PL43849B1 - - Google Patents
Download PDFInfo
- Publication number
- PL43849B1 PL43849B1 PL43849A PL4384959A PL43849B1 PL 43849 B1 PL43849 B1 PL 43849B1 PL 43849 A PL43849 A PL 43849A PL 4384959 A PL4384959 A PL 4384959A PL 43849 B1 PL43849 B1 PL 43849B1
- Authority
- PL
- Poland
- Prior art keywords
- acid
- sulfuric acid
- oil
- alkylsulfonarylide
- separated
- Prior art date
Links
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 6
- 238000006386 neutralization reaction Methods 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 238000006277 sulfonation reaction Methods 0.000 claims description 5
- 150000004982 aromatic amines Chemical class 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 3
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 claims description 2
- 239000003921 oil Substances 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 8
- 239000003960 organic solvent Substances 0.000 description 7
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 125000004422 alkyl sulphonamide group Chemical group 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 239000003599 detergent Substances 0.000 description 3
- 238000005187 foaming Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- -1 alkyl sulphochlorides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000005517 mercerization Methods 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 230000007096 poisonous effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000009423 ventilation Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL43849B1 true PL43849B1 (enExample) | 1960-10-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3424694A (en) | Mixture of surface-active compounds and process for preparing same | |
| US2081876A (en) | Diaryl oxide sulphonic acids and processes for preparing the same | |
| US2337552A (en) | Purification of saturated hydrocarbon sulphonic acids | |
| US2704295A (en) | Aromatic hydrocarbon sulfonation | |
| US2567854A (en) | Production of alkyl aromatic sulfonic acids and their salts | |
| US2228598A (en) | Purification of hydrocarbon-sulphur dioxide-chlorine reaction products | |
| US2658916A (en) | Preparation and purification of higher alkyl aryl sulfonamides and their salts | |
| US2366027A (en) | Detergent and wetting compositions | |
| PL43849B1 (enExample) | ||
| US2854476A (en) | Method of sulfonation with a sulfur trioxide addition product | |
| US2195088A (en) | Sulphonated ketones | |
| US2820056A (en) | Alkaryl sulfonates | |
| US2010754A (en) | Sulphonated sulphones and their production | |
| US2531469A (en) | Polyvinyl sulfonates and process for preparing the same | |
| US2341614A (en) | Process for preparing capillary active substances | |
| US2703788A (en) | Preparation of sulfonated alkyl aryl detergent slurries | |
| US2084506A (en) | Process fob preparing improved | |
| US2292998A (en) | Nitrogen substituted sulphimides | |
| US2235534A (en) | Composition of matter and method of making same | |
| US1191880A (en) | Organic chemical process. | |
| US2614084A (en) | Alkyl thiophene sulfonate wetting agents and method for making same | |
| US3104247A (en) | Process for preparing alpha sulfo fatty acids and salts thereof | |
| GB818243A (en) | Method of making alkyl diphenyl ether sulphonates | |
| US2203443A (en) | Method of preparing detergent | |
| US2205949A (en) | Alkyl hydroxy aromatic sulphonates |