PL82048B1 - - Google Patents
Download PDFInfo
- Publication number
- PL82048B1 PL82048B1 PL1972157326A PL15732672A PL82048B1 PL 82048 B1 PL82048 B1 PL 82048B1 PL 1972157326 A PL1972157326 A PL 1972157326A PL 15732672 A PL15732672 A PL 15732672A PL 82048 B1 PL82048 B1 PL 82048B1
- Authority
- PL
- Poland
- Prior art keywords
- plants
- formula
- damaged
- destroyed
- compound
- Prior art date
Links
- -1 alkyl radical Chemical class 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 56
- 150000001875 compounds Chemical class 0.000 description 22
- 230000006378 damage Effects 0.000 description 12
- 239000004480 active ingredient Substances 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000013543 active substance Substances 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 230000002363 herbicidal effect Effects 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 244000075850 Avena orientalis Species 0.000 description 5
- 235000016068 Berberis vulgaris Nutrition 0.000 description 5
- 241000335053 Beta vulgaris Species 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 244000046052 Phaseolus vulgaris Species 0.000 description 5
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 5
- 240000008042 Zea mays Species 0.000 description 5
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 5
- 230000000717 retained effect Effects 0.000 description 5
- 235000007319 Avena orientalis Nutrition 0.000 description 4
- 241000234642 Festuca Species 0.000 description 4
- 241000209219 Hordeum Species 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- 240000004713 Pisum sativum Species 0.000 description 4
- 235000010582 Pisum sativum Nutrition 0.000 description 4
- 241000209140 Triticum Species 0.000 description 4
- 235000021307 Triticum Nutrition 0.000 description 4
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 4
- 235000005822 corn Nutrition 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 239000004009 herbicide Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 244000062793 Sorghum vulgare Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 235000012211 aluminium silicate Nutrition 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 235000019713 millet Nutrition 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical class [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 241000219146 Gossypium Species 0.000 description 2
- 229920001732 Lignosulfonate Polymers 0.000 description 2
- 244000042664 Matricaria chamomilla Species 0.000 description 2
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 240000006694 Stellaria media Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 241000219422 Urtica Species 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 125000005265 dialkylamine group Chemical group 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- 235000017060 Arachis glabrata Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000018262 Arachis monticola Nutrition 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- 241000209200 Bromus Species 0.000 description 1
- 241000220244 Capsella <angiosperm> Species 0.000 description 1
- 235000007866 Chamaemelum nobile Nutrition 0.000 description 1
- 241000219312 Chenopodium Species 0.000 description 1
- 240000006162 Chenopodium quinoa Species 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 244000189548 Chrysanthemum x morifolium Species 0.000 description 1
- 241000254173 Coleoptera Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000208175 Daucus Species 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 235000007351 Eleusine Nutrition 0.000 description 1
- 241000209215 Eleusine Species 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 235000009438 Gossypium Nutrition 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000801118 Lepidium Species 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 241000221024 Mercurialis Species 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 241000209094 Oryza Species 0.000 description 1
- 241000219833 Phaseolus Species 0.000 description 1
- 241000746981 Phleum Species 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 241000209051 Saccharum Species 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- 244000274883 Urtica dioica Species 0.000 description 1
- 235000009108 Urtica dioica Nutrition 0.000 description 1
- 241000209149 Zea Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- WLDHEUZGFKACJH-UHFFFAOYSA-K amaranth Chemical compound [Na+].[Na+].[Na+].C12=CC=C(S([O-])(=O)=O)C=C2C=C(S([O-])(=O)=O)C(O)=C1N=NC1=CC=C(S([O-])(=O)=O)C2=CC=CC=C12 WLDHEUZGFKACJH-UHFFFAOYSA-K 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- 235000010633 broth Nutrition 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- SPJIVJKZYGYWQH-UHFFFAOYSA-N n-ethyl-1,3-benzothiazol-2-amine Chemical compound C1=CC=C2SC(NCC)=NC2=C1 SPJIVJKZYGYWQH-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D277/82—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2141468A DE2141468C3 (de) | 1971-08-19 | 1971-08-19 | H2-Benzothiazolyl)-l-äthyl-3methyl-harnstoff, Verfahren zu seiner Herstellung sowie seine Verwendung als Herbizid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL82048B1 true PL82048B1 (enFirst) | 1975-10-31 |
Family
ID=5817112
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1972157326A PL82048B1 (enFirst) | 1971-08-19 | 1972-08-18 |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US3845069A (enFirst) |
| JP (2) | JPS4829769A (enFirst) |
| AT (1) | AT318969B (enFirst) |
| AU (1) | AU458754B2 (enFirst) |
| BE (1) | BE787660A (enFirst) |
| BR (1) | BR7205637D0 (enFirst) |
| CA (1) | CA986119A (enFirst) |
| CH (1) | CH575710A5 (enFirst) |
| CS (1) | CS171265B2 (enFirst) |
| DD (1) | DD102904A5 (enFirst) |
| DE (1) | DE2141468C3 (enFirst) |
| DK (1) | DK140839B (enFirst) |
| EG (1) | EG10614A (enFirst) |
| ES (1) | ES405969A1 (enFirst) |
| FR (1) | FR2150183A5 (enFirst) |
| GB (1) | GB1364383A (enFirst) |
| HU (1) | HU165007B (enFirst) |
| IL (1) | IL40144A (enFirst) |
| IT (1) | IT964040B (enFirst) |
| NL (1) | NL7211273A (enFirst) |
| PL (1) | PL82048B1 (enFirst) |
| RO (1) | RO62790A (enFirst) |
| SU (1) | SU686593A3 (enFirst) |
| TR (1) | TR17398A (enFirst) |
| YU (1) | YU210772A (enFirst) |
| ZA (1) | ZA725701B (enFirst) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5614643B2 (enFirst) * | 1973-07-02 | 1981-04-06 | ||
| JPS5040755A (enFirst) * | 1973-08-13 | 1975-04-14 | ||
| DE2404979A1 (de) * | 1974-02-01 | 1975-08-21 | Bayer Ag | Mittel zur selektiven unkrautbekaempfung in getreide |
| US4033750A (en) * | 1974-09-14 | 1977-07-05 | Nippon Soda Company Limited | Herbicidal composition |
| JPS5747885B2 (enFirst) * | 1974-10-31 | 1982-10-13 | ||
| DE2527394A1 (de) * | 1975-06-19 | 1976-12-30 | Bayer Ag | Mittel zur selektiven unkrautbekaempfung in getreide |
| JPS5735868Y2 (enFirst) * | 1975-11-12 | 1982-08-09 | ||
| US4029491A (en) * | 1976-04-29 | 1977-06-14 | Velsicol Chemical Corporation | 1-Benzothiazolyl-5-hydroxyimidazolidinones |
| DE2640730C2 (de) * | 1976-09-10 | 1983-08-25 | Hoechst Ag, 6230 Frankfurt | Benzoxazolyloxy- und Benzothiazolyloxy-phenoxy-Verbindungen und diese enthaltende herbizide Mittel |
| US4380640A (en) * | 1980-01-21 | 1983-04-19 | Ciba-Geigy Corporation | Novel benzthiazolylurea derivatives, compositions containing them and their use as herbicides |
| JPS57148937U (enFirst) * | 1981-03-11 | 1982-09-18 | ||
| JPS5767566A (en) * | 1981-05-29 | 1982-04-24 | Nippon Soda Co Ltd | Production of benzothiazole derivative |
| JPS63149131U (enFirst) * | 1987-03-18 | 1988-09-30 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2756135A (en) * | 1955-07-13 | 1956-07-24 | Du Pont | 1-methyl-3-(2-benzothiazolyl)-ureas and their use as herbicides |
| CH505543A (de) * | 1968-11-01 | 1971-04-15 | Ciba Geigy Ag | Schädlingsbekämpfungsmittel |
-
0
- BE BE787660D patent/BE787660A/xx unknown
-
1971
- 1971-08-19 DE DE2141468A patent/DE2141468C3/de not_active Expired
-
1972
- 1972-08-07 CS CS5494A patent/CS171265B2/cs unknown
- 1972-08-09 EG EG329/72A patent/EG10614A/xx active
- 1972-08-09 SU SU721820700A patent/SU686593A3/ru active
- 1972-08-09 US US00279115A patent/US3845069A/en not_active Expired - Lifetime
- 1972-08-16 IL IL7240144A patent/IL40144A/xx unknown
- 1972-08-17 NL NL7211273A patent/NL7211273A/xx not_active Application Discontinuation
- 1972-08-17 BR BR5637/72A patent/BR7205637D0/pt unknown
- 1972-08-17 IT IT28254/72A patent/IT964040B/it active
- 1972-08-17 HU HUBA2789A patent/HU165007B/hu unknown
- 1972-08-17 CH CH1222472A patent/CH575710A5/xx not_active IP Right Cessation
- 1972-08-17 AU AU45694/72A patent/AU458754B2/en not_active Expired
- 1972-08-17 YU YU02107/72A patent/YU210772A/xx unknown
- 1972-08-17 DD DD165110A patent/DD102904A5/xx unknown
- 1972-08-18 DK DK409772AA patent/DK140839B/da unknown
- 1972-08-18 PL PL1972157326A patent/PL82048B1/pl unknown
- 1972-08-18 TR TR17398A patent/TR17398A/xx unknown
- 1972-08-18 CA CA149,692A patent/CA986119A/en not_active Expired
- 1972-08-18 FR FR7229606A patent/FR2150183A5/fr not_active Expired
- 1972-08-18 ES ES405969A patent/ES405969A1/es not_active Expired
- 1972-08-18 GB GB3865672A patent/GB1364383A/en not_active Expired
- 1972-08-18 ZA ZA725701A patent/ZA725701B/xx unknown
- 1972-08-19 JP JP47082486A patent/JPS4829769A/ja active Pending
- 1972-08-19 RO RO197271996A patent/RO62790A/ro unknown
- 1972-08-19 JP JP8248772A patent/JPS5622845B2/ja not_active Expired
- 1972-08-21 AT AT719072A patent/AT318969B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| YU210772A (en) | 1979-10-31 |
| DK140839B (da) | 1979-11-26 |
| ZA725701B (en) | 1973-04-25 |
| AU458754B2 (en) | 1975-03-06 |
| CS171265B2 (enFirst) | 1976-10-29 |
| ES405969A1 (es) | 1975-08-01 |
| US3845069A (en) | 1974-10-29 |
| JPS4829769A (enFirst) | 1973-04-19 |
| BR7205637D0 (pt) | 1973-07-05 |
| DK140839C (enFirst) | 1980-05-12 |
| AT318969B (de) | 1974-11-25 |
| RO62790A (fr) | 1978-01-15 |
| DE2141468B2 (de) | 1979-11-29 |
| EG10614A (en) | 1976-06-30 |
| JPS4828638A (enFirst) | 1973-04-16 |
| AU4569472A (en) | 1974-02-21 |
| IL40144A0 (en) | 1972-10-29 |
| DE2141468A1 (de) | 1973-08-16 |
| JPS5622845B2 (enFirst) | 1981-05-27 |
| GB1364383A (en) | 1974-08-21 |
| DE2141468C3 (de) | 1980-08-14 |
| NL7211273A (enFirst) | 1973-02-21 |
| IT964040B (it) | 1974-01-21 |
| SU686593A3 (ru) | 1979-09-15 |
| TR17398A (tr) | 1975-03-24 |
| DD102904A5 (enFirst) | 1974-01-05 |
| FR2150183A5 (enFirst) | 1973-03-30 |
| BE787660A (fr) | 1973-02-19 |
| IL40144A (en) | 1975-04-25 |
| HU165007B (enFirst) | 1974-06-28 |
| CA986119A (en) | 1976-03-23 |
| CH575710A5 (enFirst) | 1976-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL82048B1 (enFirst) | ||
| PL76442B1 (enFirst) | ||
| PL113006B1 (en) | Selective herbicide | |
| US3773780A (en) | 1-(1,3,4-thiadiazol-2-yl)-imidazolidinone-(2)compounds | |
| US3758492A (en) | 1-(1,3,4-thiadiazol-2-yl)-imidazolidinone-(2) compounds | |
| US3629275A (en) | Carboxylic acid (1 2 4-thiadiazol-5-yl)-amides | |
| US3657264A (en) | Heterocyclically substituted thiadiazoles | |
| US3823006A (en) | Method for selective weed control in beets | |
| PL126774B1 (en) | Herbicide | |
| CS203033B2 (en) | Herbicide and process for preparing efective compound thereof | |
| IL30586A (en) | N-substituted 5-amino-1,3,4-thiadiazoles | |
| US3873299A (en) | 1,2,4-thiodiazolyl-urea herbicidal agents | |
| US3962306A (en) | Sulfonyloxyphenylurea compounds and herbicidal compositions | |
| PL80423B1 (enFirst) | ||
| US4626273A (en) | Herbicidal novel 2-alkoxyaminosulfonyl-benzene-sulfonylureas | |
| US4128412A (en) | Herbicidal composition and method using N-(2-ethylsulfonyl-1,3,4-thiadiazol-5-yl)-N-methyl-N'-methyl urea | |
| PL77191B1 (enFirst) | ||
| US4619688A (en) | Herbicidal sulfonylguanidine derivatives | |
| PL76179B1 (enFirst) | ||
| US3981714A (en) | Cyclic N-thiadiazolyl-(2)-carboxylic acid compounds and herbicidal compositions | |
| US4639526A (en) | N-substituted 5-amino-1,3,4-thiadiazoles | |
| US3984468A (en) | Herbicidal N-trifluoromethylmercaptophenyl ureas | |
| PL93788B1 (enFirst) | ||
| US3943180A (en) | 2,4-Bis-(trifluoromethyl)-6-nitrophenol compounds and herbicidal compositions | |
| PL129394B1 (en) | Herbicide and method of obtaining new derivatives of 2-pyridiloxyacetanilides |