PH11986A - 3-pyrimidylmethyl phenyl-carbamate - Google Patents
3-pyrimidylmethyl phenyl-carbamateInfo
- Publication number
- PH11986A PH11986A PH17365A PH17365A PH11986A PH 11986 A PH11986 A PH 11986A PH 17365 A PH17365 A PH 17365A PH 17365 A PH17365 A PH 17365A PH 11986 A PH11986 A PH 11986A
- Authority
- PH
- Philippines
- Prior art keywords
- pyrimidylmethyl
- carbamate
- phenyl
- pyrimidylmethyl phenyl
- Prior art date
Links
- WEFCTESCLHLPFW-UHFFFAOYSA-N 2H-pyrimidin-1-ylmethyl N-phenylcarbamate Chemical compound C1(=CC=CC=C1)NC(OCN1CN=CC=C1)=O WEFCTESCLHLPFW-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US497542A US3925397A (en) | 1974-08-14 | 1974-08-14 | 3-Pyridylmethyl-(N-substituted phenyl)-carbamate derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PH11986A true PH11986A (en) | 1978-10-05 |
Family
ID=23977284
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PH17365A PH11986A (en) | 1974-08-14 | 1975-07-10 | 3-pyrimidylmethyl phenyl-carbamate |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3925397A (forum.php) |
| JP (1) | JPS5141365A (forum.php) |
| AT (1) | AT344438B (forum.php) |
| BE (1) | BE832383A (forum.php) |
| CH (1) | CH602000A5 (forum.php) |
| CS (1) | CS181184B2 (forum.php) |
| DD (1) | DD121012A5 (forum.php) |
| DE (1) | DE2536192A1 (forum.php) |
| ES (1) | ES440233A1 (forum.php) |
| FR (1) | FR2281927A1 (forum.php) |
| GB (1) | GB1509457A (forum.php) |
| IL (1) | IL47764A (forum.php) |
| IT (1) | IT1036308B (forum.php) |
| NL (1) | NL7508752A (forum.php) |
| PH (1) | PH11986A (forum.php) |
| ZA (1) | ZA754710B (forum.php) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3929810A (en) * | 1974-06-03 | 1975-12-30 | Rohm & Haas | 3-Pyridylmethyl N-(4-cyanomethylphenyl)-carbamate and derivatives |
| JPS6356698U (forum.php) * | 1986-10-01 | 1988-04-15 | ||
| JPS6442198U (forum.php) * | 1987-09-09 | 1989-03-14 | ||
| DE10239480A1 (de) * | 2002-08-28 | 2004-03-04 | Bayer Cropscience Ag | Tetrahydropyridazin-Derivate |
| EP2076261A2 (en) * | 2006-10-03 | 2009-07-08 | Ranbaxy Laboratories, Ltd. | Muscarinic receptor antagonists |
-
1974
- 1974-08-14 US US497542A patent/US3925397A/en not_active Expired - Lifetime
-
1975
- 1975-06-16 IT IT68546/75A patent/IT1036308B/it active
- 1975-07-10 PH PH17365A patent/PH11986A/en unknown
- 1975-07-17 GB GB29949/75A patent/GB1509457A/en not_active Expired
- 1975-07-22 IL IL47764A patent/IL47764A/xx unknown
- 1975-07-22 NL NL7508752A patent/NL7508752A/xx unknown
- 1975-07-22 ZA ZA00754710A patent/ZA754710B/xx unknown
- 1975-07-31 JP JP50093661A patent/JPS5141365A/ja active Pending
- 1975-08-11 CS CS7500005523A patent/CS181184B2/cs unknown
- 1975-08-13 FR FR7525261A patent/FR2281927A1/fr active Granted
- 1975-08-13 ES ES440233A patent/ES440233A1/es not_active Expired
- 1975-08-13 BE BE159159A patent/BE832383A/xx unknown
- 1975-08-13 DD DD187836A patent/DD121012A5/xx unknown
- 1975-08-13 DE DE19752536192 patent/DE2536192A1/de active Pending
- 1975-08-13 CH CH1058875A patent/CH602000A5/xx not_active IP Right Cessation
- 1975-08-14 AT AT634075A patent/AT344438B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1509457A (en) | 1978-05-04 |
| JPS5141365A (en) | 1976-04-07 |
| DD121012A5 (forum.php) | 1976-07-12 |
| CH602000A5 (forum.php) | 1978-07-14 |
| IL47764A0 (en) | 1975-10-15 |
| FR2281927A1 (fr) | 1976-03-12 |
| IT1036308B (it) | 1979-10-30 |
| ES440233A1 (es) | 1977-11-16 |
| NL7508752A (nl) | 1976-02-17 |
| US3925397A (en) | 1975-12-09 |
| ZA754710B (en) | 1976-07-28 |
| DE2536192A1 (de) | 1976-03-04 |
| FR2281927B1 (forum.php) | 1977-12-16 |
| AU8398675A (en) | 1977-02-17 |
| CS181184B2 (en) | 1978-03-31 |
| AT344438B (de) | 1978-07-25 |
| IL47764A (en) | 1978-08-31 |
| BE832383A (fr) | 1976-02-13 |
| ATA634075A (de) | 1977-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PH14161A (en) | Thiazolylacetamido compounds | |
| JPS51105283A (en) | Kotaihatsuko jukososhi | |
| GB1516331A (en) | Aminotetralol compounds | |
| ZA757892B (en) | Thiazolylacetamido compounds | |
| JPS5171255A (en) | H gatakonoyunibaasaruatsuenho | |
| MY8200111A (en) | Tetrazolethiomethylcephalosporin compounds | |
| JPS5152447A (en) | Jukijugotaino kakyoketsugohoho | |
| JPS5110749A (en) | Ccmos maruchibaibureeta | |
| JPS5110661A (en) | Katsuseiodeinyoru haisuishoriho | |
| PH11986A (en) | 3-pyrimidylmethyl phenyl-carbamate | |
| JPS5113586A (en) | Handotaisochino seizohoho | |
| JPS5120688A (en) | Roran c jushinkyo fuirutasochi | |
| JPS512669A (en) | H konadomagekakoki | |
| JPS5110769A (en) | Handotaisochino seizohoho | |
| JPS5113115A (en) | Yakuekichunyunyoru shisuihekino sekohotosono sekonishosuru shisuihekisekoyokeeshingu | |
| JPS5110541A (en) | Dendo enjinkudokirikaeshikishokoki | |
| JPS5110605A (en) | Kuiuchikikaino boonsochi | |
| JPS5110658A (en) | Futsusosanhaiekino shorihoho | |
| AU8552175A (en) | Trisazodyestuffs | |
| JPS5113307A (en) | Koroheno genryosonyuhoho | |
| JPS5110668A (en) | Haikibutsuno konkuriitokokahoho | |
| JPS5110454A (en) | Yuwakashikino toketsuboshisochi | |
| JPS5121274A (en) | C gatapuresuseikeikakoteiisochi | |
| JPS5132791A (en) | Sefuarosuhorin c nosaishu seiseiho | |
| AU8597975A (en) | Hydrodipyrano - phthalazine compounds |