PL69898B1 - - Google Patents
Download PDFInfo
- Publication number
- PL69898B1 PL69898B1 PL1968135898A PL13589868A PL69898B1 PL 69898 B1 PL69898 B1 PL 69898B1 PL 1968135898 A PL1968135898 A PL 1968135898A PL 13589868 A PL13589868 A PL 13589868A PL 69898 B1 PL69898 B1 PL 69898B1
- Authority
- PL
- Poland
- Prior art keywords
- maleic
- dichloroaniline
- dichlorophenyl
- heated
- preparation
- Prior art date
Links
- -1 3,5-dichlorophenyl Chemical group 0.000 claims description 6
- UQRLKWGPEVNVHT-UHFFFAOYSA-N 3,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC(Cl)=C1 UQRLKWGPEVNVHT-UHFFFAOYSA-N 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 claims description 2
- 238000009833 condensation Methods 0.000 claims 1
- 230000005494 condensation Effects 0.000 claims 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims 1
- 238000010438 heat treatment Methods 0.000 claims 1
- RINCXYDBBGOEEQ-UHFFFAOYSA-N succinic anhydride Chemical compound O=C1CCC(=O)O1 RINCXYDBBGOEEQ-UHFFFAOYSA-N 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229940014800 succinic anhydride Drugs 0.000 description 2
- PEEHTFAAVSWFBL-UHFFFAOYSA-N Maleimide Chemical class O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 1
- CFZLNRGUBAVQNO-UHFFFAOYSA-N N-(3,5-Dichlorophenyl)succinimide Chemical compound ClC1=CC(Cl)=CC(N2C(CCC2=O)=O)=C1 CFZLNRGUBAVQNO-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/36—Oxygen or sulfur atoms
- C07D207/40—2,5-Pyrrolidine-diones
- C07D207/404—2,5-Pyrrolidine-diones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. succinimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
- C07D207/448—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide
- C07D207/452—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide with hydrocarbon radicals, substituted by hetero atoms, directly attached to the ring nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyrrole Compounds (AREA)
- Indole Compounds (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7723367 | 1967-12-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL69898B1 true PL69898B1 (enExample) | 1973-10-31 |
Family
ID=13628130
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1968135898A PL69898B1 (enExample) | 1967-12-01 | 1968-12-02 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3586697A (enExample) |
| BR (1) | BR6804482D0 (enExample) |
| CH (1) | CH500187A (enExample) |
| CS (1) | CS152462B2 (enExample) |
| DE (1) | DE1812206A1 (enExample) |
| DK (1) | DK120289B (enExample) |
| ES (1) | ES360892A1 (enExample) |
| FR (1) | FR1604658A (enExample) |
| GB (1) | GB1227620A (enExample) |
| IL (1) | IL31172A (enExample) |
| NL (1) | NL6817250A (enExample) |
| PL (1) | PL69898B1 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2015493A1 (enExample) * | 1968-08-12 | 1970-04-30 | Sumitomo Chemical Co | |
| JPS6017764B2 (ja) * | 1976-07-10 | 1985-05-07 | イハラケミカル工業株式会社 | 水中生物忌避剤 |
| JPS5398959A (en) * | 1977-02-07 | 1978-08-29 | Sumitomo Chem Co Ltd | Cycloalkanespiro-3- 1-(3,5-dihalogenophenyl) pyrrolidine-2,5-dione process for their preparation and nonmedical fungicides containing the same as active constituents |
| US4128529A (en) * | 1977-04-08 | 1978-12-05 | Abbott Laboratories | Industrial biocide |
| DE2852924A1 (de) * | 1978-12-07 | 1980-06-26 | Bayer Ag | Substituierte spiro-derivate von 3- (3,5-dihalogenphenyl)-oxazolidin-2,4-dionen (thion-onen), verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| JPS5671006A (en) * | 1979-11-14 | 1981-06-13 | Ihara Chem Ind Co Ltd | Industrial mildewcide |
| DE3030926A1 (de) * | 1980-08-16 | 1982-04-01 | Consortium für elektrochemische Industrie GmbH, 8000 München | Substituierte bernsteinsaeureimide |
| IL76200A0 (en) * | 1984-08-30 | 1985-12-31 | Consortium Elektrochem Ind | Substituted 1-phenyl-3-methyl-pyrrolidinediones,their preparation and their use as fungicides |
| US5759462A (en) * | 1994-10-14 | 1998-06-02 | Amoco Corporaiton | Electrically conductive tapes and process |
| CN119707773A (zh) * | 2024-12-23 | 2025-03-28 | 中国农业大学 | 一种含马来酰亚胺结构的化合物的制备方法和应用 |
-
1968
- 1968-11-26 US US779278A patent/US3586697A/en not_active Expired - Lifetime
- 1968-11-27 IL IL31172A patent/IL31172A/en unknown
- 1968-11-27 DK DK577768AA patent/DK120289B/da unknown
- 1968-11-28 GB GB1227620D patent/GB1227620A/en not_active Expired
- 1968-11-29 ES ES0360892A patent/ES360892A1/es not_active Expired
- 1968-11-29 BR BR204482/68A patent/BR6804482D0/pt unknown
- 1968-11-29 FR FR1604658D patent/FR1604658A/fr not_active Expired
- 1968-12-02 CH CH1793568A patent/CH500187A/de not_active IP Right Cessation
- 1968-12-02 DE DE19681812206 patent/DE1812206A1/de not_active Withdrawn
- 1968-12-02 CS CS8218A patent/CS152462B2/cs unknown
- 1968-12-02 NL NL6817250A patent/NL6817250A/xx unknown
- 1968-12-02 PL PL1968135898A patent/PL69898B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR1604658A (enExample) | 1972-01-03 |
| BR6804482D0 (pt) | 1973-01-16 |
| IL31172A0 (en) | 1969-01-29 |
| DK120289B (da) | 1971-05-10 |
| GB1227620A (enExample) | 1971-04-07 |
| NL6817250A (enExample) | 1969-06-03 |
| IL31172A (en) | 1972-03-28 |
| DE1812206A1 (de) | 1969-07-03 |
| CS152462B2 (enExample) | 1973-12-19 |
| ES360892A1 (es) | 1971-10-16 |
| CH500187A (de) | 1970-12-15 |
| US3586697A (en) | 1971-06-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Short et al. | Synthesis of 5‐aryl‐2‐oxazolepropionic acids and analogs. Antiinflammatory agents | |
| PL69898B1 (enExample) | ||
| IE38886B1 (en) | Heterocyclic compounds | |
| Bourdais et al. | Polycyclic azines. III. Synthesis of 3‐aminoimidazo [1, 5‐a] pyridine derivatives by cyclodesulfurization of N′‐Substituted‐N‐(2‐pyridylmethyl) thioureas with dicyclohexylcarbodiimide | |
| Atkinson et al. | 657. Triazoles. Part I. Unsymmetrical Einhorn–Brunner and related Pellizzari reactions | |
| US4225716A (en) | Process for the manufacture of 2,6-dichloropyridine derivatives | |
| US3907809A (en) | 3,5-Substituted-1,2,4-oxadiazole inner quaternary ammonium salts | |
| Kano et al. | Isoxazoles—XV: Conversion of N-(5-methyl-3-isoxazolyl)-N′-arylformamidines into 1-aryl-3-acetonyl-1, 2, 4-triazoles | |
| Takeuchi et al. | Benzylic azide functionalization of tautomeric o-acyl-benzoic acid,-benzamide, and-nicotinic acid derivatives, and thermal decomposition of the derived azides | |
| US2698850A (en) | N-substituted phthalimide compound and method for obtaining the same | |
| US2641597A (en) | Furans and method of production | |
| Zakharkin et al. | Synthesis of 1, 2-Dicarba-closo-dodecaboran (12)-3-yl-carboxylic Acids (3-O-Carboranecarboxylic Acids) | |
| Miyano | Syntheses of N-(2-Pyridylmethyl) aniline and its derivatives | |
| US2698851A (en) | N-substituted phthalimide compound and method for obtaining the same | |
| Abramovitch et al. | TRYPTAMINES, CARBOLINES, AND RELATED COMPOUNDS: PART V. 3-(α-ALKYL-β-AMINOETHYL) INDOLES | |
| US3372169A (en) | Preparation of diphenylmaleic anhydride and diphenylmaleic anhydride dimer | |
| GB1138621A (en) | Imidazole derivatives | |
| US2746972A (en) | Thiophene-2-carboxaldehyde thiosemicarbazone and certain substitution derivatives | |
| US2837527A (en) | Process for preparing 1-isonicotinyl-2-cyanomethylhydrazine | |
| US3171836A (en) | 2, 4, 7-triamino-n-(substituted)-6-pteridinecarboxamides | |
| JPS6160673A (ja) | グアニジノチアゾ−ル誘導体の製造法 | |
| DE3269453D1 (en) | Process for the preparation of carboxylic acid anhydrides | |
| US2857398A (en) | Succinimide compounds and method for obtaining the same | |
| SU528848A1 (ru) | , -(Дитиооксалил)-бис- бутиролактам, про вл ющий антимикробную активность, и способ его получени | |
| US2482521A (en) | Halogenated phenacylpyridines |