NZ209731A - Aqueous enzyme-containing cleaning compositions - Google Patents
Aqueous enzyme-containing cleaning compositionsInfo
- Publication number
- NZ209731A NZ209731A NZ209731A NZ20973184A NZ209731A NZ 209731 A NZ209731 A NZ 209731A NZ 209731 A NZ209731 A NZ 209731A NZ 20973184 A NZ20973184 A NZ 20973184A NZ 209731 A NZ209731 A NZ 209731A
- Authority
- NZ
- New Zealand
- Prior art keywords
- composition
- weight
- enzyme
- surfactant
- acetate
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 96
- 102000004190 Enzymes Human genes 0.000 title claims description 76
- 108090000790 Enzymes Proteins 0.000 title claims description 76
- 238000004140 cleaning Methods 0.000 title description 4
- 229940088598 enzyme Drugs 0.000 claims description 75
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 20
- 108091005804 Peptidases Proteins 0.000 claims description 19
- 150000002148 esters Chemical class 0.000 claims description 18
- 102000035195 Peptidases Human genes 0.000 claims description 15
- 230000000694 effects Effects 0.000 claims description 14
- 239000004365 Protease Substances 0.000 claims description 11
- 239000004094 surface-active agent Substances 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical group CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 9
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical group [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 8
- 108090000637 alpha-Amylases Proteins 0.000 claims description 8
- 102000004139 alpha-Amylases Human genes 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 7
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 239000002736 nonionic surfactant Substances 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000000129 anionic group Chemical group 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 239000007859 condensation product Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims description 4
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 claims description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical group [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 claims description 4
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 claims description 4
- 239000001632 sodium acetate Substances 0.000 claims description 4
- 235000017281 sodium acetate Nutrition 0.000 claims description 4
- 239000011780 sodium chloride Substances 0.000 claims description 4
- 235000011152 sodium sulphate Nutrition 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 229940072049 amyl acetate Drugs 0.000 claims description 3
- PGMYKACGEOXYJE-UHFFFAOYSA-N anhydrous amyl acetate Natural products CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 claims description 3
- 239000003945 anionic surfactant Substances 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 150000002191 fatty alcohols Chemical class 0.000 claims description 3
- MNWFXJYAOYHMED-UHFFFAOYSA-M heptanoate Chemical compound CCCCCCC([O-])=O MNWFXJYAOYHMED-UHFFFAOYSA-M 0.000 claims description 3
- 239000003209 petroleum derivative Substances 0.000 claims description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 claims description 3
- 230000003381 solubilizing effect Effects 0.000 claims description 3
- 244000063299 Bacillus subtilis Species 0.000 claims description 2
- 235000014469 Bacillus subtilis Nutrition 0.000 claims description 2
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 claims description 2
- JGFBQFKZKSSODQ-UHFFFAOYSA-N Isothiocyanatocyclopropane Chemical compound S=C=NC1CC1 JGFBQFKZKSSODQ-UHFFFAOYSA-N 0.000 claims description 2
- DIQMPQMYFZXDAX-UHFFFAOYSA-N Pentyl formate Chemical compound CCCCCOC=O DIQMPQMYFZXDAX-UHFFFAOYSA-N 0.000 claims description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 claims description 2
- PWLNAUNEAKQYLH-UHFFFAOYSA-N butyric acid octyl ester Natural products CCCCCCCCOC(=O)CCC PWLNAUNEAKQYLH-UHFFFAOYSA-N 0.000 claims description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 claims description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 claims description 2
- UUIQMZJEGPQKFD-UHFFFAOYSA-N n-butyric acid methyl ester Natural products CCCC(=O)OC UUIQMZJEGPQKFD-UHFFFAOYSA-N 0.000 claims description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 claims 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 206010011416 Croup infectious Diseases 0.000 claims 1
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 150000003863 ammonium salts Chemical class 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 201000010549 croup Diseases 0.000 claims 1
- 229940048842 sodium xylenesulfonate Drugs 0.000 claims 1
- QUCDWLYKDRVKMI-UHFFFAOYSA-M sodium;3,4-dimethylbenzenesulfonate Chemical group [Na+].CC1=CC=C(S([O-])(=O)=O)C=C1C QUCDWLYKDRVKMI-UHFFFAOYSA-M 0.000 claims 1
- -1 alkoxy alcohol Chemical compound 0.000 description 14
- 239000003599 detergent Substances 0.000 description 11
- 239000003381 stabilizer Substances 0.000 description 10
- 235000019441 ethanol Nutrition 0.000 description 8
- 239000007788 liquid Substances 0.000 description 7
- 235000011187 glycerol Nutrition 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 238000003860 storage Methods 0.000 description 5
- 108091005658 Basic proteases Proteins 0.000 description 4
- 230000002255 enzymatic effect Effects 0.000 description 4
- 108010020132 microbial serine proteinases Proteins 0.000 description 4
- 235000018102 proteins Nutrition 0.000 description 4
- 102000004169 proteins and genes Human genes 0.000 description 4
- 108090000623 proteins and genes Proteins 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 230000006641 stabilisation Effects 0.000 description 4
- 238000011105 stabilization Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- 238000000855 fermentation Methods 0.000 description 3
- 230000004151 fermentation Effects 0.000 description 3
- 230000007774 longterm Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 230000002797 proteolythic effect Effects 0.000 description 3
- 230000000087 stabilizing effect Effects 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 108010056079 Subtilisins Proteins 0.000 description 2
- 102000005158 Subtilisins Human genes 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000003625 amylolytic effect Effects 0.000 description 2
- 230000001580 bacterial effect Effects 0.000 description 2
- 239000006172 buffering agent Substances 0.000 description 2
- 229910001424 calcium ion Inorganic materials 0.000 description 2
- 230000009849 deactivation Effects 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- 229920002521 macromolecule Polymers 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 108010003855 mesentericopeptidase Proteins 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000002304 perfume Substances 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 108010075550 termamyl Proteins 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical class CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- 241001459693 Dipterocarpus zeylanicus Species 0.000 description 1
- 241000448280 Elates Species 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 108091005507 Neutral proteases Proteins 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 108010022999 Serine Proteases Proteins 0.000 description 1
- 102000012479 Serine Proteases Human genes 0.000 description 1
- UATJOMSPNYCXIX-UHFFFAOYSA-N Trinitrobenzene Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 UATJOMSPNYCXIX-UHFFFAOYSA-N 0.000 description 1
- ZZXDRXVIRVJQBT-UHFFFAOYSA-M Xylenesulfonate Chemical class CC1=CC=CC(S([O-])(=O)=O)=C1C ZZXDRXVIRVJQBT-UHFFFAOYSA-M 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 125000005233 alkylalcohol group Chemical group 0.000 description 1
- 229940024171 alpha-amylase Drugs 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical class [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000004464 cereal grain Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 229940079919 digestives enzyme preparation Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 239000002979 fabric softener Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 235000013882 gravy Nutrition 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000004900 laundering Methods 0.000 description 1
- ZQQZEDHGSZBETO-UHFFFAOYSA-L magnesium;2-hydroxypropanoate;chloride Chemical class [Mg+2].[Cl-].CC(O)C([O-])=O ZQQZEDHGSZBETO-UHFFFAOYSA-L 0.000 description 1
- 239000002075 main ingredient Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 239000011591 potassium Chemical group 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical class [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical class CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 230000017854 proteolysis Effects 0.000 description 1
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000004671 saturated fatty acids Chemical class 0.000 description 1
- 235000003441 saturated fatty acids Nutrition 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 235000002639 sodium chloride Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- CMPGARWFYBADJI-UHFFFAOYSA-L tungstic acid Chemical compound O[W](O)(=O)=O CMPGARWFYBADJI-UHFFFAOYSA-L 0.000 description 1
- 229940071104 xylenesulfonate Drugs 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/38—Products with no well-defined composition, e.g. natural products
- C11D3/386—Preparations containing enzymes, e.g. protease or amylase
- C11D3/38663—Stabilised liquid enzyme compositions
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S435/00—Chemistry: molecular biology and microbiology
- Y10S435/8215—Microorganisms
- Y10S435/822—Microorganisms using bacteria or actinomycetales
- Y10S435/832—Bacillus
- Y10S435/839—Bacillus subtilis
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Enzymes And Modification Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/539,515 US4548727A (en) | 1983-10-06 | 1983-10-06 | Aqueous compositions containing stabilized enzymes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ209731A true NZ209731A (en) | 1988-05-30 |
Family
ID=24151551
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ209731A NZ209731A (en) | 1983-10-06 | 1984-10-01 | Aqueous enzyme-containing cleaning compositions |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4548727A (OSRAM) |
| JP (1) | JPS6098983A (OSRAM) |
| AU (1) | AU564203B2 (OSRAM) |
| BR (1) | BR8405022A (OSRAM) |
| CA (1) | CA1228042A (OSRAM) |
| DE (1) | DE3436678A1 (OSRAM) |
| FR (1) | FR2555604B1 (OSRAM) |
| GB (1) | GB2147607B (OSRAM) |
| IE (1) | IE58303B1 (OSRAM) |
| IT (1) | IT1178011B (OSRAM) |
| NZ (1) | NZ209731A (OSRAM) |
| SE (1) | SE462917B (OSRAM) |
| ZA (1) | ZA847370B (OSRAM) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1263944A (en) * | 1984-09-12 | 1989-12-19 | Barbara H. Munk | Pre-wash compositions containing enzymes |
| EP0385526A3 (en) * | 1989-02-27 | 1991-09-11 | Unilever N.V. | Enzymatic liquid detergent composition |
| US5254283A (en) * | 1991-01-17 | 1993-10-19 | Genencor International, Inc. | Isophthalic polymer coated particles |
| US5531927A (en) * | 1992-03-20 | 1996-07-02 | Bio-Safe Specialty Products, Inc. | Stain removing compositions and methods of using the same |
| US5356800A (en) * | 1992-11-30 | 1994-10-18 | Buckman Laboratories International, Inc. | Stabilized liquid enzymatic compositions |
| CA2120375A1 (en) * | 1993-04-02 | 1994-10-03 | John Klier | A laundry pretreater having enhanced oily soil removal |
| DE69424683T2 (de) * | 1993-12-03 | 2000-10-05 | Buckman Laboratories International, Inc. | Enzymstabilisierung durch blockcopolymere |
| US5474701A (en) * | 1994-01-21 | 1995-12-12 | Buckman Laboratories International, Inc. | Enzymes for recreational water |
| US5565135A (en) * | 1995-01-24 | 1996-10-15 | The Procter & Gamble Company | Highly aqueous, cost effective liquid detergent compositions |
| CA2181125A1 (en) * | 1995-07-14 | 1997-01-15 | Gladys S. Gabriel | Stabilization of enzymes in laundry detergent compositions |
| US5571446A (en) * | 1995-07-27 | 1996-11-05 | Diversey Corporation | Anionic stabilized enzyme based clean-in-place system |
| US6342381B1 (en) | 1998-02-27 | 2002-01-29 | Buckman Laboratories Internationals, Inc. | Enzyme stabilization with pre-superpolyamide or pre-fiber-forming polyamide oligomers |
| GB9914622D0 (en) * | 1999-06-23 | 1999-08-25 | Reckitt & Colman Inc | Improvements in or relating to organic compositions |
| CN100491525C (zh) * | 2000-07-28 | 2009-05-27 | 汉高两合股份公司 | 从芽孢杆菌a7-7(dsm 12368)中提取的新型淀粉分解酶以及含有该新型淀粉分解酶的洗涤剂和清洗剂 |
| US6881711B1 (en) | 2001-10-26 | 2005-04-19 | Prestone Products Corporation | Low VOC cleaning compositions for hard surfaces |
| EP1694805A1 (en) * | 2003-12-15 | 2006-08-30 | The Procter and Gamble Company | Compositions for removing cooked-, baked- and burnt-on soils |
| US8349591B2 (en) * | 2008-10-16 | 2013-01-08 | Scientek Llc | Method and apparatus for producing alcohol or sugar using a commercial-scale bioreactor |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3023168A (en) * | 1958-11-25 | 1962-02-27 | Atlantic Refining Co | Heavy duty liquid detergent |
| US3296094A (en) * | 1966-05-05 | 1967-01-03 | Baxter Laboratories Inc | Stabilized aqueous enzyme solutions |
| US3557002A (en) * | 1967-11-15 | 1971-01-19 | Procter & Gamble | Stabilized aqueous enzyme preparation |
| US3532599A (en) * | 1968-10-23 | 1970-10-06 | Isadore Nathan Cooperman | Process for cleaning with enzymes |
| US3575864A (en) * | 1969-04-17 | 1971-04-20 | Irving Innerfield | Stabilized protease of bacterial origin and method of stabilizing such protease |
| US3600318A (en) * | 1969-06-02 | 1971-08-17 | Procter & Gamble | Enzyme-containing detergent compositions for neutral washing |
| BE759360A (OSRAM) * | 1969-11-25 | 1971-05-24 | Procter & Gamble Europ | |
| US3844951A (en) * | 1970-01-14 | 1974-10-29 | Henkel & Cie Gmbh | Detergent compositions containing a textile softener |
| US3682842A (en) * | 1970-05-04 | 1972-08-08 | Irving Innerfield | Stabilized enzymic compositions containing protease and alpha amylase of bacterial origin and method of stabilizing such compositions |
| US3746649A (en) * | 1971-10-01 | 1973-07-17 | J Barrett | Stable liquid enzyme product |
| US4169817A (en) * | 1971-12-23 | 1979-10-02 | Midwest Biochemical Corporation | Liquid cleaning composition containing stabilized enzymes |
| BE794713A (fr) * | 1972-01-31 | 1973-07-30 | Procter & Gamble | Compositions detergentes liquides |
| US3974082A (en) * | 1972-08-21 | 1976-08-10 | Colgate-Palmolive Company | Bleaching compositions |
| JPS5014651A (OSRAM) * | 1973-06-15 | 1975-02-15 | ||
| US4021377A (en) * | 1973-09-11 | 1977-05-03 | Miles Laboratories, Inc. | Liquid detergent composition |
| US3953353A (en) * | 1974-11-08 | 1976-04-27 | Purex Corporation | Laundering pre-spotter and method of production |
| IT1106254B (it) * | 1976-03-08 | 1985-11-11 | Procter & Gamble Europ | Composizione detergente liquida contenente enzimi |
| DE2633601A1 (de) * | 1976-07-27 | 1978-02-02 | Henkel Kgaa | Fluessiges, als wasch- und reinigungsmittel verwendbares, enzymhaltiges konzentrat |
| US4243546A (en) * | 1979-03-23 | 1981-01-06 | The Drackett Company | Stable aqueous compositions containing enzymes |
| US4243543A (en) * | 1979-05-11 | 1981-01-06 | Economics Laboratory, Inc. | Stabilized liquid enzyme-containing detergent compositions |
| US4261868A (en) * | 1979-08-08 | 1981-04-14 | Lever Brothers Company | Stabilized enzymatic liquid detergent composition containing a polyalkanolamine and a boron compound |
| US4318818A (en) * | 1979-11-09 | 1982-03-09 | The Procter & Gamble Company | Stabilized aqueous enzyme composition |
| US4287082A (en) * | 1980-02-22 | 1981-09-01 | The Procter & Gamble Company | Homogeneous enzyme-containing liquid detergent compositions containing saturated acids |
-
1983
- 1983-10-06 US US06/539,515 patent/US4548727A/en not_active Expired - Fee Related
-
1984
- 1984-09-11 AU AU32912/84A patent/AU564203B2/en not_active Ceased
- 1984-09-19 ZA ZA847370A patent/ZA847370B/xx unknown
- 1984-10-01 NZ NZ209731A patent/NZ209731A/en unknown
- 1984-10-02 SE SE8404930A patent/SE462917B/sv not_active IP Right Cessation
- 1984-10-02 IT IT48935/84A patent/IT1178011B/it active
- 1984-10-03 FR FR8415178A patent/FR2555604B1/fr not_active Expired
- 1984-10-04 BR BR8405022A patent/BR8405022A/pt unknown
- 1984-10-05 IE IE255684A patent/IE58303B1/en not_active IP Right Cessation
- 1984-10-05 CA CA000464809A patent/CA1228042A/en not_active Expired
- 1984-10-05 DE DE19843436678 patent/DE3436678A1/de not_active Ceased
- 1984-10-05 GB GB08425192A patent/GB2147607B/en not_active Expired
- 1984-10-05 JP JP59208422A patent/JPS6098983A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| IE842556L (en) | 1985-04-06 |
| SE8404930L (sv) | 1985-04-07 |
| ZA847370B (en) | 1985-05-29 |
| DE3436678A1 (de) | 1985-04-25 |
| JPS6098983A (ja) | 1985-06-01 |
| US4548727A (en) | 1985-10-22 |
| JPH0555107B2 (OSRAM) | 1993-08-16 |
| CA1228042A (en) | 1987-10-13 |
| SE8404930D0 (sv) | 1984-10-02 |
| GB2147607A (en) | 1985-05-15 |
| AU3291284A (en) | 1985-04-18 |
| GB2147607B (en) | 1987-03-25 |
| IE58303B1 (en) | 1993-09-08 |
| BR8405022A (pt) | 1985-08-20 |
| FR2555604A1 (fr) | 1985-05-31 |
| IT8448935A1 (it) | 1986-04-02 |
| FR2555604B1 (fr) | 1986-12-19 |
| SE462917B (sv) | 1990-09-17 |
| IT1178011B (it) | 1987-09-03 |
| GB8425192D0 (en) | 1984-11-14 |
| AU564203B2 (en) | 1987-08-06 |
| IT8448935A0 (it) | 1984-10-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4243546A (en) | Stable aqueous compositions containing enzymes | |
| US4548727A (en) | Aqueous compositions containing stabilized enzymes | |
| US3819528A (en) | Stabilized aqueous enzyme compositions | |
| US3627688A (en) | Stabilized aqueous enzyme containing compositions | |
| US4518694A (en) | Aqueous compositions containing stabilized enzymes | |
| EP0544777B1 (en) | Enzymatic detergent composition and method for enzyme stabilization | |
| US3634266A (en) | Liquid detergent compositions containing amylolytic enzymes | |
| FI61715C (fi) | Enzymer innehaollande stabiliserad flytande detergentkomposition | |
| US5156761A (en) | Method of stabilizing an enzymatic liquid detergent composition | |
| NO128370B (OSRAM) | ||
| JPH0241398A (ja) | 安定化酵素液体洗剤組成物 | |
| NZ208156A (en) | Built single-phase liquid detergent compositions containing stabilised enzymes | |
| CA1151088A (en) | Aqueous compositions containing stabilized enzymes | |
| US4490285A (en) | Heavy-duty liquid detergent composition | |
| US5527487A (en) | Enzymatic detergent composition and method for enzyme stabilization | |
| US3781212A (en) | Aerosol enzyme detergents stabilized with carbon dioxide | |
| US5501820A (en) | Aqueous enzymatic detergent compositions | |
| US5589448A (en) | High water liquid enzyme prewash composition | |
| WO2011001173A1 (en) | Composition | |
| CA1208578A (en) | Liquid detergent composition with mixed enzyme formulation | |
| EP1141209A1 (en) | Stable aqueous enzyme compositions | |
| US20040023833A1 (en) | Aqueous compositions comprising protease and/or amylase |