PL56632B1 - - Google Patents
Download PDFInfo
- Publication number
- PL56632B1 PL56632B1 PL104913A PL10491364A PL56632B1 PL 56632 B1 PL56632 B1 PL 56632B1 PL 104913 A PL104913 A PL 104913A PL 10491364 A PL10491364 A PL 10491364A PL 56632 B1 PL56632 B1 PL 56632B1
- Authority
- PL
- Poland
- Prior art keywords
- germanium
- compounds
- solution
- acid
- arsenic
- Prior art date
Links
- 229910052732 germanium Inorganic materials 0.000 claims description 16
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 16
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 11
- 229910052785 arsenic Inorganic materials 0.000 claims description 8
- 239000004021 humic acid Substances 0.000 claims description 8
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 7
- 150000001495 arsenic compounds Chemical class 0.000 claims description 7
- 229940093920 gynecological arsenic compound Drugs 0.000 claims description 7
- QJZYHAIUNVAGQP-UHFFFAOYSA-N 3-nitrobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid Chemical compound C1C2C=CC1C(C(=O)O)C2(C(O)=O)[N+]([O-])=O QJZYHAIUNVAGQP-UHFFFAOYSA-N 0.000 claims description 6
- 150000002291 germanium compounds Chemical class 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- 238000005868 electrolysis reaction Methods 0.000 claims description 5
- 150000004697 chelate complex Chemical class 0.000 claims description 4
- 229910006151 GeIV Inorganic materials 0.000 claims description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 3
- -1 alkali metal sulfite Chemical class 0.000 claims description 3
- 230000000536 complexating effect Effects 0.000 claims description 3
- 238000000926 separation method Methods 0.000 claims description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical compound [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 239000003638 chemical reducing agent Substances 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims 1
- YBMRDBCBODYGJE-UHFFFAOYSA-N germanium dioxide Chemical compound O=[Ge]=O YBMRDBCBODYGJE-UHFFFAOYSA-N 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- VXXCTRXMBKNRII-UHFFFAOYSA-L S(=O)(=O)([O-])[O-].[Ge+2] Chemical compound S(=O)(=O)([O-])[O-].[Ge+2] VXXCTRXMBKNRII-UHFFFAOYSA-L 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- PQUCIEFHOVEZAU-UHFFFAOYSA-N Diammonium sulfite Chemical class [NH4+].[NH4+].[O-]S([O-])=O PQUCIEFHOVEZAU-UHFFFAOYSA-N 0.000 description 1
- 241000208152 Geranium Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 238000010668 complexation reaction Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL56632B1 true PL56632B1 (enExample) | 1968-12-27 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4151077A (en) | Process for elimination of mercury from industrial waste waters by means of extraction with solvents | |
| SE8304858L (sv) | Forfarande for rening av fororenade vattenlosningar innehallande arsenik och/eller fosfor | |
| US3493365A (en) | Treatment of zinc plant residue | |
| US3674428A (en) | Mercury removal | |
| US3911078A (en) | Method for removing arsenic and antimony from copper ore concentrates | |
| JPH021086B2 (enExample) | ||
| Gordon et al. | Oxygen tracer experiments on the oxidation of aqueous uranium (IV) with oxygen-containing oxidizing agents | |
| JPS63502890A (ja) | 超純粋硝酸銀の製造 | |
| US3097926A (en) | Removal of hydrogen sulphide from gases by a wash solution and oxidation therein to form sulfur | |
| US2727818A (en) | Method of leaching copper sulfide materials with ammoniacal leach solution | |
| US4049776A (en) | Method of removing hydrogen sulfide from gases and liquids | |
| US4428840A (en) | Anionic and cationic removal of copper from cyanide-containing wastewater | |
| PL56632B1 (enExample) | ||
| US2945743A (en) | Process for purifying impure rhenium-bearing solutions by ion exchange | |
| US5320759A (en) | Selective recovery of heavy metals using xanthates | |
| CA2402057C (en) | Process for purifying aqueous buffer solutions | |
| US4885144A (en) | Process for purifying molybdenum | |
| US7704911B2 (en) | Catalytic composition for oxidation of hydrogen sulfide, and methods for preparation thereof | |
| US3875287A (en) | Removing mercury from concentrated sulfuric acid using iodides | |
| US3099527A (en) | Purification of leach liquor containing lithium values | |
| RU2004609C1 (ru) | Способ переработки вторичного вольфрамсодержащего сернистого сырь | |
| CA1263539A (en) | Process for the separation of indium from acidic solutions containing it | |
| JPS61141607A (ja) | 燐酸溶液からの脱砒素化法 | |
| US4368073A (en) | Use of the sodium salt of 2-mercaptopyridine-N-oxide to separate gold from acidic solutions | |
| US5683666A (en) | Method for the removal of sulfur dioxide and nitrogen oxides for a gaseous stream |