PL42613B1 - - Google Patents
Download PDFInfo
- Publication number
- PL42613B1 PL42613B1 PL42613A PL4261359A PL42613B1 PL 42613 B1 PL42613 B1 PL 42613B1 PL 42613 A PL42613 A PL 42613A PL 4261359 A PL4261359 A PL 4261359A PL 42613 B1 PL42613 B1 PL 42613B1
- Authority
- PL
- Poland
- Prior art keywords
- methoxypyridazine
- sulfanilamido
- anhydrous
- methoxylation
- pure
- Prior art date
Links
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 14
- -1 3-sulfanilamid-6-methoxypyridazine Chemical compound 0.000 claims description 8
- 238000006198 methoxylation reaction Methods 0.000 claims description 7
- VLYWMPOKSSWJAL-UHFFFAOYSA-N Sulfamethoxypyridazine Chemical compound N1=NC(OC)=CC=C1NS(=O)(=O)C1=CC=C(N)C=C1 VLYWMPOKSSWJAL-UHFFFAOYSA-N 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- 159000000000 sodium salts Chemical class 0.000 claims description 6
- 238000000746 purification Methods 0.000 claims description 4
- 239000011780 sodium chloride Substances 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 2
- XOXHILFPRYWFOD-UHFFFAOYSA-N sulfachloropyridazine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)NC1=CC=C(Cl)N=N1 XOXHILFPRYWFOD-UHFFFAOYSA-N 0.000 claims description 2
- ASFHDLDAWYTMJS-UHFFFAOYSA-N 3-methoxypyridazine Chemical compound COC1=CC=CN=N1 ASFHDLDAWYTMJS-UHFFFAOYSA-N 0.000 claims 1
- 239000008241 heterogeneous mixture Substances 0.000 claims 1
- 238000002955 isolation Methods 0.000 claims 1
- 230000020477 pH reduction Effects 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 3
- 230000005712 crystallization Effects 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000005755 formation reaction Methods 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229940093912 Gynecological Sulfonamides Drugs 0.000 description 1
- 229960004936 Sulfamethoxypyridazine Drugs 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N Sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- GRWZHXKQBITJKP-UHFFFAOYSA-L dithionite(2-) Chemical compound [O-]S(=O)S([O-])=O GRWZHXKQBITJKP-UHFFFAOYSA-L 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drugs Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229940079867 intestinal antiinfectives Sulfonamides Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229940005938 ophthalmologic antiinfectives Sulfonamides Drugs 0.000 description 1
- 230000002035 prolonged Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 229960001663 sulfanilamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 229940026752 topical Sulfonamides Drugs 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL42613B1 true PL42613B1 (de) | 1959-10-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0298650B1 (de) | Azithromycin-Dihydrat | |
| JPH02311483A (ja) | セフトリアキソンの製造方法 | |
| NO135777B (de) | ||
| US2744907A (en) | Production of heterocyclic sulfonyl chlorides | |
| PL42613B1 (de) | ||
| US3507860A (en) | Process for the purification of crude 7-aminocephalosporanic acid and acid addition salts of 7 - amino - cephalosporanic acid employed therein | |
| US2186773A (en) | 2(p-nicotinylaminobenzenesulfon-amide) pyridine and its salts, and process of preparing them | |
| CA1236089A (en) | Ceftazidime | |
| GB2048858A (en) | Spectinomycin recovery process | |
| US5260462A (en) | Purification of tauroursodesoxycholic acid dihydrate | |
| US2413833A (en) | Substituted 4,4'-diaminodiphenyl sulfones and process of making same | |
| US3654292A (en) | Manufacture of 3 5-dichloro-2 6-difluoro - 4 - hydroxypyridine and salts thereof | |
| US4859772A (en) | Process for the preparation of 3-isopropyl-benzo-2-thia-1,3-diazinone-(4)-2,2-dioxide | |
| EP0285655B1 (de) | Verfahren zur herstellung von chinolin-carbonsäurederivaten | |
| US2303972A (en) | Sulphanilyl guanylureas and process for making them | |
| US654122A (en) | Dichloro-oxypurin and process of making same. | |
| SU436057A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ ИЗОПРОПИЛИДЕНОВЫХ ПРОИЗВОДНЫХ ПИРИДОКСИНАВ ПТ5ФОНЯ mmim | |
| US4186133A (en) | Process for the preparation of an indole-3-acetohydroxamic acid | |
| US3152123A (en) | Process for the preparation of benzo- | |
| US2738352A (en) | Purification of pyridine compounds | |
| US631758A (en) | Alkyl-xanthin derivative and process of making same. | |
| GB570341A (en) | Resolution of ª‡-hydroxy-ª‰:ª‰-dimethyl-ª†-butyrolactone | |
| US2517496A (en) | Preparation of symmetrical monoaminodihydroxytoluene | |
| AT228209B (de) | Verfahren zur Herstellung von neuen Sulfonamiden | |
| US2860135A (en) | Preparation of arylsulphonyl thiazoles |