SE383340B - Aromatisk sulfenamid - Google Patents
Aromatisk sulfenamidInfo
- Publication number
- SE383340B SE383340B SE7104330A SE433071A SE383340B SE 383340 B SE383340 B SE 383340B SE 7104330 A SE7104330 A SE 7104330A SE 433071 A SE433071 A SE 433071A SE 383340 B SE383340 B SE 383340B
- Authority
- SE
- Sweden
- Prior art keywords
- sulfenamide
- aromatic
- aromatic sulfenamide
- Prior art date
Links
- QAZLUNIWYYOJPC-UHFFFAOYSA-M sulfenamide Chemical compound [Cl-].COC1=C(C)C=[N+]2C3=NC4=CC=C(OC)C=C4N3SCC2=C1C QAZLUNIWYYOJPC-UHFFFAOYSA-M 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/76—Nitrogen atoms to which a second hetero atom is attached
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C313/00—Sulfinic acids; Sulfenic acids; Halides, esters or anhydrides thereof; Amides of sulfinic or sulfenic acids, i.e. compounds having singly-bound oxygen atoms of sulfinic or sulfenic groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C313/08—Sulfenic acids; Derivatives thereof
- C07C313/18—Sulfenamides
- C07C313/24—Sulfenamides having sulfur atoms of sulfenamide groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/04—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US3236970A | 1970-04-27 | 1970-04-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE383340B true SE383340B (sv) | 1976-03-08 |
Family
ID=21864597
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7104330A SE383340B (sv) | 1970-04-27 | 1971-04-02 | Aromatisk sulfenamid |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3661974A (xx) |
| JP (1) | JPS5030610B1 (xx) |
| BE (1) | BE766266A (xx) |
| CH (1) | CH562210A5 (xx) |
| DE (1) | DE2119711A1 (xx) |
| FR (1) | FR2090796A5 (xx) |
| IT (1) | IT986798B (xx) |
| NL (1) | NL7105595A (xx) |
| SE (1) | SE383340B (xx) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE392103B (sv) * | 1970-04-27 | 1977-03-14 | Sherwin Williams Co | Sett att framstella 1,2-bensisotiazolin-3-oner |
| US3706758A (en) * | 1971-06-18 | 1972-12-19 | Sherwin Williams Co | 2-(1-adamantanyl)-1,2-benzisothiazolin-3-one |
| NZ182325A (en) * | 1975-11-18 | 1979-03-16 | Beecham Group Ltd | 2-substituted-1,2-benzisothiazol-3-ones |
| EP0000254B1 (en) * | 1977-06-20 | 1981-06-10 | Beecham Group Plc | Antithrombotic 2-(gamma-(1-piperidinyl)propyl)1,2-benzisothiazol 3-one, its pharmaceutically acceptable acid addition salts, their preparation and their compositions |
| DE3118127A1 (de) * | 1981-05-07 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | Neue sulfenamide, verfahren zu ihrer herstellung, ihre verwendung in arzneimitteln und deren herstellung |
| FR2583046B1 (fr) * | 1985-06-05 | 1987-07-17 | Cird | Alkyl ou aralkyl thio-2 cycloalkene-1 carboxamides-1 et leurs sulfoxydes, leurs procedes de preparation et leur application a la synthese de tri et tetramethylene-4,5 isothiazoline-4, ones-3 |
| US5734081A (en) * | 1994-08-05 | 1998-03-31 | Warner-Lambert Company | Arylthio compounds |
| US5620997A (en) * | 1995-05-31 | 1997-04-15 | Warner-Lambert Company | Isothiazolones |
| US6001863A (en) * | 1996-11-26 | 1999-12-14 | Warner-Lambert Company | Isothiazolones |
| US7252850B2 (en) * | 2003-05-30 | 2007-08-07 | Delavau Llc | High protein and high fiber food products |
-
1970
- 1970-04-27 US US32369A patent/US3661974A/en not_active Expired - Lifetime
-
1971
- 1971-04-02 SE SE7104330A patent/SE383340B/xx unknown
- 1971-04-14 IT IT23168/71A patent/IT986798B/it active
- 1971-04-22 DE DE19712119711 patent/DE2119711A1/de active Pending
- 1971-04-23 CH CH600271A patent/CH562210A5/xx not_active IP Right Cessation
- 1971-04-26 BE BE766266A patent/BE766266A/xx unknown
- 1971-04-26 JP JP46026792A patent/JPS5030610B1/ja active Pending
- 1971-04-26 NL NL7105595A patent/NL7105595A/xx not_active Application Discontinuation
- 1971-04-27 FR FR7114985A patent/FR2090796A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL7105595A (xx) | 1971-10-29 |
| US3661974A (en) | 1972-05-09 |
| IT986798B (it) | 1975-01-30 |
| FR2090796A5 (xx) | 1972-01-14 |
| DE2119711A1 (de) | 1971-11-11 |
| CH562210A5 (xx) | 1975-05-30 |
| JPS5030610B1 (xx) | 1975-10-02 |
| BE766266A (fr) | 1971-10-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IT941224B (it) | Bascula perfezionata | |
| FI53495C (fi) | Oeverhoerningsdaempande till-lufts- och fraon-luftsdon i ventilationsanlaeggningar | |
| BE761447A (fr) | Termineur | |
| AT309996B (de) | Skibob | |
| BE760036A (fr) | Reklamezuil | |
| ATA818171A (de) | Buestenhalter | |
| BE764537A (fr) | Gamma-piperidino-butyrophenones | |
| BE764860A (fr) | Opfokkooi | |
| BE761406A (fr) | Lichtprojectie-apparaat | |
| BE765952A (fr) | Weefmachine | |
| BE761752A (fr) | Marmerachtige glasmaterialen | |
| SE383340B (sv) | Aromatisk sulfenamid | |
| IT942120B (it) | Perfezionamenti neibigodini | |
| BE760221A (fr) | Resonateur-piezo-electrique | |
| ATA437571A (de) | Stalltur | |
| FI45408C (fi) | Extraktionsanordning foer vaetskevaetske-extraktion i motstroem | |
| BE762183A (fr) | Sproeibusklep | |
| AT324988B (de) | Backkopen | |
| BE765368A (fr) | Dokumentenmap | |
| BE755973A (fr) | Stylographe | |
| IT1008004B (it) | Biocidi | |
| BE766827A (fr) | Expansiestuk | |
| BE766954A (fr) | 3-sulfamido-4-hydroxyphenyl-2-piperidylcarbinols | |
| BE765746A (fr) | 4-isopropylidene-3-oxocephames | |
| BE766546A (fr) | Evaporateur-concentrateur |