PL66395B1 - - Google Patents
Download PDFInfo
- Publication number
- PL66395B1 PL66395B1 PL110969A PL11096965A PL66395B1 PL 66395 B1 PL66395 B1 PL 66395B1 PL 110969 A PL110969 A PL 110969A PL 11096965 A PL11096965 A PL 11096965A PL 66395 B1 PL66395 B1 PL 66395B1
- Authority
- PL
- Poland
- Prior art keywords
- explosive
- weight
- ammonium chloride
- salt
- alkaline earth
- Prior art date
Links
- 239000002360 explosive Substances 0.000 claims description 51
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 34
- 235000019270 ammonium chloride Nutrition 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 20
- 150000003839 salts Chemical class 0.000 claims description 20
- 239000000463 material Substances 0.000 claims description 16
- SNIOPGDIGTZGOP-UHFFFAOYSA-N Nitroglycerin Chemical compound [O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O SNIOPGDIGTZGOP-UHFFFAOYSA-N 0.000 claims description 7
- 239000000006 Nitroglycerin Substances 0.000 claims description 7
- 229910001963 alkali metal nitrate Inorganic materials 0.000 claims description 7
- 229960003711 glyceryl trinitrate Drugs 0.000 claims description 7
- -1 alkaline earth metal carbonates Chemical class 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 4
- 238000004200 deflagration Methods 0.000 claims description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims 4
- 238000000034 method Methods 0.000 claims 1
- 239000002245 particle Substances 0.000 claims 1
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 22
- 235000002639 sodium chloride Nutrition 0.000 description 19
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 15
- 229910000019 calcium carbonate Inorganic materials 0.000 description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- 239000001301 oxygen Substances 0.000 description 12
- 229910052760 oxygen Inorganic materials 0.000 description 12
- 235000010216 calcium carbonate Nutrition 0.000 description 11
- 239000011833 salt mixture Substances 0.000 description 10
- 238000005474 detonation Methods 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 7
- 239000007789 gas Substances 0.000 description 7
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Inorganic materials [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 7
- 235000010344 sodium nitrate Nutrition 0.000 description 7
- 239000005909 Kieselgur Substances 0.000 description 6
- UQXKXGWGFRWILX-UHFFFAOYSA-N ethylene glycol dinitrate Chemical compound O=N(=O)OCCON(=O)=O UQXKXGWGFRWILX-UHFFFAOYSA-N 0.000 description 6
- 238000004880 explosion Methods 0.000 description 6
- 239000004576 sand Substances 0.000 description 6
- 239000004317 sodium nitrate Substances 0.000 description 5
- 230000002441 reversible effect Effects 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 235000010333 potassium nitrate Nutrition 0.000 description 3
- 239000004323 potassium nitrate Substances 0.000 description 3
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- 241000549556 Nanos Species 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 238000005422 blasting Methods 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 235000011148 calcium chloride Nutrition 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 230000008646 thermal stress Effects 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL66395B1 true PL66395B1 (enExample) | 1972-06-30 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Oommen et al. | Ammonium nitrate: a promising rocket propellant oxidizer | |
| Mahadevan | Ammonium nitrate explosives for civil applications: slurries, emulsions and ammonium nitrate fuel oils | |
| US4963201A (en) | Primer composition | |
| Hayes | Elements of Ordnance: A textbook for use of cadets of the United States Military Academy | |
| US3366468A (en) | Method of desensitizing fertilizer grade ammonium nitrate and the product obtained | |
| CN103319290A (zh) | 耐低温高威力煤矿许用水胶炸药及其制造方法 | |
| JPS59232988A (ja) | エマルジヨン型爆発性組成物とその製法 | |
| US2613146A (en) | Unsheathed safety explosive composition | |
| US3619305A (en) | Explosive compositions containing expanded ammonium nitrate in crystalline form and method of preparing same | |
| PL66395B1 (enExample) | ||
| US3278350A (en) | Explosive-ammonium nitrate in phenol-aldehyde resin | |
| RU2122990C1 (ru) | Пороховой взрывчатый состав | |
| PL79079B1 (enExample) | ||
| US4424087A (en) | Method for desensitizing particle formed solid explosive substances | |
| US2235060A (en) | Manufacture of explosive compositions or blasting charges | |
| RU2130446C1 (ru) | Пороховой взрывчатый состав и способ его изготовления | |
| RU2526994C1 (ru) | Предохранительный эмульсионный взрывчатый состав для шпуровых зарядов | |
| US2154416A (en) | Nondetonating blasting explosive | |
| Scott et al. | Ammonium nitrate: its properties and fire and explosion hazards | |
| US3053710A (en) | Magnesium hydride explosive compositions | |
| NO165409B (no) | Fremgangsmaate for fjerning av lignin fra konsentrert blekeriavloepsvann fra kjemisk masse. | |
| US2048827A (en) | Blasting charge | |
| KR102851800B1 (ko) | 친환경 탄광굴진용 에멀젼 폭약 조성물 | |
| Liu | Liquid explosive mixtures | |
| Silva et al. | PANFO-A novel low-density dry bulk explosive |