PL56875B3 - - Google Patents
Download PDFInfo
- Publication number
- PL56875B3 PL56875B3 PL121200A PL12120067A PL56875B3 PL 56875 B3 PL56875 B3 PL 56875B3 PL 121200 A PL121200 A PL 121200A PL 12120067 A PL12120067 A PL 12120067A PL 56875 B3 PL56875 B3 PL 56875B3
- Authority
- PL
- Poland
- Prior art keywords
- head
- track
- ferrite
- magnetic
- individual
- Prior art date
Links
- 229910000859 α-Fe Inorganic materials 0.000 claims description 11
- 239000000463 material Substances 0.000 claims description 7
- 238000004804 winding Methods 0.000 claims description 3
- 210000003128 head Anatomy 0.000 description 34
- 230000005520 electrodynamics Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 2
- 230000004907 flux Effects 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 210000001061 forehead Anatomy 0.000 description 2
- 238000012216 screening Methods 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- 210000001520 comb Anatomy 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 238000009342 intercropping Methods 0.000 description 1
- 239000000696 magnetic material Substances 0.000 description 1
- 238000007885 magnetic separation Methods 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US698196A US3543396A (en) | 1967-01-17 | 1968-01-16 | Method of multi-track,two-gap,ferrite magnetic heads designed especially for digital recording |
| DE19681774356 DE1774356A1 (de) | 1966-03-12 | 1968-05-31 | Verfahren zur Herstellung von mehrspurigen,ein oder mehrspaltigen,insbesondere fuer digitale Ein- und Ausgabe bestimmten Magnetkoepfen |
| GB1239574D GB1239574A (OSRAM) | 1967-06-17 | 1968-06-05 | |
| NL6808391A NL6808391A (OSRAM) | 1966-03-12 | 1968-06-14 | |
| CS443668A CS165330B2 (OSRAM) | 1967-06-17 | 1968-06-15 | |
| BE716686D BE716686A (OSRAM) | 1966-03-12 | 1968-06-17 | |
| FR1580285D FR1580285A (OSRAM) | 1967-06-17 | 1968-06-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL56875B3 true PL56875B3 (OSRAM) | 1968-12-27 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3940797A (en) | Shielded magnetoresistive magnetic transducer | |
| US4369476A (en) | Multi-track recording head assembly with electromagnetic cross-talk neutralization | |
| US2846517A (en) | Magnetic head | |
| US3969771A (en) | Magnetic head with shield plates for respective head elements | |
| PL56875B3 (OSRAM) | ||
| CA1195773A (en) | Magnetic erasing head | |
| GB1423520A (en) | Manufacture of magnetic transducing heads | |
| US2839614A (en) | Magnetic recording head | |
| US3497633A (en) | Multitrack electromagnetic transducer head with cross field pole | |
| US3325795A (en) | High resolution digital magnetic head with flux focusing shield | |
| US4300178A (en) | Multichannel magnetic head | |
| ATE9518T1 (de) | Abgeschirmter magnetoresistiver sensor zum abtasten von informationsspuren eines magnetischen aufzeichnungstraegers. | |
| US3474528A (en) | Method of manufacturing a flux-sensitive mono- or multi-track magnetic head | |
| JPS632988Y2 (OSRAM) | ||
| SU809331A1 (ru) | Многодорожечный блок магнитныхгОлОВОК | |
| SU957265A1 (ru) | Многодорожечна магнитна головка | |
| US2730570A (en) | Magnetic sound record erasing method and heads therefor | |
| RU2101783C1 (ru) | Многодорожечный блок магнитных головок | |
| SU506053A1 (ru) | Многодорожечный блок магнитных головок | |
| SU801059A1 (ru) | Магнитна головка холла | |
| SU934543A1 (ru) | Многодорожечный блок ферритовых магнитных головок | |
| KR890005693Y1 (ko) | 자기 헤드 | |
| US3372241A (en) | Multitrack erase head | |
| SU417831A1 (OSRAM) | ||
| SU538396A1 (ru) | Блок магнитных головок |