SU192686A1 - - Google Patents
Info
- Publication number
- SU192686A1 SU192686A1 SU923452A SU923452A SU192686A1 SU 192686 A1 SU192686 A1 SU 192686A1 SU 923452 A SU923452 A SU 923452A SU 923452 A SU923452 A SU 923452A SU 192686 A1 SU192686 A1 SU 192686A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- phosphates
- phosphate
- weight
- microns
- orthophosphates
- Prior art date
Links
- 229910019142 PO4 Inorganic materials 0.000 claims description 17
- 235000021317 phosphate Nutrition 0.000 claims description 17
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 10
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 5
- 239000007788 liquid Substances 0.000 claims description 3
- 239000002245 particle Substances 0.000 claims description 2
- 230000008719 thickening Effects 0.000 claims description 2
- 239000010452 phosphate Substances 0.000 description 9
- 239000000203 mixture Substances 0.000 description 7
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 3
- 239000011164 primary particle Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 229910000389 calcium phosphate Inorganic materials 0.000 description 2
- 235000011010 calcium phosphates Nutrition 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- 239000002966 varnish Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- 240000009023 Myrrhis odorata Species 0.000 description 1
- 235000007265 Myrrhis odorata Nutrition 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 235000012550 Pimpinella anisum Nutrition 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- DROMNWUQASBTFM-UHFFFAOYSA-N dinonyl benzene-1,2-dicarboxylate Chemical compound CCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCC DROMNWUQASBTFM-UHFFFAOYSA-N 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- HCHKCACWOHOZIP-OIOBTWANSA-N zinc-62 Chemical compound [62Zn] HCHKCACWOHOZIP-OIOBTWANSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU192686A1 true SU192686A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CN110290710B (zh) | 水分散性制剂 | |
| US2436146A (en) | Composition of matter | |
| US3066056A (en) | Stabilized dicalcium phosphate dihydrate | |
| JP2004515625A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| EP0192153B1 (de) | Zusätze für Wasch- und Reinigungsmittel | |
| US3317276A (en) | Stabilized ammonium nitrate compositions and their production | |
| SU192686A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| JPH0214303B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| CA2111273A1 (en) | Thermally and oxidatively stable solid lubricants | |
| US4750938A (en) | Aqueous phosphate pigment dispersions | |
| US3704158A (en) | Treatment of powdered chalk | |
| CA1115620A (en) | Granulate consisting of hydrated sodium tripolyphosphate and water-insoluble alumino silicate ion exchanger material | |
| CA1264407A (en) | Homogeneous mixtures of polyphosphates | |
| US3361665A (en) | Metal phosphate thickening agent and compositions containing such | |
| JP3995776B2 (ja) | アルカリ抽出腐植酸質資材 | |
| KR20020060680A (ko) | 티오황산암모늄 함유 비료 | |
| US2995437A (en) | Defluorination of phosphate rock | |
| DE900338C (de) | Herstellung von glasige Phosphate in Pulverform enthaltenden Praeparaten | |
| DE2014917A1 (de) | Herstellung von Phosphorpentafluorid und Fluorphosphorsäuren | |
| PL50640B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| CA1268327A (en) | Heat storage compositions | |
| BR112014032176B1 (pt) | Processo contínuo para a fabricação de um fertilizante de fósforo/potássio (p/k) ácido, sólido, livremente fluente e fertilizante | |
| US2874057A (en) | Cementiferous paints | |
| US1871895A (en) | Nitrophosphates | |
| US5578107A (en) | Water soluble caking inhibitors for ammonium phosphates |