SE393372B - 2,6-dinitroanilin-herbicider - Google Patents
2,6-dinitroanilin-herbiciderInfo
- Publication number
- SE393372B SE393372B SE7211004A SE1100472DA SE393372B SE 393372 B SE393372 B SE 393372B SE 7211004 A SE7211004 A SE 7211004A SE 1100472D A SE1100472D A SE 1100472DA SE 393372 B SE393372 B SE 393372B
- Authority
- SE
- Sweden
- Prior art keywords
- dinitroanilin
- herbicides
- dinitroanilin herbicides
- Prior art date
Links
- QFUSCYRJMXLNRB-UHFFFAOYSA-N 2,6-dinitroaniline Chemical compound NC1=C([N+]([O-])=O)C=CC=C1[N+]([O-])=O QFUSCYRJMXLNRB-UHFFFAOYSA-N 0.000 title 1
- 239000004009 herbicide Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/30—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/37—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups having the sulfur atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
- C07C311/38—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups having the sulfur atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring having sulfur atoms of sulfonamide groups and amino groups bound to carbon atoms of six-membered rings of the same carbon skeleton
- C07C311/39—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups having the sulfur atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring having sulfur atoms of sulfonamide groups and amino groups bound to carbon atoms of six-membered rings of the same carbon skeleton having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/60—Preparation of compounds containing amino groups bound to a carbon skeleton by condensation or addition reactions, e.g. Mannich reaction, addition of ammonia or amines to alkenes or to alkynes or addition of compounds containing an active hydrogen atom to Schiff's bases, quinone imines, or aziranes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/07—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms
- C07C205/11—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings
- C07C205/12—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings the six-membered aromatic ring or a condensed ring system containing that ring being substituted by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/58—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/43—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C211/44—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring
- C07C211/52—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring the carbon skeleton being further substituted by halogen atoms or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US17493871A | 1971-08-25 | 1971-08-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE393372B true SE393372B (sv) | 1977-05-09 |
Family
ID=22638140
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7211004A SE393372B (sv) | 1971-08-25 | 1972-08-24 | 2,6-dinitroanilin-herbicider |
Country Status (25)
| Country | Link |
|---|---|
| JP (1) | JPS5842844B2 (esLanguage) |
| KR (1) | KR780000132B1 (esLanguage) |
| AR (1) | AR194492A1 (esLanguage) |
| AU (1) | AU472953B2 (esLanguage) |
| BE (1) | BE787939A (esLanguage) |
| BR (1) | BR7205530D0 (esLanguage) |
| CA (1) | CA988944A (esLanguage) |
| CH (1) | CH573704A5 (esLanguage) |
| CS (1) | CS180602B2 (esLanguage) |
| DD (1) | DD104289A5 (esLanguage) |
| DE (1) | DE2241408C2 (esLanguage) |
| DK (1) | DK132402C (esLanguage) |
| ES (1) | ES406098A1 (esLanguage) |
| FR (1) | FR2151415A5 (esLanguage) |
| GB (1) | GB1389479A (esLanguage) |
| IL (1) | IL39841A (esLanguage) |
| IT (1) | IT962214B (esLanguage) |
| KE (1) | KE2706A (esLanguage) |
| MY (1) | MY7700250A (esLanguage) |
| NL (1) | NL177561C (esLanguage) |
| PH (1) | PH9657A (esLanguage) |
| SE (1) | SE393372B (esLanguage) |
| SU (1) | SU724073A3 (esLanguage) |
| TR (1) | TR17956A (esLanguage) |
| ZA (1) | ZA724608B (esLanguage) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IN145613B (esLanguage) * | 1975-12-22 | 1978-11-18 | American Cyanamid Co | |
| DE2837499A1 (de) * | 1978-08-28 | 1980-03-20 | Bayer Ag | Verfahren zur herstellung von substituierten benzotrifluoriden und neue substituierte benzotrifluoride |
| DE2909158A1 (de) | 1979-03-08 | 1980-09-11 | Basf Ag | Herbizide mischungen |
| EP2052612A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037629A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| CN109320424B (zh) * | 2017-07-31 | 2021-12-21 | 江苏永安化工有限公司 | 一种二甲戊灵的纯化方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2013510C3 (de) * | 1969-04-01 | 1985-11-14 | United States Borax & Chemical Corp., Los Angeles, Calif. | Verwendung von 6-Trifluormethyl-2,4- dinitro-1,3-phenylendiaminen als Herbizide |
-
0
- BE BE787939D patent/BE787939A/xx not_active IP Right Cessation
-
1972
- 1972-07-05 ZA ZA724608A patent/ZA724608B/xx unknown
- 1972-07-05 CA CA146,411A patent/CA988944A/en not_active Expired
- 1972-07-06 IL IL39841A patent/IL39841A/xx unknown
- 1972-07-06 AU AU44324/72A patent/AU472953B2/en not_active Expired
- 1972-07-06 GB GB3178472A patent/GB1389479A/en not_active Expired
- 1972-07-13 AR AR243345A patent/AR194492A1/es active
- 1972-07-14 PH PH13722*UA patent/PH9657A/en unknown
- 1972-07-24 KR KR7201127A patent/KR780000132B1/ko not_active Expired
- 1972-07-27 SU SU721820551A patent/SU724073A3/ru active
- 1972-08-10 NL NLAANVRAGE7210935,A patent/NL177561C/xx not_active IP Right Cessation
- 1972-08-10 TR TR17956A patent/TR17956A/xx unknown
- 1972-08-14 BR BR5530/72A patent/BR7205530D0/pt unknown
- 1972-08-23 DE DE2241408A patent/DE2241408C2/de not_active Expired
- 1972-08-24 DK DK420672A patent/DK132402C/da not_active IP Right Cessation
- 1972-08-24 SE SE7211004A patent/SE393372B/xx unknown
- 1972-08-24 CS CS7200005844A patent/CS180602B2/cs unknown
- 1972-08-24 IT IT52339/72A patent/IT962214B/it active
- 1972-08-25 FR FR7230426A patent/FR2151415A5/fr not_active Expired
- 1972-08-25 CH CH1263172A patent/CH573704A5/xx not_active IP Right Cessation
- 1972-08-25 DD DD165256A patent/DD104289A5/xx unknown
- 1972-08-25 JP JP47085195A patent/JPS5842844B2/ja not_active Expired
- 1972-08-25 ES ES406098A patent/ES406098A1/es not_active Expired
-
1977
- 1977-02-15 KE KE2706A patent/KE2706A/xx unknown
- 1977-12-30 MY MY250/77A patent/MY7700250A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| MY7700250A (en) | 1977-12-31 |
| JPS5842844B2 (ja) | 1983-09-22 |
| IT962214B (it) | 1973-12-20 |
| DE2241408C2 (de) | 1984-01-12 |
| DK132402C (da) | 1976-05-03 |
| BR7205530D0 (pt) | 1973-01-16 |
| GB1389479A (en) | 1975-04-03 |
| NL177561B (nl) | 1985-05-17 |
| DK132402B (da) | 1975-12-01 |
| PH9657A (en) | 1976-01-27 |
| IL39841A (en) | 1975-10-15 |
| IL39841A0 (en) | 1972-09-28 |
| KR780000132B1 (en) | 1978-04-25 |
| JPS4828641A (esLanguage) | 1973-04-16 |
| ZA724608B (en) | 1973-03-28 |
| CS180602B2 (en) | 1978-01-31 |
| KE2706A (en) | 1977-03-04 |
| DD104289A5 (esLanguage) | 1974-03-05 |
| BE787939A (fr) | 1973-02-26 |
| SU724073A3 (ru) | 1980-03-25 |
| ES406098A1 (es) | 1976-03-01 |
| AR194492A1 (es) | 1973-07-23 |
| CH573704A5 (esLanguage) | 1976-03-31 |
| FR2151415A5 (esLanguage) | 1973-04-13 |
| CA988944A (en) | 1976-05-11 |
| AU4432472A (en) | 1974-01-10 |
| DE2241408A1 (de) | 1973-03-01 |
| NL7210935A (esLanguage) | 1973-02-27 |
| AU472953B2 (en) | 1976-06-10 |
| NL177561C (nl) | 1985-10-16 |
| TR17956A (tr) | 1976-07-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI55186B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara osymmetriska 1,4-dihydropyridinkarboxylsyraestrar | |
| BG18585A3 (bg) | Хербицидно средство | |
| BG19086A3 (bg) | Хербицидно средство | |
| AT318297B (de) | Herbizid | |
| AT322271B (de) | Herbizid | |
| BG19151A3 (bg) | Хербицидно средство | |
| BE789811A (fr) | 1,4-bis-acylpiperazines | |
| IT967673B (it) | Erbicidi | |
| SE393372B (sv) | 2,6-dinitroanilin-herbicider | |
| IT958435B (it) | Erbicida | |
| IT967389B (it) | Allofan immidati erbicidi | |
| AT313633B (de) | Herbizid | |
| DK134256B (da) | Herbicid. | |
| IT953537B (it) | Erbicidi | |
| AT315570B (de) | Herbizid | |
| ATA808374A (de) | Herbizid | |
| AT316921B (de) | Herbizid | |
| BG26654A3 (bg) | Хербицидно средство | |
| SE7601317L (sv) | 1,4-bensodiazepin-2-onderivat | |
| DK133845B (da) | Herbicid. | |
| BE785046A (fr) | Herbicides | |
| BG20524A3 (bg) | Хербицидно средство | |
| BE791318A (fr) | Herbicide | |
| BE780846A (fr) | 5-hydroxymethyl-(1,3-dioxa-2-sila-cylco-hexanes) | |
| BE790899A (fr) | Herbicides |