PL35779B1 - - Google Patents
Download PDFInfo
- Publication number
- PL35779B1 PL35779B1 PL35779A PL3577950A PL35779B1 PL 35779 B1 PL35779 B1 PL 35779B1 PL 35779 A PL35779 A PL 35779A PL 3577950 A PL3577950 A PL 3577950A PL 35779 B1 PL35779 B1 PL 35779B1
- Authority
- PL
- Poland
- Prior art keywords
- mixture
- combustible
- acetanilide
- potassium perchlorate
- parts
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 47
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 claims description 18
- VBIXEXWLHSRNKB-UHFFFAOYSA-N ammonium oxalate Chemical compound [NH4+].[NH4+].[O-]C(=O)C([O-])=O VBIXEXWLHSRNKB-UHFFFAOYSA-N 0.000 claims description 14
- AXZAYXJCENRGIM-UHFFFAOYSA-J dipotassium;tetrabromoplatinum(2-) Chemical compound [K+].[K+].[Br-].[Br-].[Br-].[Br-].[Pt+2] AXZAYXJCENRGIM-UHFFFAOYSA-J 0.000 claims description 10
- 229910001487 potassium perchlorate Inorganic materials 0.000 claims description 10
- 229960001413 acetanilide Drugs 0.000 claims description 9
- -1 amine compound Chemical class 0.000 claims description 5
- 239000000463 material Substances 0.000 claims description 4
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 claims description 4
- VQNRMLCRMNVBBP-UHFFFAOYSA-N aniline;oxalic acid Chemical compound OC(=O)C(O)=O.NC1=CC=CC=C1 VQNRMLCRMNVBBP-UHFFFAOYSA-N 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 239000004323 potassium nitrate Substances 0.000 claims description 2
- 235000010333 potassium nitrate Nutrition 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims 1
- 239000007800 oxidant agent Substances 0.000 claims 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 18
- 229910002092 carbon dioxide Inorganic materials 0.000 description 9
- KKXWTTFQKVYWDQ-UHFFFAOYSA-J Cl(=O)(=O)[O-].[C+4].Cl(=O)(=O)[O-].Cl(=O)(=O)[O-].Cl(=O)(=O)[O-] Chemical compound Cl(=O)(=O)[O-].[C+4].Cl(=O)(=O)[O-].Cl(=O)(=O)[O-].Cl(=O)(=O)[O-] KKXWTTFQKVYWDQ-UHFFFAOYSA-J 0.000 description 7
- 229910000831 Steel Inorganic materials 0.000 description 7
- 239000010959 steel Substances 0.000 description 7
- 239000004359 castor oil Substances 0.000 description 6
- 235000019438 castor oil Nutrition 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 230000009172 bursting Effects 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 230000000717 retained effect Effects 0.000 description 3
- 238000002485 combustion reaction Methods 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 235000004443 Ricinus communis Nutrition 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000003721 gunpowder Substances 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical group OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL35779B1 true PL35779B1 (https=) | 1953-02-28 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2159234A (en) | Gas-producing nondetonating composition | |
| US2477549A (en) | Explosive composition | |
| US2769701A (en) | Compositions for use in re-utilisable blasting apparatus | |
| US2640770A (en) | Igniting composition and method of preparing same | |
| US3068080A (en) | Charcoal briquet and method for production of same | |
| Zhang et al. | Combustion–explosion suppression and environmental protection of typical sulfur-containing hazardous chemicals | |
| US2530491A (en) | Incendiary composition | |
| Tulepov et al. | Methods of Reducing the Front Performance Flame at the Underground Mines Works | |
| US2613146A (en) | Unsheathed safety explosive composition | |
| PL35779B1 (https=) | ||
| US2079777A (en) | Safety igniter for blasting explosive devices | |
| RU2501776C1 (ru) | Пиротехнический воспламенительный состав | |
| US2481795A (en) | Explosives suitable for safety blasting explosives | |
| US2154221A (en) | Charge for gas pressure operated blasting devices | |
| US3733224A (en) | Explosive composition containing phosphorus and particulate coffee | |
| Kadarkaraithangam et al. | Monitoring the thermal and safety characteristics of flash and black powder composition containing fructose | |
| US1674163A (en) | Fuel lighter | |
| US2048827A (en) | Blasting charge | |
| US3662801A (en) | Composition causing combustion when contacted with water | |
| MOJSILOVIĆ et al. | Design of suitable pyrotechnic delay composition with widely used components | |
| US1563926A (en) | Blasting-powder composition | |
| US1563925A (en) | Blasting-powder composition | |
| US2162910A (en) | Explosive | |
| US1563924A (en) | Blasting-powder composition | |
| DE946879C (de) | Druckgas erzeugende Ladung fuer wiederholt verwendbare Sprengeinrichtungen |