PL60638B1 - - Google Patents
Download PDFInfo
- Publication number
- PL60638B1 PL60638B1 PL121469A PL12146967A PL60638B1 PL 60638 B1 PL60638 B1 PL 60638B1 PL 121469 A PL121469 A PL 121469A PL 12146967 A PL12146967 A PL 12146967A PL 60638 B1 PL60638 B1 PL 60638B1
- Authority
- PL
- Poland
- Prior art keywords
- methyl
- water
- carbon atoms
- mixture
- alkoxyindoles
- Prior art date
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- MDWJZBVEVLTXDE-UHFFFAOYSA-N 2-methyl-1h-indol-5-ol Chemical compound OC1=CC=C2NC(C)=CC2=C1 MDWJZBVEVLTXDE-UHFFFAOYSA-N 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 150000008050 dialkyl sulfates Chemical class 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- VSWGLJOQFUMFOQ-UHFFFAOYSA-N 5-methoxy-2-methyl-1h-indole Chemical compound COC1=CC=C2NC(C)=CC2=C1 VSWGLJOQFUMFOQ-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- -1 3-substituted indole Chemical class 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- STJROFNHNCUGHJ-UHFFFAOYSA-N 4-methoxy-n-(propan-2-ylideneamino)aniline Chemical compound COC1=CC=C(NN=C(C)C)C=C1 STJROFNHNCUGHJ-UHFFFAOYSA-N 0.000 description 1
- WUHIKCJBSKWNIC-UHFFFAOYSA-N 5-ethoxy-2-methyl-1h-indole Chemical compound CCOC1=CC=C2NC(C)=CC2=C1 WUHIKCJBSKWNIC-UHFFFAOYSA-N 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000000506 psychotropic effect Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical class C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 1
- 239000000021 stimulant Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL60638B1 true PL60638B1 (Sortimente) | 1970-06-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Windus et al. | The resolution of synthetic methionine | |
| US2960441A (en) | Therapeutic compositions of salts of 3, 3-pentamethylene-4-hydroxybutyric acid | |
| Burckhalter et al. | A new type of 8-quinolinol amebacidal agent | |
| US2679500A (en) | Substituted m-thiazane-x-ones | |
| PL60638B1 (Sortimente) | ||
| US3345416A (en) | Preparation and rearrangement of beta-ketosulfoxides | |
| US2350265A (en) | Pyrimidine compounds | |
| SU489310A3 (ru) | Способ получени производного бифенилацетамида или его соли | |
| DK141531B (da) | Analogifremgangsmåde til fremstilling af 1-metyl-9,10-dihydro-d-lysergsyreallylamid eller syreadditionssalte deraf. | |
| US2557284A (en) | Esters of pantothenic acid, intermediates thereof, and process for their production | |
| BARKENBUS et al. | The Beckmann Rearrangement of Some Heterocyclic Ketoximes | |
| US2864822A (en) | 9-amino-7-methyl-belta10-ergolene and derivatives thereof | |
| US3651048A (en) | Purification process | |
| US2140480A (en) | 3-keto-d-pentonic acid lactone and process for the manufacture of same | |
| SU408546A1 (ru) | Способ получени хлоргидрата 1= аминоадамантана | |
| US2639287A (en) | Thiosemicarbazones of furylketones | |
| Gregory et al. | 446. The conversion of sucrose into pyridazine derivatives. Part V. Experiments on the synthesis of 3-amino-6-methylpyridazine and of its sulphanilamido-derivative | |
| JPS5838414B2 (ja) | シクロペンテノロン ノ ブンカツホウ | |
| US1062203A (en) | Manufacture and production of alkyl derivatives and substituted alkyl derivatives of hydrocupreine. | |
| US2350264A (en) | Pyrimidine compounds | |
| Hibbert et al. | Studies on Reactions Relating to Carbohydrates and Polysaccharides. XIX. Structural, Geometrical and Optical Isomerism of the Para-Nitrobenzylidene Glycerols and Their Derivatives | |
| US2336826A (en) | Pyrimtoine compounds | |
| US2479148A (en) | S-crotyl-s-phenylbarbituric | |
| US2907773A (en) | Amino derivatives of 4h-pyran-4-ones | |
| SU64732A1 (ru) | Способ получени 2-аминотиазола |