SE453395B - Polymerisationskatalysator, forfarande for dess framstellning samt anvendning derav for olefinpolymerisation - Google Patents
Polymerisationskatalysator, forfarande for dess framstellning samt anvendning derav for olefinpolymerisationInfo
- Publication number
- SE453395B SE453395B SE8202169A SE8202169A SE453395B SE 453395 B SE453395 B SE 453395B SE 8202169 A SE8202169 A SE 8202169A SE 8202169 A SE8202169 A SE 8202169A SE 453395 B SE453395 B SE 453395B
- Authority
- SE
- Sweden
- Prior art keywords
- silica
- catalyst
- solvent
- compound
- reaction
- Prior art date
Links
- 238000006116 polymerization reaction Methods 0.000 title claims description 17
- 238000002360 preparation method Methods 0.000 title claims description 8
- 238000000034 method Methods 0.000 title claims description 7
- 239000002685 polymerization catalyst Substances 0.000 title description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 72
- 239000003054 catalyst Substances 0.000 claims description 58
- 239000000377 silicon dioxide Substances 0.000 claims description 34
- 239000002904 solvent Substances 0.000 claims description 30
- 239000012025 fluorinating agent Substances 0.000 claims description 19
- 239000002245 particle Substances 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 17
- 229910052809 inorganic oxide Inorganic materials 0.000 claims description 16
- 239000010936 titanium Substances 0.000 claims description 14
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 13
- 239000007795 chemical reaction product Substances 0.000 claims description 13
- 229910052719 titanium Inorganic materials 0.000 claims description 13
- 150000003623 transition metal compounds Chemical class 0.000 claims description 13
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 12
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 229910052731 fluorine Inorganic materials 0.000 claims description 11
- 239000011737 fluorine Substances 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 150000002222 fluorine compounds Chemical class 0.000 claims description 10
- 229910052723 transition metal Inorganic materials 0.000 claims description 9
- 150000003624 transition metals Chemical class 0.000 claims description 9
- 238000010438 heat treatment Methods 0.000 claims description 8
- 150000001336 alkenes Chemical class 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 125000005234 alkyl aluminium group Chemical group 0.000 claims description 6
- 229920000642 polymer Polymers 0.000 claims description 6
- 239000011541 reaction mixture Substances 0.000 claims description 6
- 239000004215 Carbon black (E152) Substances 0.000 claims description 5
- 229930195733 hydrocarbon Natural products 0.000 claims description 5
- 230000008569 process Effects 0.000 claims description 5
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 150000002430 hydrocarbons Chemical class 0.000 claims description 4
- 229910052720 vanadium Inorganic materials 0.000 claims description 4
- 229910052726 zirconium Inorganic materials 0.000 claims description 4
- 239000006227 byproduct Substances 0.000 claims description 3
- 238000007334 copolymerization reaction Methods 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 239000011261 inert gas Substances 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 18
- -1 magnesium alkoxide Chemical class 0.000 description 17
- 239000000463 material Substances 0.000 description 14
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 12
- 235000019441 ethanol Nutrition 0.000 description 10
- 150000002901 organomagnesium compounds Chemical class 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- 239000011949 solid catalyst Substances 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 230000009257 reactivity Effects 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- 230000000694 effects Effects 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 229910052782 aluminium Inorganic materials 0.000 description 5
- 229910052749 magnesium Inorganic materials 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 5
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 5
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 4
- 239000005977 Ethylene Substances 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical group [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 4
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 150000002681 magnesium compounds Chemical class 0.000 description 4
- 229910052710 silicon Inorganic materials 0.000 description 4
- 239000010703 silicon Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 150000003609 titanium compounds Chemical class 0.000 description 4
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 3
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 3
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 3
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 239000004698 Polyethylene Substances 0.000 description 3
- 150000001298 alcohols Chemical group 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229920000573 polyethylene Polymers 0.000 description 3
- 229910002012 Aerosil® Inorganic materials 0.000 description 2
- 229910015900 BF3 Inorganic materials 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Chemical compound CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 238000003682 fluorination reaction Methods 0.000 description 2
- 230000002140 halogenating effect Effects 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 230000001965 increasing effect Effects 0.000 description 2
- 239000001282 iso-butane Substances 0.000 description 2
- 239000000395 magnesium oxide Substances 0.000 description 2
- KJJBSBKRXUVBMX-UHFFFAOYSA-N magnesium;butane Chemical compound [Mg+2].CCC[CH2-].CCC[CH2-] KJJBSBKRXUVBMX-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 239000011148 porous material Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 description 1
- CEBDXRXVGUQZJK-UHFFFAOYSA-N 2-methyl-1-benzofuran-7-carboxylic acid Chemical compound C1=CC(C(O)=O)=C2OC(C)=CC2=C1 CEBDXRXVGUQZJK-UHFFFAOYSA-N 0.000 description 1
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 1
- 101000856246 Arabidopsis thaliana Cleavage stimulation factor subunit 77 Proteins 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 101100328843 Dictyostelium discoideum cofB gene Proteins 0.000 description 1
- 101100298295 Drosophila melanogaster flfl gene Proteins 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 229910018485 SF4 Inorganic materials 0.000 description 1
- 229910004014 SiF4 Inorganic materials 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- SZUKQRSUJLZCFE-UHFFFAOYSA-N [Ti].O=[Si]=O Chemical compound [Ti].O=[Si]=O SZUKQRSUJLZCFE-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- MBXXQYJBFRRFCK-UHFFFAOYSA-N benzyl fluoride Chemical compound FCC1=CC=CC=C1 MBXXQYJBFRRFCK-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Chemical group 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IYRWEQXVUNLMAY-UHFFFAOYSA-N carbonyl fluoride Chemical compound FC(F)=O IYRWEQXVUNLMAY-UHFFFAOYSA-N 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- 239000004035 construction material Substances 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- NMGYKLMMQCTUGI-UHFFFAOYSA-J diazanium;titanium(4+);hexafluoride Chemical compound [NH4+].[NH4+].[F-].[F-].[F-].[F-].[F-].[F-].[Ti+4] NMGYKLMMQCTUGI-UHFFFAOYSA-J 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- BPFZRKQDXVZTFD-UHFFFAOYSA-N disulfur decafluoride Chemical compound FS(F)(F)(F)(F)S(F)(F)(F)(F)F BPFZRKQDXVZTFD-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000005243 fluidization Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 238000012685 gas phase polymerization Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 238000005304 joining Methods 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 125000002734 organomagnesium group Chemical group 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- LXPCOISGJFXEJE-UHFFFAOYSA-N oxifentorex Chemical compound C=1C=CC=CC=1C[N+](C)([O-])C(C)CC1=CC=CC=C1 LXPCOISGJFXEJE-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- ABTOQLMXBSRXSM-UHFFFAOYSA-N silicon tetrafluoride Chemical compound F[Si](F)(F)F ABTOQLMXBSRXSM-UHFFFAOYSA-N 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- QHMQWEPBXSHHLH-UHFFFAOYSA-N sulfur tetrafluoride Chemical compound FS(F)(F)F QHMQWEPBXSHHLH-UHFFFAOYSA-N 0.000 description 1
- LSJNBGSOIVSBBR-UHFFFAOYSA-N thionyl fluoride Chemical compound FS(F)=O LSJNBGSOIVSBBR-UHFFFAOYSA-N 0.000 description 1
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 1
- 229910003452 thorium oxide Inorganic materials 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 238000006276 transfer reaction Methods 0.000 description 1
- 238000009489 vacuum treatment Methods 0.000 description 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 1
- IGELFKKMDLGCJO-UHFFFAOYSA-N xenon difluoride Chemical compound F[Xe]F IGELFKKMDLGCJO-UHFFFAOYSA-N 0.000 description 1
- DUNKXUFBGCUVQW-UHFFFAOYSA-J zirconium tetrachloride Chemical compound Cl[Zr](Cl)(Cl)Cl DUNKXUFBGCUVQW-UHFFFAOYSA-J 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerization Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/253,732 US4359403A (en) | 1981-04-13 | 1981-04-13 | Polymerization catalyst and method |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE8202169L SE8202169L (sv) | 1982-10-14 |
| SE453395B true SE453395B (sv) | 1988-02-01 |
Family
ID=22961493
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8202169A SE453395B (sv) | 1981-04-13 | 1982-04-05 | Polymerisationskatalysator, forfarande for dess framstellning samt anvendning derav for olefinpolymerisation |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4359403A (cs) |
| JP (1) | JPS606964B2 (cs) |
| BE (1) | BE892823A (cs) |
| CA (1) | CA1172621A (cs) |
| DE (1) | DE3212868A1 (cs) |
| FR (1) | FR2503715B1 (cs) |
| GB (1) | GB2096623B (cs) |
| IT (1) | IT1147905B (cs) |
| SE (1) | SE453395B (cs) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4451574A (en) * | 1981-09-30 | 1984-05-29 | Exxon Research & Engineering Co. | Polymerization catalyst |
| US4455386A (en) * | 1982-03-29 | 1984-06-19 | Chemplex Company | Polymerization catalyst |
| US4510299A (en) * | 1982-03-29 | 1985-04-09 | Chemplex Company | Polymerization method |
| US4490514A (en) * | 1983-08-16 | 1984-12-25 | Chemplex Company | High-temperature ethylene polymerization and copolymerization using dialuminoxane cocatalysts |
| AU6725790A (en) * | 1989-11-01 | 1991-05-31 | Exxon Chemical Patents Inc. | Support adjuvant for improved vanadium polymerization catalyst |
| JP2796868B2 (ja) * | 1990-01-29 | 1998-09-10 | 旭光学工業株式会社 | 内視鏡用光源装置のランプ保持装置 |
| US5064796A (en) * | 1991-01-07 | 1991-11-12 | Exxon Chemical Patents Inc. | Support adjuvant for improved vanadium polymerization catalyst |
| US5198399A (en) * | 1992-01-17 | 1993-03-30 | Quantum Chemical Corporation | Polymerization catalyst and method |
| EP0594914A1 (en) * | 1992-10-26 | 1994-05-04 | Bp Chemicals S.N.C. | Preparation of a catalyst for the manufacture of polyethylene |
| US5885924A (en) | 1995-06-07 | 1999-03-23 | W. R. Grace & Co.-Conn. | Halogenated supports and supported activators |
| US6071614A (en) * | 1997-07-14 | 2000-06-06 | 3M Innovative Properties Company | Microporous fluorinated silica agglomerate and method of preparing and using same |
| US6177375B1 (en) * | 1998-03-09 | 2001-01-23 | Pq Corporation | High activity olefin polymerization catalysts |
| US6096678A (en) * | 1998-04-22 | 2000-08-01 | Ray; Sabyasachi Sinha | Process for the preparation of supported aluminium chloride catalyst containing organo aluminium compound |
| ES2197649T3 (es) | 1998-08-26 | 2004-01-01 | Exxonmobil Chemical Patents Inc. | Composiciones cataliticas soportadas altamente activas. |
| US6613712B1 (en) * | 1999-11-24 | 2003-09-02 | Phillips Petroleum Company | Organometal catalyst compositions with solid oxide supports treated with fluorine and boron |
| US6548442B1 (en) * | 1999-12-03 | 2003-04-15 | Phillips Petroleum Company | Organometal compound catalyst |
| US6576583B1 (en) * | 2000-02-11 | 2003-06-10 | Phillips Petroleum Company | Organometal catalyst composition |
| US7534842B2 (en) * | 2005-11-16 | 2009-05-19 | Chevron Phillips Chemical Company, Lp | Catalysts for olefin polymerization |
| US9845367B2 (en) * | 2015-09-24 | 2017-12-19 | Chevron Phillips Chemical Company Lp | Heterogeneous Ziegler-Natta catalysts with fluorided silica-coated alumina |
| US9758599B2 (en) * | 2015-09-24 | 2017-09-12 | Chevron Phillips Chemical Company Lp | Heterogeneous Ziegler-Natta catalysts with fluorided silica-coated alumina |
| US9540457B1 (en) * | 2015-09-24 | 2017-01-10 | Chevron Phillips Chemical Company Lp | Ziegler-natta—metallocene dual catalyst systems with activator-supports |
| CN116685609B (zh) * | 2020-12-24 | 2025-06-10 | 浙江大学 | 制备负载型烯烃聚合催化剂的方法、所得催化剂及其应用 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3513150A (en) * | 1965-11-23 | 1970-05-19 | Mitsubishi Chem Ind | Method of manufacturing polyethylene |
| FR2082153A5 (fr) * | 1970-03-05 | 1971-12-10 | Solvay | Catalyseurs et procede perfectionnes pour la polymerisation et la copolymerisation des olefines |
| LU61816A1 (cs) * | 1970-10-06 | 1972-06-28 | ||
| LU61838A1 (cs) * | 1970-10-08 | 1972-06-28 | ||
| US3978031A (en) * | 1970-10-08 | 1976-08-31 | Solvay & Cie | Process for the polymerization of olefins and catalytic products |
| GB1367460A (en) * | 1970-12-22 | 1974-09-18 | Int Synthetic Rubber | Polymerisation catalyst |
| US3936431A (en) * | 1971-10-05 | 1976-02-03 | Solvay & Cie | Process for the polymerization of olefins and catalytic products |
| LU65059A1 (cs) * | 1972-03-28 | 1973-10-03 | ||
| US3888789A (en) * | 1972-12-15 | 1975-06-10 | Universal Oil Prod Co | Preparation of polymerization catalyst systems |
| GB1498852A (en) * | 1974-04-30 | 1978-01-25 | Asahi Chemical Ind | Catalyst and method for polymerizing ethylene and propylene |
| GB1484254A (en) | 1974-10-10 | 1977-09-01 | Bp Chem Int Ltd | Production of supported ziegler catalyst components |
| DE2553179A1 (de) * | 1975-11-27 | 1977-06-08 | Hoechst Ag | Verfahren zur herstellung eines katalysators |
| US4263171A (en) * | 1979-08-01 | 1981-04-21 | Chemplex Company | Polymerization catalyst |
-
1981
- 1981-04-13 US US06/253,732 patent/US4359403A/en not_active Expired - Lifetime
-
1982
- 1982-02-03 CA CA000395433A patent/CA1172621A/en not_active Expired
- 1982-02-23 GB GB8205235A patent/GB2096623B/en not_active Expired
- 1982-03-17 IT IT48007/82A patent/IT1147905B/it active
- 1982-04-05 SE SE8202169A patent/SE453395B/sv not_active IP Right Cessation
- 1982-04-06 DE DE19823212868 patent/DE3212868A1/de active Granted
- 1982-04-07 FR FR8206035A patent/FR2503715B1/fr not_active Expired
- 1982-04-08 JP JP57057455A patent/JPS606964B2/ja not_active Expired
- 1982-04-09 BE BE0/207807A patent/BE892823A/fr unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IT1147905B (it) | 1986-11-26 |
| US4359403A (en) | 1982-11-16 |
| JPS606964B2 (ja) | 1985-02-21 |
| CA1172621A (en) | 1984-08-14 |
| GB2096623B (en) | 1984-11-28 |
| JPS57185303A (en) | 1982-11-15 |
| SE8202169L (sv) | 1982-10-14 |
| DE3212868C2 (cs) | 1987-10-22 |
| FR2503715B1 (fr) | 1986-02-28 |
| GB2096623A (en) | 1982-10-20 |
| DE3212868A1 (de) | 1982-10-28 |
| BE892823A (fr) | 1982-08-02 |
| IT8248007A0 (it) | 1982-03-17 |
| FR2503715A1 (fr) | 1982-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE453395B (sv) | Polymerisationskatalysator, forfarande for dess framstellning samt anvendning derav for olefinpolymerisation | |
| CA1263104A (en) | Polymerization catalyst, production and use | |
| US4665140A (en) | Process for polymerizing a monomer charge | |
| US4558025A (en) | Polymerization catalyst, production and use | |
| US4499198A (en) | Polymerization catalysts and methods | |
| SE449107B (sv) | Katalysator innefattande ett magnesium-aluminiumkomplex, forfarande for dess framstellning samt anvendning derav for olefinpolymerisation | |
| US4640907A (en) | Polymerization catalyst, production and use | |
| US4478988A (en) | Polymerization method | |
| CA1207739A (en) | Catalyst composition | |
| US4544646A (en) | Olefin polymerization catalyst and method | |
| US4711865A (en) | Olefin polymerization catalysts, production and use | |
| CA1220778A (en) | Polymerization catalysts and methods | |
| CA1248510A (en) | Polymerization catalyst, production and use | |
| AU610052B2 (en) | Polymerization catalyst, production and use | |
| US4634747A (en) | Polymerization catalyst, production and use | |
| EP0173487B1 (en) | Polymerization catalyst, production and use | |
| CA1263995A (en) | Process for polymerizing a monomer charge | |
| US4665141A (en) | Process for polymerizing a monomer | |
| AU600436B2 (en) | A process for polymerizing a monomer charge | |
| US4866144A (en) | Polymerization catalyst, production and use | |
| US4701506A (en) | Polymerization catalyst, production and use | |
| US4634749A (en) | Polymerization catalyst, production and use | |
| AU600894B2 (en) | A process for polymerizing a monomer charge | |
| CA1187862A (en) | Polymerization catalyst | |
| EP0197689A1 (en) | A process for polymerizing a monomer charge |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 8202169-2 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 8202169-2 Format of ref document f/p: F |