PL42022B1 - - Google Patents
Download PDFInfo
- Publication number
- PL42022B1 PL42022B1 PL42022A PL4202258A PL42022B1 PL 42022 B1 PL42022 B1 PL 42022B1 PL 42022 A PL42022 A PL 42022A PL 4202258 A PL4202258 A PL 4202258A PL 42022 B1 PL42022 B1 PL 42022B1
- Authority
- PL
- Poland
- Prior art keywords
- ammonium nitrate
- superphosphate
- calcium
- aqueous
- calcium carbonate
- Prior art date
Links
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 7
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 claims description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 4
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical compound [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 claims description 4
- 239000002426 superphosphate Substances 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000002994 raw material Substances 0.000 claims description 2
- 239000000243 solution Substances 0.000 claims description 2
- 239000000725 suspension Substances 0.000 claims description 2
- 238000009736 wetting Methods 0.000 claims description 2
- 239000006286 aqueous extract Substances 0.000 claims 1
- 239000012266 salt solution Substances 0.000 claims 1
- 239000011575 calcium Substances 0.000 description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 4
- NGLMYMJASOJOJY-UHFFFAOYSA-O azanium;calcium;nitrate Chemical compound [NH4+].[Ca].[O-][N+]([O-])=O NGLMYMJASOJOJY-UHFFFAOYSA-O 0.000 description 4
- 229910052791 calcium Inorganic materials 0.000 description 4
- 235000013339 cereals Nutrition 0.000 description 3
- 235000013312 flour Nutrition 0.000 description 3
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 2
- 235000011941 Tilia x europaea Nutrition 0.000 description 2
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 239000004571 lime Substances 0.000 description 2
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000005649 metathesis reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL42022B1 true PL42022B1 (cg-RX-API-DMAC10.html) | 1959-04-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3419379A (en) | Process for coating fertilizer particles with magnesium and calcium phosphates and sulfates and the resulting product | |
| US3333939A (en) | Discrete fertilizer granule containing a urea compound, sulfur and a phosphate plant food | |
| Bolan et al. | Preparation, forms and properties of controlled-release phosphate fertilizers | |
| US3076700A (en) | Fertilizer compositions and process | |
| GB1432579A (en) | Process for the preparation of phosphoric acid | |
| US4559076A (en) | Nitrogen fertilization | |
| NZ194273A (en) | Non caking granular mineral fertilisers containing an ammonium salt and dicyandiamide | |
| US3351455A (en) | Ammonium sulfate-ammonium bisulfate fertilizer and method of making | |
| US3466161A (en) | Granulated potassium chloride fertilizer | |
| PL42022B1 (cg-RX-API-DMAC10.html) | ||
| US4017588A (en) | Manufacture of solid ammonium phosphate | |
| WO1996026158A1 (en) | Manufacturing method for porous ammonium nitrate | |
| US3241947A (en) | Encapsulated particulate fertilizer | |
| US2750270A (en) | Production of soluble phosphates | |
| GB1142288A (en) | Process for the mixing of solid compounds with a melt or a suspension in the production of npk-fertilizer prills | |
| Nielsson et al. | Nitric phosphates, manufacture from phosphate rock, nitric acid ammonia, and potassium or other soluble sulfates | |
| DE1028591B (de) | Verfahren zur Herstellung von granulierten Phosphatduengemitteln | |
| US2861878A (en) | Manufacture of complex fertilizers | |
| US2222734A (en) | Peptized phosphatic fertilizer | |
| JPS6117795B2 (cg-RX-API-DMAC10.html) | ||
| EP0093204B1 (de) | Verfahren zum Granulieren von Eisen-(II)-sulfat enthaltenden Düngergemischen | |
| WO2006057573A2 (en) | Method for producing a nitrogen-potassium fertiliser | |
| Kazakhbaev et al. | IMPROVING TECHNOLOGY FOR PRODUCING COMPLEX FERTILIZER FROM LOW-GRADE PHOSPHORITES OF THE CENTRAL KUMKYZYL | |
| GB886951A (en) | Phosphate fertilizer composition and the method of manufacture thereof | |
| JPS6339549B2 (cg-RX-API-DMAC10.html) |