PH14387A - Indane-acetic acid aminoester derivative - Google Patents
Indane-acetic acid aminoester derivativeInfo
- Publication number
- PH14387A PH14387A PH22804A PH22804A PH14387A PH 14387 A PH14387 A PH 14387A PH 22804 A PH22804 A PH 22804A PH 22804 A PH22804 A PH 22804A PH 14387 A PH14387 A PH 14387A
- Authority
- PH
- Philippines
- Prior art keywords
- indane
- acetic acid
- aminoester derivative
- derivative
- acid aminoester
- Prior art date
Links
- OUODBMYUKUQGSR-UHFFFAOYSA-N amino 2-(2,3-dihydro-1h-inden-1-yl)acetate Chemical class C1=CC=C2C(CC(=O)ON)CCC2=C1 OUODBMYUKUQGSR-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/58—Preparation of carboxylic acid halides
- C07C51/60—Preparation of carboxylic acid halides by conversion of carboxylic acids or their anhydrides or esters, lactones, salts into halides with the same carboxylic acid part
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/18—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by etherified hydroxyl radicals
- C07D303/20—Ethers with hydroxy compounds containing no oxirane rings
- C07D303/24—Ethers with hydroxy compounds containing no oxirane rings with polyhydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7821849A FR2432021A1 (fr) | 1978-07-24 | 1978-07-24 | Nouveaux esters amines d'acide indane-acetique et leur utilisation en therapeutique |
| FR7913532A FR2457862A2 (fr) | 1979-05-28 | 1979-05-28 | Procede de preparation d'esters amines d'acide indaneacetique |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PH14387A true PH14387A (en) | 1981-06-24 |
Family
ID=26220683
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PH22804A PH14387A (en) | 1978-07-24 | 1979-07-23 | Indane-acetic acid aminoester derivative |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4271161A (enExample) |
| EP (2) | EP0034838A3 (enExample) |
| AR (2) | AR220210A1 (enExample) |
| AU (1) | AU516742B2 (enExample) |
| CA (1) | CA1125756A (enExample) |
| ES (2) | ES482656A0 (enExample) |
| GB (3) | GB2038830A (enExample) |
| GR (1) | GR65999B (enExample) |
| PH (1) | PH14387A (enExample) |
| PT (1) | PT69941A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4339580A (en) * | 1979-06-26 | 1982-07-13 | Mitsubishi Chemical Industries, Limited | Piperazinylalkoxyindanes and acid addition salts thereof |
| DE3377415D1 (en) * | 1983-11-09 | 1988-08-25 | Juste Sa | Novel phenylpiperazine derivatives, process for preparing them and therapeutic compositions containing them |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3953449A (en) * | 1973-05-09 | 1976-04-27 | Synthelabo | 2-(4-M-CF3 or -SCF3 phenylpiperazino)-ethyl benzoates |
| FR2258840A1 (en) * | 1974-01-29 | 1975-08-22 | Synthelabo | (4-Phenylpiperazino) alkyl esters - with analgesic activity for human and veterinary use |
| AR206619A1 (es) | 1974-02-07 | 1976-08-06 | Hexachimie | Procedimiento para peparar acidos 5-indanilaceticos |
| FR2341313A1 (fr) * | 1976-02-23 | 1977-09-16 | Roussel Uclaf | Nouvelles quinoleines substituees, leur procede de preparation et leur application comme medicament |
| SE7712447L (sv) * | 1977-01-21 | 1978-07-22 | Roussel Uclaf | Sett att framstella nya bensofenonderivat |
-
1979
- 1979-06-09 GR GR59316A patent/GR65999B/el unknown
- 1979-07-03 GB GB8002206A patent/GB2038830A/en not_active Withdrawn
- 1979-07-03 GB GB08210290A patent/GB2103599B/en not_active Expired
- 1979-07-03 GB GB7923195A patent/GB2027019B/en not_active Expired
- 1979-07-06 AR AR277223A patent/AR220210A1/es active
- 1979-07-09 US US06/055,907 patent/US4271161A/en not_active Expired - Lifetime
- 1979-07-10 CA CA331,498A patent/CA1125756A/en not_active Expired
- 1979-07-13 EP EP81103269A patent/EP0034838A3/fr not_active Withdrawn
- 1979-07-13 EP EP79400500A patent/EP0008256A3/fr not_active Withdrawn
- 1979-07-18 AU AU49019/79A patent/AU516742B2/en not_active Ceased
- 1979-07-18 PT PT69941A patent/PT69941A/pt unknown
- 1979-07-19 ES ES482656A patent/ES482656A0/es active Granted
- 1979-07-23 PH PH22804A patent/PH14387A/en unknown
-
1980
- 1980-06-02 ES ES492085A patent/ES8104254A1/es not_active Expired
- 1980-08-26 AR AR282297A patent/AR220500A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| GB2038830A (en) | 1980-07-30 |
| AU4901979A (en) | 1980-01-31 |
| AR220210A1 (es) | 1980-10-15 |
| CA1125756A (en) | 1982-06-15 |
| GB2027019A (en) | 1980-02-13 |
| EP0034838A3 (fr) | 1981-10-07 |
| AR220500A1 (es) | 1980-10-31 |
| PT69941A (fr) | 1979-08-01 |
| GB2103599A (en) | 1983-02-23 |
| EP0008256A2 (fr) | 1980-02-20 |
| GR65999B (enExample) | 1981-01-13 |
| ES8101063A1 (es) | 1980-12-01 |
| GB2027019B (en) | 1983-01-06 |
| EP0034838A2 (fr) | 1981-09-02 |
| ES482656A0 (es) | 1980-12-01 |
| EP0008256A3 (fr) | 1980-12-10 |
| GB2103599B (en) | 1983-06-08 |
| ES492085A0 (es) | 1981-04-16 |
| US4271161A (en) | 1981-06-02 |
| ES8104254A1 (es) | 1981-04-16 |
| AU516742B2 (en) | 1981-06-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS54141758A (en) | Thioetianic acid derivative | |
| ZA79989B (en) | Phenoxyalkylcarboxylic acid derivatives | |
| GB2090595B (en) | Threo-3-amino-2-hydroxybutanoylacetice acid derivatives | |
| JPS54151929A (en) | Carbamic acid derivative | |
| JPS5625146A (en) | 33aminopropanesulfonic acid derivative | |
| GB2016001B (en) | Phenylacetic acid derivatives | |
| GB2081715B (en) | Novel 5-phenylcarbamoylbarbituric acid compounds | |
| JPS54135752A (en) | Nonatetraene acid derivative | |
| JPS54100382A (en) | 44pyridonee33carboxylic acid derivative | |
| GB2040919B (en) | Epoxysuccinamic acid compounds | |
| GB2106896B (en) | N-substituted aziridine-2-carboxylic acid derivatives | |
| JPS5612365A (en) | Mercaptoacylamino acid derivative | |
| JPS5677262A (en) | Mercaptoacyldihydropyrazolecarboxylic acid derivative | |
| GB2037283B (en) | -aryloxy-cyclohexylacetic acid derivatives | |
| GB2016004B (en) | U-naphthyl-acetic acid derivatives | |
| GB2039476B (en) | Farnesylacetic acid ester derivatives | |
| JPS5553255A (en) | 33chlorostiryll2*22dimethyllcyclopropanecarboxylic acid 44fluoroo33phenoxyyalphaa cyanobenzylester | |
| JPS5659742A (en) | Nnacyllamino acid derivative | |
| PH14387A (en) | Indane-acetic acid aminoester derivative | |
| ZA792472B (en) | N-substituted triorganostannylhydrocarbylcarboxylic acid | |
| JPS55149251A (en) | Substituted pyrrolidinylbenzoic acid derivative | |
| GB2026485B (en) | Thiopropanoylamino acid derivatives | |
| GB2038334B (en) | O-sulfamoylglycolic acid amide derivatives | |
| JPS5615269A (en) | Dihydronicotinic acid derivative | |
| JPS567747A (en) | Acylaminobenzoic acid derivative |