PL94982B1 - - Google Patents
Download PDFInfo
- Publication number
- PL94982B1 PL94982B1 PL16325373A PL16325373A PL94982B1 PL 94982 B1 PL94982 B1 PL 94982B1 PL 16325373 A PL16325373 A PL 16325373A PL 16325373 A PL16325373 A PL 16325373A PL 94982 B1 PL94982 B1 PL 94982B1
- Authority
- PL
- Poland
- Prior art keywords
- nitroindandione
- sodium salt
- methylcellulose
- solution
- suspension
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 45
- 239000000243 solution Substances 0.000 claims description 35
- 239000000725 suspension Substances 0.000 claims description 31
- 238000000034 method Methods 0.000 claims description 29
- 159000000000 sodium salts Chemical class 0.000 claims description 25
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 18
- -1 methylcellulose sodium salt Chemical class 0.000 claims description 17
- 238000006396 nitration reaction Methods 0.000 claims description 16
- 229920000609 methyl cellulose Polymers 0.000 claims description 12
- 239000001923 methylcellulose Substances 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 12
- 238000012360 testing method Methods 0.000 claims description 12
- 239000000460 chlorine Substances 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- 108010058846 Ovalbumin Proteins 0.000 claims description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- 229940092253 ovalbumin Drugs 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 125000004076 pyridyl group Chemical group 0.000 claims description 5
- 229910052708 sodium Inorganic materials 0.000 claims description 5
- 239000011734 sodium Substances 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 230000004044 response Effects 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 230000005764 inhibitory process Effects 0.000 claims description 3
- 239000011630 iodine Substances 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000002837 carbocyclic group Chemical group 0.000 claims description 2
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical compound COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000012266 salt solution Substances 0.000 claims 14
- 238000004166 bioassay Methods 0.000 claims 1
- 150000001721 carbon Chemical group 0.000 claims 1
- 229920002678 cellulose Polymers 0.000 claims 1
- 239000001913 cellulose Substances 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 90
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 72
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 57
- 238000002844 melting Methods 0.000 description 44
- 230000008018 melting Effects 0.000 description 44
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 43
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 42
- 239000000203 mixture Substances 0.000 description 36
- 239000002244 precipitate Substances 0.000 description 31
- 238000002425 crystallisation Methods 0.000 description 28
- 230000008025 crystallization Effects 0.000 description 28
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- 241000700159 Rattus Species 0.000 description 13
- 239000000047 product Substances 0.000 description 13
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- 238000009835 boiling Methods 0.000 description 11
- 239000002480 mineral oil Substances 0.000 description 11
- 235000010446 mineral oil Nutrition 0.000 description 11
- 238000001816 cooling Methods 0.000 description 10
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 9
- 238000002347 injection Methods 0.000 description 9
- 239000007924 injection Substances 0.000 description 9
- 239000012312 sodium hydride Substances 0.000 description 9
- 229910000104 sodium hydride Inorganic materials 0.000 description 9
- 239000003350 kerosene Substances 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 7
- 238000006114 decarboxylation reaction Methods 0.000 description 7
- 238000003512 Claisen condensation reaction Methods 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 210000002966 serum Anatomy 0.000 description 6
- WFFZGYRTVIPBFN-UHFFFAOYSA-N 3h-indene-1,2-dione Chemical compound C1=CC=C2C(=O)C(=O)CC2=C1 WFFZGYRTVIPBFN-UHFFFAOYSA-N 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 238000010790 dilution Methods 0.000 description 4
- 239000012895 dilution Substances 0.000 description 4
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 4
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 2
- SDJHPPZKZZWAKF-UHFFFAOYSA-N 2,3-dimethylbuta-1,3-diene Chemical compound CC(=C)C(C)=C SDJHPPZKZZWAKF-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 230000003266 anti-allergic effect Effects 0.000 description 2
- 208000006673 asthma Diseases 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- QMNXUENRZFQJOB-UHFFFAOYSA-N cyclopenta[a]naphthalene-1,3-dione Chemical compound C1=CC2=CC=CC=C2C2=C1C(=O)CC2=O QMNXUENRZFQJOB-UHFFFAOYSA-N 0.000 description 2
- BHISBMLCPDHRHT-UHFFFAOYSA-N dimethyl 3-ethylbenzene-1,2-dicarboxylate Chemical compound CCC1=CC=CC(C(=O)OC)=C1C(=O)OC BHISBMLCPDHRHT-UHFFFAOYSA-N 0.000 description 2
- KKSNRHOMXHCRGF-UHFFFAOYSA-N dimethyl 3-methoxybenzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC=CC(OC)=C1C(=O)OC KKSNRHOMXHCRGF-UHFFFAOYSA-N 0.000 description 2
- BMODQQWZCVNPKL-UHFFFAOYSA-N dimethyl 4,5-dimethylbenzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC(C)=C(C)C=C1C(=O)OC BMODQQWZCVNPKL-UHFFFAOYSA-N 0.000 description 2
- VHILMKFSCRWWIJ-UHFFFAOYSA-N dimethyl acetylenedicarboxylate Chemical compound COC(=O)C#CC(=O)OC VHILMKFSCRWWIJ-UHFFFAOYSA-N 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- 235000011056 potassium acetate Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- JKUYRAMKJLMYLO-UHFFFAOYSA-N tert-butyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC(C)(C)C JKUYRAMKJLMYLO-UHFFFAOYSA-N 0.000 description 2
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- YBEWLMKRCGNUIO-TWGQIWQCSA-N (5z)-5-[(5-methylfuran-2-yl)methylidene]furan-2-one Chemical compound O1C(C)=CC=C1\C=C/1C=CC(=O)O\1 YBEWLMKRCGNUIO-TWGQIWQCSA-N 0.000 description 1
- 125000005654 1,2-cyclohexylene group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([*:2])C([H])([*:1])C1([H])[H] 0.000 description 1
- MFYSUUPKMDJYPF-UHFFFAOYSA-N 2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-n-phenylbutanamide Chemical compound C=1C=CC=CC=1NC(=O)C(C(=O)C)N=NC1=CC=C(C)C=C1[N+]([O-])=O MFYSUUPKMDJYPF-UHFFFAOYSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- VBXUUFVCIMWMSR-UHFFFAOYSA-N 2-nitrocyclopenta[b]naphthalene-1,3-dione Chemical compound C1=CC=C2C=C(C(C([N+](=O)[O-])C3=O)=O)C3=CC2=C1 VBXUUFVCIMWMSR-UHFFFAOYSA-N 0.000 description 1
- WEPCDISQBQXOBE-UHFFFAOYSA-N 4,7-dimethyl-2-benzofuran-1,3-dione Chemical compound CC1=CC=C(C)C2=C1C(=O)OC2=O WEPCDISQBQXOBE-UHFFFAOYSA-N 0.000 description 1
- JMQGMDHERUWPEX-UHFFFAOYSA-N 4,7-dimethylindene-1,3-dione Chemical compound CC1=CC=C(C)C2=C1C(=O)CC2=O JMQGMDHERUWPEX-UHFFFAOYSA-N 0.000 description 1
- SQBHQKFWZYZVAT-UHFFFAOYSA-N 4-bromoindene-1,3-dione Chemical compound BrC1=CC=CC2=C1C(=O)CC2=O SQBHQKFWZYZVAT-UHFFFAOYSA-N 0.000 description 1
- KWBHLUOJJPXFKB-UHFFFAOYSA-N 4-methoxyindene-1,3-dione Chemical compound COC1=CC=CC2=C1C(=O)CC2=O KWBHLUOJJPXFKB-UHFFFAOYSA-N 0.000 description 1
- BCKVHOUUJMYIAN-UHFFFAOYSA-N 5-bromo-2-benzofuran-1,3-dione Chemical compound BrC1=CC=C2C(=O)OC(=O)C2=C1 BCKVHOUUJMYIAN-UHFFFAOYSA-N 0.000 description 1
- XVMKZAAFVWXIII-UHFFFAOYSA-N 5-fluoro-2-benzofuran-1,3-dione Chemical compound FC1=CC=C2C(=O)OC(=O)C2=C1 XVMKZAAFVWXIII-UHFFFAOYSA-N 0.000 description 1
- OOGJCWRSXJSCJR-UHFFFAOYSA-N 5-methylindene-1,3-dione Chemical compound CC1=CC=C2C(=O)CC(=O)C2=C1 OOGJCWRSXJSCJR-UHFFFAOYSA-N 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- 241000272814 Anser sp. Species 0.000 description 1
- 241001239379 Calophysus macropterus Species 0.000 description 1
- 206010011224 Cough Diseases 0.000 description 1
- 241000790917 Dioxys <bee> Species 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 201000005702 Pertussis Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- 208000030961 allergic reaction Diseases 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 208000003455 anaphylaxis Diseases 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- YAJKDGXVZVCTKQ-UHFFFAOYSA-N cyclopenta[b]naphthalene-1,3-dione Chemical compound C1=CC=C2C=C3C(=O)CC(=O)C3=CC2=C1 YAJKDGXVZVCTKQ-UHFFFAOYSA-N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- CSJDDDONKCSXPX-UHFFFAOYSA-N diethyl 3-methylbenzene-1,2-dicarboxylate Chemical compound CCOC(=O)C1=CC=CC(C)=C1C(=O)OCC CSJDDDONKCSXPX-UHFFFAOYSA-N 0.000 description 1
- VMODTUAZZAIDGU-UHFFFAOYSA-N diethyl 4-methylbenzene-1,2-dicarboxylate Chemical compound CCOC(=O)C1=CC=C(C)C=C1C(=O)OCC VMODTUAZZAIDGU-UHFFFAOYSA-N 0.000 description 1
- DEMPTVYXFMKCIA-UHFFFAOYSA-N diethyl naphthalene-1,2-dicarboxylate Chemical compound C1=CC=CC2=C(C(=O)OCC)C(C(=O)OCC)=CC=C21 DEMPTVYXFMKCIA-UHFFFAOYSA-N 0.000 description 1
- SRVVCVXNCDLHFO-UHFFFAOYSA-N dimethyl 3-butoxybenzene-1,2-dicarboxylate Chemical compound CCCCOC1=CC=CC(C(=O)OC)=C1C(=O)OC SRVVCVXNCDLHFO-UHFFFAOYSA-N 0.000 description 1
- DKAXMMVRWZGLNQ-UHFFFAOYSA-N dimethyl 3-ethoxybenzene-1,2-dicarboxylate Chemical compound CCOC1=CC=CC(C(=O)OC)=C1C(=O)OC DKAXMMVRWZGLNQ-UHFFFAOYSA-N 0.000 description 1
- XQKLZEQZJYFCGV-UHFFFAOYSA-N dimethyl 3-methoxy-5-methylbenzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC(C)=CC(OC)=C1C(=O)OC XQKLZEQZJYFCGV-UHFFFAOYSA-N 0.000 description 1
- LRUDOARPHSTPPU-UHFFFAOYSA-N dimethyl 3-phenylbenzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC=CC(C=2C=CC=CC=2)=C1C(=O)OC LRUDOARPHSTPPU-UHFFFAOYSA-N 0.000 description 1
- FQOJAKYIPJAQPS-UHFFFAOYSA-N dimethyl 3-propoxybenzene-1,2-dicarboxylate Chemical compound CCCOC1=CC=CC(C(=O)OC)=C1C(=O)OC FQOJAKYIPJAQPS-UHFFFAOYSA-N 0.000 description 1
- CVFAUXQYWPECKA-UHFFFAOYSA-N dimethyl 4,5-dimethylcyclohexa-1,4-diene-1,2-dicarboxylate Chemical compound COC(=O)C1=C(C(=O)OC)CC(C)=C(C)C1 CVFAUXQYWPECKA-UHFFFAOYSA-N 0.000 description 1
- PBHDDYJJBJNTLH-UHFFFAOYSA-N dimethyl 4-methoxy-5-methylbenzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC(C)=C(OC)C=C1C(=O)OC PBHDDYJJBJNTLH-UHFFFAOYSA-N 0.000 description 1
- MINFPQZYHRBMNP-UHFFFAOYSA-N dimethyl 4-phenylbenzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1C1=CC=CC=C1 MINFPQZYHRBMNP-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 230000008105 immune reaction Effects 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- YWOITFUKFOYODT-UHFFFAOYSA-N methanol;sodium Chemical compound [Na].OC YWOITFUKFOYODT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 206010039083 rhinitis Diseases 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- AUHHYELHRWCWEZ-UHFFFAOYSA-N tetrachlorophthalic anhydride Chemical compound ClC1=C(Cl)C(Cl)=C2C(=O)OC(=O)C2=C1Cl AUHHYELHRWCWEZ-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL16325373A PL94982B1 (enExample) | 1973-06-09 | 1973-06-09 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL16325373A PL94982B1 (enExample) | 1973-06-09 | 1973-06-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL94982B1 true PL94982B1 (enExample) | 1977-09-30 |
Family
ID=19963020
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL16325373A PL94982B1 (enExample) | 1973-06-09 | 1973-06-09 |
Country Status (1)
| Country | Link |
|---|---|
| PL (1) | PL94982B1 (enExample) |
-
1973
- 1973-06-09 PL PL16325373A patent/PL94982B1/pl unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4006237A (en) | Tetrahydrocarbostyril derivatives for the prophylaxis of asthma, hayfever and rhinitis | |
| US3974289A (en) | Coumarin derivatives for the treatment of allergies | |
| US3952013A (en) | 1-Thiachromone-2-carboxylic acids and derivatives | |
| US3415834A (en) | Derivatives of 2-anilino-nicotinic acid and process for their preparation | |
| US4036964A (en) | Isocarbostyril-3-carboxylic acid derivatives for the prophylaxis of asthma, hayfever and rhinitis | |
| US3962445A (en) | Anti-allergenic carbostyril derivatives | |
| US3933844A (en) | Benzopyranyltetrazoles | |
| US4190659A (en) | Pharmaceutical preparation and use of 4-hydroxy-2-quinolinone-3-carboxylic acid esters | |
| US4145419A (en) | Novel imidazobenzoxazines | |
| US4060533A (en) | Pyranone carboxamides | |
| US4065457A (en) | 4-Hydroxy-3-nitro-carbostyril compounds | |
| US4031099A (en) | 4-Hydroxy-3-nitro-5,6,7,8 tetrahydro-carbostyrils | |
| US4110464A (en) | Indolopyrones having antiallergic activity | |
| GB2089795A (en) | Quinolone derivatives and their use as pharmaceuticals | |
| KR880001719B1 (ko) | 1,4,9,10-테트라하이드로-피라졸로[4,3-e]-피리도[3,2-b][1,4]디아제핀-10-온의 제조 방법 | |
| DE2430588A1 (de) | Benzopyranopyrazolcarbonsaeuren, verfahren zu ihrer herstellung und arzneimittel | |
| PL94982B1 (enExample) | ||
| US3975535A (en) | Anti-allergic-3-carboxy-isocoumarin compositions and methods of use | |
| US4130660A (en) | Method of inhibiting the complement system with trisubstituted naphthalene compounds | |
| JPS6045199B2 (ja) | 新規なイミダゾベンゾオキサジン及びそれらを含む製薬組成物 | |
| US3988476A (en) | Pharmaceutical compositions and methods of treating allergic conditions utilizing 2-nitroindane-1,3-dione derivatives as the active agent | |
| US3978231A (en) | Pharmaceutical compositions and method of treating allergic conditions utilizing 2-nitroindane-1,3-dione derivatives as the active agents | |
| US4298610A (en) | Ester derivatives of quinolopyran-4-one-2-carboxylic acids and antiallergic antasthmatics | |
| US3925557A (en) | Anti-allergic pharmaceutical compositions | |
| US3936563A (en) | Hydroxymethylene-substituted chromone-3-carboxaldehydes, process for their preparation and intermediates produced thereby |