PL77081B2 - - Google Patents
Info
- Publication number
- PL77081B2 PL77081B2 PL15219371A PL15219371A PL77081B2 PL 77081 B2 PL77081 B2 PL 77081B2 PL 15219371 A PL15219371 A PL 15219371A PL 15219371 A PL15219371 A PL 15219371A PL 77081 B2 PL77081 B2 PL 77081B2
- Authority
- PL
- Poland
- Prior art keywords
- parts
- carboxylic acid
- hot
- perylene tetra
- acid dihydrazide
- Prior art date
Links
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 claims description 30
- 239000000049 pigment Substances 0.000 claims description 28
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 claims description 26
- GJHNYXSSNYISFA-UHFFFAOYSA-N 1,2-bis(hydrazinecarbonyl)perylene-3,4-dicarboxylic acid Chemical compound C1(=C(C(=C2C(=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)C(=O)O)C(=O)O)C(=O)NN)C(=O)NN GJHNYXSSNYISFA-UHFFFAOYSA-N 0.000 claims description 15
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 14
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 14
- 238000009835 boiling Methods 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 5
- 239000003960 organic solvent Substances 0.000 claims description 4
- -1 pyrazolonyl Chemical group 0.000 claims description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 4
- 239000011230 binding agent Substances 0.000 claims description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000001632 sodium acetate Substances 0.000 claims description 2
- 235000017281 sodium acetate Nutrition 0.000 claims description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 125000002080 perylenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)* 0.000 claims 1
- CSHWQDPOILHKBI-UHFFFAOYSA-N peryrene Natural products C1=CC(C2=CC=CC=3C2=C2C=CC=3)=C3C2=CC=CC3=C1 CSHWQDPOILHKBI-UHFFFAOYSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- 239000000725 suspension Substances 0.000 description 18
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 9
- ALKYHXVLJMQRLQ-UHFFFAOYSA-N 3-Hydroxy-2-naphthoate Chemical compound C1=CC=C2C=C(O)C(C(=O)O)=CC2=C1 ALKYHXVLJMQRLQ-UHFFFAOYSA-N 0.000 description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 3
- CZZZABOKJQXEBO-UHFFFAOYSA-N 2,4-dimethylaniline Chemical compound CC1=CC=C(N)C(C)=C1 CZZZABOKJQXEBO-UHFFFAOYSA-N 0.000 description 2
- AVYGCQXNNJPXSS-UHFFFAOYSA-N 2,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC=C1Cl AVYGCQXNNJPXSS-UHFFFAOYSA-N 0.000 description 2
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229960004050 aminobenzoic acid Drugs 0.000 description 2
- 239000001058 brown pigment Substances 0.000 description 2
- WSRHMJYUEZHUCM-UHFFFAOYSA-N perylene-1,2,3,4-tetracarboxylic acid Chemical compound C=12C3=CC=CC2=CC=CC=1C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C2=C1C3=CC=C2C(=O)O WSRHMJYUEZHUCM-UHFFFAOYSA-N 0.000 description 2
- FVDOBFPYBSDRKH-UHFFFAOYSA-N perylene-3,4,9,10-tetracarboxylic acid Chemical compound C=12C3=CC=C(C(O)=O)C2=C(C(O)=O)C=CC=1C1=CC=C(C(O)=O)C2=C1C3=CC=C2C(=O)O FVDOBFPYBSDRKH-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- KQCMTOWTPBNWDB-UHFFFAOYSA-N 2,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C=C1Cl KQCMTOWTPBNWDB-UHFFFAOYSA-N 0.000 description 1
- FBLAHUMENIHUGG-UHFFFAOYSA-N 3-hydroxy-n-(2-methylphenyl)naphthalene-2-carboxamide Chemical compound CC1=CC=CC=C1NC(=O)C1=CC2=CC=CC=C2C=C1O FBLAHUMENIHUGG-UHFFFAOYSA-N 0.000 description 1
- CBXPDPVHDWNDPZ-UHFFFAOYSA-N 4-(3-methyl-5-oxopyrazol-4-yl)benzoic acid Chemical compound O=C1N=NC(C)=C1C1=CC=C(C(O)=O)C=C1 CBXPDPVHDWNDPZ-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- VEFXTGTZJOWDOF-UHFFFAOYSA-N benzene;hydrate Chemical compound O.C1=CC=CC=C1 VEFXTGTZJOWDOF-UHFFFAOYSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- CNXZLZNEIYFZGU-UHFFFAOYSA-N n-(4-amino-2,5-diethoxyphenyl)benzamide Chemical compound C1=C(N)C(OCC)=CC(NC(=O)C=2C=CC=CC=2)=C1OCC CNXZLZNEIYFZGU-UHFFFAOYSA-N 0.000 description 1
- IIZGWPQZWKLJOI-UHFFFAOYSA-N perylene-3-carboxylic acid Chemical compound C=12C3=CC=CC2=CC=CC=1C1=CC=CC2=C1C3=CC=C2C(=O)O IIZGWPQZWKLJOI-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000001054 red pigment Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
Landscapes
- Developing Agents For Electrophotography (AREA)
- Optical Filters (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL15219371A PL77081B2 (cg-RX-API-DMAC7.html) | 1971-12-16 | 1971-12-16 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL15219371A PL77081B2 (cg-RX-API-DMAC7.html) | 1971-12-16 | 1971-12-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL77081B2 true PL77081B2 (cg-RX-API-DMAC7.html) | 1975-02-28 |
Family
ID=19956626
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL15219371A PL77081B2 (cg-RX-API-DMAC7.html) | 1971-12-16 | 1971-12-16 |
Country Status (1)
| Country | Link |
|---|---|
| PL (1) | PL77081B2 (cg-RX-API-DMAC7.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0896964A3 (de) * | 1997-07-24 | 1999-03-24 | Ciba SC Holding AG | Perylenhydrazidimide als Carbonylderivatisierungsreagenzien |
-
1971
- 1971-12-16 PL PL15219371A patent/PL77081B2/pl unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0896964A3 (de) * | 1997-07-24 | 1999-03-24 | Ciba SC Holding AG | Perylenhydrazidimide als Carbonylderivatisierungsreagenzien |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2973358A (en) | 4, 5, 6, 7-tetrachloro-3-imino-isoindoline-1-one derivatives | |
| US4866113A (en) | Compounds useful as pigments containing one or more 2,2,6,6-tetraalkylpiperidine groups | |
| US4326066A (en) | Triazolyl coumarin compounds, processes for their preparation and their use as whiteners and laser dyestuffs | |
| US3622583A (en) | Yellow dyes of the phtalimidoquinophthalone series | |
| US2872449A (en) | Production of azo dyestuff cations | |
| PL77081B2 (cg-RX-API-DMAC7.html) | ||
| US4373102A (en) | Isoindoline dyes, their preparation and use | |
| Maki et al. | Vat Dyes of Acenaphthene Series. VI. Derivatives of Acenaphthene Violet | |
| US1935945A (en) | Vat dyestuffs and process of preparing them | |
| US3661898A (en) | Metalliferous dyes | |
| US3829439A (en) | Process for preparing compounds of the benzothioxanthene series | |
| US4064349A (en) | Novel 2-hydroxynaphthalene-1-aldehydes, process for preparing them and their use | |
| US4042611A (en) | Water-in-soluble disazo methine compounds | |
| US3766199A (en) | Manufacture of 3-benzimidazolyl-coumarins as fluorescent compounds | |
| US4285863A (en) | Pigment compounds and method of preparations | |
| CA1037480A (en) | Aromatic aldehydes and process for preparing them | |
| US4077961A (en) | Yellow to blue dyestuffs of the benzo-benzimidazo(1,2-a)-quinoline series, process for their manufacture, and their use | |
| US3492295A (en) | New methinic dyestuffs derived from pyrylium and their method of preparation | |
| US4081446A (en) | Process for the preparation of 4-amino-1,8-naphthalic acid-N-arylimides | |
| Kurda | Synthesis, characterization, and dye performance investigations of azo-coumarin bearing chalcone moieties | |
| US4096157A (en) | Azamethine metal complex compounds | |
| JPH07258565A (ja) | イソインドリンアゾ顔料 | |
| US4166181A (en) | N,n'-diphenyldiimides of 6,12, dialkyl-3,4,9,10-anthanthrene-tetracarboxylic acid | |
| US4252566A (en) | Cumarinic pigments | |
| KHOSRAVI et al. | Investigation of synthesis and dyeing properties of some azonaphthalimide disperse dyestuffs for the dyeing of polyester fibres |