SE385881B - Sett att framstella nya 2-amino - 1,4-dihydropyridiner med en karbonylfunktion - Google Patents
Sett att framstella nya 2-amino - 1,4-dihydropyridiner med en karbonylfunktionInfo
- Publication number
- SE385881B SE385881B SE7311812A SE7311812A SE385881B SE 385881 B SE385881 B SE 385881B SE 7311812 A SE7311812 A SE 7311812A SE 7311812 A SE7311812 A SE 7311812A SE 385881 B SE385881 B SE 385881B
- Authority
- SE
- Sweden
- Prior art keywords
- dihydropyridines
- amino
- way
- produce new
- carbonyl function
- Prior art date
Links
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical compound NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 title 1
- -1 CARBONYL FUNCTION Chemical group 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
- Quinoline Compounds (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2242786A DE2242786A1 (de) | 1972-08-31 | 1972-08-31 | Verfahren zur herstellung von neuen 2-amino-1,4-dihydropyridinen mit einer carbonylfunktion sowie ihre verwendung als arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE385881B true SE385881B (sv) | 1976-07-26 |
Family
ID=5855064
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7311812A SE385881B (sv) | 1972-08-31 | 1973-08-30 | Sett att framstella nya 2-amino - 1,4-dihydropyridiner med en karbonylfunktion |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US3862162A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS4962482A (cg-RX-API-DMAC10.html) |
| AT (1) | AT327901B (cg-RX-API-DMAC10.html) |
| AU (1) | AU470790B2 (cg-RX-API-DMAC10.html) |
| BE (1) | BE804160A (cg-RX-API-DMAC10.html) |
| CA (1) | CA999869A (cg-RX-API-DMAC10.html) |
| CH (1) | CH592062A5 (cg-RX-API-DMAC10.html) |
| DD (1) | DD111904A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2242786A1 (cg-RX-API-DMAC10.html) |
| DK (1) | DK135040C (cg-RX-API-DMAC10.html) |
| ES (1) | ES418339A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2279397A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1389504A (cg-RX-API-DMAC10.html) |
| HU (1) | HU166813B (cg-RX-API-DMAC10.html) |
| IE (1) | IE38182B1 (cg-RX-API-DMAC10.html) |
| IL (1) | IL43079A (cg-RX-API-DMAC10.html) |
| LU (1) | LU68326A1 (cg-RX-API-DMAC10.html) |
| NL (1) | NL7311831A (cg-RX-API-DMAC10.html) |
| PL (1) | PL89414B1 (cg-RX-API-DMAC10.html) |
| SE (1) | SE385881B (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA735974B (cg-RX-API-DMAC10.html) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3959296A (en) * | 1972-06-10 | 1976-05-25 | Bayer Aktiengesellschaft | 1,4-Dihydropyridines |
| NZ201395A (en) * | 1981-07-30 | 1987-02-20 | Bayer Ag | Pharmaceutical compositions containing 1,4-dihydropyridines and certain of these dihydropyridines |
| DE3130041A1 (de) * | 1981-07-30 | 1983-02-17 | Bayer Ag, 5090 Leverkusen | Dihydropyridine mit positiv inotroper wirkung, neue verbindungen, ihre verwendung in arzneimitteln und verfahren zu ihrer herstellung |
| DE3206671A1 (de) * | 1982-02-25 | 1983-09-01 | Bayer Ag, 5090 Leverkusen | Dihydropyridine mit positiv inotroper wirkung, neue verbindungen, ihre verwendung in arzneimitteln und verfahren zu ihrer herstellung |
| US4678796A (en) * | 1984-11-30 | 1987-07-07 | Warner-Lambert Company | 2-alkylidene derivatives of 1,2,3,4-tetrahydropyridine-2,5-pyridine carboxylic acid dialkyl esters useful for treatment of cardiovascular disorders |
| FI862343A7 (fi) | 1985-06-17 | 1986-12-18 | Warner Lambert Co | Foerfarande foer framstaellning av terapeutiskt verkande 1,4-dihydropyridinfoereningar. |
| US4732898A (en) * | 1986-04-29 | 1988-03-22 | Warner-Lambert Company | 2-(2-aryl-2-oxoalkylidene) analogs of-3,5-pyridinedicarboxylic acid dialkyl esters useful for treatment of cardiovascular disorders |
| DE4117750A1 (de) * | 1991-05-30 | 1992-12-24 | Bayer Ag | Neue 2-amino-5-cyano-1,4-dihydropyridine, verfahren zu ihrer herstellung und ihre verwendung in arzneimitteln |
| DE4313693A1 (de) * | 1993-04-27 | 1994-11-03 | Bayer Ag | 2-Amino-4-chinolin-dihydropyridine, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE4313695A1 (de) * | 1993-04-27 | 1994-11-03 | Bayer Ag | 2-Amino-5-cyano-4-chinolyldihydropyridinester, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln |
| DE4313696A1 (de) * | 1993-04-27 | 1994-11-03 | Bayer Ag | 2-Amino-4-heteroaryl-1,4-dihydropyridine, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1923990C3 (de) * | 1969-05-10 | 1978-11-23 | Bayer Ag | Verfahren zur Herstellung von N-substituierten M-Dihydropyridin-S.S-dicarbonsäureestern |
| ZA7152B (en) * | 1970-01-24 | 1971-10-27 | Bayer Ag | New pharmaceutically active 1,4-dihydropyridines |
| DE2117571C3 (de) * | 1971-04-10 | 1979-10-11 | Bayer Ag, 5090 Leverkusen | Unsymmetrische 1,4-Dihydropyridin-33-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
| DE2117572C3 (de) * | 1971-04-10 | 1980-03-20 | Bayer Ag, 5090 Leverkusen | Unsymmetrische 1,4-Dihydropyridin ^-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
-
1972
- 1972-08-31 DE DE2242786A patent/DE2242786A1/de active Pending
-
1973
- 1973-08-21 US US390194A patent/US3862162A/en not_active Expired - Lifetime
- 1973-08-23 CA CA179,511A patent/CA999869A/en not_active Expired
- 1973-08-27 IL IL43079A patent/IL43079A/en unknown
- 1973-08-28 NL NL7311831A patent/NL7311831A/xx not_active Application Discontinuation
- 1973-08-29 BE BE135059A patent/BE804160A/xx unknown
- 1973-08-29 LU LU68326A patent/LU68326A1/xx unknown
- 1973-08-29 DD DD173162A patent/DD111904A5/xx unknown
- 1973-08-29 CH CH1239073A patent/CH592062A5/xx not_active IP Right Cessation
- 1973-08-29 PL PL1973164909A patent/PL89414B1/pl unknown
- 1973-08-29 JP JP48096288A patent/JPS4962482A/ja active Pending
- 1973-08-30 SE SE7311812A patent/SE385881B/xx unknown
- 1973-08-30 IE IE1523/73A patent/IE38182B1/xx unknown
- 1973-08-30 ZA ZA735974A patent/ZA735974B/xx unknown
- 1973-08-30 ES ES418339A patent/ES418339A1/es not_active Expired
- 1973-08-30 AU AU59834/73A patent/AU470790B2/en not_active Expired
- 1973-08-30 HU HUBA2975A patent/HU166813B/hu unknown
- 1973-08-30 GB GB4084773A patent/GB1389504A/en not_active Expired
- 1973-08-30 DK DK476473A patent/DK135040C/da active
- 1973-08-31 AT AT759973A patent/AT327901B/de not_active IP Right Cessation
- 1973-08-31 FR FR7331530A patent/FR2279397A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| ES418339A1 (es) | 1976-03-16 |
| AT327901B (de) | 1976-02-25 |
| AU470790B2 (en) | 1976-03-25 |
| GB1389504A (en) | 1975-04-03 |
| AU5983473A (en) | 1975-03-06 |
| FR2279397B1 (cg-RX-API-DMAC10.html) | 1978-07-28 |
| IL43079A0 (en) | 1973-11-28 |
| CH592062A5 (cg-RX-API-DMAC10.html) | 1977-10-14 |
| DD111904A5 (cg-RX-API-DMAC10.html) | 1975-03-12 |
| DK135040C (da) | 1977-09-05 |
| IE38182B1 (en) | 1978-01-18 |
| DE2242786A1 (de) | 1974-03-14 |
| ZA735974B (en) | 1974-08-28 |
| PL89414B1 (cg-RX-API-DMAC10.html) | 1976-11-30 |
| IL43079A (en) | 1976-06-30 |
| IE38182L (en) | 1974-02-28 |
| US3862162A (en) | 1975-01-21 |
| FR2279397A1 (fr) | 1976-02-20 |
| CA999869A (en) | 1976-11-16 |
| NL7311831A (cg-RX-API-DMAC10.html) | 1974-03-04 |
| HU166813B (cg-RX-API-DMAC10.html) | 1975-06-28 |
| BE804160A (fr) | 1974-02-28 |
| JPS4962482A (cg-RX-API-DMAC10.html) | 1974-06-17 |
| DK135040B (da) | 1977-02-28 |
| ATA759973A (de) | 1975-05-15 |
| LU68326A1 (cg-RX-API-DMAC10.html) | 1973-10-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE7614680L (sv) | Sett att framstella nya bensodiazepinderivat | |
| ES199586Y (es) | Un juguete. | |
| DK139147C (da) | Rumforskalling | |
| NL175588C (nl) | Hartgangmaker. | |
| SE7711848L (sv) | Sett att framstella nya 5-metyl-7-hydroxi-isoflavonderivat | |
| SE411349B (sv) | Sett att framstella nya penicilliner | |
| SE417089B (sv) | Sett att framstella en sulfonamidoarylforening | |
| SE410600B (sv) | Sett att framstella nya arylaminopyrimidinderivat | |
| SE384207B (sv) | Sett att framstella nya 2-amino-1,4-dihydropyridinderivat | |
| IT998388B (it) | Perfezionamenti relativi a stampatrici | |
| SE385881B (sv) | Sett att framstella nya 2-amino - 1,4-dihydropyridiner med en karbonylfunktion | |
| SE386164B (sv) | Sett att framstella nya 2-alkylamino-dihydropyridiner | |
| DK140463C (da) | Rumforskalling | |
| SE384208B (sv) | Sett att framstella nya 2,6-diamino-dihydropyridiner | |
| SE385882B (sv) | Sett att framstella nya 3,4-dihydropyridoner | |
| SE7610170L (sv) | Sett att framstella nya aminoimidazol-isokinolinderivat | |
| SE403285B (sv) | Sett att framstella nya 1,4-dihydrokinoliner | |
| SE393375B (sv) | Sett att framstella nya amino-3,4-dihydropyridiner | |
| SE395007B (sv) | Sett att framstella 9,10-seko-ostranderivat | |
| SE402226B (sv) | Sett att framstella en keramisk skalform | |
| SE395457B (sv) | Sett att framstella nya penicilliner | |
| SE406911B (sv) | Sett att framstella nya kinolinderivat | |
| SE7601079L (sv) | Sett att framstella nya bicykloalkan-derivat | |
| DK139646B (da) | Oscillationsanemometer. | |
| ES198380Y (es) | Juguete a base de elemento de construccion. |