PL60932B1 - - Google Patents
Download PDFInfo
- Publication number
- PL60932B1 PL60932B1 PL110409A PL11040965A PL60932B1 PL 60932 B1 PL60932 B1 PL 60932B1 PL 110409 A PL110409 A PL 110409A PL 11040965 A PL11040965 A PL 11040965A PL 60932 B1 PL60932 B1 PL 60932B1
- Authority
- PL
- Poland
- Prior art keywords
- generator
- chlorine
- chlorate
- reaction
- chloride
- Prior art date
Links
- OSVXSBDYLRYLIG-UHFFFAOYSA-N dioxidochlorine(.) Chemical compound O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 claims description 50
- XTEGARKTQYYJKE-UHFFFAOYSA-M chlorate Inorganic materials [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims description 36
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 33
- 238000000034 method Methods 0.000 claims description 32
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical group [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 30
- 238000006243 chemical reaction Methods 0.000 claims description 27
- 239000004155 Chlorine dioxide Substances 0.000 claims description 25
- 235000019398 chlorine dioxide Nutrition 0.000 claims description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 22
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 18
- 239000000460 chlorine Substances 0.000 claims description 18
- 229910052801 chlorine Inorganic materials 0.000 claims description 16
- 239000011780 sodium chloride Substances 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 10
- 239000011541 reaction mixture Substances 0.000 claims description 6
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical group CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 238000000354 decomposition reaction Methods 0.000 claims description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- -1 alkali metal chlorate Chemical class 0.000 claims description 2
- 229910001514 alkali metal chloride Inorganic materials 0.000 claims description 2
- 238000011437 continuous method Methods 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 230000001105 regulatory effect Effects 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims 1
- 239000000243 solution Substances 0.000 description 30
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 25
- 229910052938 sodium sulfate Inorganic materials 0.000 description 13
- 235000011152 sodium sulphate Nutrition 0.000 description 13
- 239000013078 crystal Substances 0.000 description 10
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 8
- 239000012527 feed solution Substances 0.000 description 7
- 239000007789 gas Substances 0.000 description 7
- 239000007832 Na2SO4 Substances 0.000 description 6
- 238000005406 washing Methods 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 238000010924 continuous production Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 230000008929 regeneration Effects 0.000 description 3
- 238000011069 regeneration method Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000003784 tall oil Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 229910001902 chlorine oxide Inorganic materials 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 239000010802 sludge Substances 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- 239000012808 vapor phase Substances 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005202 decontamination Methods 0.000 description 1
- 230000003588 decontaminative effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- IYGFDEZBVCNBRU-UHFFFAOYSA-L disodium sulfuric acid sulfate Chemical compound [H+].[H+].[H+].[H+].[Na+].[Na+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O IYGFDEZBVCNBRU-UHFFFAOYSA-L 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 229940090046 jet injector Drugs 0.000 description 1
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical class [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000011973 solid acid Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL60932B1 true PL60932B1 (enExample) | 1970-06-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3864456A (en) | Manufacture of chlorine dioxide, chlorine and anhydrous sodium sulphate | |
| US3563702A (en) | Production of chlorine dioxide | |
| US3998935A (en) | Manufacture of potassium sulfate | |
| US5324497A (en) | Integrated procedure for high yield production of chlorine dioxide and apparatus used therefor | |
| US3789108A (en) | Production of chlorine dioxide | |
| US3754081A (en) | Process for the production of chlorine dioxide,chlorine and a mixtureof an alkali metal sulfate and bisulfate | |
| US3933988A (en) | Method of simultaneously producing chlorine dioxide and a sulfate salt | |
| NZ242432A (en) | Process for the conversion of sodium sesquisulphate to neutral anhydrous sodium sulphate; process and apparatus for generation of chlorine dioxide | |
| US3341288A (en) | Production of chlorine dioxide | |
| US3347628A (en) | Production of chlorine dioxide | |
| US3760065A (en) | Production of chlorine dioxide | |
| US3829557A (en) | Production of chlorine dioxide | |
| US3929974A (en) | Production of chlorine dioxide | |
| US4543243A (en) | Process and a device for the production of chlorine dioxide | |
| US2895801A (en) | Process for producing chlorine dioxide | |
| CA1105877A (en) | Process for producing chlorine dioxide | |
| US3933987A (en) | Simultaneous production of chlorine dioxide and a salt of a strong acid | |
| US3241912A (en) | Process of aqueous chlorination | |
| US4045542A (en) | Production of chlorine dioxide | |
| CN102803131B (zh) | 生产二氧化氯的方法 | |
| US4486399A (en) | Method to reduce the potential salt cake content of chlorine dioxide generator spent acids | |
| EP0667835B1 (en) | Metathesis of acidic by-product of chlorine dioxide generating process | |
| US4156713A (en) | Production of chlorine dioxide | |
| US4578261A (en) | Method to reduce the potential salt cake content of chlorine dioxide generator spent acids | |
| PL60932B1 (enExample) |