SU322399A1 - - Google Patents
Info
- Publication number
- SU322399A1 SU322399A1 SU1459518A SU1459518A SU322399A1 SU 322399 A1 SU322399 A1 SU 322399A1 SU 1459518 A SU1459518 A SU 1459518A SU 1459518 A SU1459518 A SU 1459518A SU 322399 A1 SU322399 A1 SU 322399A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- steel
- manganese
- aluminum
- titanium
- niobium
- Prior art date
Links
- 229910000831 Steel Inorganic materials 0.000 description 10
- 239000010959 steel Substances 0.000 description 10
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- 239000010936 titanium Substances 0.000 description 4
- 229910052719 titanium Inorganic materials 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052758 niobium Inorganic materials 0.000 description 3
- 239000010955 niobium Substances 0.000 description 3
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 3
- 229910052720 vanadium Inorganic materials 0.000 description 3
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 3
- 229910052726 zirconium Inorganic materials 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 229910052748 manganese Inorganic materials 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- 229910052715 tantalum Inorganic materials 0.000 description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 2
- 229910000617 Mangalloy Inorganic materials 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Treatment Of Steel In Its Molten State (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1459518A SU322399A1 (enExample) | 1970-07-03 | 1970-07-03 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU1459518A SU322399A1 (enExample) | 1970-07-03 | 1970-07-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU322399A1 true SU322399A1 (enExample) | 1971-11-30 |
Family
ID=39105516
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1459518A SU322399A1 (enExample) | 1970-07-03 | 1970-07-03 |
Country Status (1)
| Country | Link |
|---|---|
| SU (1) | SU322399A1 (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4162158A (en) * | 1978-12-28 | 1979-07-24 | The United States Of America As Represented By The United States Department Of Energy | Ferritic Fe-Mn alloy for cryogenic applications |
| EP0091897A1 (de) * | 1982-04-13 | 1983-10-19 | Voest-Alpine Stahl Aktiengesellschaft | Kaltverfestigender austenitischer Manganhartstahl und Verfahren zur Herstellung desselben |
| EP0136433A1 (de) * | 1983-08-05 | 1985-04-10 | Kos, Bernd, Dipl.-Ing. | Austenitischer Manganhartstahl und Verfahren zum Herstellen desselben |
| EP0141804A1 (de) * | 1983-10-14 | 1985-05-15 | Vereinigte Edelstahlwerke Aktiengesellschaft (Vew) | Manganhartstahl und Verfahren zu seiner Herstellung |
| EP0143873A1 (de) * | 1983-09-23 | 1985-06-12 | Bernd Dipl.-Ing. Kos | Austenitischer Manganhartstahl und Verfahren zu seiner Herstellung |
| WO1987005946A1 (fr) * | 1986-03-26 | 1987-10-08 | Belorussky Tekhnologichesky Institut Imeni S.M.Kir | Acier resistant a l'usure et procede de fabrication |
-
1970
- 1970-07-03 SU SU1459518A patent/SU322399A1/ru active
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4162158A (en) * | 1978-12-28 | 1979-07-24 | The United States Of America As Represented By The United States Department Of Energy | Ferritic Fe-Mn alloy for cryogenic applications |
| FR2445387A1 (fr) * | 1978-12-28 | 1980-07-25 | Us Energy | Acier allie ferritique pour applications cryogeniques |
| EP0091897A1 (de) * | 1982-04-13 | 1983-10-19 | Voest-Alpine Stahl Aktiengesellschaft | Kaltverfestigender austenitischer Manganhartstahl und Verfahren zur Herstellung desselben |
| US4512804A (en) * | 1982-04-13 | 1985-04-23 | Vereinigte Edelstahlwerke Aktiengesellschaft (Vew) | Work-hardenable austenitic manganese steel and method for the production thereof |
| US4531974A (en) * | 1982-04-13 | 1985-07-30 | Vereinigte Edelstahlwerke Ag (Vew) | Work-hardenable austenitic manganese steel and method for the production thereof |
| EP0136433A1 (de) * | 1983-08-05 | 1985-04-10 | Kos, Bernd, Dipl.-Ing. | Austenitischer Manganhartstahl und Verfahren zum Herstellen desselben |
| EP0143873A1 (de) * | 1983-09-23 | 1985-06-12 | Bernd Dipl.-Ing. Kos | Austenitischer Manganhartstahl und Verfahren zu seiner Herstellung |
| EP0141804A1 (de) * | 1983-10-14 | 1985-05-15 | Vereinigte Edelstahlwerke Aktiengesellschaft (Vew) | Manganhartstahl und Verfahren zu seiner Herstellung |
| WO1987005946A1 (fr) * | 1986-03-26 | 1987-10-08 | Belorussky Tekhnologichesky Institut Imeni S.M.Kir | Acier resistant a l'usure et procede de fabrication |
| GB2194551A (en) * | 1986-03-26 | 1988-03-09 | Bruss Ti Kirova | Wear-resistant steel and method for making it |
| GB2194551B (en) * | 1986-03-26 | 1990-08-22 | Bruss Ti Kirova | Production of wear-resistant steel. |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU322399A1 (enExample) | ||
| SU369169A1 (ru) | Сталь | |
| SU395493A1 (ru) | Сталь | |
| SU416412A1 (enExample) | ||
| SU377399A1 (ru) | Сталь | |
| SU404892A1 (ru) | Сталь | |
| SU406946A1 (ru) | Сталь | |
| SU376477A1 (ru) | Сталь | |
| SU241691A1 (enExample) | ||
| SU399569A1 (ru) | Сталь | |
| SU668970A1 (ru) | Сталь | |
| SU326239A1 (enExample) | ||
| SU395491A1 (ru) | Износостойкий сплав | |
| SU456849A1 (ru) | Рельсова сталь | |
| SU263163A1 (enExample) | ||
| SU399568A1 (ru) | Износостойкая сталь | |
| SU485170A1 (ru) | Чугун | |
| SU412283A1 (enExample) | ||
| SU443936A1 (ru) | Конструкционна сталь | |
| SU395487A1 (ru) | Сталь | |
| SU326241A1 (ru) | Конструкционная сталь | |
| SU282660A1 (ru) | Мартенситностареющая сталь | |
| SU342940A1 (enExample) | ||
| SU425968A1 (ru) | Литейная. сталь | |
| SU387024A1 (ru) | Литейная конструкционная сталь |