SE191321C1 - - Google Patents
Info
- Publication number
- SE191321C1 SE191321C1 SE191321DA SE191321C1 SE 191321 C1 SE191321 C1 SE 191321C1 SE 191321D A SE191321D A SE 191321DA SE 191321 C1 SE191321 C1 SE 191321C1
- Authority
- SE
- Sweden
- Prior art keywords
- acid
- formula
- carbon atoms
- max
- alkyl group
- Prior art date
Links
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 5
- 150000001408 amides Chemical class 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 150000008064 anhydrides Chemical class 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 2
- 150000004982 aromatic amines Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 239000012948 isocyanate Substances 0.000 claims description 2
- 150000002513 isocyanates Chemical class 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 150000003931 anilides Chemical class 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- 230000004048 modification Effects 0.000 claims 1
- 125000001997 phenyl group Chemical class [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- 230000001225 therapeutic effect Effects 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 230000029936 alkylation Effects 0.000 description 6
- 238000005804 alkylation reaction Methods 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical class C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- -1 5-ethylpiperidine-2-carboxylic acid chloride - hydrochloride Chemical compound 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- UFFBMTHBGFGIHF-UHFFFAOYSA-N 2,6-dimethylaniline Chemical group CC1=CC=CC(C)=C1N UFFBMTHBGFGIHF-UHFFFAOYSA-N 0.000 description 2
- MLPVBIWIRCKMJV-UHFFFAOYSA-N 2-ethylaniline Chemical compound CCC1=CC=CC=C1N MLPVBIWIRCKMJV-UHFFFAOYSA-N 0.000 description 2
- JYWQLXDCNQQXGO-UHFFFAOYSA-N 5-methylpiperidine-2-carboxylic acid Chemical compound CC1CCC(C(O)=O)NC1 JYWQLXDCNQQXGO-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000010186 staining Methods 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- AXAOTHQUPORHQV-UHFFFAOYSA-N 1,5-diethylpiperidine-2-carboxylic acid Chemical compound C(C)N1C(CCC(C1)CC)C(=O)O AXAOTHQUPORHQV-UHFFFAOYSA-N 0.000 description 1
- UKGIPDYBALMOLZ-UHFFFAOYSA-N 1,5-dimethylpiperidine-2-carboxylic acid Chemical compound CC1CCC(C(O)=O)N(C)C1 UKGIPDYBALMOLZ-UHFFFAOYSA-N 0.000 description 1
- ULHFFAFDSSHFDA-UHFFFAOYSA-N 1-amino-2-ethoxybenzene Chemical compound CCOC1=CC=CC=C1N ULHFFAFDSSHFDA-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- VNSFRNQGPLODIO-UHFFFAOYSA-N 1-ethyl-5-methylpyrrolidine-2-carboxylic acid Chemical compound CCN1C(C)CCC1C(O)=O VNSFRNQGPLODIO-UHFFFAOYSA-N 0.000 description 1
- CDULGHZNHURECF-UHFFFAOYSA-N 2,3-dimethylaniline 2,4-dimethylaniline 2,5-dimethylaniline 2,6-dimethylaniline 3,4-dimethylaniline 3,5-dimethylaniline Chemical group CC1=CC=C(N)C(C)=C1.CC1=CC=C(C)C(N)=C1.CC1=CC(C)=CC(N)=C1.CC1=CC=C(N)C=C1C.CC1=CC=CC(N)=C1C.CC1=CC=CC(C)=C1N CDULGHZNHURECF-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- YQLRKXVEALTVCZ-UHFFFAOYSA-N 2-isocyanato-1,3-dimethylbenzene Chemical compound CC1=CC=CC(C)=C1N=C=O YQLRKXVEALTVCZ-UHFFFAOYSA-N 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- 206010003497 Asphyxia Diseases 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- QSACPWSIIRFHHR-UHFFFAOYSA-N dimethylphenyl isocyanide Natural products CC1=CC=CC(C)=C1C#N QSACPWSIIRFHHR-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 229960005015 local anesthetics Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000012958 reprocessing Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE191321T |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE191321C1 true SE191321C1 (show.php) | 1964-01-01 |
Family
ID=41977805
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE191321D SE191321C1 (show.php) |
Country Status (1)
| Country | Link |
|---|---|
| SE (1) | SE191321C1 (show.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4302465A (en) | 1979-07-10 | 1981-11-24 | Thuresson Af Ekenstam Bo | Therapeutically active, substituted piperidines and pyrrolidines therapeutic compositions thereof and methods of use thereof |
-
0
- SE SE191321D patent/SE191321C1/sv unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4302465A (en) | 1979-07-10 | 1981-11-24 | Thuresson Af Ekenstam Bo | Therapeutically active, substituted piperidines and pyrrolidines therapeutic compositions thereof and methods of use thereof |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2441498A (en) | Alkyl glycinanilides | |
| US2830991A (en) | Products of the amino-piperidine-2-6-dione series | |
| US2009144A (en) | Substituted amides of amphatic- | |
| US2744910A (en) | 2-(ortho-benzylbenzyl)-imidazoline and acid addition salts | |
| US1895105A (en) | Cubt bath | |
| US2359329A (en) | Quinoline substituted dihydropyridines | |
| US2364833A (en) | N-allylnormorphine and processes for its production | |
| SE191321C1 (show.php) | ||
| US3105074A (en) | New dihydrotriazine derivatives and a process for their manufacture | |
| US2578526A (en) | Pyrrolidine compounds and method for preparing same | |
| US2531010A (en) | 9-[2-(2-hydroxyethylamino) ethylamino] acridine and method for its production | |
| US2203506A (en) | Nitrogen-containing organinc compound | |
| US2090429A (en) | Lysergic acid hydkazide and a | |
| US2654778A (en) | Derivatives of cycloalkylbenzoylaralkanoic acids | |
| US3031455A (en) | 1-phenethyl-4-piperidyl carbamates | |
| US2525927A (en) | 2-nitramino delta 2-1, 3 diazacycloalkenes | |
| US3919310A (en) | Preparation of free sulfoximines by hydrolysis of N-(ortho- and para-nitrobenzoyl)-sulfoximines | |
| US2372690A (en) | Intermediates for the production of vitamin b6 and processes of preparing the same | |
| US2210588A (en) | Process of | |
| US2731469A (en) | N-dialkylaminoalkyl derivatives of diarylisonicotinamides | |
| US2509594A (en) | Production of nicotinanilide | |
| US2476464A (en) | Intermediates for the production of vitamin b6 and processes of preparing the same | |
| US2569814A (en) | beta-haloethylamines | |
| US2566723A (en) | 8-hydroxy-1-methyl-1,2,3,4-tetrahydroquinoline dimethyl urethanes | |
| US2486375A (en) | Alicyclic (secondary) amino alkyl benzoates |