SU328588A1 - - Google Patents
Info
- Publication number
- SU328588A1 SU328588A1 SU1338312A SU1338312A SU328588A1 SU 328588 A1 SU328588 A1 SU 328588A1 SU 1338312 A SU1338312 A SU 1338312A SU 1338312 A SU1338312 A SU 1338312A SU 328588 A1 SU328588 A1 SU 328588A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- toxicity
- fact
- hours
- temperature
- reaction
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 10
- 231100000419 toxicity Toxicity 0.000 claims description 10
- 230000001988 toxicity Effects 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 150000001266 acyl halides Chemical class 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- -1 carbethoxymethyl group Chemical group 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- GKIPXFAANLTWBM-UHFFFAOYSA-N epibromohydrin Chemical compound BrCC1CO1 GKIPXFAANLTWBM-UHFFFAOYSA-N 0.000 claims 1
- 150000002170 ethers Chemical class 0.000 claims 1
- 239000003960 organic solvent Substances 0.000 claims 1
- 238000003756 stirring Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- NAGJZTKCGNOGPW-UHFFFAOYSA-N dithiophosphoric acid Chemical class OP(O)(S)=S NAGJZTKCGNOGPW-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 101150046224 ABAT gene Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 239000005949 Malathion Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 230000032798 delamination Effects 0.000 description 1
- JXSJBGJIGXNWCI-UHFFFAOYSA-N diethyl 2-[(dimethoxyphosphorothioyl)thio]succinate Chemical compound CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC JXSJBGJIGXNWCI-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000004119 disulfanediyl group Chemical group *SS* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229960000453 malathion Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- WWJZWCUNLNYYAU-UHFFFAOYSA-N temephos Chemical compound C1=CC(OP(=S)(OC)OC)=CC=C1SC1=CC=C(OP(=S)(OC)OC)C=C1 WWJZWCUNLNYYAU-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU328588A1 true SU328588A1 (https=) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU328588A1 (https=) | ||
| EP2289899B1 (fr) | Nouveaux liquides ioniques à base d'anions dithiophosphate et leurs préparations | |
| Morgan et al. | CCCLX.—Interactions of tellurium tetrachloride and monoketones | |
| US3928586A (en) | O,O-Diethyl-0-1-(2,4-dichlorophenyl)-2,2-dibromovinyl phosphate used to control the Colorado potato beetle | |
| SU1156594A3 (ru) | Способ получени @ -замещенных 3-циклоалкилсульфонилпирролидиндионов-2,5 | |
| Marsden et al. | XIX.—Organic derivatives of silicon. Part IV. The sulphonation of benzylethylpropylsilicyl oxide and of benzylethyldipropylsilicane | |
| FR2562888A1 (fr) | Composes d'ammonium quaternaire bactericides | |
| SU187244A1 (https=) | ||
| SU701627A1 (ru) | Аллиламиды диалкилфосфорных кислот, обладающие свойствами хемостерил нтов вредных насекомых | |
| CA1152514A (en) | 1-diethyleneamido-thiophosphoryl-2- trichloromethyl-.delta..sup.2-imidazoline | |
| SU192203A1 (https=) | ||
| Van Der Neut et al. | Phosphatide acids and derivatives: I. Synthesis of phosphatidic acids derived from glycol, starting from monoacylglycols | |
| US3903210A (en) | Production of toxic organo phosphorus compounds | |
| SU401047A1 (ru) | Способ получения фенацетилгуанидина | |
| Herbst | The Condensation of α-Keto Acids and Amides. II. Pyruvic Acid and Acetamide | |
| EP0008813A1 (en) | Processes for the preparation of 3-azabicyclo(3.1.0)hexane derivatives | |
| SU1074874A1 (ru) | (+) (1-Мета-ментен-8-ил-оксикарбонилметил) морфолин гидрохлорид,про вл ющий инсектицидную в отношении гусениц блонной плодожорки и нематоцидную в отношении личинок галловых нематод активности | |
| SU1395659A1 (ru) | Способ переработки клеточного сока розы | |
| Eastman et al. | Reaction of d-α-Phenethyl Chloride with Silver Nitrite | |
| CA2083653A1 (en) | Preparation of alkenols | |
| Reist et al. | Potential Anticancer Agents. LII. meso-1, 4-Bis (1-aziridinyl)-2, 3-butanediol. | |
| WO2023011857A1 (en) | Novel applications for oxazaborolidines and new methods of manufacture thereof | |
| SU195451A1 (ru) | Способ получения амидов 0-алкил-8-арилдитио- фосфорной кислоты | |
| RU2007394C1 (ru) | 3-фенил-1он-4,5-дигидропиразоло[4,3-а]карбазол, обладающий противоопухолевой и антилейкозной активностью | |
| RU1210407C (ru) | Способ получени 3,4,5,6-тетрагидрофталимидометил-D,L-цис-транс-хризантемата |