SU403784A1 - - Google Patents
Info
- Publication number
- SU403784A1 SU403784A1 SU1677624A SU1677624A SU403784A1 SU 403784 A1 SU403784 A1 SU 403784A1 SU 1677624 A SU1677624 A SU 1677624A SU 1677624 A SU1677624 A SU 1677624A SU 403784 A1 SU403784 A1 SU 403784A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- cobalt
- sodium
- nickel
- solution
- film
- Prior art date
Links
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 8
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 5
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 5
- 229910017052 cobalt Inorganic materials 0.000 description 5
- 239000010941 cobalt Substances 0.000 description 5
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 5
- 239000001632 sodium acetate Substances 0.000 description 5
- 235000017281 sodium acetate Nutrition 0.000 description 5
- 235000011121 sodium hydroxide Nutrition 0.000 description 5
- IGOJDKCIHXGPTI-UHFFFAOYSA-N [P].[Co].[Ni] Chemical compound [P].[Co].[Ni] IGOJDKCIHXGPTI-UHFFFAOYSA-N 0.000 description 4
- 238000005137 deposition process Methods 0.000 description 4
- 229910000363 nickel(II) sulfate Inorganic materials 0.000 description 4
- KWSLGOVYXMQPPX-UHFFFAOYSA-N 5-[3-(trifluoromethyl)phenyl]-2h-tetrazole Chemical compound FC(F)(F)C1=CC=CC(C2=NNN=N2)=C1 KWSLGOVYXMQPPX-UHFFFAOYSA-N 0.000 description 3
- 238000005234 chemical deposition Methods 0.000 description 3
- KTVIXTQDYHMGHF-UHFFFAOYSA-L cobalt(2+) sulfate Chemical compound [Co+2].[O-]S([O-])(=O)=O KTVIXTQDYHMGHF-UHFFFAOYSA-L 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- LGQLOGILCSXPEA-UHFFFAOYSA-L nickel sulfate Chemical compound [Ni+2].[O-]S([O-])(=O)=O LGQLOGILCSXPEA-UHFFFAOYSA-L 0.000 description 3
- 229910001379 sodium hypophosphite Inorganic materials 0.000 description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 229910000361 cobalt sulfate Inorganic materials 0.000 description 2
- 229940044175 cobalt sulfate Drugs 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 230000005415 magnetization Effects 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- GTWJEGZBBUNTPJ-UHFFFAOYSA-L C(C)(=O)[O-].[Na+].[Na+].C(CC(O)(C(=O)O)CC(=O)O)(=O)O.C(C)(=O)[O-] Chemical compound C(C)(=O)[O-].[Na+].[Na+].C(CC(O)(C(=O)O)CC(=O)O)(=O)O.C(C)(=O)[O-] GTWJEGZBBUNTPJ-UHFFFAOYSA-L 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- POVGIDNLKNVCTJ-UHFFFAOYSA-J cobalt(2+);nickel(2+);disulfate Chemical compound [Co+2].[Ni+2].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O POVGIDNLKNVCTJ-UHFFFAOYSA-J 0.000 description 1
- 238000000151 deposition Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- NCPXQVVMIXIKTN-UHFFFAOYSA-N trisodium;phosphite Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])[O-] NCPXQVVMIXIKTN-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Chemically Coating (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1677624A SU403784A1 (https=) | 1971-06-18 | 1971-06-18 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1677624A SU403784A1 (https=) | 1971-06-18 | 1971-06-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU403784A1 true SU403784A1 (https=) | 1973-10-26 |
Family
ID=20481713
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1677624A SU403784A1 (https=) | 1971-06-18 | 1971-06-18 |
Country Status (1)
| Country | Link |
|---|---|
| SU (1) | SU403784A1 (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2822912C1 (ru) * | 2024-01-16 | 2024-07-16 | Федеральное государственное бюджетное учреждение науки Институт физической химии и электрохимии им. А.Н. Фрумкина Российской академии наук (ИФХЭ РАН) | Способ химико-каталитического нанесения кобальт-фосфорного покрытия на деталь из стали, меди или латуни |
-
1971
- 1971-06-18 SU SU1677624A patent/SU403784A1/ru active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2822912C1 (ru) * | 2024-01-16 | 2024-07-16 | Федеральное государственное бюджетное учреждение науки Институт физической химии и электрохимии им. А.Н. Фрумкина Российской академии наук (ИФХЭ РАН) | Способ химико-каталитического нанесения кобальт-фосфорного покрытия на деталь из стали, меди или латуни |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4397812A (en) | Electroless nickel polyalloys | |
| DE2049061C3 (de) | Alkalisches wäßriges Bad und dessen Verwendung zur stromlosen Verkupferung | |
| DE1621311B2 (de) | Alkalisches bad zur stromlosen verkupferung | |
| GB1192167A (en) | Improvements relating to Magnetically Stable Powders | |
| US4158074A (en) | Process for preparing colored aluminum powder | |
| DE2849173A1 (de) | Verfahren zur herstellung von nadelfoermigem eisen-iii-oxid und dessen weiterverarbeitung | |
| SU403784A1 (https=) | ||
| GB950342A (en) | Method of preparing thin magnetic films | |
| DE2310450A1 (de) | Komplexbildner fuer mehrwertige metallionen | |
| DE2132003A1 (de) | Loesung zum stromlosen Verkupfern | |
| US3661596A (en) | Stabilized, chemical nickel plating bath | |
| US3992197A (en) | Silver crystals and production thereof | |
| KR840008308A (ko) | 자기기록용 침상 강자성 합금입자 및 그의 제조방법(磁氣記錄用針狀强磁性合金粒子 및 그의 製造方法) | |
| DE1464614B1 (de) | Verfahren zur Herstellung eines Dauermagneten | |
| DE1521350A1 (de) | Verfahren zur chemischen Vernickelung von nichtmetallischen Gegenstaenden | |
| DE712457C (de) | Magnetogrammtraeger | |
| US3469973A (en) | Magnetic alloy for data storage devices | |
| US3991233A (en) | Method of manufacturing a magnetizable layer for a magnetic domain device | |
| DE2236493C3 (de) | Verfahren zum galvanischen Abscheiden glänzender Goldüberzüge mit hohem Goldgehalt | |
| JPS5724022A (en) | Production of magnetic recording substance | |
| JPS6362882A (ja) | 非晶質合金めつき液 | |
| JPS6115985A (ja) | 無電解めつき浴 | |
| CA1075501A (en) | Ni-fe-rd alloys | |
| SU393372A1 (ru) | РАСТВОР ДЛЯ ХИМИЧЕСКОГО ОСАЖДЕНИЯ CnTlABT НА ОСНОВЕ НИКЕЛЯ | |
| SU456045A1 (ru) | Способ электрохимического осаждени покрытий из магнитных сплавов |