SE445856B - Elektrisk initialsprengkapsel med ett tendholje - Google Patents
Elektrisk initialsprengkapsel med ett tendholjeInfo
- Publication number
- SE445856B SE445856B SE7905059A SE7905059A SE445856B SE 445856 B SE445856 B SE 445856B SE 7905059 A SE7905059 A SE 7905059A SE 7905059 A SE7905059 A SE 7905059A SE 445856 B SE445856 B SE 445856B
- Authority
- SE
- Sweden
- Prior art keywords
- insert body
- charge
- capsule
- initial explosion
- housing
- Prior art date
Links
- 239000002775 capsule Substances 0.000 title description 7
- 238000004880 explosion Methods 0.000 title description 3
- 210000002435 tendon Anatomy 0.000 title 1
- 239000002360 explosive Substances 0.000 claims description 8
- 239000011800 void material Substances 0.000 description 5
- AGUIVNYEYSCPNI-UHFFFAOYSA-N N-methyl-N-picrylnitramine Chemical group [O-][N+](=O)N(C)C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O AGUIVNYEYSCPNI-UHFFFAOYSA-N 0.000 description 2
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 description 2
- 238000005474 detonation Methods 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 238000004804 winding Methods 0.000 description 2
- XHTWJVXQFKLDJS-UHFFFAOYSA-N 1,2-dimethyl-3,4,5-trinitrobenzene Chemical compound CC1=CC([N+]([O-])=O)=C([N+]([O-])=O)C([N+]([O-])=O)=C1C XHTWJVXQFKLDJS-UHFFFAOYSA-N 0.000 description 1
- SPSSULHKWOKEEL-UHFFFAOYSA-N 2,4,6-trinitrotoluene Chemical compound CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O SPSSULHKWOKEEL-UHFFFAOYSA-N 0.000 description 1
- 244000141359 Malus pumila Species 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 235000021016 apples Nutrition 0.000 description 1
- 230000004323 axial length Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000003351 stiffener Substances 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B3/00—Blasting cartridges, i.e. case and explosive
- F42B3/10—Initiators therefor
- F42B3/195—Manufacture
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B39/00—Packaging or storage of ammunition or explosive charges; Safety features thereof; Cartridge belts or bags
- F42B39/30—Containers for detonators or fuzes
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Air Bags (AREA)
- Portable Nailing Machines And Staplers (AREA)
- Toys (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2825742A DE2825742C2 (de) | 1978-06-12 | 1978-06-12 | Elektrischer Sprengmomentzünder |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7905059L SE7905059L (sv) | 1979-12-13 |
| SE445856B true SE445856B (sv) | 1986-07-21 |
Family
ID=6041615
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7905059A SE445856B (sv) | 1978-06-12 | 1979-06-11 | Elektrisk initialsprengkapsel med ett tendholje |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4331078A (cs) |
| BE (1) | BE876922A (cs) |
| CS (1) | CS207793B2 (cs) |
| DE (1) | DE2825742C2 (cs) |
| PL (1) | PL123081B1 (cs) |
| SE (1) | SE445856B (cs) |
| ZA (1) | ZA792883B (cs) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1259855A (en) * | 1986-06-26 | 1989-09-26 | Ghislain M. Dumas | Pyrotechnic delay for high g's application |
| AU670612B2 (en) * | 1992-10-08 | 1996-07-25 | Orica Explosives Technology Pty Ltd | Shock resistant detonator and method of making the same |
| US5780765A (en) * | 1997-02-18 | 1998-07-14 | Dyben; Jerry F. | Pyrogen compound kit for an electrical model rocket ignitor |
| US5889228A (en) * | 1997-04-09 | 1999-03-30 | The Ensign-Bickford Company | Detonator with loosely packed ignition charge and method of assembly |
| US6295930B1 (en) * | 1998-01-08 | 2001-10-02 | Harness System Technologies Research, Ltd. | Circuit breaker |
| RU2156945C1 (ru) * | 1999-11-01 | 2000-09-27 | Новосибирский механический завод "Искра" | Детонатор без первичного взрывчатого вещества |
| RU2215975C2 (ru) * | 2000-04-17 | 2003-11-10 | Федеральное государственное унитарное предприятие "Научно-производственное предприятие "Краснознаменец" | Капсюль-детонатор для взрывных работ |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2024586A (en) * | 1933-04-29 | 1935-12-17 | Du Pont | Initiator |
| BE540685A (cs) * | 1954-08-23 | |||
| US3088006A (en) * | 1960-10-13 | 1963-04-30 | Kabik Irving | Method of internally venting gasless delays |
| FR1301849A (fr) * | 1961-06-13 | 1962-08-24 | Schlumberger Prospection | Détonateur électrique de sécurité |
| BE624024A (cs) * | 1961-10-24 | |||
| US3557656A (en) * | 1964-03-03 | 1971-01-26 | Tech De Rech Industielles Et M | Charging explosive projectiles, especially hollow charge projectiles |
| DE1796082B1 (de) * | 1968-08-28 | 1971-12-09 | Wasagchemie Ag | Zuender fuer die punktfoermige Initiierung von Sprengladungen |
| US3608492A (en) * | 1969-10-02 | 1971-09-28 | Gen Electric | Ammunition high-voltage electrical ignition system |
| CA955110A (en) | 1971-12-01 | 1974-09-24 | Frederik Van Zeggeren | Delay elements for blasting caps |
-
1978
- 1978-06-12 DE DE2825742A patent/DE2825742C2/de not_active Expired
-
1979
- 1979-05-30 PL PL1979215974A patent/PL123081B1/pl unknown
- 1979-06-01 CS CS793791A patent/CS207793B2/cs unknown
- 1979-06-11 SE SE7905059A patent/SE445856B/sv unknown
- 1979-06-11 US US06/047,079 patent/US4331078A/en not_active Expired - Lifetime
- 1979-06-11 ZA ZA792883A patent/ZA792883B/xx unknown
- 1979-06-12 BE BE0/195696A patent/BE876922A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| PL123081B1 (en) | 1982-09-30 |
| SE7905059L (sv) | 1979-12-13 |
| PL215974A1 (cs) | 1980-02-25 |
| ZA792883B (en) | 1980-06-25 |
| US4331078A (en) | 1982-05-25 |
| CS207793B2 (en) | 1981-08-31 |
| BE876922A (fr) | 1979-10-01 |
| DE2825742A1 (de) | 1979-12-13 |
| DE2825742C2 (de) | 1987-03-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4132171A (en) | Apparatus for detonating an explosive charge | |
| US3119302A (en) | Gas sealed explosive propelling arrangement | |
| US4425849A (en) | Primer assembly | |
| US3431851A (en) | Primers for use with delay action blasting caps and process of blasting using the same | |
| US927968A (en) | Fuse with double action. | |
| KR840002759A (ko) | 비전기성 폭팔물 | |
| US3070018A (en) | Nose cone ejection system | |
| SE445856B (sv) | Elektrisk initialsprengkapsel med ett tendholje | |
| US3604353A (en) | Cast booster assembly | |
| US3212438A (en) | Priming device for blasting compositions | |
| US1318926A (en) | settle | |
| US3789760A (en) | Enclosure for explosive material | |
| US2251918A (en) | Antiaircraft projectile | |
| US2707437A (en) | Blasting explosive assembly | |
| US3931763A (en) | Explosive priming device | |
| US1698962A (en) | Detonator package | |
| US3188914A (en) | Explosive release ignition assembly | |
| US1458925A (en) | Detonator | |
| US3105438A (en) | Rocket devices | |
| US3491687A (en) | Explosive cartridge | |
| US1440175A (en) | Rocket | |
| US2062189A (en) | Detonator package | |
| US2960935A (en) | Igniter | |
| US5147974A (en) | Unwinding ribbon safing and arming device | |
| US612495A (en) | High-explosive shell |