PL87989B1 - - Google Patents
Download PDFInfo
- Publication number
- PL87989B1 PL87989B1 PL17416674A PL17416674A PL87989B1 PL 87989 B1 PL87989 B1 PL 87989B1 PL 17416674 A PL17416674 A PL 17416674A PL 17416674 A PL17416674 A PL 17416674A PL 87989 B1 PL87989 B1 PL 87989B1
- Authority
- PL
- Poland
- Prior art keywords
- ethyl ester
- general formula
- acid
- acid ethyl
- formula
- Prior art date
Links
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 12
- 125000004494 ethyl ester group Chemical group 0.000 claims description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 8
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 claims description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- OBNCKNCVKJNDBV-UHFFFAOYSA-N butanoic acid ethyl ester Natural products CCCC(=O)OCC OBNCKNCVKJNDBV-UHFFFAOYSA-N 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- -1 N-benzylaminobutyric acid ethyl ester hydrochloride Chemical compound 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- 229910052739 hydrogen Inorganic materials 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- HTFPTAKNJLIQHT-UHFFFAOYSA-N 2-(benzylamino)butanoic acid Chemical compound CCC(C(O)=O)NCC1=CC=CC=C1 HTFPTAKNJLIQHT-UHFFFAOYSA-N 0.000 description 4
- KCDJTVBLSBGDOY-UHFFFAOYSA-N 2-(2-phenylethylamino)butanoic acid Chemical compound CCC(C(O)=O)NCCC1=CC=CC=C1 KCDJTVBLSBGDOY-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- RNLJMWQXJBUUMG-SQKCAUCHSA-N (3S)-2-benzyl-1,2,3,4-tetrahydroisoquinolin-2-ium-3-carboxylic acid chloride hydrate Chemical compound O.[Cl-].OC(=O)[C@@H]1Cc2ccccc2C[NH+]1Cc1ccccc1 RNLJMWQXJBUUMG-SQKCAUCHSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ZQICGTYUOSVFMN-UHFFFAOYSA-N Iselin Natural products CC1=C(COc2c3ccoc3cc3oc(=O)ccc23)CC(C)(C)CC1 ZQICGTYUOSVFMN-UHFFFAOYSA-N 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- IZWBJQAUJRUHLC-UHFFFAOYSA-N ethyl 2-(benzylamino)butanoate Chemical compound CCOC(=O)C(CC)NCC1=CC=CC=C1 IZWBJQAUJRUHLC-UHFFFAOYSA-N 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000000506 psychotropic effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000012485 toluene extract Substances 0.000 description 1
Landscapes
- Hydrogenated Pyridines (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL17416674A PL87989B1 (enExample) | 1974-09-18 | 1974-09-18 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL17416674A PL87989B1 (enExample) | 1974-09-18 | 1974-09-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL87989B1 true PL87989B1 (enExample) | 1976-07-31 |
Family
ID=19968946
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL17416674A PL87989B1 (enExample) | 1974-09-18 | 1974-09-18 |
Country Status (1)
| Country | Link |
|---|---|
| PL (1) | PL87989B1 (enExample) |
-
1974
- 1974-09-18 PL PL17416674A patent/PL87989B1/pl unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3674836A (en) | 2,2-dimethyl-{11 -aryloxy-alkanoic acids and salts and esters thereof | |
| US4156687A (en) | Tetrahydrofuran polycarboxylates | |
| US3077496A (en) | Process for the preparation of chrysanthemumic acid | |
| US4144397A (en) | Preparation of 2-aryl-propionic acids by direct coupling utilizing a mixed magnesium halide complex | |
| PL130559B1 (en) | Process for preparing pure isosorbite 5-nitrate | |
| KR20040026627A (ko) | 5-아미노-3-카르복시메틸-4-시아노-2-티오펜카르복실산의산업적 합성 방법, 및 라넬산의 이가염 및 이의 수화물의합성에의 적용 | |
| PL87989B1 (enExample) | ||
| US4189596A (en) | Preparing 2-arylalkanoic acid derivatives | |
| US3043868A (en) | N-xenylalkanoylaminoalkanoic acids and esters thereof | |
| US3345416A (en) | Preparation and rearrangement of beta-ketosulfoxides | |
| US3168529A (en) | 1-(p-lower alkanoylphenyl)-5-arylpyrrole-2-propionic acid compounds | |
| EP0346852B1 (de) | Verfahren zur Herstellung von 4-chlor-3-alkoxy-but-2E-en-säurealkylester | |
| US4284562A (en) | Process for preparing pyrrole-2-acetic acids | |
| US2466232A (en) | Synthesis of biotin intermediates | |
| US2687415A (en) | 4-substituted-2-chloro-5-benzylpyrimidine compounds | |
| HU214086B (en) | Process for producing 3-isoxazolecarboxylic acid and intermediates thereof | |
| US3535367A (en) | Process for synthesis of 4-hydroxycyclohexanecarboxylic acid and derivatives thereof | |
| CA1054630A (en) | Substituted indanylpropionic acids | |
| JPS61263950A (ja) | 2−(4−イソブチルフエニル)−プロピオヒドロキサム酸の製造方法 | |
| Cromartie et al. | 186. Melanin and its precursors. Part IV. Synthesis of β-3: 4-dihydroxy-2-and-5-methylphenylalanine | |
| US2540307A (en) | 3, 4-diethoxymandelic acid and process for preparing same | |
| US3829474A (en) | 5,5-diphenylpent-4-enoic acids and related compounds | |
| US2537892A (en) | Esters of 2-benzamido-3-carboxymethylmercapto-propanoic acid | |
| US4172208A (en) | 5-Bromo-5,5-dicarboxyethylvalaraldehyde diethyl acetal | |
| US2744915A (en) | Process for the preparation of substituted pyrroles |