024B (enExample) |
| NL (1) | NL157301B (enExample) |
| SU (1) | SU435613A3 (enExample) |
| ZA (1) | ZA72304B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2198942B1 (enExample) * | 1972-09-12 | 1975-03-14 | Rhone Poulenc Ind | |
| JPS5274934U (enExample) * | 1975-11-29 | 1977-06-04 | ||
| JPS5435220Y2 (enExample) * | 1975-12-16 | 1979-10-26 | ||
| US20090320724A1 (en) * | 2008-06-27 | 2009-12-31 | Walburn William L | Swivel base with installation aid |
-
1971
- 1971-01-19 FR FR7101647A patent/FR2122305B1/fr not_active Expired
-
1972
- 1972-01-11 SU SU1732456A patent/SU435613A3/ru active
- 1972-01-11 NL NL7200407.A patent/NL157301B/xx not_active IP Right Cessation
- 1972-01-17 AU AU38004/72A patent/AU454492B2/en not_active Expired
- 1972-01-17 CA CA132,616*7A patent/CA953722A/en not_active Expired
- 1972-01-17 IL IL38568A patent/IL38568A/xx unknown
- 1972-01-17 US US00218528A patent/US3821197A/en not_active Expired - Lifetime
- 1972-01-17 JP JP47006848A patent/JPS4837037B2/ja not_active Expired
- 1972-01-17 CS CS285A patent/CS167963B2/cs unknown
- 1972-01-17 IE IE60/72A patent/IE36061B1/xx unknown
- 1972-01-18 HU HURO640A patent/HU163154B/hu unknown
- 1972-01-18 BE BE778208A patent/BE778208A/xx not_active IP Right Cessation
- 1972-01-18 CH CH72672A patent/CH546766A/fr not_active IP Right Cessation
- 1972-01-18 GB GB242572A patent/GB1328602A/en not_active Expired
- 1972-01-18 DD DD160393A patent/DD98928A5/xx unknown
- 1972-01-19 DE DE2202486A patent/DE2202486C3/de not_active Expired
- 1972-01-19 ES ES399022A patent/ES399022A1/es not_active Expired
- 1972-01-19 IT IT19557/72A patent/IT995024B/it active
- 1972-01-19 AT AT42572A patent/AT313905B/de not_active IP Right Cessation
- 1972-08-22 ZA ZA720304*[A patent/ZA72304B/xx unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU552025A3 (ru) | Способ получени производных фенил-имидазолил-алканов | |
| Boekelheide et al. | Reissert Compounds. Further Alkylation Studies and a Novel Rearrangement1 | |
| NO154554B (no) | Fremgangsmaate til fremstilling av armeringsfibre for mineralske byggematerialer. | |
| SU508205A3 (ru) | Способ получени производных изофлавона | |
| US4024158A (en) | Aroylcrownethers | |
| SU435613A1 (enExample) | ||
| US3337554A (en) | Piperazino and homopiperazino-10-11-dihydrobenzo[b, f]-thiepin | |
| SU479290A3 (ru) | Способ получени 2-(фурилметил)-6,7бензоморфанов | |
| IE42978B1 (en) | Triaryl alkyl azabicyclo compounds | |
| FI78084B (fi) | Foerfarande foer framstaellning av nya, terapeutiskt verksamma bensopyranderivat. | |
| US3726870A (en) | 10-carbamoyl-dibenzo(a,d)cyclohepta(1,4,6)trien-5-ones | |
| Baraldi et al. | Ethyl 2, 4-dioxoalkanoates as starting materials for a convenient route to 3 (2H) furanones and 3 (2H) furanimines | |
| CH436295A (de) | Verfahren zur Herstellung neuer 3-Morpholinone | |
| US3287368A (en) | Dihydrobenzothiepin-5(2h)-one oximes | |
| Berliner | The Mechanism of Cyclization Reactions | |
| US3810905A (en) | Pyrazolo(3,4-b)pyridine-5-carboxamides | |
| US2712542A (en) | New series of 2-(3-pyridazonyl)-acids and their derivatives and method of preparing members of the series | |
| US3487085A (en) | Dihydrothieno benzothiepene | |
| JPS598260B2 (ja) | 10−アミノ−9、10−ジヒドロフエナントレン誘導体およびその製造法 | |
| US3609179A (en) | Lower alkyl 9-carboxylates of 9-(tert.-aminobutynyl) fluorenes | |
| SU470960A3 (ru) | Способ получени производных 3-амино-2-пиразолина | |
| Henry et al. | New Compounds. Some Derivatives of Morpholine | |
| US6573384B1 (en) | Process for production of indole derivatives and intermediates therefor | |
| SU414785A3 (ru) | Способ получения этаноантраценов | |
| NO132307B (enExample) |