SU168698A1 - - Google Patents
Info
- Publication number
- SU168698A1 SU168698A1 SU768566A SU768566A SU168698A1 SU 168698 A1 SU168698 A1 SU 168698A1 SU 768566 A SU768566 A SU 768566A SU 768566 A SU768566 A SU 768566A SU 168698 A1 SU168698 A1 SU 168698A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- phosphorylation
- reaction
- hydrogen chloride
- amino acids
- amino acid
- Prior art date
Links
- 238000000034 method Methods 0.000 description 5
- 150000001413 amino acids Chemical class 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- NTNZTEQNFHNYBC-UHFFFAOYSA-N ethyl 2-aminoacetate Chemical compound CCOC(=O)CN NTNZTEQNFHNYBC-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 238000006366 phosphorylation reaction Methods 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- -1 amino acid esters Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- WLUODQDXJNAOEQ-UHFFFAOYSA-N dibutyl(trihydroxy)-$l^{5}-phosphane Chemical compound CCCCP(O)(O)(O)CCCC WLUODQDXJNAOEQ-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU168698A1 true SU168698A1 (https=) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Kukhar' et al. | Asymmetric synthesis of phosphorus analogs of amino acids | |
| Tokairin et al. | Asymmetric synthesis of the two enantiomers of β-phosphorus-containing α-amino acids via hydrophosphinylation and hydrophosphonylation of chiral Ni (II)-complexes | |
| CA2533173A1 (en) | Method for the production of cyclic phosphonic acid anhydrides | |
| SU168698A1 (https=) | ||
| KR102644410B1 (ko) | N-부틸(3-아미노-3-시아노프로필)메틸포스피네이트 및 (3-아미노-3-시아노프로필)메틸포스핀산 암모늄 염의 혼합물을 제공하기 위한 3-[n-부톡시(메틸)포스포릴]-1-시아노프로필 아세테이트의 반응에 의한 글루포시네이트의 제조 | |
| Grison et al. | Design, synthesis and activity of bisubstrate, transition-state analogues and competitive inhibitors of aspartate transcarbamylase | |
| CA1066715A (en) | Production of organic phosphorus compounds containing carboxylic groups | |
| SU633485A3 (ru) | Способ получени фосфорсодержащих сложных эфиров | |
| SU239950A1 (https=) | ||
| SU427945A1 (ru) | СПОСОБ ПОЛУЧЕНИЯа ПОЛИФТОРАЛКИЛЗАМЕЩЕННЫХБЕНЗИЛДИХЛОРФОСФАТОВ | |
| US3775470A (en) | Process for the preparation of organophosphonyl dichlorides | |
| SU199880A1 (https=) | ||
| SU250138A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ ДИХЛОРАНГИДРИДОВ а-ЗАМЕЩЕННЫХ ВИНИЛФОСФИНОВЫХ КИСЛОТ | |
| SU193829A1 (https=) | ||
| SU197584A1 (ru) | Способ получения дихлорметилиден-0, 0-диалкил-о- диалкилфосфатфосфоранов | |
| SU687079A1 (ru) | Способ получени алкилфосфонистых кислот | |
| SU165720A1 (https=) | ||
| SU311458A1 (https=) | ||
| SU154268A1 (https=) | ||
| SU332738A1 (https=) | ||
| SU179772A1 (https=) | ||
| SU509599A1 (ru) | Способ получени 2-хлорэтилдихлорфосфита | |
| SU292283A1 (ru) | Способ получения эфиров кислот трехвалентногофосфора | |
| SU237143A1 (ru) | Способ получения триалкилтетратиофосфатов | |
| SU302345A1 (ru) | Блиотека i |