SU251499A1 - - Google Patents
Info
- Publication number
- SU251499A1 SU251499A1 SU1225447A SU1225447A SU251499A1 SU 251499 A1 SU251499 A1 SU 251499A1 SU 1225447 A SU1225447 A SU 1225447A SU 1225447 A SU1225447 A SU 1225447A SU 251499 A1 SU251499 A1 SU 251499A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- carbon atoms
- chain length
- fatty acid
- glycol
- fat
- Prior art date
Links
- -1 fatty acid ester Chemical class 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 229910052751 metal Inorganic materials 0.000 claims description 8
- 239000002184 metal Substances 0.000 claims description 8
- 239000000194 fatty acid Substances 0.000 claims description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 6
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 6
- 229930195729 fatty acid Natural products 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 150000002739 metals Chemical class 0.000 claims description 4
- 239000002480 mineral oil Substances 0.000 claims description 4
- 229920001515 polyalkylene glycol Polymers 0.000 claims description 4
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 3
- NTODTBOPMAMSQG-UHFFFAOYSA-N 1-[(3,4-dimethylphenyl)disulfanyl]-2,4-dimethylbenzene Chemical compound CC1=CC(C)=CC=C1SSC1=CC=C(C)C(C)=C1 NTODTBOPMAMSQG-UHFFFAOYSA-N 0.000 claims description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 3
- 239000002202 Polyethylene glycol Substances 0.000 claims description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 239000003995 emulsifying agent Substances 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- 235000010446 mineral oil Nutrition 0.000 claims description 3
- 239000011574 phosphorus Substances 0.000 claims description 3
- 229910052698 phosphorus Inorganic materials 0.000 claims description 3
- 229920001223 polyethylene glycol Polymers 0.000 claims description 3
- 238000006116 polymerization reaction Methods 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 claims description 2
- 235000019197 fats Nutrition 0.000 claims 2
- 150000002894 organic compounds Chemical class 0.000 claims 2
- 235000019871 vegetable fat Nutrition 0.000 claims 2
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 239000005068 cooling lubricant Substances 0.000 claims 1
- 230000003993 interaction Effects 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 9
- 238000000034 method Methods 0.000 description 6
- 239000000839 emulsion Substances 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000002199 base oil Substances 0.000 description 2
- 239000003792 electrolyte Substances 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 230000008646 thermal stress Effects 0.000 description 2
- 244000188595 Brassica sinapistrum Species 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241001397173 Kali <angiosperm> Species 0.000 description 1
- 241000207836 Olea <angiosperm> Species 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000000110 cooling liquid Substances 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000003344 environmental pollutant Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- 239000010687 lubricating oil Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 231100000719 pollutant Toxicity 0.000 description 1
- 229940096992 potassium oleate Drugs 0.000 description 1
- MLICVSDCCDDWMD-KVVVOXFISA-M potassium;(z)-octadec-9-enoate Chemical compound [K+].CCCCCCCC\C=C/CCCCCCCC([O-])=O MLICVSDCCDDWMD-KVVVOXFISA-M 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU251499A1 true SU251499A1 (enExample) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3887693T2 (de) | Gemische von partialestern von fettsäuren mit mehrwertigen alkoholen und sulfurisierten zusammensetzungen und ihre verwendung als schmiermittelzusätze. | |
| DE3876438T2 (de) | Sulfurizierte zusammensetzungen und diese enthaltende zusatzkonzentrate und schmieroele. | |
| US3494949A (en) | Aluminum salts of alkyl orthophosphates | |
| US4885104A (en) | Metalworking lubricants derived from natural fats and oils | |
| US4416788A (en) | Metal cutting oil and method for using same | |
| US2406564A (en) | Compounded lubricating oil | |
| CN108048187A (zh) | 一种攻牙油及其制备方法 | |
| CN105733765A (zh) | 环保免清洗的防锈冲压油 | |
| PT93783B (pt) | Processo para a preparacao de um fluido lubrificante para a laminagem a frio do aco | |
| US3156728A (en) | Thiobis (2, 6-dialkylaniline) compounds | |
| US2382700A (en) | Compounded lubricating oil | |
| SU251499A1 (enExample) | ||
| US2394596A (en) | Nonfoaming compositions and methods of making same | |
| US2727005A (en) | Marine engine oil containing a petroleum oxidate | |
| JPH11501681A (ja) | 潤滑油用の抗酸化剤相乗的組合わせ | |
| US2894910A (en) | Water-in-oil emulsion lubricants | |
| US2952636A (en) | Associates of inorganic metal compounds with copolymers containing a plurality of hydroxy groups | |
| US3753908A (en) | Oxidation inhibited lubricating oil compositions with extreme pressure properties | |
| US2927892A (en) | Oil dispersions of calcium acetate hydrates | |
| US2388132A (en) | Turbine oil | |
| US4218331A (en) | Extreme pressure lubricating compositions | |
| US3565926A (en) | Amine salts of perhalogenated monobasic carboxylic acids | |
| US2422276A (en) | Compounded lubricating oil | |
| US2976243A (en) | Stable calcium acetate-mineral oil dispersion | |
| US2419360A (en) | Lubricating oil composition |