PL54007B1 - - Google Patents
Download PDFInfo
- Publication number
- PL54007B1 PL54007B1 PL106889A PL10688965A PL54007B1 PL 54007 B1 PL54007 B1 PL 54007B1 PL 106889 A PL106889 A PL 106889A PL 10688965 A PL10688965 A PL 10688965A PL 54007 B1 PL54007 B1 PL 54007B1
- Authority
- PL
- Poland
- Prior art keywords
- oxazine
- methyl
- ethyl
- formula
- nzór
- Prior art date
Links
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 24
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 150000004893 oxazines Chemical class 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 4
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- QUSNBJAOOMFDIB-UHFFFAOYSA-N monoethyl amine Natural products CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- LKLLNYWECKEQIB-UHFFFAOYSA-N 1,3,5-triazinane Chemical compound C1NCNCN1 LKLLNYWECKEQIB-UHFFFAOYSA-N 0.000 claims description 2
- 238000010533 azeotropic distillation Methods 0.000 claims description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 claims 2
- 239000007795 chemical reaction product Substances 0.000 claims 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 claims 1
- 238000002425 crystallisation Methods 0.000 claims 1
- 230000008025 crystallization Effects 0.000 claims 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N mono-methylamine Natural products NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims 1
- -1 3, 5-dioxacyclohexyl Chemical group 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 3
- DPMZXMBOYHBELT-UHFFFAOYSA-N 1,3,5-trimethyl-1,3,5-triazinane Chemical compound CN1CN(C)CN(C)C1 DPMZXMBOYHBELT-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- XYRTVIAPRQLSOW-UHFFFAOYSA-N 1,3,5-triethyl-1,3,5-triazinane Chemical compound CCN1CN(CC)CN(CC)C1 XYRTVIAPRQLSOW-UHFFFAOYSA-N 0.000 description 1
- XIFHEJPWOZEGLV-UHFFFAOYSA-N 5-nitro-1,3-oxazinane Chemical class [O-][N+](=O)C1CNCOC1 XIFHEJPWOZEGLV-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical group O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000000247 oncostatic effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19661695091 DE1695091A1 (de) | 1965-01-07 | 1966-01-07 | 2-,3-,5-substituierte 5-Nitrotetrahydro-1,3-oxazinderivate und Verfahren zu ihrer Herstellung |
| NL6600207A NL6600207A (enExample) | 1965-01-07 | 1966-01-07 | |
| GB89866A GB1120793A (en) | 1965-01-07 | 1966-01-07 | 5-nitrotetrahydro-1,3-oxazines |
| DE19661695051 DE1695051A1 (de) | 1965-01-07 | 1966-01-07 | 2-,3-,5-substituierte 5-Nitrotetrahydro-1,3-oxazinderivate,Verfahren zu ihrer Herstellung und Verwendung |
| FR45156A FR1501718A (fr) | 1965-01-07 | 1966-01-07 | Procédé de préparation de dérivés 2, 3, 5-trisubstitués de 5-nitro-tétrahydro-1, 3-oxazines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL54007B1 true PL54007B1 (enExample) | 1967-08-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1592272A (en) | Fused thiazolidine derivatives and process for their manufacture | |
| EP0004066B1 (en) | 2-(4-aminobutoxy)stilbenes and pharmaceutical compositions containing these substances | |
| US2870161A (en) | 2-(1-indanyl amino)-oxazolines | |
| PL54007B1 (enExample) | ||
| US2483998A (en) | Nu-(pyrrolidylalkyl)-phenothiazines | |
| Mizzoni | Structure and anticoccidial activity among some 4-hydroxyquinolinecarboxylates | |
| CS229692B2 (en) | Manufacturing process of derivate 4-phenylquinazoline | |
| US3119823A (en) | Process for preparation of o-hydroxyphenyl-triazines | |
| US3574222A (en) | Preparation of 5-amino-1,2,4-oxadiazoles | |
| US3674787A (en) | 2-(alpha-morpholinobenzyl)-anilides | |
| US2217660A (en) | Secondary xenoxy-alkyl amines | |
| IL28645A (en) | Tropine derivatives | |
| US3136764A (en) | Tetrahalocyclopentadienyldiamine compounds | |
| CRAIG et al. | Synthesis of Phenothiazines. VI. Certain 2-Substituted Phenothiazines and Their 10-Aminoalkyl Derivatives | |
| US2653949A (en) | 1-(di-n-butylaminoalkylamino)-4-methylthiaxanthones and synthesis thereof | |
| US2740795A (en) | Isoindolineicompounds | |
| GB1565021A (en) | Pharmaceutical compositions containing alkylamine deratives | |
| KR880001298B1 (ko) | 벤조일-페닐-피페리딘 유도체의 제법 | |
| DK142844B (da) | Analogifremgangsmåde til fremstilling af substituerede N-(2-pyrrolidylmethyl)-benzamidderivater. | |
| US3322775A (en) | Quaternary ammonium salts of [4-(3-aminoalkanoyl) phenoxy] alkanoic acids | |
| US2748129A (en) | Sulfamylpiperazines and method of preparing the same | |
| US3322778A (en) | Novel ether derivatives of benzmorphans | |
| US2650230A (en) | Xanthene-9-carboxylic acid esters of nuclearly alkylated 4-piperidinols and salts thereof | |
| US3701786A (en) | Dibenzofuranyl-aminoalcohols | |
| US3285919A (en) | Piperazinyl alkyl thiaxanthene derivatives |