SE385708B - Sett att framstella nya teofyllinisobutyrat - Google Patents
Sett att framstella nya teofyllinisobutyratInfo
- Publication number
- SE385708B SE385708B SE7111994A SE1199471A SE385708B SE 385708 B SE385708 B SE 385708B SE 7111994 A SE7111994 A SE 7111994A SE 1199471 A SE1199471 A SE 1199471A SE 385708 B SE385708 B SE 385708B
- Authority
- SE
- Sweden
- Prior art keywords
- isobutyrate
- way
- produce new
- theophylline
- new theophylline
- Prior art date
Links
- OJKSQFWUAWNQBR-UHFFFAOYSA-N C(C(C)C)(=O)O.N1(C)C(=O)N(C)C=2N=CNC2C1=O Chemical compound C(C(C)C)(=O)O.N1(C)C(=O)N(C)C=2N=CNC2C1=O OJKSQFWUAWNQBR-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
- C07D473/04—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms
- C07D473/06—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3
- C07D473/08—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3 with methyl radicals in positions 1 and 3, e.g. theophylline
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI1033A HU165315B (sv) | 1970-09-25 | 1970-09-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE385708B true SE385708B (sv) | 1976-07-19 |
Family
ID=10994392
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7111994A SE385708B (sv) | 1970-09-25 | 1971-09-22 | Sett att framstella nya teofyllinisobutyrat |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3801578A (sv) |
| JP (1) | JPS5111167B1 (sv) |
| AT (1) | AT315197B (sv) |
| AU (1) | AU457853B2 (sv) |
| BE (1) | BE773084A (sv) |
| CH (1) | CH557832A (sv) |
| CS (1) | CS169921B1 (sv) |
| DD (1) | DD101896A1 (sv) |
| DK (1) | DK129525B (sv) |
| ES (1) | ES395402A1 (sv) |
| FI (1) | FI54483C (sv) |
| FR (1) | FR2107964B1 (sv) |
| GB (1) | GB1341612A (sv) |
| HU (1) | HU165315B (sv) |
| IL (1) | IL37623A (sv) |
| NL (1) | NL175825C (sv) |
| NO (1) | NO132906C (sv) |
| SE (1) | SE385708B (sv) |
| YU (1) | YU237571A (sv) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4092417A (en) * | 1976-12-08 | 1978-05-30 | Johann A. Wulfing | Theophylline salts of 5-methylisoxazole-3-carboxylic acid |
| US4263301A (en) * | 1980-01-24 | 1981-04-21 | Shell Oil Company | β-Phenyl-β-hydroxyethylaminoalkyltheophyllines as inhibitors of biosynthesis of triglycerides |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1089763B (de) * | 1957-10-26 | 1960-09-29 | Wuelfing J A Fa | Verfahren zur Herstellung des 7-[ª‰-Oxy-ª†-(methyl-ª‰-oxyaethylamino)-propyl]-theophyllin-nikotinats |
-
1970
- 1970-09-25 HU HUCI1033A patent/HU165315B/hu unknown
-
1971
- 1971-08-31 IL IL37623A patent/IL37623A/xx unknown
- 1971-09-02 CH CH1288371A patent/CH557832A/xx not_active IP Right Cessation
- 1971-09-02 US US00177424A patent/US3801578A/en not_active Expired - Lifetime
- 1971-09-03 AU AU33093/71A patent/AU457853B2/en not_active Expired
- 1971-09-03 GB GB4127171A patent/GB1341612A/en not_active Expired
- 1971-09-09 AT AT782871A patent/AT315197B/de not_active IP Right Cessation
- 1971-09-10 CS CS6504A patent/CS169921B1/cs unknown
- 1971-09-16 FR FR7133341A patent/FR2107964B1/fr not_active Expired
- 1971-09-17 DK DK456571AA patent/DK129525B/da not_active IP Right Cessation
- 1971-09-20 YU YU02375/71A patent/YU237571A/xx unknown
- 1971-09-22 SE SE7111994A patent/SE385708B/sv unknown
- 1971-09-22 FI FI2647/71A patent/FI54483C/fi active
- 1971-09-22 JP JP46074187A patent/JPS5111167B1/ja active Pending
- 1971-09-22 NL NLAANVRAGE7113000,A patent/NL175825C/xx not_active IP Right Cessation
- 1971-09-23 DD DD157920A patent/DD101896A1/xx unknown
- 1971-09-24 ES ES395402A patent/ES395402A1/es not_active Expired
- 1971-09-24 BE BE773084A patent/BE773084A/xx not_active IP Right Cessation
- 1971-09-24 NO NO3538/71A patent/NO132906C/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2107964A1 (sv) | 1972-05-12 |
| NL175825C (nl) | 1985-01-02 |
| HU165315B (sv) | 1974-08-28 |
| DK129525B (da) | 1974-10-21 |
| DE2144225A1 (de) | 1972-03-30 |
| FI54483B (fi) | 1978-08-31 |
| JPS5111167B1 (sv) | 1976-04-09 |
| AU457853B2 (en) | 1975-02-13 |
| BE773084A (fr) | 1972-01-17 |
| NO132906B (sv) | 1975-10-20 |
| AU3309371A (en) | 1973-03-08 |
| NL7113000A (sv) | 1972-03-28 |
| AT315197B (de) | 1974-05-10 |
| DD101896A1 (sv) | 1973-11-20 |
| SU447889A3 (ru) | 1974-10-25 |
| CH557832A (de) | 1975-01-15 |
| YU237571A (en) | 1982-02-28 |
| FR2107964B1 (sv) | 1975-02-07 |
| CS169921B1 (sv) | 1976-08-27 |
| IL37623A0 (en) | 1971-11-29 |
| US3801578A (en) | 1974-04-02 |
| NO132906C (sv) | 1976-01-28 |
| DE2144225B2 (de) | 1976-07-22 |
| DK129525C (sv) | 1975-03-17 |
| IL37623A (en) | 1974-10-22 |
| GB1341612A (en) | 1973-12-25 |
| FI54483C (fi) | 1978-12-11 |
| ES395402A1 (es) | 1975-11-01 |
| NL175825B (nl) | 1984-08-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI56018B (fi) | Foerfarande foer framstaellning av 5-azapyrimidinnukleosider | |
| BE763072R (fr) | Perfectionnements aux | |
| SE393383B (sv) | Sett att framstella adenosinderivat | |
| SE412586B (sv) | Sett att framstella isoflavonderivat | |
| SE7901914L (sv) | Sett att tillverka samlingsperm | |
| SE411349B (sv) | Sett att framstella nya penicilliner | |
| SE7608643L (sv) | Sett att framstella segmentpolymerisat | |
| SE8205332D0 (sv) | Sett att framstella hoghallfast stalband | |
| SE382215B (sv) | Sett att framstella kromanderivat | |
| SE391181B (sv) | Sett att framstella kinazolinderivat | |
| SE391337B (sv) | Sett att framstella 2-substituerade adenosinderivat | |
| SE384867B (sv) | Sett att framstella 2-substituerade adenosinderivat | |
| SE387337B (sv) | Sett att framstella nya tiokarbamidsyraderivat | |
| SE389116B (sv) | Sett att syntetisera pteridiner | |
| SE417211B (sv) | Sett att framstella indenyl-3-acetoglucuronider | |
| SE386164B (sv) | Sett att framstella nya 2-alkylamino-dihydropyridiner | |
| SE398349B (sv) | Sett att framstella nya pyrimidinyl-6-acethydroxamsyror | |
| SE397679B (sv) | Sett att framstella kinazolinonderivat | |
| SE395896B (sv) | Sett att framstella nya 3-acylureidoacetamidopenicillansyraderivat | |
| SE396608B (sv) | Sett att framstella nya penicilliner | |
| SE385708B (sv) | Sett att framstella nya teofyllinisobutyrat | |
| SE387632B (sv) | Sett att framstella nya 3-amino-delta?722-pyrazolinderivat | |
| SE390308B (sv) | Sett att framstella substituerade kobamider | |
| SE415884B (sv) | Sett att framstella vinkamon | |
| IT944270B (it) | Procedimento per ottenere idroge noclorosilani |