SU194083A1 - - Google Patents
Info
- Publication number
- SU194083A1 SU194083A1 SU1054850A SU1054850A SU194083A1 SU 194083 A1 SU194083 A1 SU 194083A1 SU 1054850 A SU1054850 A SU 1054850A SU 1054850 A SU1054850 A SU 1054850A SU 194083 A1 SU194083 A1 SU 194083A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- pinene
- hydroperoxides
- oxidized
- decomposition
- oxygen
- Prior art date
Links
- GRWFGVWFFZKLTI-IUCAKERBSA-N (-)-α-pinene Chemical compound CC1=CC[C@@H]2C(C)(C)[C@H]1C2 GRWFGVWFFZKLTI-IUCAKERBSA-N 0.000 description 5
- WONIGEXYPVIKFS-UHFFFAOYSA-N Verbenol Chemical compound CC1=CC(O)C2C(C)(C)C1C2 WONIGEXYPVIKFS-UHFFFAOYSA-N 0.000 description 4
- 150000002432 hydroperoxides Chemical class 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000000654 additive Substances 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- IRZWAJHUWGZMMT-UHFFFAOYSA-N Chrysanthenol Natural products CC1=CCC2C(C)(C)C1C2O IRZWAJHUWGZMMT-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- DCSCXTJOXBUFGB-JGVFFNPUSA-N (R)-(+)-Verbenone Natural products CC1=CC(=O)[C@@H]2C(C)(C)[C@H]1C2 DCSCXTJOXBUFGB-JGVFFNPUSA-N 0.000 description 1
- DCSCXTJOXBUFGB-SFYZADRCSA-N (R)-(+)-verbenone Chemical compound CC1=CC(=O)[C@H]2C(C)(C)[C@@H]1C2 DCSCXTJOXBUFGB-SFYZADRCSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- MVNCAPSFBDBCGF-UHFFFAOYSA-N alpha-pinene Natural products CC1=CCC23C1CC2C3(C)C MVNCAPSFBDBCGF-UHFFFAOYSA-N 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- GRWFGVWFFZKLTI-UHFFFAOYSA-N rac-alpha-Pinene Natural products CC1=CCC2C(C)(C)C1C2 GRWFGVWFFZKLTI-UHFFFAOYSA-N 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- DCSCXTJOXBUFGB-UHFFFAOYSA-N verbenone Natural products CC1=CC(=O)C2C(C)(C)C1C2 DCSCXTJOXBUFGB-UHFFFAOYSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU194083A1 true SU194083A1 (enrdf_load_stackoverflow) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5162579A (en) | Preparation of alkoxyalkanoic acids | |
| US5175359A (en) | Preparation of alkoxyalkanoic acids | |
| EP0304763A1 (de) | Verfahren zur Herstellung von Ethercarbonsäuren | |
| DE3135946A1 (de) | Verfahren zur herstellung von alkoxyessigsaeuren | |
| US2773906A (en) | alpha, alpha-dialkyl-ar-phenylbenzyl hydroperoxides | |
| SU194083A1 (enrdf_load_stackoverflow) | ||
| EP0028714A1 (de) | Verfahren zur Herstellung von 3-Phenoxy-benzaldehyden | |
| Payne | Alkaline Epoxidation of α, β-Unsaturated Aldehydes | |
| US2863882A (en) | Producing and recovering terpenic oxidation products | |
| US2083856A (en) | Purification of organic oxy-compounds | |
| US2663740A (en) | Oxidation of aromatic hydrocarbons | |
| Campestrini et al. | Baeyer-Villiger oxidation of ketones by peroxomolybdenum complexes: a revisit | |
| DE2103686A1 (en) | Alpha-hydroxy-gamma-lactones prepn - from alpha -oxocarboxylic acid and olefinic unsatd cpds with acid catalysts | |
| US2881220A (en) | Production of dimethyl phenyl carbinol | |
| DE2164004A1 (de) | Verfahren zur Herstellung von Alkylphenolen | |
| DE1543016A1 (de) | Verfahren zur Herstellung von Alkoholen | |
| SU237160A1 (ru) | Способ получения фенола и циклогёксанона | |
| CN116621750B (zh) | 环己基苯氧化生成液中氧化副产物的去除方法及其应用 | |
| DE60005905T2 (de) | Herstellung von peroxyketalen | |
| SU218866A1 (ru) | Способ получения гя?т-бутилового спирта | |
| US4016207A (en) | Hydrolyzing di- and tricarboxy celluloses with sulfurous acid | |
| US1959478A (en) | Derivative of higher fatty acids and process of making same | |
| DE1907532A1 (de) | Verfahren zur Herstellung von cycloaliphatischen Alkoholen | |
| DE2225451C3 (de) | Verfahren zur Herstellung von Sulfoxyden und Sulfonen | |
| SU146733A1 (enrdf_load_stackoverflow) |